diff --git a/archetypes/default.md b/archetypes/default.md index 26f317f..00e77bd 100644 --- a/archetypes/default.md +++ b/archetypes/default.md @@ -3,3 +3,4 @@ title: "{{ replace .Name "-" " " | title }}" date: {{ .Date }} draft: true --- + diff --git a/config.toml b/config.toml index 7f6ebe5..459f2c8 100644 --- a/config.toml +++ b/config.toml @@ -1,42 +1,101 @@ -baseURL = "https://caffeinated.blog/" -title = "Caffeinated Blog" -copyright = "Copyright © 2021, Glenn Rice" -languageCode = "en-US" -theme = "indigo" -paginate = 3 +baseURL = "https://example.com" +languageCode = "en" +DefaultContentLanguage = "en" +title = "Website of Jane Doe" +theme = "anatole" +summarylength = 10 +enableEmoji = true +enableRobotsTXT = true + +# Enable Disqus +#disqusShortname = "" + +# Google Analytics +#googleAnalytics = "UA-123-45" + +# Syntax highlighting +pygmentsUseClasses = true +pygmentsCodeFences = true +pygmentsCodefencesGuessSyntax = true [params] - Author = "Glenn Rice" - Description = "Description of website for head meta tag" - Subtitle = "A bit of personal space for writing" - Avatar = "images/myAvatar.svg" - Biography = "A short description, a few sentences describing the author. Set the 'ShowBio' parameter to false to hide this." - ShowBio = false - PermalinkText = "🔗" +title = "Caffeinated" +author = "Glenn" +#copyright = "2020-2021" +description = "A bit of personal space for writing" +profilePicture = "images/site-logo.png" +keywords = "" +favicon = "favicons/" +# example ["css/custom.css"] +customCss = [] +# example ["js/custom.js"] +customJs = [] +mainSections = ["post"] +images = ["images/site-feature-image.png"] +doNotLoadAnimations = false +# Form Spree Contact Form +#contactFormAction = "https://formspree.io/f/your-form-hash-here" +# Google Site Verify +#googleSiteVerify = "ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789" +# indexDateFormat = "Mon, Jan 2, 2006" +# listDateFormat = "Jan 2" +# singleDateFormat = "Mon, Jan 2, 2006" - # Contact/social-network identifiers for social icons - #EmailAddress = "email.address@example.com" - #FacebookUser = "FacebookUserName" - #FlickrUser = "FlickrUserName" - GitHubUser = "glennrice" - #GitLabUser = "GitLabUserName" - #GlitchUser = "GlitchUserName" - KeybaseUser = "glennr" - #LinkedInUser = "LinkedInUserName" - #MediumUser = "MediumUserName" - MicroBlogUser = "glennr" - #RedditUser = "RedditUserName" - #StackOverflowUser = "StackOverflowUserName" - #TumblrUser = "TumblrUserName" - #TwitterUser = "TwitterUserName" +[params.simpleAnalytics] +# enable = true +# customurl = "https://analytics.example.com" - # These are parameters used for indieweb identity. You should set these along - # with the above email/social network parameters. - [params.indieWeb] - #EmailAddress = "email.address@example.com" - #FlickrUser = "FlickrUserName" - GitHubUser = "glennrice" - #TwitterUser = "TwitterUserName" - MicroBlogUser = "glennr" - Country = "Australia" - #City = "CityName" +## Math settings +[params.math] +enable = false # options: true, false. Enable math support globally, default: false. You can always enable math on per page. +use = "katex" # options: "katex", "mathjax". default is "katex". + +## Social links +# use 'fab' when brand icons, use 'fas' when standard solid icons. +[[params.socialIcons]] +icon = "fab fa-linkedin" +title = "Linkedin" +url = "https://de.linkedin.com/" + +[[params.socialIcons]] +icon = "fab fa-github" +title = "GitHub" +url = "https://github.com/lxndrblz/anatole/" + +[[params.socialIcons]] +icon = "fab fa-instagram" +title = "instagram" +url = "https://www.instagram.com/" + +[[params.socialIcons]] +icon = "fas fa-envelope" +title = "e-mail" +url = "mailto:mail@alexbilz.com" + +## Menu items + +[menu] + + [[menu.main]] + name = "Home" + identifier = "home" + weight = 100 + url = "/" + + [[menu.main]] + name = "Posts" + weight = 200 + identifier = "posts" + url = "/post/" + + [[menu.main]] + name = "About" + weight = 300 + identifier = "about" + url = "/about/" + + [[menu.main]] + name = "Contact" + weight = 400 + identifier = "contact" + url = "/contact/" diff --git a/content/_index.md b/content/_index.md new file mode 100644 index 0000000..3e127b3 --- /dev/null +++ b/content/_index.md @@ -0,0 +1,24 @@ ++++ +author = "Hugo Authors" ++++ + + diff --git a/content/about.md b/content/about.md index 1e5303f..f49aec5 100644 --- a/content/about.md +++ b/content/about.md @@ -1,13 +1,25 @@ ---- -title: "About The Theme" -menu: "main" -draft: false ---- ++++ +title = "About" +description = "Hugo, the world's fastest framework for building websites" +date = "2019-02-28" +aliases = ["about-us", "about-hugo", "contact"] +author = "Hugo Authors" ++++ -Indigo is a lightweight theme for [Hugo][hugo] with [IndieWeb][indieweb] features baked in. It's great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces. +Written in Go, Hugo is an open source static site generator available under the [Apache Licence 2.0.](https://github.com/gohugoio/hugo/blob/master/LICENSE) Hugo supports TOML, YAML and JSON data file types, Markdown and HTML content files and uses shortcodes to add rich content. Other notable features are taxonomies, multilingual mode, image processing, custom output formats, HTML/CSS/JS minification and support for Sass SCSS workflows. -Read more about the theme [here][intro]. +Hugo makes use of a variety of open source projects including: -[hugo]: https://gohugo.io -[indieweb]: https://indieweb.org/ -[intro]: /post/introducing-indigo \ No newline at end of file +* https://github.com/yuin/goldmark +* https://github.com/alecthomas/chroma +* https://github.com/muesli/smartcrop +* https://github.com/spf13/cobra +* https://github.com/spf13/viper + +Hugo is ideal for blogs, corporate websites, creative portfolios, online magazines, single page applications or even a website with thousands of pages. + +Hugo is for people who want to hand code their own website without worrying about setting up complicated runtimes, dependencies and databases. + +Websites built with Hugo are extremelly fast, secure and can be deployed anywhere including, AWS, GitHub Pages, Heroku, Netlify and any other hosting provider. + +Learn more and contribute on [GitHub](https://github.com/gohugoio). diff --git a/content/adding-menu-items.md b/content/adding-menu-items.md deleted file mode 100644 index 36016cb..0000000 --- a/content/adding-menu-items.md +++ /dev/null @@ -1,9 +0,0 @@ ---- -title: "Adding Page Items" -menu: "main" -draft: false ---- - -Indigo supports adding a simple navigation-style menu items across the top of the site. To do so, simply add a `menu: "main"` entry in your page's front matter (TOML format shown). - -If no date is included in the front matter, then the published date won't be shown (as in this page). \ No newline at end of file diff --git a/content/archives.md b/content/archives.md new file mode 100644 index 0000000..db16eed --- /dev/null +++ b/content/archives.md @@ -0,0 +1,5 @@ +--- +date: 2019-05-28 +type: section +layout: "archives" +--- diff --git a/content/contact.md b/content/contact.md new file mode 100644 index 0000000..36f054f --- /dev/null +++ b/content/contact.md @@ -0,0 +1,7 @@ +--- +author: Hugo Authors +title: Contact +date: 2019-03-08 +description: Contact Page +contact: true +--- diff --git a/content/post/2021/02/online-with-hugo.md b/content/post/2021/02/online-with-hugo.md index 0315362..e6ab45d 100644 --- a/content/post/2021/02/online-with-hugo.md +++ b/content/post/2021/02/online-with-hugo.md @@ -2,6 +2,19 @@ title: "Online With Hugo" date: 2021-02-02T22:53:29+10:00 draft: false +tags: [ + "newbeginnings", +] +categories: [ + "blogging", +] +thumbnail: "/images/2021/danielle-macinnes-coffee-begin-unsplash.jpg" --- + + As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. I have just spun up a new web host with Apache and Git to automatically pull site changes from the repo and publish them. It's all working beautifully so far. + +---- + +Photo by [Danielle MacInnes](https://unsplash.com/@dsmacinnes?utm_source=unsplash&utm_medium=referral&utm_content=creditCopyText) on [Unsplash](https://unsplash.com/s/photos/new-start?utm_source=unsplash&utm_medium=referral&utm_content=creditCopyText) diff --git a/content/post/_index.md b/content/post/_index.md new file mode 100644 index 0000000..8a084d9 --- /dev/null +++ b/content/post/_index.md @@ -0,0 +1,6 @@ ++++ +aliases = ["posts", "articles", "blog", "showcase", "docs"] +title = "Posts" +author = "Hugo Authors" +tags = ["index"] ++++ diff --git a/footer.html b/footer.html deleted file mode 100644 index 35f8718..0000000 --- a/footer.html +++ /dev/null @@ -1,48 +0,0 @@ - - {{ if .Site.Params.ShowBio }} -
- -
-

{{ .Site.Params.Author }}

-

- {{ .Site.Params.IndieWeb.City }}, - {{ .Site.Params.IndieWeb.Country }}
- Email me -

-
-

{{ .Site.Params.Biography }}

-
- {{ end }} - - - - - \ No newline at end of file diff --git a/layouts/partials/footer.html b/layouts/partials/footer.html deleted file mode 100644 index 5964864..0000000 --- a/layouts/partials/footer.html +++ /dev/null @@ -1,50 +0,0 @@ - - {{ if .Site.Params.ShowBio }} -
- -
-

{{ .Site.Params.Author }}

-

- {{ .Site.Params.IndieWeb.City }}, - {{ .Site.Params.IndieWeb.Country }}
- Email me -

-
-

{{ .Site.Params.Biography }}

-
- {{ end }} - - - - - - - diff --git a/layouts/partials/header.html b/layouts/partials/header.html deleted file mode 100644 index 4afa49a..0000000 --- a/layouts/partials/header.html +++ /dev/null @@ -1,20 +0,0 @@ - - -{{ partial "head.html" . }} - - -
- {{ partial "pagenav.html" . }} - {{ if not .IsPage }} - - {{ end }} -
diff --git a/public/404.html b/public/404.html index 98b5486..902c50d 100644 --- a/public/404.html +++ b/public/404.html @@ -1,116 +1,177 @@ - - - + + Glenn | 404 Page not found + - 404 Page not found | Caffeinated Blog - - + + - - - - - - - + + + + + + + + + + + + + + - - - + + + - - + + + - + + + + + + - - - -
- -

404

-
-
-
-

Whoops.

-

- The page you were looking for doesn't exist. Would you like to go to the home page? -

-
+
+
+
+ + +
+ +
+
+
+

404

+

Page Not Found

+

Sorry, this page does not exist.

+

You can head back to homepage.

- - - +
- -

- Copyright © 2021, Glenn Rice -

- -
- - + + + + + + - + diff --git a/public/about-hugo/index.html b/public/about-hugo/index.html new file mode 100644 index 0000000..62a3133 --- /dev/null +++ b/public/about-hugo/index.html @@ -0,0 +1 @@ +https://example.com/about/ \ No newline at end of file diff --git a/public/about-us/index.html b/public/about-us/index.html new file mode 100644 index 0000000..62a3133 --- /dev/null +++ b/public/about-us/index.html @@ -0,0 +1 @@ +https://example.com/about/ \ No newline at end of file diff --git a/public/about/index.html b/public/about/index.html index 552d367..c79a4df 100644 --- a/public/about/index.html +++ b/public/about/index.html @@ -1,146 +1,203 @@ - - - + + Glenn | About + - About The Theme | Caffeinated Blog - - + + - - - - - - - + + + + + + + + + + + + + + - - - + + + - - + + + - + + + + + + - - - -
- + +
+
© Glenn 2021
+
+
+
+
+ +
- - - -

- Copyright © 2021, Glenn Rice -

- -
- - + + + + + + - + diff --git a/public/adding-menu-items/index.html b/public/adding-menu-items/index.html deleted file mode 100644 index 6729617..0000000 --- a/public/adding-menu-items/index.html +++ /dev/null @@ -1,146 +0,0 @@ - - - - - - Adding Page Items | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
- - -
- - - - -
-
-
-

Adding Page Items

- - -
-
-

Indigo supports adding a simple navigation-style menu items across the top of the site. To do so, simply add a menu: "main" entry in your page’s front matter (TOML format shown).

-

If no date is included in the front matter, then the published date won’t be shown (as in this page).

- -
- -
-
- - - - - - - - - - diff --git a/public/android-chrome-192x192.png b/public/android-chrome-192x192.png deleted file mode 100644 index c8da0ee..0000000 Binary files a/public/android-chrome-192x192.png and /dev/null differ diff --git a/public/android-chrome-512x512.png b/public/android-chrome-512x512.png deleted file mode 100644 index 2b42b5f..0000000 Binary files a/public/android-chrome-512x512.png and /dev/null differ diff --git a/public/apple-touch-icon.png b/public/apple-touch-icon.png deleted file mode 100644 index 50ef0d2..0000000 Binary files a/public/apple-touch-icon.png and /dev/null differ diff --git a/public/archives/index.html b/public/archives/index.html new file mode 100644 index 0000000..ad46025 --- /dev/null +++ b/public/archives/index.html @@ -0,0 +1,190 @@ + + + Glenn + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ profile picture +

Caffeinated

+
+

A bit of personal space for writing

+
+
+
+ +
+
© Glenn 2021
+
+
+
+
+ + +
+ +
+
+
+
+ +
+

+ +
+ +
+
+
+ + +
+
+ + +
+ + +
+
+
+ + + + + + + + + + + + diff --git a/public/articles/index.html b/public/articles/index.html new file mode 100644 index 0000000..e111f0a --- /dev/null +++ b/public/articles/index.html @@ -0,0 +1 @@ +https://example.com/post/ \ No newline at end of file diff --git a/public/blog/index.html b/public/blog/index.html new file mode 100644 index 0000000..e111f0a --- /dev/null +++ b/public/blog/index.html @@ -0,0 +1 @@ +https://example.com/post/ \ No newline at end of file diff --git a/public/browserconfig.xml b/public/browserconfig.xml deleted file mode 100644 index 5aecc91..0000000 --- a/public/browserconfig.xml +++ /dev/null @@ -1,9 +0,0 @@ - - - - - - #00aba9 - - - diff --git a/public/categories/blogging/index.html b/public/categories/blogging/index.html new file mode 100644 index 0000000..a32084e --- /dev/null +++ b/public/categories/blogging/index.html @@ -0,0 +1,189 @@ + + + Glenn | blogging + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ profile picture +

Caffeinated

+
+

A bit of personal space for writing

+
+
+
+ +
+
© Glenn 2021
+
+
+
+
+ + +
+ +
+
+
+ +
+ +
+
+
+ + + + + + + + + + + + diff --git a/public/categories/blogging/index.xml b/public/categories/blogging/index.xml new file mode 100644 index 0000000..a787ab7 --- /dev/null +++ b/public/categories/blogging/index.xml @@ -0,0 +1,24 @@ + + + + blogging on Website of Jane Doe + https://example.com/categories/blogging/ + Recent content in blogging on Website of Jane Doe + Hugo -- gohugo.io + en + Tue, 02 Feb 2021 22:53:29 +1000 + + + + + + Online With Hugo + https://example.com/post/2021/02/online-with-hugo/ + Tue, 02 Feb 2021 22:53:29 +1000 + + https://example.com/post/2021/02/online-with-hugo/ + As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. + + + + \ No newline at end of file diff --git a/public/categories/index.html b/public/categories/index.html index 035be46..87ec1a4 100644 --- a/public/categories/index.html +++ b/public/categories/index.html @@ -1,126 +1,189 @@ - - - + + Glenn | Categories + - Categories | Caffeinated Blog - - + + - - - - - - - + + + + + + + + + + + + + + + + - - + + + - + + + - - - - + + + + + + - - - -
- - - + +
- -

- categories: - Categories -

- -
- +
  • + + + +
    • + +
  • + + + +
    • + +
  • + + + +
    • + +
  • + + + +
    • + + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + +
    - - + + + + + + + - + diff --git a/public/categories/index.xml b/public/categories/index.xml index 522bbe2..12c2e4f 100644 --- a/public/categories/index.xml +++ b/public/categories/index.xml @@ -1,15 +1,24 @@ - Categories on Caffeinated Blog - https://caffeinated.blog/categories/ - Recent content in Categories on Caffeinated Blog + Categories on Website of Jane Doe + https://example.com/categories/ + Recent content in Categories on Website of Jane Doe Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice + en + Tue, 02 Feb 2021 22:53:29 +1000 - + + + blogging + https://example.com/categories/blogging/ + Tue, 02 Feb 2021 22:53:29 +1000 + + https://example.com/categories/blogging/ + + + \ No newline at end of file diff --git a/public/categories/meta/index.html b/public/categories/meta/index.html deleted file mode 100644 index 580d6ab..0000000 --- a/public/categories/meta/index.html +++ /dev/null @@ -1,183 +0,0 @@ - - - - - - meta | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
    - - - - -
    - -

    - categories: - meta -

    - -
    - -
    -
    - -

    Introducing Indigo

    - -

    - -

    -
    -
    - Indigo is a lightweight theme for Hugo with IndieWeb features baked in. It’s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces. - -
    - -

    Read more →

    - -
    - -
    -
    - -

    Featured Typefaces

    - -

    - -

    -
    -
    - Indigo uses a combination of three beautiful typefaces to render your words. - -
    - -

    Read more →

    - -
    - -
    -
    - -

    Author Bios

    - -

    - -

    -
    -
    - The bottom of every page in the theme can optionally show a short biography of the site author, including a profile picture, email link, and location. - -
    - -

    Read more →

    - -
    - -
    - - - - - - - diff --git a/public/categories/meta/index.xml b/public/categories/meta/index.xml deleted file mode 100644 index 42e0c2a..0000000 --- a/public/categories/meta/index.xml +++ /dev/null @@ -1,43 +0,0 @@ - - - - meta on Caffeinated Blog - https://caffeinated.blog/categories/meta/ - Recent content in meta on Caffeinated Blog - Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice - Mon, 01 Oct 2018 09:00:00 -0400 - - - - - - Introducing Indigo - https://caffeinated.blog/post/introducing-indigo/ - Mon, 01 Oct 2018 09:00:00 -0400 - - https://caffeinated.blog/post/introducing-indigo/ - <p>Indigo is a lightweight theme for <a href="https://gohugo.io">Hugo</a> with <a href="https://indieweb.org">IndieWeb</a> features baked in. It&rsquo;s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces.</p> - - - - Featured Typefaces - https://caffeinated.blog/post/featured-typefaces/ - Mon, 01 Oct 2018 08:30:00 -0400 - - https://caffeinated.blog/post/featured-typefaces/ - <p>Indigo uses a combination of three beautiful typefaces to render your words.</p> - - - - Author Bios - https://caffeinated.blog/post/author-bios/ - Mon, 01 Oct 2018 08:00:00 -0400 - - https://caffeinated.blog/post/author-bios/ - <p>The bottom of every page in the theme can optionally show a short biography of the site author, including a profile picture, email link, and location.</p> - - - - \ No newline at end of file diff --git a/public/categories/page/1/index.html b/public/categories/page/1/index.html deleted file mode 100644 index 726663c..0000000 --- a/public/categories/page/1/index.html +++ /dev/null @@ -1 +0,0 @@ -https://example.com/categories/ \ No newline at end of file diff --git a/public/categories/syntax/index.html b/public/categories/syntax/index.html new file mode 100644 index 0000000..f54c9f3 --- /dev/null +++ b/public/categories/syntax/index.html @@ -0,0 +1,189 @@ + + + Glenn | syntax + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/categories/syntax/index.xml b/public/categories/syntax/index.xml new file mode 100644 index 0000000..7d6c821 --- /dev/null +++ b/public/categories/syntax/index.xml @@ -0,0 +1,24 @@ + + + + syntax on Website of Jane Doe + https://example.com/categories/syntax/ + Recent content in syntax on Website of Jane Doe + Hugo -- gohugo.io + en + Mon, 11 Mar 2019 00:00:00 +0000 + + + + + + Markdown Syntax Guide + https://example.com/post/markdown-syntax/ + Mon, 11 Mar 2019 00:00:00 +0000 + + https://example.com/post/markdown-syntax/ + <p>This article offers a sample of basic Markdown syntax that can be used in Hugo content files, also it shows whether basic HTML elements are decorated with CSS in a Hugo theme.</p> + + + + \ No newline at end of file diff --git a/public/categories/themes/index.html b/public/categories/themes/index.html new file mode 100644 index 0000000..439f682 --- /dev/null +++ b/public/categories/themes/index.html @@ -0,0 +1,189 @@ + + + Glenn | themes + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/categories/themes/index.xml b/public/categories/themes/index.xml new file mode 100644 index 0000000..c587043 --- /dev/null +++ b/public/categories/themes/index.xml @@ -0,0 +1,24 @@ + + + + themes on Website of Jane Doe + https://example.com/categories/themes/ + Recent content in themes on Website of Jane Doe + Hugo -- gohugo.io + en + Mon, 11 Mar 2019 00:00:00 +0000 + + + + + + Markdown Syntax Guide + https://example.com/post/markdown-syntax/ + Mon, 11 Mar 2019 00:00:00 +0000 + + https://example.com/post/markdown-syntax/ + <p>This article offers a sample of basic Markdown syntax that can be used in Hugo content files, also it shows whether basic HTML elements are decorated with CSS in a Hugo theme.</p> + + + + \ No newline at end of file diff --git a/public/contact/index.html b/public/contact/index.html new file mode 100644 index 0000000..9a3ec22 --- /dev/null +++ b/public/contact/index.html @@ -0,0 +1,209 @@ + + + Glenn | Contact + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + +
    +

    Contact

    + +
    + + +
    +
    +
      +
    • + +
      • +
    • + +
      • +
    • + +
      • +
    • + +
      • +
    +
    +
    +
    +
    +
    + + +
    +
    + + +
    + + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/css/fonts.css b/public/css/fonts.css deleted file mode 100644 index ad1f5c4..0000000 --- a/public/css/fonts.css +++ /dev/null @@ -1,72 +0,0 @@ -@font-face { - font-family: 'Fira Code'; - src: url('../fonts/FiraCode-Regular.eot'); - src: url('../fonts/FiraCode-Regular.eot?#iefix') format('embedded-opentype'), - url('../fonts/FiraCode-Regular.woff2') format('woff2'), - url('../fonts/FiraCode-Regular.woff') format('woff'), - url('../fonts/FiraCode-Regular.ttf') format('truetype'); - font-weight: 400; - font-style: normal; - font-display: fallback; -} - -@font-face { - font-family: 'Charter'; - src: url('../fonts/charter_regular-webfont.eot'); - src: url('../fonts/charter_regular-webfont.eot?#iefix') format('embedded-opentype'), - url('../fonts/charter_regular-webfont.woff') format('woff'), - url('../fonts/charter_regular-webfont.ttf') format('truetype'); - font-display: fallback; -} - -@font-face { - font-family: 'Charter'; - src: url('../fonts/charter_bold-webfont.eot'); - src: url('../fonts/charter_bold-webfont.eot?#iefix') format('embedded-opentype'), - url('../fonts/charter_bold-webfont.woff') format('woff'), - url('../fonts/charter_bold-webfont.ttf') format('truetype'); - font-weight: bold; - font-display: fallback; -} - -@font-face { - font-family: 'Charter'; - src: url('../fonts/charter_italic-webfont.eot'); - src: url('../fonts/charter_italic-webfont.eot?#iefix') format('embedded-opentype'), - url('../fonts/charter_italic-webfont.woff') format('woff'), - url('../fonts/charter_italic-webfont.ttf') format('truetype'); - font-style: italic; - font-display: fallback; -} - -@font-face { - font-family: 'Charter'; - src: url('../fonts/charter_bold_italic-webfont.eot'); - src: url('../fonts/charter_bold_italic-webfont.eot?#iefix') format('embedded-opentype'), - url('../fonts/charter_bold_italic-webfont.woff') format('woff'), - url('../fonts/charter_bold_italic-webfont.ttf') format('truetype'); - font-style: italic; - font-weight: bold; - font-display: fallback; -} - -@font-face { - font-family: 'Fira Sans'; - src: url('../fonts/FiraSans-Book.eot'); - src: url('../fonts/FiraSans-Book.eot?#iefix') format('embedded-opentype'), - url('../fonts/FiraSans-Book.woff2') format('woff2'), - url('../fonts/FiraSans-Book.woff') format('woff'), - url('../fonts/FiraSans-Book.ttf') format('truetype'); - font-display: fallback; -} - -@font-face { - font-family: 'Fira Sans'; - src: url('../fonts/FiraSans-Bold.eot'); - src: url('../fonts/FiraSans-Bold.eot?#iefix') format('embedded-opentype'), - url('../fonts/FiraSans-Bold.woff2') format('woff2'), - url('../fonts/FiraSans-Bold.woff') format('woff'), - url('../fonts/FiraSans-Bold.ttf') format('truetype'); - font-weight: bold; - font-display: fallback; -} diff --git a/public/css/markupHighlight.min.cc84ed683057cc175ddfa738ea6ba2d5c882b95cb64f50bf9be918cb3791887b.css b/public/css/markupHighlight.min.cc84ed683057cc175ddfa738ea6ba2d5c882b95cb64f50bf9be918cb3791887b.css new file mode 100644 index 0000000..cbd50aa --- /dev/null +++ b/public/css/markupHighlight.min.cc84ed683057cc175ddfa738ea6ba2d5c882b95cb64f50bf9be918cb3791887b.css @@ -0,0 +1 @@ +:root{--chr-def-color: #272822;--chr-def-bg-color: #fafafa;--chr-err-color: #960050;--chr-err-bg-color: #960050;--chr-hl-bg-color: #ffffcc;--chr-lnt-color: #7f7f7f;--chr-ln-color: #7f7f7f;--chr-k-color: #00a8c8;--chr-kc-color: #00a8c8;--chr-kd-color: #00a8c8;--chr-kn-color: #f92672;--chr-kp-color: #00a8c8;--chr-kr-color: #00a8c8;--chr-kt-color: #00a8c8;--chr-n-color: #111111;--chr-na-color: #75af00;--chr-nb-color: #111111;--chr-bp-color: #111111;--chr-nc-color: #75af00;--chr-no-color: #00a8c8;--chr-nd-color: #75af00;--chr-ni-color: #111111;--chr-ne-color: #75af00;--chr-nf-color: #75af00;--chr-fm-color: #111111;--chr-nl-color: #111111;--chr-nn-color: #111111;--chr-nx-color: #75af00;--chr-py-color: #111111;--chr-nt-color: #f92672;--chr-nv-color: #111111;--chr-vc-color: #111111;--chr-vg-color: #111111;--chr-vi-color: #111111;--chr-vm-color: #111111;--chr-l-color: #ae81ff;--chr-ld-color: #d88200;--chr-s-color: #d88200;--chr-sa-color: #d88200;--chr-sb-color: #d88200;--chr-sc-color: #d88200;--chr-dl-color: #d88200;--chr-sd-color: #d88200;--chr-s2-color: #d88200;--chr-se-color: #8045ff;--chr-sh-color: #d88200;--chr-si-color: #d88200;--chr-sx-color: #d88200;--chr-sr-color: #d88200;--chr-s1-color: #d88200;--chr-ss-color: #d88200;--chr-m-color: #ae81ff;--chr-mb-color: #ae81ff;--chr-mf-color: #ae81ff;--chr-mh-color: #ae81ff;--chr-mi-color: #ae81ff;--chr-il-color: #ae81ff;--chr-mo-color: #ae81ff;--chr-o-color: #f92672;--chr-ow-color: #f92672;--chr-p-color: #111111;--chr-c-color: #75715e;--chr-ch-color: #75715e;--chr-cm-color: #75715e;--chr-c1-color: #75715e;--chr-cs-color: #75715e;--chr-cp-color: #75715e;--chr-cpf-color: #75715e}html[data-theme=dark]{--chr-def-color: #f8f8f2;--chr-def-bg-color: #272822;--chr-err-color: #960050;--chr-err-bg-color: #1e0010;--chr-hl-bg-color: #ffffcc;--chr-lnt-color: #7f7f7f;--chr-ln-color: #7f7f7f;--chr-k-color: #66d9ef;--chr-kc-color: #66d9ef;--chr-kd-color: #66d9ef;--chr-kn-color: #f92672;--chr-kp-color: #66d9ef;--chr-kr-color: #66d9ef;--chr-kt-color: #66d9ef;--chr-na-color: #a6e22e;--chr-nc-color: #a6e22e;--chr-no-color: #66d9ef;--chr-nd-color: #a6e22e;--chr-ne-color: #a6e22e;--chr-nf-color: #a6e22e;--chr-nx-color: #a6e22e;--chr-nt-color: #f92672;--chr-l-color: #ae81ff;--chr-ld-color: #e6db74;--chr-s-color: #e6db74;--chr-sa-color: #e6db74;--chr-sb-color: #e6db74;--chr-sc-color: #e6db74;--chr-dl-color: #e6db74;--chr-sd-color: #e6db74;--chr-s2-color: #e6db74;--chr-se-color: #ae81ff;--chr-sh-color: #e6db74;--chr-si-color: #e6db74;--chr-sx-color: #e6db74;--chr-sr-color: #e6db74;--chr-s1-color: #e6db74;--chr-ss-color: #e6db74;--chr-m-color: #ae81ff;--chr-mb-color: #ae81ff;--chr-mf-color: #ae81ff;--chr-mh-color: #ae81ff;--chr-mi-color: #ae81ff;--chr-il-color: #ae81ff;--chr-mo-color: #ae81ff;--chr-o-color: #f92672;--chr-ow-color: #f92672;--chr-p-color: #f8f8f2;--chr-c-color: #75715e;--chr-ch-color: #75715e;--chr-cm-color: #75715e;--chr-c1-color: #75715e;--chr-cs-color: #75715e;--chr-cp-color: #75715e;--chr-cpf-color: #75715e;--chr-gd-color: #f92672;--chr-gi-color: #a6e22e;--chr-gu-color: #75715e}.chroma{color:var(--chr-def-color);background-color:var(--chr-def-bg-color)}.chroma .x{}.chroma .err{color:var(--chr-err-color);background-color:var(--chr-err-bg-color)}.chroma .lntd{vertical-align:top;padding:0;margin:0;border:0}.chroma .lntable{border-spacing:0;padding:0;margin:0;border:0;width:auto;overflow:auto;display:block}.chroma .hl{display:block;width:100%;background-color:var(--chr-hl-bg-color)}.chroma .lnt{margin-right:.4em;padding:0 .4em;color:var(--chr-lnt-color)}.chroma .ln{margin-right:.4em;padding:0 .4em;color:var(--chr-ln-color)}.chroma .k{color:var(--chr-k-color)}.chroma .kc{color:var(--chr-kc-color)}.chroma .kd{color:var(--chr-kd-color)}.chroma .kn{color:var(--chr-kn-color)}.chroma .kp{color:var(--chr-kp-color)}.chroma .kr{color:var(--chr-kr-color)}.chroma .kt{color:var(--chr-kt-color)}.chroma .n{color:var(--chr-n-color)}.chroma .na{color:var(--chr-na-color)}.chroma .nb{color:var(--chr-nb-color)}.chroma .bp{color:var(--chr-bp-color)}.chroma .nc{color:var(--chr-nc-color)}.chroma .no{color:var(--chr-no-color)}.chroma .nd{color:var(--chr-nd-color)}.chroma .ni{color:var(--chr-ni-color)}.chroma .ne{color:var(--chr-ne-color)}.chroma .nf{color:var(--chr-nf-color)}.chroma .fm{color:var(--chr-fm-color)}.chroma .nl{color:var(--chr-nl-color)}.chroma .nn{color:var(--chr-nn-color)}.chroma .nx{color:var(--chr-nx-color)}.chroma .py{color:var(--chr-py-color)}.chroma .nt{color:var(--chr-nt-color)}.chroma .nv{color:var(--chr-nv-color)}.chroma .vc{color:var(--chr-vc-color)}.chroma .vg{color:var(--chr-vg-color)}.chroma .vi{color:var(--chr-vi-color)}.chroma .vm{color:var(--chr-vm-color)}.chroma .l{color:var(--chr-l-color)}.chroma .ld{color:var(--chr-ld-color)}.chroma .s{color:var(--chr-s-color)}.chroma .sa{color:var(--chr-sa-color)}.chroma .sb{color:var(--chr-sb-color)}.chroma .sc{color:var(--chr-sc-color)}.chroma .dl{color:var(--chr-dl-color)}.chroma .sd{color:var(--chr-sd-color)}.chroma .s2{color:var(--chr-s2-color)}.chroma .se{color:var(--chr-se-color)}.chroma .sh{color:var(--chr-sh-color)}.chroma .si{color:var(--chr-si-color)}.chroma .sx{color:var(--chr-sx-color)}.chroma .sr{color:var(--chr-sr-color)}.chroma .s1{color:var(--chr-s1-color)}.chroma .ss{color:var(--chr-ss-color)}.chroma .m{color:var(--chr-m-color)}.chroma .mb{color:var(--chr-mb-color)}.chroma .mf{color:var(--chr-mf-color)}.chroma .mh{color:var(--chr-mh-color)}.chroma .mi{color:var(--chr-mi-color)}.chroma .il{color:var(--chr-il-color)}.chroma .mo{color:var(--chr-mo-color)}.chroma .o{color:var(--chr-o-color)}.chroma .ow{color:var(--chr-ow-color)}.chroma .p{color:var(--chr-p-color)}.chroma .c{color:var(--chr-c-color)}.chroma .ch{color:var(--chr-ch-color)}.chroma .cm{color:var(--chr-cm-color)}.chroma .c1{color:var(--chr-c1-color)}.chroma .cs{color:var(--chr-cs-color)}.chroma .cp{color:var(--chr-cp-color)}.chroma .cpf{color:var(--chr-cpf-color)}.chroma .g{}.chroma .gd{}.chroma .ge{font-style:italic}.chroma .gr{}.chroma .gh{}.chroma .gi{}.chroma .go{}.chroma .gp{}.chroma .gs{font-weight:700}.chroma .gu{}.chroma .gt{}.chroma .gl{}.chroma .w{} \ No newline at end of file diff --git a/public/css/style.css b/public/css/style.css deleted file mode 100644 index db2c31e..0000000 --- a/public/css/style.css +++ /dev/null @@ -1,464 +0,0 @@ -* { - box-sizing: border-box; -} - -body { - background-color: #f8f8f8; - color: #3f3f3f; - font-family: "Charter", Times, "Times New Roman", serif; - margin: 0 auto; -} - -/* Desktop styles */ -@media only screen and (min-width: 860px) { - div#sitelogo { - margin-left: -96px; - position: fixed; - } -} - -@media only screen and (min-width: 768px) { - body { - max-width: 800px; - font-size: 1.3em; - width: 90%; - } - - code, - pre { - font-size: 0.9em; - } - - img { - width: 100%; - } - - blockquote { - font-size: x-large; - } - - .icon-24x24:hover { - background-color: #f8f8f8; - border-top: 2px solid #00416a; - padding-top: 2px; - } - - .card-content { - margin-left: 25px; - } -} - -/* High-DPI mobile styles */ -@media only screen and (max-width: 768px) { - body { - font-size: 1em; - max-width: 90%; - } - - img { - max-width: 100%; - } - - blockquote { - font-size: x-large; - } - - .card-content { - margin-left: 25px; - } -} - -/* Low-DPI mobile styles */ -@media only screen and (max-width: 414px) { - body { - font-size: 1.2em; - max-width: 90%; - } - - img { - max-width: 100%; - } - - blockquote { - font-size: x-large; - } - - .card-content { - margin-left: 0; - } -} - -#sitelogo { - margin: 16px auto 0 auto; - width: 64px; -} - -.glyph:hover { - background-color: #f8f8f8; -} - -h1, -h2, -h3, -h4, -h5, -h6 { - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-weight: bold; - margin-top: 2em; - padding-top: 0.15em; -} - -h1 { - font-size: 2em; -} - -a { - color: #00416a; -} - -a:visited { - color: #316586; -} - -a:hover { - background-color: #00416a; - color: #dee5e9; -} - -h1.post-title { - border-top: 2px solid #3f3f3f; - font-size: 2.5em; -} - -h2.list-title > a { - color: #00416a; -} - -h2.list-title > a:visited { - color: #316586; -} - -h2.list-title > a:hover { - background-color: #f8f8f8; - color: #7b9cb0; -} - -a.read-more { - font-family: "Fira Sans"; - font-size: smaller; - text-transform: uppercase; -} - -section.content { - line-height: 1.5em; -} - -p.post-date { - background-color: #00416a; - color: #dee5e9; - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-size: smaller; - margin: 0 0 2.5em 0; - padding: 0.25em 0.5em; -} - -a.p-author { - color: #dee5e9; - text-decoration: none; -} - -h2.list-title { - margin: 2em 0 0 0; - padding: 0; -} - -p.list-post-date { - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-size: smaller; - margin: 1em 0 1.5em 0; - padding: 0; - text-transform: uppercase; -} - -#footer { - width: 100%; -} - -.copyright { - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-size: smaller; - margin-top: 2em; - text-align: center; -} - -div.h-card { - box-shadow: 0 5px 5px #ccc; - margin: 100px auto; - min-height: 150px; - padding: 25px; - width: 90%; -} - -img.u-photo { - width: 100px; -} - -.card-content { - display: inline-block; -} - -.card-name { - margin: 0; -} - -.card-subhead { - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-size: smaller; - text-transform: uppercase; -} - -blockquote { - color: #00416a; - background-color: #dee5e9; - border-left: 25px solid #00416a; - line-height: 1.25em; - margin: 2em auto; - padding: 1% 5%; - width: 100%; -} - -code { - background-color: #dee5e9; - color: #00416a; - font-family: "Fira Code", "Courier New", Courier, monospace; - padding: 0.1em 0.2em 0.1em 0.2em; -} - -pre { - background-color: #dee5e9; - border: 1px solid #ccc; - border-radius: 5px; - font-size: 0.8em; - margin: 2em auto; - overflow-x: scroll; - padding: 1em; - width: 100%; -} - -hr.post-underline { - border: 0; - border-top: 1px solid #ccc; - display: block; - height: 1px; - padding: 0; - margin: 2em auto; - width: 75%; -} - -a.permalink { - border-radius: 100%; - text-decoration: none; -} - -.post-tag { - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-size: small; - text-transform: uppercase; -} - -a.post-tag { - background-color: #dee5e9; - border: 1px solid #7b9cb0; - border-radius: 5px; - color: #316586; - padding: 0.15em 0.3em 0.1em 0.3em; - text-decoration: none; -} - -a.post-tag:hover { - background-color: #7b9cb0; - color: #fff; -} - -.list-heading-type { - font-size: large; - text-transform: uppercase; -} - -.list-heading-tag { - background-color: #dee5e9; - border: 1px solid #7b9cb0; - border-radius: 5px; - color: #316586; - font-size: large; - font-weight: 100; - padding: 0.25em 0.5em; - text-transform: uppercase; -} - -div#site-header { - border-top: 5px solid #3f3f3f; - border-bottom: 2px solid #3f3f3f; -} - -div#site-header > h1 { - font-size: 2.5em; - line-height: 1em; - margin-top: 1em; -} - -div#site-header > p { - margin-top: 0; - margin-bottom: 1em; -} - -div#page-nav, -#pagination { - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-size: smaller; - line-height: 1em; - margin: 1.5em 0 2.5em 0; - padding: 0; - text-align: center; - text-transform: uppercase; - width: 100%; -} - -#page-nav { - align-items: flex-start; - display: flex; - flex-direction: row; - flex-wrap: nowrap; - justify-content: space-around; -} - -div.page-nav-item, -div.page-nav-spacer { - flex: 1 1 auto; - margin: 0; - padding: 0; -} - -div.page-nav-item > a { - color: #00416a; - display: block; - text-decoration: none; - width: 100%; -} - -div.page-nav-item > a:hover { - background-color: #00416a; - color: #dee5e9; -} - -div#pagination { - display: inline-block; - margin: 3.5em 0; -} - -div.pagination-item:hover { - background-color: #00416a; -} - -div.pagination-item, -div.pagination-item-spacer { - display: inline-block; - float: left; - margin: 0; - padding: 0; - width: 20%; -} - -div.pagination-item > a { - color: #00416a; - display: block; - text-decoration: none; -} - -div.pagination-item > a:hover { - color: #dee5e9; -} - -aside#social { - border-top: 2px solid #3f3f3f; - display: flex; - height: 48px; - margin: 0 auto; - width: 100%; -} - -div#social-icons { - align-items: center; - display: flex; - flex-basis: 414px; - flex-wrap: wrap; - height: 24px; - justify-content: space-between; - margin-top: 20px; - max-width: 414px; - min-width: 288px; -} - -.icon-24x24 { - height: 24px; - width: 24px; -} - -nav#article-skip { - align-items: flex-start; - border-top: 1px solid #dee5e9; - display: flex; - flex-direction: row; - flex-wrap: nowrap; - font-family: "Fira Sans", Helvetica, Arial, sans-serif; - font-size: smaller; - justify-content: space-around; - line-height: 1em; - margin: 5em 0 0 0; - padding: 0; - text-align: center; - text-transform: uppercase; -} - -.next, -.prev, -.top { - flex: 0 1 auto; - margin: 0; - padding: 0.5em; - width: 100%; -} - -.next { - text-align: left; -} - -.prev { - text-align: right; -} - -.top { - border-left: 1px solid #dee5e9; - border-right: 1px solid #dee5e9; -} - -div.next > p, -div.prev > p { - margin: 0; - padding: 0; -} - -div.next > a, -div.prev > a, -div.top > a { - color: #00416a; - text-decoration: none; -} - -div.next > a:hover, -div.prev > a:hover, -div.top > a:hover { - background-color: #00416a; - color: #dee5e9; -} diff --git a/public/css/style.min.9a6700e4461b50dccdddfc4f81dc65d77e7fca22c35665e398a0c36568db59c7.css b/public/css/style.min.9a6700e4461b50dccdddfc4f81dc65d77e7fca22c35665e398a0c36568db59c7.css new file mode 100644 index 0000000..1c8b2fc --- /dev/null +++ b/public/css/style.min.9a6700e4461b50dccdddfc4f81dc65d77e7fca22c35665e398a0c36568db59c7.css @@ -0,0 +1 @@ +@charset "UTF-8";:root{--bg-color: #fff;--secondary-bg-color: #eeeeee;--heading-color: #5f5f5f;--body-color: rgba(0, 0, 0, 0.7);--post-color: rgba(0, 0, 0, 0.44);--border-color: rgba(0, 0, 0, 0.15);--form-border-color: #9f9f9f;--form-button-hover-border-color: #000;--pre-bg-color: #f9f9fd;--nav-text-color: #5a5a5a;--tag-color: #424242;--blockquote-text-color: #858585;--blockquote-border-color: #dfe2e5;--thumbnail-height: 15em;scroll-padding-top:100px}html[data-theme=dark]{--bg-color: #292a2d;--secondary-bg-color: #2c2d32;--heading-color: rgb(169, 169, 179);--body-color: rgb(169, 169, 179);--post-color: rgba(0, 0, 0, 0.44);--border-color: rgb(38, 38, 38);--form-border-color: rgb(169, 169, 179);--form-button-hover-border-color: #fff;--pre-bg-color: rgb(33, 33, 45);--nav-text-color: rgb(191, 191, 191);--tag-color: rgb(191, 191, 191);--blockquote-text-color: #808080;--blockquote-border-color: #424242}html{background-color:var(--bg-color);-webkit-font-smoothing:antialiased}body{color:var(--body-color);font-family:verdana,sans-serif;font-size:15px;width:100%;margin:0 auto 30px;background-color:var(--bg-color)}p{line-height:1.9em;font-weight:400;font-size:14px}a{text-decoration:none}blockquote{padding:0 1em;border-left:.25em solid var(--blockquote-border-color);color:var(--blockquote-text-color)}.category{padding:4px 6px;border-radius:3px;color:var(--tag-color)!important;background-color:var(--secondary-bg-color);border:1px solid var(--border-color)}.tag::before{content:"#";opacity:.5}.tag,.category{display:inline-block;font-size:15px;line-height:1;margin:5px 8px 5px 0}pre{background-color:var(--pre-bg-color);padding:5px;display:block;overflow-x:auto}.info i{opacity:.5;margin-right:5px}a:link,a:visited{opacity:1;color:var(--tag-color)}a:hover,a:active{color:#2660ab}.animated{transition:top .8s linear;-webkit-animation-duration:1s;-moz-animation-duration:1s;-ms-animation-duration:1s;-o-animation-duration:1s;animation-duration:1s}.animated.hinge{-webkit-animation-duration:1s;-moz-animation-duration:1s;-ms-animation-duration:1s;-o-animation-duration:1s;animation-duration:1s}@-webkit-keyframes fadeInDown{0%{-webkit-transform:translateY(-20px)}100%{-webkit-transform:translateY(0)}}@-moz-keyframes fadeInDown{0%{-moz-transform:translateY(-20px)}100%{-moz-transform:translateY(0)}}@-o-keyframes fadeInDown{0%{-o-transform:translateY(-20px)}100%{-o-transform:translateY(0)}}@keyframes fadeInDown{0%{transform:translateY(-20px)}100%{transform:translateY(0)}}.fadeInDown{-webkit-animation-name:fadeInDown;-moz-animation-name:fadeInDown;-o-animation-name:fadeInDown;animation-name:fadeInDown}.content{height:auto;float:right;width:60%;margin-top:60px}.page-top{width:60%;position:fixed;right:0;z-index:3;background-color:var(--bg-color);height:60px;border-bottom:1px solid var(--border-color)}.page-top .nav{list-style:none;padding:11px 30px;float:left;font-size:12px;display:block;width:calc(100% - 30px)}.page-top .nav li{position:relative;display:initial;padding-right:20px}.page-top .nav a{color:var(--nav-text-color)}.page-top .nav a:hover{color:#2660ab}.page-top .nav a.current{color:var(--nav-text-color);padding-bottom:22px;border-bottom:1px solid var(--nav-text-color)}.theme-switch-item{float:right;font-size:2em;margin-top:-5px}.page-top .information{float:right;padding-top:12px;padding-right:20px}.page-top .information .avatar{float:right}.page-top .information .avatar img{width:32px;height:32px;border-radius:300px}.page-top .information .back_btn{float:left;padding-top:5px;margin-right:-10px}.page-top .information .back_btn li{display:initial;padding-right:40px}.sidebar{width:40%;-webkit-background-size:cover;background-size:cover;background-color:var(--bg-color);height:100%;top:0;left:0;position:fixed;z-index:4;border-right:1px solid var(--border-color);display:flex;flex-direction:column;min-height:100%}.sidebar .logo-title{text-align:center;padding-top:240px;flex:1}.sidebar .logo-title .description{font-size:14px}.sidebar .logo-title .logo{margin:0 auto}.sidebar .logo-title .title img{width:127px;border-radius:50%}.sidebar .logo-title .title h3{text-transform:uppercase;font-size:2rem;font-weight:700;letter-spacing:2px;line-height:1;margin:1em}.sidebar .logo-title .title a{text-decoration:none;color:var(--heading-color);font-size:2rem;font-weight:700}.sidebar .social-links{list-style:none;padding:0;font-size:14px;text-align:center;flex:7}.sidebar .social-links i{margin-right:3px}.sidebar .social-links li{display:inline;padding:0 4px;line-height:0}.sidebar .social-links a{color:var(--heading-color)}.sidebar .social-links a:hover{color:#2660ab}.post{background-color:var(--bg-color);margin:30px}.post .post-title h1{text-transform:uppercase;font-size:30px;letter-spacing:5px;line-height:1}.post .post-title h2{text-transform:uppercase;letter-spacing:1px;font-size:28px;line-height:1;font-weight:600;color:var(--heading-color)}.post .post-title h3{text-transform:uppercase;letter-spacing:1px;line-height:1;font-weight:600;color:var(--heading-color);font-size:22px;margin:0}.post .post-title a{text-decoration:none;letter-spacing:1px;color:var(--heading-color)}.post .post-title a:hover{text-decoration:underline}.post .post-content a{text-decoration:none;letter-spacing:1px;color:#2660ab}.post .post-content a:hover{color:#2f69b3}.post .post-content h3{font-size:22px;font-weight:600}.post .post-content h4{font-size:16px}.post .post-content img{max-width:100%}.post .post-footer{padding:0 0 10px;border-bottom:1px solid var(--border-color)}.post .post-footer .meta{max-width:100%;display:flex;color:#bbb}.post .post-footer .meta .info{float:left;font-size:12px;margin-bottom:1em;color:var(--body-color)}.post .post-footer .info .separator a{margin-right:.2em}.post .post-footer .meta .info .date{margin-right:10px;margin-left:5px}.info{margin:1em}.info span{margin-right:.5em}.post .post-footer .meta a{text-decoration:none;color:var(--body-color)}.post .post-footer .meta a:hover{color:#2660ab}.post .post-footer .meta i{margin-right:6px}.post .post-footer .tags{padding-bottom:15px;font-size:13px}.post .post-footer .tags ul{list-style-type:none;display:inline;margin:0;padding:0}.post .post-footer .tags ul li{list-style-type:none;margin:0;padding-right:5px;display:inline}.post .post-footer .tags a{text-decoration:none;color:var(--post-color);font-weight:400}.post .post-footer .tags a:hover{text-decoration:none}.post .post-thumbnail{width:100%;padding-bottom:1em;box-shadow:#000;border-radius:.5em;overflow:hidden;transition:box-shadow .3s ease}.post .post-thumbnail img{width:100%;height:var(--thumbnail-height);object-fit:cover;border:1px solid var(--border-color);border-bottom:0}.pagination{margin:30px;padding:0 0 56px;text-align:center}.pagination ul{list-style:none;margin:0;padding:0;height:13px}.pagination ul li{margin:0 2px;display:inline;line-height:1}.pagination ul li a{text-decoration:none;color:var(--body-color)}.pagination .pre{float:left}.pagination .next{float:right}.like-reblog-buttons{float:right}.like-button{float:right;padding:0 0 0 10px}.reblog-button{float:right;padding:0}#install-btn{position:fixed;bottom:0;right:6px}#disqus_thread{margin:30px;border-bottom:1px solid var(--border-color)}.footer{clear:both;text-align:center;font-size:10px;margin:0 auto;bottom:0;width:100%;padding-bottom:20px;flex:0;position:relative}.footer a{color:#a6a6a6}.footer a:hover{color:#2660ab}.archive{width:100%}.list-with-title{font-size:14px;margin:30px;padding:0}.list-with-title li{list-style-type:none;padding:0}.list-with-title .listing-title{font-size:24px;color:#666;font-weight:600;line-height:2.2em}.list-with-title .listing{padding:0}.list-with-title .listing .listing-post{padding-bottom:5px}.list-with-title .listing .listing-post .post-time{float:right;display:inline-block;max-width:10%;text-align:right;color:#c5c5c5}.list-with-title .listing .listing-post a{color:#8f8f8f;width:90%;display:inline-block}.list-with-title .listing .listing-post a:hover{color:#2660ab}.share{margin:0 30px;display:inline-flex}.evernote{width:32px;height:32px;border-radius:300px;background-color:#3e3e3e;margin-right:5px}.evernote a{color:#fff;padding:11px;font-size:12px}.evernote a:hover{color:#ed6243;padding:11px}.weibo{width:32px;height:32px;border-radius:300px;background-color:#ed6243;margin-right:5px}.weibo a{color:#fff;padding:9px}.weibo a:hover{color:#bd4226}.twitter{width:32px;height:32px;border-radius:300px;background-color:#59c0fd;margin-right:5px}.twitter a{color:#fff;padding:9px}.twitter a:hover{color:#4b9ece}.about{margin:30px}.about h3{font-size:22px}.links{margin:30px}.links h3{font-size:22px}.links a{cursor:pointer}.comment-count{color:#666}.tab-community{color:#666}.read_more{font-size:14px}.back-button{padding-top:30px;max-width:100px;padding-left:40px;float:left}#fb_comments_container{margin:30px}.utterances{max-width:unset}a.btn{color:#868686;font-weight:400}.btn{display:inline-block;position:relative;outline:0;color:var(--post-color);background:0 0;font-size:14px;text-align:center;text-decoration:none;cursor:pointer;border:1px solid var(--border-color);white-space:nowrap;font-weight:400;font-style:normal;border-radius:999em}.btn:hover{display:inline-block;position:relative;outline:0;color:#464545;background:0 0;font-size:14px;text-align:center;text-decoration:none;cursor:pointer;border:1px solid #464545;white-space:nowrap;font-weight:400;font-style:normal;border-radius:999em}[role=back]{padding:.5em 1.25em;line-height:1.666em}[role=home]{padding:.5em 1.25em;line-height:1.666em}[role=navigation]{padding:.5em 1.25em;line-height:1.666em}[role=tags]{padding:6px 12px}.menu{float:right;padding-top:30px}.menu .btn-down{margin:0}.menu .btn-down li{list-style:none;width:100px}.menu .btn-down li a{display:inline-block;position:relative;padding:.5em 1.25em;outline:0;color:var(--post-color);background:0 0;font-size:14px;text-align:center;text-decoration:none;cursor:pointer;border:1px solid var(--border-color);white-space:nowrap;font-weight:400;font-style:normal;border-radius:999em;margin-top:5px}.menu .btn-down li a:hover{position:relative;padding:.5em 1.25em;outline:0;color:#fff;background:#3cbd10;font-size:14px;text-align:center;text-decoration:none;cursor:pointer;border:1px solid rgba(0,0,0,.15);white-space:nowrap;font-weight:400;font-style:normal;border-radius:999em;margin-top:5px}.menu .btn-down div{position:absolute;visibility:hidden;width:100px;float:right}.page_404{text-align:center;padding-top:50px}.navbar-burger{display:none}@media screen and (max-width:960px),print{.sidebar{width:100%;position:absolute;border-right:none;z-index:1}.sidebar .logo-title{padding-top:120px}.sidebar .logo-title .title img{width:100px}.sidebar .logo-title .title h3{font-size:20px}.page-top{width:100%}.post-title h3{line-height:1.6}.content{margin-top:420px;width:100%;z-index:2;position:absolute}.footer{display:none}.share{display:grid}.page-top .nav{background-color:var(--secondary-bg-color);box-shadow:0 8px 16px rgba(10,10,10,.1);padding:.5rem 0;width:100%;display:none;margin-top:0}.page-top .nav.is-active{display:block}.page-top .nav li{display:block;flex-grow:0;flex-shrink:0;line-height:2.5;padding:.5rem .75rem;position:relative;text-transform:uppercase;text-align:center;font-size:1.3em}.page-top .nav a.current{border-bottom:none}.navbar-burger{cursor:pointer;display:block;height:3.25rem;position:relative;width:3.25rem;margin-left:auto}.navbar-burger span{background-color:var(--heading-color);display:block;height:1px;left:calc(50% - 8px);position:absolute;transform-origin:center;transition-duration:86ms;transition-property:background-color,opacity,transform;transition-timing-function:ease-out;width:16px}.navbar-burger span:nth-child(1){top:calc(50% - 6px)}.navbar-burger span:nth-child(2){top:calc(50% - 1px)}.navbar-burger span:nth-child(3){top:calc(50% + 4px)}.theme-switch-item{float:none}.list-with-title .listing .listing-post .post-time{max-width:20%}.list-with-title .listing .listing-post a{width:80%}}.medium-zoom-overlay{position:fixed;top:0;right:0;bottom:0;left:0;opacity:0;transition:opacity 300ms;will-change:opacity;background:var(--bg-color)}.medium-zoom--opened .medium-zoom-overlay{cursor:pointer;cursor:zoom-out;opacity:1}.medium-zoom-image{cursor:pointer;cursor:zoom-in;transition:transform 300ms cubic-bezier(0.2,0,0.2,1)!important;z-index:100}.medium-zoom-image--hidden{visibility:hidden}.medium-zoom-image--opened{position:relative;cursor:pointer;cursor:zoom-out;will-change:transform}@media print{.page-top{display:none}}@media(min-width:1921px){.content{padding-right:25%;width:35%}.sidebar{padding-left:15%;width:25%}}.contact-form{margin-top:30px}.form-style{width:100%}.form-style ul{padding:0;margin:0;list-style:none}.form-style ul li{display:block;margin-bottom:10px;min-height:35px}.form-style ul li .field-style{box-sizing:border-box;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;font-size:14px;padding:8px;outline:none;background-color:var(--bg-color);border:1px solid var(--form-border-color);color:var(--body-color)}.form-style ul li .field-style:focus{box-shadow:0 0 5px;border:1px solid}.form-style ul li .field-split{width:49%}.form-style ul li .field-full{width:100%}.form-style ul li input.align-left{float:left}.form-style ul li input.align-right{float:right}.form-style ul li textarea{background-color:var(--bg-color);border:1px solid var(--form-border-color);color:var(--body-color);width:100%;height:auto}.form-style ul li input[type=button],.form-style ul li input[type=submit]{background-color:var(--bg-color);border:1px solid var(--form-border-color);display:inline-block;cursor:pointer;color:var(--body-color);text-decoration:none;width:100%}.form-style ul li input[type=button]:hover,.form-style ul li input[type=submit]:hover{background-color:var(--bg-color);border:1px solid var(--form-button-hover-border-color)} \ No newline at end of file diff --git a/public/docs/index.html b/public/docs/index.html new file mode 100644 index 0000000..e111f0a --- /dev/null +++ b/public/docs/index.html @@ -0,0 +1 @@ +https://example.com/post/ \ No newline at end of file diff --git a/public/favicon-16x16.png b/public/favicon-16x16.png deleted file mode 100644 index 5357f74..0000000 Binary files a/public/favicon-16x16.png and /dev/null differ diff --git a/public/favicon.ico b/public/favicon.ico deleted file mode 100644 index 2732399..0000000 Binary files a/public/favicon.ico and /dev/null differ diff --git a/public/favicon-32x32.png b/public/favicons/favicon.png similarity index 100% rename from public/favicon-32x32.png rename to public/favicons/favicon.png diff --git a/public/fonts/FiraCode-Regular.eot b/public/fonts/FiraCode-Regular.eot deleted file mode 100755 index cef458e..0000000 Binary files a/public/fonts/FiraCode-Regular.eot and /dev/null differ diff --git a/public/fonts/FiraCode-Regular.otf b/public/fonts/FiraCode-Regular.otf deleted file mode 100755 index 4770d16..0000000 Binary files a/public/fonts/FiraCode-Regular.otf and /dev/null differ diff --git a/public/fonts/FiraCode-Regular.ttf b/public/fonts/FiraCode-Regular.ttf deleted file mode 100755 index 0fb0817..0000000 Binary files a/public/fonts/FiraCode-Regular.ttf and /dev/null differ diff --git a/public/fonts/FiraCode-Regular.woff b/public/fonts/FiraCode-Regular.woff deleted file mode 100755 index 5e4106f..0000000 Binary files a/public/fonts/FiraCode-Regular.woff and /dev/null differ diff --git a/public/fonts/FiraCode-Regular.woff2 b/public/fonts/FiraCode-Regular.woff2 deleted file mode 100755 index df544dc..0000000 Binary files a/public/fonts/FiraCode-Regular.woff2 and /dev/null differ diff --git a/public/fonts/FiraSans-Bold.eot b/public/fonts/FiraSans-Bold.eot deleted file mode 100644 index 91245f1..0000000 Binary files a/public/fonts/FiraSans-Bold.eot and /dev/null differ diff --git a/public/fonts/FiraSans-Bold.ttf b/public/fonts/FiraSans-Bold.ttf deleted file mode 100644 index f03425a..0000000 Binary files a/public/fonts/FiraSans-Bold.ttf and /dev/null differ diff --git a/public/fonts/FiraSans-Bold.woff b/public/fonts/FiraSans-Bold.woff deleted file mode 100644 index aac5ce3..0000000 Binary files a/public/fonts/FiraSans-Bold.woff and /dev/null differ diff --git a/public/fonts/FiraSans-Bold.woff2 b/public/fonts/FiraSans-Bold.woff2 deleted file mode 100644 index 9216d5e..0000000 Binary files a/public/fonts/FiraSans-Bold.woff2 and /dev/null differ diff --git a/public/fonts/FiraSans-Book.eot b/public/fonts/FiraSans-Book.eot deleted file mode 100644 index 9902a51..0000000 Binary files a/public/fonts/FiraSans-Book.eot and /dev/null differ diff --git a/public/fonts/FiraSans-Book.ttf b/public/fonts/FiraSans-Book.ttf deleted file mode 100644 index f6c2a6c..0000000 Binary files a/public/fonts/FiraSans-Book.ttf and /dev/null differ diff --git a/public/fonts/FiraSans-Book.woff b/public/fonts/FiraSans-Book.woff deleted file mode 100644 index a480632..0000000 Binary files a/public/fonts/FiraSans-Book.woff and /dev/null differ diff --git a/public/fonts/FiraSans-Book.woff2 b/public/fonts/FiraSans-Book.woff2 deleted file mode 100644 index be1642d..0000000 Binary files a/public/fonts/FiraSans-Book.woff2 and /dev/null differ diff --git a/public/fonts/FiraSans-Light.eot b/public/fonts/FiraSans-Light.eot deleted file mode 100644 index 683a207..0000000 Binary files a/public/fonts/FiraSans-Light.eot and /dev/null differ diff --git a/public/fonts/FiraSans-Light.ttf b/public/fonts/FiraSans-Light.ttf deleted file mode 100644 index d06adde..0000000 Binary files a/public/fonts/FiraSans-Light.ttf and /dev/null differ diff --git a/public/fonts/FiraSans-Light.woff b/public/fonts/FiraSans-Light.woff deleted file mode 100644 index fc2d955..0000000 Binary files a/public/fonts/FiraSans-Light.woff and /dev/null differ diff --git a/public/fonts/FiraSans-Light.woff2 b/public/fonts/FiraSans-Light.woff2 deleted file mode 100644 index 28ff042..0000000 Binary files a/public/fonts/FiraSans-Light.woff2 and /dev/null differ diff --git a/public/fonts/charter_bold-webfont.eot b/public/fonts/charter_bold-webfont.eot deleted file mode 100755 index 800aa39..0000000 Binary files a/public/fonts/charter_bold-webfont.eot and /dev/null differ diff --git a/public/fonts/charter_bold-webfont.ttf b/public/fonts/charter_bold-webfont.ttf deleted file mode 100755 index cea448b..0000000 Binary files a/public/fonts/charter_bold-webfont.ttf and /dev/null differ diff --git a/public/fonts/charter_bold-webfont.woff b/public/fonts/charter_bold-webfont.woff deleted file mode 100755 index 6d7fd7a..0000000 Binary files a/public/fonts/charter_bold-webfont.woff and /dev/null differ diff --git a/public/fonts/charter_bold_italic-webfont.eot b/public/fonts/charter_bold_italic-webfont.eot deleted file mode 100755 index 62268df..0000000 Binary files a/public/fonts/charter_bold_italic-webfont.eot and /dev/null differ diff --git a/public/fonts/charter_bold_italic-webfont.ttf b/public/fonts/charter_bold_italic-webfont.ttf deleted file mode 100755 index c83766c..0000000 Binary files a/public/fonts/charter_bold_italic-webfont.ttf and /dev/null differ diff --git a/public/fonts/charter_bold_italic-webfont.woff b/public/fonts/charter_bold_italic-webfont.woff deleted file mode 100755 index 1ef433f..0000000 Binary files a/public/fonts/charter_bold_italic-webfont.woff and /dev/null differ diff --git a/public/fonts/charter_italic-webfont.eot b/public/fonts/charter_italic-webfont.eot deleted file mode 100755 index 2124b1c..0000000 Binary files a/public/fonts/charter_italic-webfont.eot and /dev/null differ diff --git a/public/fonts/charter_italic-webfont.ttf b/public/fonts/charter_italic-webfont.ttf deleted file mode 100755 index 9276421..0000000 Binary files a/public/fonts/charter_italic-webfont.ttf and /dev/null differ diff --git a/public/fonts/charter_italic-webfont.woff b/public/fonts/charter_italic-webfont.woff deleted file mode 100755 index 08c8249..0000000 Binary files a/public/fonts/charter_italic-webfont.woff and /dev/null differ diff --git a/public/fonts/charter_license.txt b/public/fonts/charter_license.txt deleted file mode 100644 index 364606e..0000000 --- a/public/fonts/charter_license.txt +++ /dev/null @@ -1,5 +0,0 @@ -Charter License - -This is a copy of the Char­ter fonts which Bit­stream con­tributed to the X con­sor­tium. This is the orig­i­nal no­tice in­cluded with the fonts: - -(c) Copy­right 1989-1992, Bit­stream Inc., Cam­bridge, MA. You are hereby granted per­mis­sion un­der all Bit­stream pro­pri­ety rights to use, copy, mod­ify, sub­li­cense, sell, and re­dis­trib­ute the 4 Bit­stream Char­ter (r) Type 1 out­line fonts and the 4 Courier Type 1 out­line fonts for any pur­pose and with­out re­stric­tion; pro­vided, that this no­tice is left in­tact on all copies of such fonts and that Bit­stream’s trade­mark is ac­knowl­edged as shown be­low on all un­mod­i­fied copies of the 4 Char­ter Type 1 fonts. BIT­STREAM CHAR­TER is a reg­is­tered trade­mark of Bit­stream Inc. \ No newline at end of file diff --git a/public/fonts/charter_regular-webfont.eot b/public/fonts/charter_regular-webfont.eot deleted file mode 100755 index 01872e3..0000000 Binary files a/public/fonts/charter_regular-webfont.eot and /dev/null differ diff --git a/public/fonts/charter_regular-webfont.ttf b/public/fonts/charter_regular-webfont.ttf deleted file mode 100755 index 44e097a..0000000 Binary files a/public/fonts/charter_regular-webfont.ttf and /dev/null differ diff --git a/public/fonts/charter_regular-webfont.woff b/public/fonts/charter_regular-webfont.woff deleted file mode 100755 index a19483d..0000000 Binary files a/public/fonts/charter_regular-webfont.woff and /dev/null differ diff --git a/public/fonts/fira-code_license.txt b/public/fonts/fira-code_license.txt deleted file mode 100644 index 5ec3dbc..0000000 --- a/public/fonts/fira-code_license.txt +++ /dev/null @@ -1,102 +0,0 @@ -Copyright (c) 2014, Nikita Prokopov http://tonsky.me -with Reserved Font Name Fira Code. - -Copyright (c) 2014, Mozilla Foundation https://mozilla.org/ -with Reserved Font Name Fira Sans. - -Copyright (c) 2014, Mozilla Foundation https://mozilla.org/ -with Reserved Font Name Fira Mono. - -Copyright (c) 2014, Telefonica S.A. - -This Font Software is licensed under the SIL Open Font License, Version 1.1. -This license is copied below, and is also available with a FAQ at: -http://scripts.sil.org/OFL - - ------------------------------------------------------------ -SIL OPEN FONT LICENSE Version 1.1 - 26 February 2007 ------------------------------------------------------------ - -PREAMBLE -The goals of the Open Font License (OFL) are to stimulate worldwide -development of collaborative font projects, to support the font creation -efforts of academic and linguistic communities, and to provide a free and -open framework in which fonts may be shared and improved in partnership -with others. - -The OFL allows the licensed fonts to be used, studied, modified and -redistributed freely as long as they are not sold by themselves. The -fonts, including any derivative works, can be bundled, embedded, -redistributed and/or sold with any software provided that any reserved -names are not used by derivative works. The fonts and derivatives, -however, cannot be released under any other type of license. The -requirement for fonts to remain under this license does not apply -to any document created using the fonts or their derivatives. - -DEFINITIONS -"Font Software" refers to the set of files released by the Copyright -Holder(s) under this license and clearly marked as such. This may -include source files, build scripts and documentation. - -"Reserved Font Name" refers to any names specified as such after the -copyright statement(s). - -"Original Version" refers to the collection of Font Software components as -distributed by the Copyright Holder(s). - -"Modified Version" refers to any derivative made by adding to, deleting, -or substituting -- in part or in whole -- any of the components of the -Original Version, by changing formats or by porting the Font Software to a -new environment. - -"Author" refers to any designer, engineer, programmer, technical -writer or other person who contributed to the Font Software. - -PERMISSION & CONDITIONS -Permission is hereby granted, free of charge, to any person obtaining -a copy of the Font Software, to use, study, copy, merge, embed, modify, -redistribute, and sell modified and unmodified copies of the Font -Software, subject to the following conditions: - -1) Neither the Font Software nor any of its individual components, -in Original or Modified Versions, may be sold by itself. - -2) Original or Modified Versions of the Font Software may be bundled, -redistributed and/or sold with any software, provided that each copy -contains the above copyright notice and this license. These can be -included either as stand-alone text files, human-readable headers or -in the appropriate machine-readable metadata fields within text or -binary files as long as those fields can be easily viewed by the user. - -3) No Modified Version of the Font Software may use the Reserved Font -Name(s) unless explicit written permission is granted by the corresponding -Copyright Holder. This restriction only applies to the primary font name as -presented to the users. - -4) The name(s) of the Copyright Holder(s) or the Author(s) of the Font -Software shall not be used to promote, endorse or advertise any -Modified Version, except to acknowledge the contribution(s) of the -Copyright Holder(s) and the Author(s) or with their explicit written -permission. - -5) The Font Software, modified or unmodified, in part or in whole, -must be distributed entirely under this license, and must not be -distributed under any other license. The requirement for fonts to -remain under this license does not apply to any document created -using the Font Software. - -TERMINATION -This license becomes null and void if any of the above conditions are -not met. - -DISCLAIMER -THE FONT SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO ANY WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT -OF COPYRIGHT, PATENT, TRADEMARK, OR OTHER RIGHT. IN NO EVENT SHALL THE -COPYRIGHT HOLDER BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, -INCLUDING ANY GENERAL, SPECIAL, INDIRECT, INCIDENTAL, OR CONSEQUENTIAL -DAMAGES, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING -FROM, OUT OF THE USE OR INABILITY TO USE THE FONT SOFTWARE OR FROM -OTHER DEALINGS IN THE FONT SOFTWARE. \ No newline at end of file diff --git a/public/fonts/fira-sans_license.txt b/public/fonts/fira-sans_license.txt deleted file mode 100644 index 5af572f..0000000 --- a/public/fonts/fira-sans_license.txt +++ /dev/null @@ -1,96 +0,0 @@ -https://bboxtype.com/downloads/Fira/OFL.txt - -Digitized data copyright 2012-2018 for FiraGO: Carrois Corporate GbR and HERE Europe B.V. All rights reserved. -Digitized data copyright 2012-2018 for Fira Sans up to version 4.3: The Mozilla Foundation, Telefonica S.A., Carrois Corporate GbR and bBox Type GmbH. - -This Font Software is licensed under the SIL Open Font License, Version 1.1. -This license is copied below, and is also available with a FAQ at: -http://scripts.sil.org/OFL - - ------------------------------------------------------------ -SIL OPEN FONT LICENSE Version 1.1 - 26 February 2007 ------------------------------------------------------------ - -PREAMBLE -The goals of the Open Font License (OFL) are to stimulate worldwide -development of collaborative font projects, to support the font creation -efforts of academic and linguistic communities, and to provide a free and -open framework in which fonts may be shared and improved in partnership -with others. - -The OFL allows the licensed fonts to be used, studied, modified and -redistributed freely as long as they are not sold by themselves. The -fonts, including any derivative works, can be bundled, embedded, -redistributed and/or sold with any software provided that any reserved -names are not used by derivative works. The fonts and derivatives, -however, cannot be released under any other type of license. The -requirement for fonts to remain under this license does not apply -to any document created using the fonts or their derivatives. - -DEFINITIONS -"Font Software" refers to the set of files released by the Copyright -Holder(s) under this license and clearly marked as such. This may -include source files, build scripts and documentation. - -"Reserved Font Name" refers to any names specified as such after the -copyright statement(s). - -"Original Version" refers to the collection of Font Software components as -distributed by the Copyright Holder(s). - -"Modified Version" refers to any derivative made by adding to, deleting, -or substituting -- in part or in whole -- any of the components of the -Original Version, by changing formats or by porting the Font Software to a -new environment. - -"Author" refers to any designer, engineer, programmer, technical -writer or other person who contributed to the Font Software. - -PERMISSION & CONDITIONS -Permission is hereby granted, free of charge, to any person obtaining -a copy of the Font Software, to use, study, copy, merge, embed, modify, -redistribute, and sell modified and unmodified copies of the Font -Software, subject to the following conditions: - -1) Neither the Font Software nor any of its individual components, -in Original or Modified Versions, may be sold by itself. - -2) Original or Modified Versions of the Font Software may be bundled, -redistributed and/or sold with any software, provided that each copy -contains the above copyright notice and this license. These can be -included either as stand-alone text files, human-readable headers or -in the appropriate machine-readable metadata fields within text or -binary files as long as those fields can be easily viewed by the user. - -3) No Modified Version of the Font Software may use the Reserved Font -Name(s) unless explicit written permission is granted by the corresponding -Copyright Holder. This restriction only applies to the primary font name as -presented to the users. - -4) The name(s) of the Copyright Holder(s) or the Author(s) of the Font -Software shall not be used to promote, endorse or advertise any -Modified Version, except to acknowledge the contribution(s) of the -Copyright Holder(s) and the Author(s) or with their explicit written -permission. - -5) The Font Software, modified or unmodified, in part or in whole, -must be distributed entirely under this license, and must not be -distributed under any other license. The requirement for fonts to -remain under this license does not apply to any document created -using the Font Software. - -TERMINATION -This license becomes null and void if any of the above conditions are -not met. - -DISCLAIMER -THE FONT SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO ANY WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT -OF COPYRIGHT, PATENT, TRADEMARK, OR OTHER RIGHT. IN NO EVENT SHALL THE -COPYRIGHT HOLDER BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, -INCLUDING ANY GENERAL, SPECIAL, INDIRECT, INCIDENTAL, OR CONSEQUENTIAL -DAMAGES, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING -FROM, OUT OF THE USE OR INABILITY TO USE THE FONT SOFTWARE OR FROM -OTHER DEALINGS IN THE FONT SOFTWARE. \ No newline at end of file diff --git a/public/icons/envelope.svg b/public/icons/envelope.svg deleted file mode 100644 index c94bfd7..0000000 --- a/public/icons/envelope.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/facebook.svg b/public/icons/facebook.svg deleted file mode 100644 index 7cdd94e..0000000 --- a/public/icons/facebook.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/flickr.svg b/public/icons/flickr.svg deleted file mode 100644 index ac7667f..0000000 --- a/public/icons/flickr.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/github.svg b/public/icons/github.svg deleted file mode 100644 index 8348350..0000000 --- a/public/icons/github.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/gitlab.svg b/public/icons/gitlab.svg deleted file mode 100644 index c966bc4..0000000 --- a/public/icons/gitlab.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/glitch.svg b/public/icons/glitch.svg deleted file mode 100644 index 5b03854..0000000 --- a/public/icons/glitch.svg +++ /dev/null @@ -1,10 +0,0 @@ - - - - Artboard - Created with Sketch. - - - - - \ No newline at end of file diff --git a/public/icons/keybase.svg b/public/icons/keybase.svg deleted file mode 100644 index 5b4f80b..0000000 --- a/public/icons/keybase.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/linkedin.svg b/public/icons/linkedin.svg deleted file mode 100644 index cd55f45..0000000 --- a/public/icons/linkedin.svg +++ /dev/null @@ -1 +0,0 @@ - diff --git a/public/icons/medium.svg b/public/icons/medium.svg deleted file mode 100644 index 2ad9fb4..0000000 --- a/public/icons/medium.svg +++ /dev/null @@ -1 +0,0 @@ - diff --git a/public/icons/microblog.svg b/public/icons/microblog.svg deleted file mode 100644 index 1435367..0000000 --- a/public/icons/microblog.svg +++ /dev/null @@ -1 +0,0 @@ -Micro.blogBW \ No newline at end of file diff --git a/public/icons/reddit-alien.svg b/public/icons/reddit-alien.svg deleted file mode 100644 index 56b913c..0000000 --- a/public/icons/reddit-alien.svg +++ /dev/null @@ -1,5 +0,0 @@ - - diff --git a/public/icons/stack-overflow.svg b/public/icons/stack-overflow.svg deleted file mode 100644 index 5a6a34e..0000000 --- a/public/icons/stack-overflow.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/tumblr.svg b/public/icons/tumblr.svg deleted file mode 100644 index 68982fc..0000000 --- a/public/icons/tumblr.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/icons/twitter.svg b/public/icons/twitter.svg deleted file mode 100644 index 2633841..0000000 --- a/public/icons/twitter.svg +++ /dev/null @@ -1 +0,0 @@ - \ No newline at end of file diff --git a/public/images/2021/danielle-macinnes-coffee-begin-unsplash.jpg b/public/images/2021/danielle-macinnes-coffee-begin-unsplash.jpg new file mode 100644 index 0000000..efb3064 Binary files /dev/null and b/public/images/2021/danielle-macinnes-coffee-begin-unsplash.jpg differ diff --git a/public/images/2021/danielle-macinnes-coffee-unsplash.jpg b/public/images/2021/danielle-macinnes-coffee-unsplash.jpg new file mode 100644 index 0000000..76e80bf Binary files /dev/null and b/public/images/2021/danielle-macinnes-coffee-unsplash.jpg differ diff --git a/public/images/2021/pleroma-mastofe.png b/public/images/2021/pleroma-mastofe.png deleted file mode 100644 index ab281d0..0000000 Binary files a/public/images/2021/pleroma-mastofe.png and /dev/null differ diff --git a/public/images/landscape.jpg b/public/images/landscape.jpg new file mode 100644 index 0000000..7a39dfe Binary files /dev/null and b/public/images/landscape.jpg differ diff --git a/public/images/profile.jpg b/public/images/profile.jpg new file mode 100644 index 0000000..500b36f Binary files /dev/null and b/public/images/profile.jpg differ diff --git a/public/images/site-feature-image.png b/public/images/site-feature-image.png new file mode 100644 index 0000000..450269e Binary files /dev/null and b/public/images/site-feature-image.png differ diff --git a/public/images/site-logo.svg b/public/images/site-logo.svg deleted file mode 100644 index f7ee96e..0000000 --- a/public/images/site-logo.svg +++ /dev/null @@ -1,12 +0,0 @@ - - - - Combined Shape - Created with Sketch. - - - - - \ No newline at end of file diff --git a/public/index.html b/public/index.html index 14d0271..3e0c8b7 100644 --- a/public/index.html +++ b/public/index.html @@ -1,182 +1,241 @@ - - - - - + + Glenn + - Caffeinated Blog | Caffeinated Blog - - + + - - - - - - - + + + + + + + + + + + + + + + + - - + + + - + + + - - - - + + + + + + - - - -
    - +
    +
    +
    + +
    +
    +
    +
    + + + - - - + + + +
    + +
    +

    Back on the Fediverse +

    +
    +
    +

    A recent post from Alan Pope, Mastodon Instances, Everywhere, reminded me that I also used to run a Mastodon instance back when it was all still new and shiny.

    +
    +
    +
    +
    + + Sun, Feb 14, 2021 + + + +
    +
    +
    +
    + + +
    + +
    + + Thumbnail image + +
    + +
    +

    Online With Hugo +

    +
    +
    +

    As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system.

    +
    +
    +
    +
    + + Tue, Feb 2, 2021 + + blogging + + newbeginnings +
    +
    +
    +
    + + + +
    +
    +
    + + + + + + + + + + diff --git a/public/index.xml b/public/index.xml index ad31c04..3840e51 100644 --- a/public/index.xml +++ b/public/index.xml @@ -1,61 +1,59 @@ + - Caffeinated Blog - https://caffeinated.blog/ - Recent content on Caffeinated Blog + Website of Jane Doe + https://example.com/ + Recent content on Website of Jane Doe Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice + en Sun, 14 Feb 2021 20:47:38 +1000 - + Back on the Fediverse - https://caffeinated.blog/post/2021/02/back-on-the-fediverse/ + https://example.com/post/2021/02/back-on-the-fediverse/ Sun, 14 Feb 2021 20:47:38 +1000 - https://caffeinated.blog/post/2021/02/back-on-the-fediverse/ - <p>A recent post from Alan Pope, <a href="https://popey.com/blog/2021/02/mastodon-instances-everywhere/">Mastodon Instances, Everywhere</a>, reminded me that I also used to run a Mastodon instance back when it was all still new and shiny.</p> -<p>My instance ran for awhile and had a few users and I actually enjoyed being on the network. It was much more civil and discussions seemed friendlier than Twitter. Eventually, I shut my instance down as it took more and more <em>sysadmin time</em>, was quite resource hungry and their updates did not always go smoothly.</p> -<p>Recently, I decided to jump back into the Fediverse and see how many people I could follow there instead of on Twitter. Not surprisingly, most of those in the Linux community are the easiest to find Mastodon accounts for.</p> -<p>To get on the Fediverse, I chose to spin up an instance of <a href="https://pleroma.social/">Pleroma</a> and so far I&rsquo;m liking this. It uses <em>a lot</em> less resources than Mastodon itself, seems easier to keep up-to-date and even has a clone of the Mastodon interface (see <a href="https://git.pleroma.social/pleroma/mastofe">MastoFE</a>).</p> -<p><img src="https://caffeinated.blog/images/2021/pleroma-mastofe.jpg" alt=""></p> -<p>How long will I run it this time? Who knows, but I am enjoying it again and without the stress of running a &ldquo;real&rdquo; Mastodon instance.</p> - + https://example.com/post/2021/02/back-on-the-fediverse/ + A recent post from Alan Pope, Mastodon Instances, Everywhere, reminded me that I also used to run a Mastodon instance back when it was all still new and shiny. Online With Hugo - https://caffeinated.blog/post/2021/02/online-with-hugo/ + https://example.com/post/2021/02/online-with-hugo/ Tue, 02 Feb 2021 22:53:29 +1000 - https://caffeinated.blog/post/2021/02/online-with-hugo/ - <p>As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. I have just spun up a new web host with Apache and Git to automatically pull site changes from the repo and publish them. It&rsquo;s all working beautifully so far.</p> - + https://example.com/post/2021/02/online-with-hugo/ + As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. - About The Theme - https://caffeinated.blog/about/ - Mon, 01 Jan 0001 00:00:00 +0000 + + https://example.com/archives/ + Tue, 28 May 2019 00:00:00 +0000 - https://caffeinated.blog/about/ - <p>Indigo is a lightweight theme for <a href="https://gohugo.io">Hugo</a> with <a href="https://indieweb.org/">IndieWeb</a> features baked in. It&rsquo;s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces.</p> -<p>Read more about the theme <a href="https://caffeinated.blog/post/introducing-indigo">here</a>.</p> - + https://example.com/archives/ + - Adding Page Items - https://caffeinated.blog/adding-menu-items/ - Mon, 01 Jan 0001 00:00:00 +0000 + Contact + https://example.com/contact/ + Fri, 08 Mar 2019 00:00:00 +0000 - https://caffeinated.blog/adding-menu-items/ - <p>Indigo supports adding a simple navigation-style menu items across the top of the site. To do so, simply add a <code>menu: &quot;main&quot;</code> entry in your page&rsquo;s front matter (TOML format shown).</p> -<p>If no date is included in the front matter, then the published date won&rsquo;t be shown (as in this page).</p> - + https://example.com/contact/ + + + + + About + https://example.com/about/ + Thu, 28 Feb 2019 00:00:00 +0000 + + https://example.com/about/ + Written in Go, Hugo is an open source static site generator available under the Apache Licence 2. diff --git a/public/js/anatole-header.min.d8599ee07b7d3f11bafbac30657ccc591e8d7fd36a9f580cd4c09e24e0e4a971.js b/public/js/anatole-header.min.d8599ee07b7d3f11bafbac30657ccc591e8d7fd36a9f580cd4c09e24e0e4a971.js new file mode 100644 index 0000000..0d85904 --- /dev/null +++ b/public/js/anatole-header.min.d8599ee07b7d3f11bafbac30657ccc591e8d7fd36a9f580cd4c09e24e0e4a971.js @@ -0,0 +1 @@ +document.addEventListener("DOMContentLoaded",function(){var $navbarBurgers=Array.prototype.slice.call(document.querySelectorAll(".navbar-burger"),0);if($navbarBurgers.length>0){$navbarBurgers.forEach(function($el){$el.addEventListener("click",function(){var target=$el.dataset.target;var $target=document.getElementById(target);$el.classList.toggle("is-active");$target.classList.toggle("is-active");});});}}); \ No newline at end of file diff --git a/public/js/anatole-theme-switcher.min.e289e9ebb2a4e7a7f895859c8a2b0da2de1ec73f22cea58d8475aa0597023837.js b/public/js/anatole-theme-switcher.min.e289e9ebb2a4e7a7f895859c8a2b0da2de1ec73f22cea58d8475aa0597023837.js new file mode 100644 index 0000000..4c9b6c6 --- /dev/null +++ b/public/js/anatole-theme-switcher.min.e289e9ebb2a4e7a7f895859c8a2b0da2de1ec73f22cea58d8475aa0597023837.js @@ -0,0 +1,5 @@ +function getTheme(){return localStorage.getItem('theme')?localStorage.getItem('theme'):null;} +function setTheme(style){document.documentElement.setAttribute('data-theme',style);localStorage.setItem('theme',style);} +function init(){const theme=getTheme();const userPrefersDark=window.matchMedia&&window.matchMedia('(prefers-color-scheme: dark)').matches;if(theme===null){if(userPrefersDark){setTheme('dark');}else if(!document.documentElement.getAttribute('data-theme')){setTheme('light');}else{setTheme(document.documentElement.getAttribute('data-theme'));}}else{if(theme==='light'){document.documentElement.setAttribute('data-theme','light');}else{document.documentElement.setAttribute('data-theme','dark');}}} +function switchTheme(){const theme=getTheme();if(theme==='light'){setTheme('dark');}else{setTheme('light');}} +document.addEventListener('DOMContentLoaded',function(){const themeSwitcher=document.querySelector('.theme-switch');themeSwitcher.addEventListener('click',switchTheme,false);},false);init(); \ No newline at end of file diff --git a/public/js/bundle.min.0f9c74cb78f13d1f15f33daff4037c70354f98acfbb97a6f61708966675c3cae.js b/public/js/bundle.min.0f9c74cb78f13d1f15f33daff4037c70354f98acfbb97a6f61708966675c3cae.js new file mode 100644 index 0000000..1a7ba2f --- /dev/null +++ b/public/js/bundle.min.0f9c74cb78f13d1f15f33daff4037c70354f98acfbb97a6f61708966675c3cae.js @@ -0,0 +1,68 @@ +/*! +* jQuery Migrate - v3.3.0 - 2020-05-05T01:57Z +* Copyright OpenJS Foundation and other contributors +*/(function(factory){"use strict";if(typeof define==="function"&&define.amd){define(["jquery"],function(jQuery){return factory(jQuery,window);});}else if(typeof module==="object"&&module.exports){module.exports=factory(require("jquery"),window);}else{factory(jQuery,window);}})(function(jQuery,window){"use strict";jQuery.migrateVersion="3.3.0";function compareVersions(v1,v2){var i,rVersionParts=/^(\d+)\.(\d+)\.(\d+)/,v1p=rVersionParts.exec(v1)||[],v2p=rVersionParts.exec(v2)||[];for(i=1;i<=3;i++){if(+v1p[i]>+v2p[i]){return 1;} +if(+v1p[i]<+v2p[i]){return-1;}} +return 0;} +function jQueryVersionSince(version){return compareVersions(jQuery.fn.jquery,version)>=0;} +(function(){if(!window.console||!window.console.log){return;} +if(!jQuery||!jQueryVersionSince("3.0.0")){window.console.log("JQMIGRATE: jQuery 3.0.0+ REQUIRED");} +if(jQuery.migrateWarnings){window.console.log("JQMIGRATE: Migrate plugin loaded multiple times");} +window.console.log("JQMIGRATE: Migrate is installed"+ +(jQuery.migrateMute?"":" with logging active")+ +", version "+jQuery.migrateVersion);})();var warnedAbout={};jQuery.migrateDeduplicateWarnings=true;jQuery.migrateWarnings=[];if(jQuery.migrateTrace===undefined){jQuery.migrateTrace=true;} +jQuery.migrateReset=function(){warnedAbout={};jQuery.migrateWarnings.length=0;};function migrateWarn(msg){var console=window.console;if(!jQuery.migrateDeduplicateWarnings||!warnedAbout[msg]){warnedAbout[msg]=true;jQuery.migrateWarnings.push(msg);if(console&&console.warn&&!jQuery.migrateMute){console.warn("JQMIGRATE: "+msg);if(jQuery.migrateTrace&&console.trace){console.trace();}}}} +function migrateWarnProp(obj,prop,value,msg){Object.defineProperty(obj,prop,{configurable:true,enumerable:true,get:function(){migrateWarn(msg);return value;},set:function(newValue){migrateWarn(msg);value=newValue;}});} +function migrateWarnFunc(obj,prop,newFunc,msg){obj[prop]=function(){migrateWarn(msg);return newFunc.apply(this,arguments);};} +if(window.document.compatMode==="BackCompat"){migrateWarn("jQuery is not compatible with Quirks Mode");} +var findProp,class2type={},oldInit=jQuery.fn.init,oldFind=jQuery.find,rattrHashTest=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/,rattrHashGlob=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/g,rtrim=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;jQuery.fn.init=function(arg1){var args=Array.prototype.slice.call(arguments);if(typeof arg1==="string"&&arg1==="#"){migrateWarn("jQuery( '#' ) is not a valid selector");args[0]=[];} +return oldInit.apply(this,args);};jQuery.fn.init.prototype=jQuery.fn;jQuery.find=function(selector){var args=Array.prototype.slice.call(arguments);if(typeof selector==="string"&&rattrHashTest.test(selector)){try{window.document.querySelector(selector);}catch(err1){selector=selector.replace(rattrHashGlob,function(_,attr,op,value){return "["+attr+op+"\""+value+"\"]";});try{window.document.querySelector(selector);migrateWarn("Attribute selector with '#' must be quoted: "+args[0]);args[0]=selector;}catch(err2){migrateWarn("Attribute selector with '#' was not fixed: "+args[0]);}}} +return oldFind.apply(this,args);};for(findProp in oldFind){if(Object.prototype.hasOwnProperty.call(oldFind,findProp)){jQuery.find[findProp]=oldFind[findProp];}} +migrateWarnFunc(jQuery.fn,"size",function(){return this.length;},"jQuery.fn.size() is deprecated and removed; use the .length property");migrateWarnFunc(jQuery,"parseJSON",function(){return JSON.parse.apply(null,arguments);},"jQuery.parseJSON is deprecated; use JSON.parse");migrateWarnFunc(jQuery,"holdReady",jQuery.holdReady,"jQuery.holdReady is deprecated");migrateWarnFunc(jQuery,"unique",jQuery.uniqueSort,"jQuery.unique is deprecated; use jQuery.uniqueSort");migrateWarnProp(jQuery.expr,"filters",jQuery.expr.pseudos,"jQuery.expr.filters is deprecated; use jQuery.expr.pseudos");migrateWarnProp(jQuery.expr,":",jQuery.expr.pseudos,"jQuery.expr[':'] is deprecated; use jQuery.expr.pseudos");if(jQueryVersionSince("3.1.1")){migrateWarnFunc(jQuery,"trim",function(text){return text==null?"":(text+"").replace(rtrim,"");},"jQuery.trim is deprecated; use String.prototype.trim");} +if(jQueryVersionSince("3.2.0")){migrateWarnFunc(jQuery,"nodeName",function(elem,name){return elem.nodeName&&elem.nodeName.toLowerCase()===name.toLowerCase();},"jQuery.nodeName is deprecated");} +if(jQueryVersionSince("3.3.0")){migrateWarnFunc(jQuery,"isNumeric",function(obj){var type=typeof obj;return(type==="number"||type==="string")&&!isNaN(obj-parseFloat(obj));},"jQuery.isNumeric() is deprecated");jQuery.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(_,name){class2type["[object "+name+"]"]=name.toLowerCase();});migrateWarnFunc(jQuery,"type",function(obj){if(obj==null){return obj+"";} +return typeof obj==="object"||typeof obj==="function"?class2type[Object.prototype.toString.call(obj)]||"object":typeof obj;},"jQuery.type is deprecated");migrateWarnFunc(jQuery,"isFunction",function(obj){return typeof obj==="function";},"jQuery.isFunction() is deprecated");migrateWarnFunc(jQuery,"isWindow",function(obj){return obj!=null&&obj===obj.window;},"jQuery.isWindow() is deprecated");migrateWarnFunc(jQuery,"isArray",Array.isArray,"jQuery.isArray is deprecated; use Array.isArray");} +if(jQuery.ajax){var oldAjax=jQuery.ajax;jQuery.ajax=function(){var jQXHR=oldAjax.apply(this,arguments);if(jQXHR.promise){migrateWarnFunc(jQXHR,"success",jQXHR.done,"jQXHR.success is deprecated and removed");migrateWarnFunc(jQXHR,"error",jQXHR.fail,"jQXHR.error is deprecated and removed");migrateWarnFunc(jQXHR,"complete",jQXHR.always,"jQXHR.complete is deprecated and removed");} +return jQXHR;};} +var oldRemoveAttr=jQuery.fn.removeAttr,oldToggleClass=jQuery.fn.toggleClass,rmatchNonSpace=/\S+/g;jQuery.fn.removeAttr=function(name){var self=this;jQuery.each(name.match(rmatchNonSpace),function(_i,attr){if(jQuery.expr.match.bool.test(attr)){migrateWarn("jQuery.fn.removeAttr no longer sets boolean properties: "+attr);self.prop(attr,false);}});return oldRemoveAttr.apply(this,arguments);};jQuery.fn.toggleClass=function(state){if(state!==undefined&&typeof state!=="boolean"){return oldToggleClass.apply(this,arguments);} +migrateWarn("jQuery.fn.toggleClass( boolean ) is deprecated");return this.each(function(){var className=this.getAttribute&&this.getAttribute("class")||"";if(className){jQuery.data(this,"__className__",className);} +if(this.setAttribute){this.setAttribute("class",className||state===false?"":jQuery.data(this,"__className__")||"");}});};function camelCase(string){return string.replace(/-([a-z])/g,function(_,letter){return letter.toUpperCase();});} +var oldFnCss,internalSwapCall=false,ralphaStart=/^[a-z]/,rautoPx=/^(?:Border(?:Top|Right|Bottom|Left)?(?:Width|)|(?:Margin|Padding)?(?:Top|Right|Bottom|Left)?|(?:Min|Max)?(?:Width|Height))$/;if(jQuery.swap){jQuery.each(["height","width","reliableMarginRight"],function(_,name){var oldHook=jQuery.cssHooks[name]&&jQuery.cssHooks[name].get;if(oldHook){jQuery.cssHooks[name].get=function(){var ret;internalSwapCall=true;ret=oldHook.apply(this,arguments);internalSwapCall=false;return ret;};}});} +jQuery.swap=function(elem,options,callback,args){var ret,name,old={};if(!internalSwapCall){migrateWarn("jQuery.swap() is undocumented and deprecated");} +for(name in options){old[name]=elem.style[name];elem.style[name]=options[name];} +ret=callback.apply(elem,args||[]);for(name in options){elem.style[name]=old[name];} +return ret;};if(jQueryVersionSince("3.4.0")&&typeof Proxy!=="undefined"){jQuery.cssProps=new Proxy(jQuery.cssProps||{},{set:function(){migrateWarn("JQMIGRATE: jQuery.cssProps is deprecated");return Reflect.set.apply(this,arguments);}});} +if(!jQuery.cssNumber){jQuery.cssNumber={};} +function isAutoPx(prop){return ralphaStart.test(prop)&&rautoPx.test(prop[0].toUpperCase()+prop.slice(1));} +oldFnCss=jQuery.fn.css;jQuery.fn.css=function(name,value){var origThis=this;if(typeof name!=="string"){jQuery.each(name,function(n,v){jQuery.fn.css.call(origThis,n,v);});} +if(typeof value==="number"&&!isAutoPx(camelCase(name))){migrateWarn("Use of number-typed values is deprecated in jQuery.fn.css");} +return oldFnCss.apply(this,arguments);};var oldData=jQuery.data;jQuery.data=function(elem,name,value){var curData,sameKeys,key;if(name&&typeof name==="object"&&arguments.length===2){curData=jQuery.hasData(elem)&&oldData.call(this,elem);sameKeys={};for(key in name){if(key!==camelCase(key)){migrateWarn("jQuery.data() always sets/gets camelCased names: "+key);curData[key]=name[key];}else{sameKeys[key]=name[key];}} +oldData.call(this,elem,sameKeys);return name;} +if(name&&typeof name==="string"&&name!==camelCase(name)){curData=jQuery.hasData(elem)&&oldData.call(this,elem);if(curData&&name in curData){migrateWarn("jQuery.data() always sets/gets camelCased names: "+name);if(arguments.length>2){curData[name]=value;} +return curData[name];}} +return oldData.apply(this,arguments);};if(jQuery.fx){var intervalValue,intervalMsg,oldTweenRun=jQuery.Tween.prototype.run,linearEasing=function(pct){return pct;};jQuery.Tween.prototype.run=function(){if(jQuery.easing[this.easing].length>1){migrateWarn("'jQuery.easing."+this.easing.toString()+"' should use only one argument");jQuery.easing[this.easing]=linearEasing;} +oldTweenRun.apply(this,arguments);};intervalValue=jQuery.fx.interval||13;intervalMsg="jQuery.fx.interval is deprecated";if(window.requestAnimationFrame){Object.defineProperty(jQuery.fx,"interval",{configurable:true,enumerable:true,get:function(){if(!window.document.hidden){migrateWarn(intervalMsg);} +return intervalValue;},set:function(newValue){migrateWarn(intervalMsg);intervalValue=newValue;}});}} +var oldLoad=jQuery.fn.load,oldEventAdd=jQuery.event.add,originalFix=jQuery.event.fix;jQuery.event.props=[];jQuery.event.fixHooks={};migrateWarnProp(jQuery.event.props,"concat",jQuery.event.props.concat,"jQuery.event.props.concat() is deprecated and removed");jQuery.event.fix=function(originalEvent){var event,type=originalEvent.type,fixHook=this.fixHooks[type],props=jQuery.event.props;if(props.length){migrateWarn("jQuery.event.props are deprecated and removed: "+props.join());while(props.length){jQuery.event.addProp(props.pop());}} +if(fixHook&&!fixHook._migrated_){fixHook._migrated_=true;migrateWarn("jQuery.event.fixHooks are deprecated and removed: "+type);if((props=fixHook.props)&&props.length){while(props.length){jQuery.event.addProp(props.pop());}}} +event=originalFix.call(this,originalEvent);return fixHook&&fixHook.filter?fixHook.filter(event,originalEvent):event;};jQuery.event.add=function(elem,types){if(elem===window&&types==="load"&&window.document.readyState==="complete"){migrateWarn("jQuery(window).on('load'...) called after load event occurred");} +return oldEventAdd.apply(this,arguments);};jQuery.each(["load","unload","error"],function(_,name){jQuery.fn[name]=function(){var args=Array.prototype.slice.call(arguments,0);if(name==="load"&&typeof args[0]==="string"){return oldLoad.apply(this,args);} +migrateWarn("jQuery.fn."+name+"() is deprecated");args.splice(0,0,name);if(arguments.length){return this.on.apply(this,args);} +this.triggerHandler.apply(this,args);return this;};});jQuery.each(("blur focus focusin focusout resize scroll click dblclick "+ +"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave "+ +"change select submit keydown keypress keyup contextmenu").split(" "),function(_i,name){jQuery.fn[name]=function(data,fn){migrateWarn("jQuery.fn."+name+"() event shorthand is deprecated");return arguments.length>0?this.on(name,null,data,fn):this.trigger(name);};});jQuery(function(){jQuery(window.document).triggerHandler("ready");});jQuery.event.special.ready={setup:function(){if(this===window.document){migrateWarn("'ready' event is deprecated");}}};jQuery.fn.extend({bind:function(types,data,fn){migrateWarn("jQuery.fn.bind() is deprecated");return this.on(types,null,data,fn);},unbind:function(types,fn){migrateWarn("jQuery.fn.unbind() is deprecated");return this.off(types,null,fn);},delegate:function(selector,types,data,fn){migrateWarn("jQuery.fn.delegate() is deprecated");return this.on(types,selector,data,fn);},undelegate:function(selector,types,fn){migrateWarn("jQuery.fn.undelegate() is deprecated");return arguments.length===1?this.off(selector,"**"):this.off(types,selector||"**",fn);},hover:function(fnOver,fnOut){migrateWarn("jQuery.fn.hover() is deprecated");return this.on("mouseenter",fnOver).on("mouseleave",fnOut||fnOver);}});var rxhtmlTag=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,origHtmlPrefilter=jQuery.htmlPrefilter,makeMarkup=function(html){var doc=window.document.implementation.createHTMLDocument("");doc.body.innerHTML=html;return doc.body&&doc.body.innerHTML;},warnIfChanged=function(html){var changed=html.replace(rxhtmlTag,"<$1>");if(changed!==html&&makeMarkup(html)!==makeMarkup(changed)){migrateWarn("HTML tags must be properly nested and closed: "+html);}};jQuery.UNSAFE_restoreLegacyHtmlPrefilter=function(){jQuery.htmlPrefilter=function(html){warnIfChanged(html);return html.replace(rxhtmlTag,"<$1>");};};jQuery.htmlPrefilter=function(html){warnIfChanged(html);return origHtmlPrefilter(html);};var oldOffset=jQuery.fn.offset;jQuery.fn.offset=function(){var docElem,elem=this[0],bogus={top:0,left:0};if(!elem||!elem.nodeType){migrateWarn("jQuery.fn.offset() requires a valid DOM element");return undefined;} +docElem=(elem.ownerDocument||window.document).documentElement;if(!jQuery.contains(docElem,elem)){migrateWarn("jQuery.fn.offset() requires an element connected to a document");return bogus;} +return oldOffset.apply(this,arguments);};if(jQuery.ajax){var oldParam=jQuery.param;jQuery.param=function(data,traditional){var ajaxTraditional=jQuery.ajaxSettings&&jQuery.ajaxSettings.traditional;if(traditional===undefined&&ajaxTraditional){migrateWarn("jQuery.param() no longer uses jQuery.ajaxSettings.traditional");traditional=ajaxTraditional;} +return oldParam.call(this,data,traditional);};} +var oldSelf=jQuery.fn.andSelf||jQuery.fn.addBack;jQuery.fn.andSelf=function(){migrateWarn("jQuery.fn.andSelf() is deprecated and removed, use jQuery.fn.addBack()");return oldSelf.apply(this,arguments);};if(jQuery.Deferred){var oldDeferred=jQuery.Deferred,tuples=[["resolve","done",jQuery.Callbacks("once memory"),jQuery.Callbacks("once memory"),"resolved"],["reject","fail",jQuery.Callbacks("once memory"),jQuery.Callbacks("once memory"),"rejected"],["notify","progress",jQuery.Callbacks("memory"),jQuery.Callbacks("memory")]];jQuery.Deferred=function(func){var deferred=oldDeferred(),promise=deferred.promise();deferred.pipe=promise.pipe=function(){var fns=arguments;migrateWarn("deferred.pipe() is deprecated");return jQuery.Deferred(function(newDefer){jQuery.each(tuples,function(i,tuple){var fn=typeof fns[i]==="function"&&fns[i];deferred[tuple[1]](function(){var returned=fn&&fn.apply(this,arguments);if(returned&&typeof returned.promise==="function"){returned.promise().done(newDefer.resolve).fail(newDefer.reject).progress(newDefer.notify);}else{newDefer[tuple[0]+"With"](this===promise?newDefer.promise():this,fn?[returned]:arguments);}});});fns=null;}).promise();};if(func){func.call(deferred,deferred);} +return deferred;};jQuery.Deferred.exceptionHook=oldDeferred.exceptionHook;} +return jQuery;});;(function($){var selectors=[];var check_binded=false;var check_lock=false;var defaults={interval:250,force_process:false};var $window=$(window);var $prior_appeared=[];function appeared(selector){return $(selector).filter(function(){return $(this).is(':appeared');});} +function process(){check_lock=false;for(var index=0,selectorsLength=selectors.length;index=window_top&&top-($element.data('appear-top-offset')||0)<=window_top+$window.height()&&left+$element.width()>=window_left&&left-($element.data('appear-left-offset')||0)<=window_left+$window.width()){return true;}else{return false;}};});$.fn.extend({appear:function(selector,options){$.appear(this,options);return this;}});$.extend({appear:function(selector,options){var opts=$.extend({},defaults,options||{});if(!check_binded){var on_check=function(){if(check_lock){return;} +check_lock=true;setTimeout(process,opts.interval);};$(window).scroll(on_check).resize(on_check);check_binded=true;} +if(opts.force_process){setTimeout(process,opts.interval);} +add_selector(selector);},force_appear:function(){if(check_binded){process();return true;} +return false;}});})(function(){if(typeof module!=='undefined'){return require('jquery');}else{return jQuery;}}()); \ No newline at end of file diff --git a/public/js/jquery.min.86b1e8f819ee2d9099a783e50b49dff24282545fc40773861f9126b921532e4c.js b/public/js/jquery.min.86b1e8f819ee2d9099a783e50b49dff24282545fc40773861f9126b921532e4c.js new file mode 100644 index 0000000..f627c05 --- /dev/null +++ b/public/js/jquery.min.86b1e8f819ee2d9099a783e50b49dff24282545fc40773861f9126b921532e4c.js @@ -0,0 +1,719 @@ +/*! +* jQuery JavaScript Library v3.5.1 +* https://jquery.com/ +* +* Includes Sizzle.js +* https://sizzlejs.com/ +* +* Copyright JS Foundation and other contributors +* Released under the MIT license +* https://jquery.org/license +* +* Date: 2020-05-04T22:49Z +*/(function(global,factory){"use strict";if(typeof module==="object"&&typeof module.exports==="object"){module.exports=global.document?factory(global,true):function(w){if(!w.document){throw new Error("jQuery requires a window with a document");} +return factory(w);};}else{factory(global);}})(typeof window!=="undefined"?window:this,function(window,noGlobal){"use strict";var arr=[];var getProto=Object.getPrototypeOf;var slice=arr.slice;var flat=arr.flat?function(array){return arr.flat.call(array);}:function(array){return arr.concat.apply([],array);};var push=arr.push;var indexOf=arr.indexOf;var class2type={};var toString=class2type.toString;var hasOwn=class2type.hasOwnProperty;var fnToString=hasOwn.toString;var ObjectFunctionString=fnToString.call(Object);var support={};var isFunction=function isFunction(obj){return typeof obj==="function"&&typeof obj.nodeType!=="number";};var isWindow=function isWindow(obj){return obj!=null&&obj===obj.window;};var document=window.document;var preservedScriptAttributes={type:true,src:true,nonce:true,noModule:true};function DOMEval(code,node,doc){doc=doc||document;var i,val,script=doc.createElement("script");script.text=code;if(node){for(i in preservedScriptAttributes){val=node[i]||node.getAttribute&&node.getAttribute(i);if(val){script.setAttribute(i,val);}}} +doc.head.appendChild(script).parentNode.removeChild(script);} +function toType(obj){if(obj==null){return obj+"";} +return typeof obj==="object"||typeof obj==="function"?class2type[toString.call(obj)]||"object":typeof obj;} +var +version="3.5.1",jQuery=function(selector,context){return new jQuery.fn.init(selector,context);};jQuery.fn=jQuery.prototype={jquery:version,constructor:jQuery,length:0,toArray:function(){return slice.call(this);},get:function(num){if(num==null){return slice.call(this);} +return num<0?this[num+this.length]:this[num];},pushStack:function(elems){var ret=jQuery.merge(this.constructor(),elems);ret.prevObject=this;return ret;},each:function(callback){return jQuery.each(this,callback);},map:function(callback){return this.pushStack(jQuery.map(this,function(elem,i){return callback.call(elem,i,elem);}));},slice:function(){return this.pushStack(slice.apply(this,arguments));},first:function(){return this.eq(0);},last:function(){return this.eq(-1);},even:function(){return this.pushStack(jQuery.grep(this,function(_elem,i){return(i+1)%2;}));},odd:function(){return this.pushStack(jQuery.grep(this,function(_elem,i){return i%2;}));},eq:function(i){var len=this.length,j=+i+(i<0?len:0);return this.pushStack(j>=0&&j0&&(length-1)in obj;} +var Sizzle=/*! +* Sizzle CSS Selector Engine v2.3.5 +* https://sizzlejs.com/ +* +* Copyright JS Foundation and other contributors +* Released under the MIT license +* https://js.foundation/ +* +* Date: 2020-03-14 +*/(function(window){var i,support,Expr,getText,isXML,tokenize,compile,select,outermostContext,sortInput,hasDuplicate,setDocument,document,docElem,documentIsHTML,rbuggyQSA,rbuggyMatches,matches,contains,expando="sizzle"+1*new Date(),preferredDoc=window.document,dirruns=0,done=0,classCache=createCache(),tokenCache=createCache(),compilerCache=createCache(),nonnativeSelectorCache=createCache(),sortOrder=function(a,b){if(a===b){hasDuplicate=true;} +return 0;},hasOwn=({}).hasOwnProperty,arr=[],pop=arr.pop,pushNative=arr.push,push=arr.push,slice=arr.slice,indexOf=function(list,elem){var i=0,len=list.length;for(;i+~]|"+whitespace+")"+whitespace+ +"*"),rdescend=new RegExp(whitespace+"|>"),rpseudo=new RegExp(pseudos),ridentifier=new RegExp("^"+identifier+"$"),matchExpr={"ID":new RegExp("^#("+identifier+")"),"CLASS":new RegExp("^\\.("+identifier+")"),"TAG":new RegExp("^("+identifier+"|[*])"),"ATTR":new RegExp("^"+attributes),"PSEUDO":new RegExp("^"+pseudos),"CHILD":new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+ +whitespace+"*(even|odd|(([+-]|)(\\d*)n|)"+whitespace+"*(?:([+-]|)"+ +whitespace+"*(\\d+)|))"+whitespace+"*\\)|)","i"),"bool":new RegExp("^(?:"+booleans+")$","i"),"needsContext":new RegExp("^"+whitespace+ +"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+whitespace+ +"*((?:-\\d)?\\d*)"+whitespace+"*\\)|)(?=[^-]|$)","i")},rhtml=/HTML$/i,rinputs=/^(?:input|select|textarea|button)$/i,rheader=/^h\d$/i,rnative=/^[^{]+\{\s*\[native \w/,rquickExpr=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,rsibling=/[+~]/,runescape=new RegExp("\\\\[\\da-fA-F]{1,6}"+whitespace+"?|\\\\([^\\r\\n\\f])","g"),funescape=function(escape,nonHex){var high="0x"+escape.slice(1)-0x10000;return nonHex?nonHex:high<0?String.fromCharCode(high+0x10000):String.fromCharCode(high>>10|0xD800,high&0x3FF|0xDC00);},rcssescape=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,fcssescape=function(ch,asCodePoint){if(asCodePoint){if(ch==="\0"){return "\uFFFD";} +return ch.slice(0,-1)+"\\"+ +ch.charCodeAt(ch.length-1).toString(16)+" ";} +return "\\"+ch;},unloadHandler=function(){setDocument();},inDisabledFieldset=addCombinator(function(elem){return elem.disabled===true&&elem.nodeName.toLowerCase()==="fieldset";},{dir:"parentNode",next:"legend"});try{push.apply((arr=slice.call(preferredDoc.childNodes)),preferredDoc.childNodes);arr[preferredDoc.childNodes.length].nodeType;}catch(e){push={apply:arr.length?function(target,els){pushNative.apply(target,slice.call(els));}:function(target,els){var j=target.length,i=0;while((target[j++]=els[i++])){} +target.length=j-1;}};} +function Sizzle(selector,context,results,seed){var m,i,elem,nid,match,groups,newSelector,newContext=context&&context.ownerDocument,nodeType=context?context.nodeType:9;results=results||[];if(typeof selector!=="string"||!selector||nodeType!==1&&nodeType!==9&&nodeType!==11){return results;} +if(!seed){setDocument(context);context=context||document;if(documentIsHTML){if(nodeType!==11&&(match=rquickExpr.exec(selector))){if((m=match[1])){if(nodeType===9){if((elem=context.getElementById(m))){if(elem.id===m){results.push(elem);return results;}}else{return results;}}else{if(newContext&&(elem=newContext.getElementById(m))&&contains(context,elem)&&elem.id===m){results.push(elem);return results;}}}else if(match[2]){push.apply(results,context.getElementsByTagName(selector));return results;}else if((m=match[3])&&support.getElementsByClassName&&context.getElementsByClassName){push.apply(results,context.getElementsByClassName(m));return results;}} +if(support.qsa&&!nonnativeSelectorCache[selector+" "]&&(!rbuggyQSA||!rbuggyQSA.test(selector))&&(nodeType!==1||context.nodeName.toLowerCase()!=="object")){newSelector=selector;newContext=context;if(nodeType===1&&(rdescend.test(selector)||rcombinators.test(selector))){newContext=rsibling.test(selector)&&testContext(context.parentNode)||context;if(newContext!==context||!support.scope){if((nid=context.getAttribute("id"))){nid=nid.replace(rcssescape,fcssescape);}else{context.setAttribute("id",(nid=expando));}} +groups=tokenize(selector);i=groups.length;while(i--){groups[i]=(nid?"#"+nid:":scope")+" "+ +toSelector(groups[i]);} +newSelector=groups.join(",");} +try{push.apply(results,newContext.querySelectorAll(newSelector));return results;}catch(qsaError){nonnativeSelectorCache(selector,true);}finally{if(nid===expando){context.removeAttribute("id");}}}}} +return select(selector.replace(rtrim,"$1"),context,results,seed);} +function createCache(){var keys=[];function cache(key,value){if(keys.push(key+" ")>Expr.cacheLength){delete cache[keys.shift()];} +return(cache[key+" "]=value);} +return cache;} +function markFunction(fn){fn[expando]=true;return fn;} +function assert(fn){var el=document.createElement("fieldset");try{return!!fn(el);}catch(e){return false;}finally{if(el.parentNode){el.parentNode.removeChild(el);} +el=null;}} +function addHandle(attrs,handler){var arr=attrs.split("|"),i=arr.length;while(i--){Expr.attrHandle[arr[i]]=handler;}} +function siblingCheck(a,b){var cur=b&&a,diff=cur&&a.nodeType===1&&b.nodeType===1&&a.sourceIndex-b.sourceIndex;if(diff){return diff;} +if(cur){while((cur=cur.nextSibling)){if(cur===b){return-1;}}} +return a?1:-1;} +function createInputPseudo(type){return function(elem){var name=elem.nodeName.toLowerCase();return name==="input"&&elem.type===type;};} +function createButtonPseudo(type){return function(elem){var name=elem.nodeName.toLowerCase();return(name==="input"||name==="button")&&elem.type===type;};} +function createDisabledPseudo(disabled){return function(elem){if("form"in elem){if(elem.parentNode&&elem.disabled===false){if("label"in elem){if("label"in elem.parentNode){return elem.parentNode.disabled===disabled;}else{return elem.disabled===disabled;}} +return elem.isDisabled===disabled||elem.isDisabled!==!disabled&&inDisabledFieldset(elem)===disabled;} +return elem.disabled===disabled;}else if("label"in elem){return elem.disabled===disabled;} +return false;};} +function createPositionalPseudo(fn){return markFunction(function(argument){argument=+argument;return markFunction(function(seed,matches){var j,matchIndexes=fn([],seed.length,argument),i=matchIndexes.length;while(i--){if(seed[(j=matchIndexes[i])]){seed[j]=!(matches[j]=seed[j]);}}});});} +function testContext(context){return context&&typeof context.getElementsByTagName!=="undefined"&&context;} +support=Sizzle.support={};isXML=Sizzle.isXML=function(elem){var namespace=elem.namespaceURI,docElem=(elem.ownerDocument||elem).documentElement;return!rhtml.test(namespace||docElem&&docElem.nodeName||"HTML");};setDocument=Sizzle.setDocument=function(node){var hasCompare,subWindow,doc=node?node.ownerDocument||node:preferredDoc;if(doc==document||doc.nodeType!==9||!doc.documentElement){return document;} +document=doc;docElem=document.documentElement;documentIsHTML=!isXML(document);if(preferredDoc!=document&&(subWindow=document.defaultView)&&subWindow.top!==subWindow){if(subWindow.addEventListener){subWindow.addEventListener("unload",unloadHandler,false);}else if(subWindow.attachEvent){subWindow.attachEvent("onunload",unloadHandler);}} +support.scope=assert(function(el){docElem.appendChild(el).appendChild(document.createElement("div"));return typeof el.querySelectorAll!=="undefined"&&!el.querySelectorAll(":scope fieldset div").length;});support.attributes=assert(function(el){el.className="i";return!el.getAttribute("className");});support.getElementsByTagName=assert(function(el){el.appendChild(document.createComment(""));return!el.getElementsByTagName("*").length;});support.getElementsByClassName=rnative.test(document.getElementsByClassName);support.getById=assert(function(el){docElem.appendChild(el).id=expando;return!document.getElementsByName||!document.getElementsByName(expando).length;});if(support.getById){Expr.filter["ID"]=function(id){var attrId=id.replace(runescape,funescape);return function(elem){return elem.getAttribute("id")===attrId;};};Expr.find["ID"]=function(id,context){if(typeof context.getElementById!=="undefined"&&documentIsHTML){var elem=context.getElementById(id);return elem?[elem]:[];}};}else{Expr.filter["ID"]=function(id){var attrId=id.replace(runescape,funescape);return function(elem){var node=typeof elem.getAttributeNode!=="undefined"&&elem.getAttributeNode("id");return node&&node.value===attrId;};};Expr.find["ID"]=function(id,context){if(typeof context.getElementById!=="undefined"&&documentIsHTML){var node,i,elems,elem=context.getElementById(id);if(elem){node=elem.getAttributeNode("id");if(node&&node.value===id){return[elem];} +elems=context.getElementsByName(id);i=0;while((elem=elems[i++])){node=elem.getAttributeNode("id");if(node&&node.value===id){return[elem];}}} +return[];}};} +Expr.find["TAG"]=support.getElementsByTagName?function(tag,context){if(typeof context.getElementsByTagName!=="undefined"){return context.getElementsByTagName(tag);}else if(support.qsa){return context.querySelectorAll(tag);}}:function(tag,context){var elem,tmp=[],i=0,results=context.getElementsByTagName(tag);if(tag==="*"){while((elem=results[i++])){if(elem.nodeType===1){tmp.push(elem);}} +return tmp;} +return results;};Expr.find["CLASS"]=support.getElementsByClassName&&function(className,context){if(typeof context.getElementsByClassName!=="undefined"&&documentIsHTML){return context.getElementsByClassName(className);}};rbuggyMatches=[];rbuggyQSA=[];if((support.qsa=rnative.test(document.querySelectorAll))){assert(function(el){var input;docElem.appendChild(el).innerHTML=""+ +"";if(el.querySelectorAll("[msallowcapture^='']").length){rbuggyQSA.push("[*^$]="+whitespace+"*(?:''|\"\")");} +if(!el.querySelectorAll("[selected]").length){rbuggyQSA.push("\\["+whitespace+"*(?:value|"+booleans+")");} +if(!el.querySelectorAll("[id~="+expando+"-]").length){rbuggyQSA.push("~=");} +input=document.createElement("input");input.setAttribute("name","");el.appendChild(input);if(!el.querySelectorAll("[name='']").length){rbuggyQSA.push("\\["+whitespace+"*name"+whitespace+"*="+ +whitespace+"*(?:''|\"\")");} +if(!el.querySelectorAll(":checked").length){rbuggyQSA.push(":checked");} +if(!el.querySelectorAll("a#"+expando+"+*").length){rbuggyQSA.push(".#.+[+~]");} +el.querySelectorAll("\\\f");rbuggyQSA.push("[\\r\\n\\f]");});assert(function(el){el.innerHTML=""+ +"";var input=document.createElement("input");input.setAttribute("type","hidden");el.appendChild(input).setAttribute("name","D");if(el.querySelectorAll("[name=d]").length){rbuggyQSA.push("name"+whitespace+"*[*^$|!~]?=");} +if(el.querySelectorAll(":enabled").length!==2){rbuggyQSA.push(":enabled",":disabled");} +docElem.appendChild(el).disabled=true;if(el.querySelectorAll(":disabled").length!==2){rbuggyQSA.push(":enabled",":disabled");} +el.querySelectorAll("*,:x");rbuggyQSA.push(",.*:");});} +if((support.matchesSelector=rnative.test((matches=docElem.matches||docElem.webkitMatchesSelector||docElem.mozMatchesSelector||docElem.oMatchesSelector||docElem.msMatchesSelector)))){assert(function(el){support.disconnectedMatch=matches.call(el,"*");matches.call(el,"[s!='']:x");rbuggyMatches.push("!=",pseudos);});} +rbuggyQSA=rbuggyQSA.length&&new RegExp(rbuggyQSA.join("|"));rbuggyMatches=rbuggyMatches.length&&new RegExp(rbuggyMatches.join("|"));hasCompare=rnative.test(docElem.compareDocumentPosition);contains=hasCompare||rnative.test(docElem.contains)?function(a,b){var adown=a.nodeType===9?a.documentElement:a,bup=b&&b.parentNode;return a===bup||!!(bup&&bup.nodeType===1&&(adown.contains?adown.contains(bup):a.compareDocumentPosition&&a.compareDocumentPosition(bup)&16));}:function(a,b){if(b){while((b=b.parentNode)){if(b===a){return true;}}} +return false;};sortOrder=hasCompare?function(a,b){if(a===b){hasDuplicate=true;return 0;} +var compare=!a.compareDocumentPosition-!b.compareDocumentPosition;if(compare){return compare;} +compare=(a.ownerDocument||a)==(b.ownerDocument||b)?a.compareDocumentPosition(b):1;if(compare&1||(!support.sortDetached&&b.compareDocumentPosition(a)===compare)){if(a==document||a.ownerDocument==preferredDoc&&contains(preferredDoc,a)){return-1;} +if(b==document||b.ownerDocument==preferredDoc&&contains(preferredDoc,b)){return 1;} +return sortInput?(indexOf(sortInput,a)-indexOf(sortInput,b)):0;} +return compare&4?-1:1;}:function(a,b){if(a===b){hasDuplicate=true;return 0;} +var cur,i=0,aup=a.parentNode,bup=b.parentNode,ap=[a],bp=[b];if(!aup||!bup){return a==document?-1:b==document?1:aup?-1:bup?1:sortInput?(indexOf(sortInput,a)-indexOf(sortInput,b)):0;}else if(aup===bup){return siblingCheck(a,b);} +cur=a;while((cur=cur.parentNode)){ap.unshift(cur);} +cur=b;while((cur=cur.parentNode)){bp.unshift(cur);} +while(ap[i]===bp[i]){i++;} +return i?siblingCheck(ap[i],bp[i]):ap[i]==preferredDoc?-1:bp[i]==preferredDoc?1:0;};return document;};Sizzle.matches=function(expr,elements){return Sizzle(expr,null,null,elements);};Sizzle.matchesSelector=function(elem,expr){setDocument(elem);if(support.matchesSelector&&documentIsHTML&&!nonnativeSelectorCache[expr+" "]&&(!rbuggyMatches||!rbuggyMatches.test(expr))&&(!rbuggyQSA||!rbuggyQSA.test(expr))){try{var ret=matches.call(elem,expr);if(ret||support.disconnectedMatch||elem.document&&elem.document.nodeType!==11){return ret;}}catch(e){nonnativeSelectorCache(expr,true);}} +return Sizzle(expr,document,null,[elem]).length>0;};Sizzle.contains=function(context,elem){if((context.ownerDocument||context)!=document){setDocument(context);} +return contains(context,elem);};Sizzle.attr=function(elem,name){if((elem.ownerDocument||elem)!=document){setDocument(elem);} +var fn=Expr.attrHandle[name.toLowerCase()],val=fn&&hasOwn.call(Expr.attrHandle,name.toLowerCase())?fn(elem,name,!documentIsHTML):undefined;return val!==undefined?val:support.attributes||!documentIsHTML?elem.getAttribute(name):(val=elem.getAttributeNode(name))&&val.specified?val.value:null;};Sizzle.escape=function(sel){return(sel+"").replace(rcssescape,fcssescape);};Sizzle.error=function(msg){throw new Error("Syntax error, unrecognized expression: "+msg);};Sizzle.uniqueSort=function(results){var elem,duplicates=[],j=0,i=0;hasDuplicate=!support.detectDuplicates;sortInput=!support.sortStable&&results.slice(0);results.sort(sortOrder);if(hasDuplicate){while((elem=results[i++])){if(elem===results[i]){j=duplicates.push(i);}} +while(j--){results.splice(duplicates[j],1);}} +sortInput=null;return results;};getText=Sizzle.getText=function(elem){var node,ret="",i=0,nodeType=elem.nodeType;if(!nodeType){while((node=elem[i++])){ret+=getText(node);}}else if(nodeType===1||nodeType===9||nodeType===11){if(typeof elem.textContent==="string"){return elem.textContent;}else{for(elem=elem.firstChild;elem;elem=elem.nextSibling){ret+=getText(elem);}}}else if(nodeType===3||nodeType===4){return elem.nodeValue;} +return ret;};Expr=Sizzle.selectors={cacheLength:50,createPseudo:markFunction,match:matchExpr,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:true}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:true},"~":{dir:"previousSibling"}},preFilter:{"ATTR":function(match){match[1]=match[1].replace(runescape,funescape);match[3]=(match[3]||match[4]||match[5]||"").replace(runescape,funescape);if(match[2]==="~="){match[3]=" "+match[3]+" ";} +return match.slice(0,4);},"CHILD":function(match){match[1]=match[1].toLowerCase();if(match[1].slice(0,3)==="nth"){if(!match[3]){Sizzle.error(match[0]);} +match[4]=+(match[4]?match[5]+(match[6]||1):2*(match[3]==="even"||match[3]==="odd"));match[5]=+((match[7]+match[8])||match[3]==="odd");}else if(match[3]){Sizzle.error(match[0]);} +return match;},"PSEUDO":function(match){var excess,unquoted=!match[6]&&match[2];if(matchExpr["CHILD"].test(match[0])){return null;} +if(match[3]){match[2]=match[4]||match[5]||"";}else if(unquoted&&rpseudo.test(unquoted)&&(excess=tokenize(unquoted,true))&&(excess=unquoted.indexOf(")",unquoted.length-excess)-unquoted.length)){match[0]=match[0].slice(0,excess);match[2]=unquoted.slice(0,excess);} +return match.slice(0,3);}},filter:{"TAG":function(nodeNameSelector){var nodeName=nodeNameSelector.replace(runescape,funescape).toLowerCase();return nodeNameSelector==="*"?function(){return true;}:function(elem){return elem.nodeName&&elem.nodeName.toLowerCase()===nodeName;};},"CLASS":function(className){var pattern=classCache[className+" "];return pattern||(pattern=new RegExp("(^|"+whitespace+ +")"+className+"("+whitespace+"|$)"))&&classCache(className,function(elem){return pattern.test(typeof elem.className==="string"&&elem.className||typeof elem.getAttribute!=="undefined"&&elem.getAttribute("class")||"");});},"ATTR":function(name,operator,check){return function(elem){var result=Sizzle.attr(elem,name);if(result==null){return operator==="!=";} +if(!operator){return true;} +result+="";return operator==="="?result===check:operator==="!="?result!==check:operator==="^="?check&&result.indexOf(check)===0:operator==="*="?check&&result.indexOf(check)>-1:operator==="$="?check&&result.slice(-check.length)===check:operator==="~="?(" "+result.replace(rwhitespace," ")+" ").indexOf(check)>-1:operator==="|="?result===check||result.slice(0,check.length+1)===check+"-":false;};},"CHILD":function(type,what,_argument,first,last){var simple=type.slice(0,3)!=="nth",forward=type.slice(-4)!=="last",ofType=what==="of-type";return first===1&&last===0?function(elem){return!!elem.parentNode;}:function(elem,_context,xml){var cache,uniqueCache,outerCache,node,nodeIndex,start,dir=simple!==forward?"nextSibling":"previousSibling",parent=elem.parentNode,name=ofType&&elem.nodeName.toLowerCase(),useCache=!xml&&!ofType,diff=false;if(parent){if(simple){while(dir){node=elem;while((node=node[dir])){if(ofType?node.nodeName.toLowerCase()===name:node.nodeType===1){return false;}} +start=dir=type==="only"&&!start&&"nextSibling";} +return true;} +start=[forward?parent.firstChild:parent.lastChild];if(forward&&useCache){node=parent;outerCache=node[expando]||(node[expando]={});uniqueCache=outerCache[node.uniqueID]||(outerCache[node.uniqueID]={});cache=uniqueCache[type]||[];nodeIndex=cache[0]===dirruns&&cache[1];diff=nodeIndex&&cache[2];node=nodeIndex&&parent.childNodes[nodeIndex];while((node=++nodeIndex&&node&&node[dir]||(diff=nodeIndex=0)||start.pop())){if(node.nodeType===1&&++diff&&node===elem){uniqueCache[type]=[dirruns,nodeIndex,diff];break;}}}else{if(useCache){node=elem;outerCache=node[expando]||(node[expando]={});uniqueCache=outerCache[node.uniqueID]||(outerCache[node.uniqueID]={});cache=uniqueCache[type]||[];nodeIndex=cache[0]===dirruns&&cache[1];diff=nodeIndex;} +if(diff===false){while((node=++nodeIndex&&node&&node[dir]||(diff=nodeIndex=0)||start.pop())){if((ofType?node.nodeName.toLowerCase()===name:node.nodeType===1)&&++diff){if(useCache){outerCache=node[expando]||(node[expando]={});uniqueCache=outerCache[node.uniqueID]||(outerCache[node.uniqueID]={});uniqueCache[type]=[dirruns,diff];} +if(node===elem){break;}}}}} +diff-=last;return diff===first||(diff%first===0&&diff/first>=0);}};},"PSEUDO":function(pseudo,argument){var args,fn=Expr.pseudos[pseudo]||Expr.setFilters[pseudo.toLowerCase()]||Sizzle.error("unsupported pseudo: "+pseudo);if(fn[expando]){return fn(argument);} +if(fn.length>1){args=[pseudo,pseudo,"",argument];return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase())?markFunction(function(seed,matches){var idx,matched=fn(seed,argument),i=matched.length;while(i--){idx=indexOf(seed,matched[i]);seed[idx]=!(matches[idx]=matched[i]);}}):function(elem){return fn(elem,0,args);};} +return fn;}},pseudos:{"not":markFunction(function(selector){var input=[],results=[],matcher=compile(selector.replace(rtrim,"$1"));return matcher[expando]?markFunction(function(seed,matches,_context,xml){var elem,unmatched=matcher(seed,null,xml,[]),i=seed.length;while(i--){if((elem=unmatched[i])){seed[i]=!(matches[i]=elem);}}}):function(elem,_context,xml){input[0]=elem;matcher(input,null,xml,results);input[0]=null;return!results.pop();};}),"has":markFunction(function(selector){return function(elem){return Sizzle(selector,elem).length>0;};}),"contains":markFunction(function(text){text=text.replace(runescape,funescape);return function(elem){return(elem.textContent||getText(elem)).indexOf(text)>-1;};}),"lang":markFunction(function(lang){if(!ridentifier.test(lang||"")){Sizzle.error("unsupported lang: "+lang);} +lang=lang.replace(runescape,funescape).toLowerCase();return function(elem){var elemLang;do{if((elemLang=documentIsHTML?elem.lang:elem.getAttribute("xml:lang")||elem.getAttribute("lang"))){elemLang=elemLang.toLowerCase();return elemLang===lang||elemLang.indexOf(lang+"-")===0;}}while((elem=elem.parentNode)&&elem.nodeType===1);return false;};}),"target":function(elem){var hash=window.location&&window.location.hash;return hash&&hash.slice(1)===elem.id;},"root":function(elem){return elem===docElem;},"focus":function(elem){return elem===document.activeElement&&(!document.hasFocus||document.hasFocus())&&!!(elem.type||elem.href||~elem.tabIndex);},"enabled":createDisabledPseudo(false),"disabled":createDisabledPseudo(true),"checked":function(elem){var nodeName=elem.nodeName.toLowerCase();return(nodeName==="input"&&!!elem.checked)||(nodeName==="option"&&!!elem.selected);},"selected":function(elem){if(elem.parentNode){elem.parentNode.selectedIndex;} +return elem.selected===true;},"empty":function(elem){for(elem=elem.firstChild;elem;elem=elem.nextSibling){if(elem.nodeType<6){return false;}} +return true;},"parent":function(elem){return!Expr.pseudos["empty"](elem);},"header":function(elem){return rheader.test(elem.nodeName);},"input":function(elem){return rinputs.test(elem.nodeName);},"button":function(elem){var name=elem.nodeName.toLowerCase();return name==="input"&&elem.type==="button"||name==="button";},"text":function(elem){var attr;return elem.nodeName.toLowerCase()==="input"&&elem.type==="text"&&((attr=elem.getAttribute("type"))==null||attr.toLowerCase()==="text");},"first":createPositionalPseudo(function(){return[0];}),"last":createPositionalPseudo(function(_matchIndexes,length){return[length-1];}),"eq":createPositionalPseudo(function(_matchIndexes,length,argument){return[argument<0?argument+length:argument];}),"even":createPositionalPseudo(function(matchIndexes,length){var i=0;for(;ilength?length:argument;for(;--i>=0;){matchIndexes.push(i);} +return matchIndexes;}),"gt":createPositionalPseudo(function(matchIndexes,length,argument){var i=argument<0?argument+length:argument;for(;++i1?function(elem,context,xml){var i=matchers.length;while(i--){if(!matchers[i](elem,context,xml)){return false;}} +return true;}:matchers[0];} +function multipleContexts(selector,contexts,results){var i=0,len=contexts.length;for(;i-1){seed[temp]=!(results[temp]=elem);}}}}else{matcherOut=condense(matcherOut===results?matcherOut.splice(preexisting,matcherOut.length):matcherOut);if(postFinder){postFinder(null,results,matcherOut,xml);}else{push.apply(results,matcherOut);}}});} +function matcherFromTokens(tokens){var checkContext,matcher,j,len=tokens.length,leadingRelative=Expr.relative[tokens[0].type],implicitRelative=leadingRelative||Expr.relative[" "],i=leadingRelative?1:0,matchContext=addCombinator(function(elem){return elem===checkContext;},implicitRelative,true),matchAnyContext=addCombinator(function(elem){return indexOf(checkContext,elem)>-1;},implicitRelative,true),matchers=[function(elem,context,xml){var ret=(!leadingRelative&&(xml||context!==outermostContext))||((checkContext=context).nodeType?matchContext(elem,context,xml):matchAnyContext(elem,context,xml));checkContext=null;return ret;}];for(;i1&&elementMatcher(matchers),i>1&&toSelector(tokens.slice(0,i-1).concat({value:tokens[i-2].type===" "?"*":""})).replace(rtrim,"$1"),matcher,i0,byElement=elementMatchers.length>0,superMatcher=function(seed,context,xml,results,outermost){var elem,j,matcher,matchedCount=0,i="0",unmatched=seed&&[],setMatched=[],contextBackup=outermostContext,elems=seed||byElement&&Expr.find["TAG"]("*",outermost),dirrunsUnique=(dirruns+=contextBackup==null?1:Math.random()||0.1),len=elems.length;if(outermost){outermostContext=context==document||context||outermost;} +for(;i!==len&&(elem=elems[i])!=null;i++){if(byElement&&elem){j=0;if(!context&&elem.ownerDocument!=document){setDocument(elem);xml=!documentIsHTML;} +while((matcher=elementMatchers[j++])){if(matcher(elem,context||document,xml)){results.push(elem);break;}} +if(outermost){dirruns=dirrunsUnique;}} +if(bySet){if((elem=!matcher&&elem)){matchedCount--;} +if(seed){unmatched.push(elem);}}} +matchedCount+=i;if(bySet&&i!==matchedCount){j=0;while((matcher=setMatchers[j++])){matcher(unmatched,setMatched,context,xml);} +if(seed){if(matchedCount>0){while(i--){if(!(unmatched[i]||setMatched[i])){setMatched[i]=pop.call(results);}}} +setMatched=condense(setMatched);} +push.apply(results,setMatched);if(outermost&&!seed&&setMatched.length>0&&(matchedCount+setMatchers.length)>1){Sizzle.uniqueSort(results);}} +if(outermost){dirruns=dirrunsUnique;outermostContext=contextBackup;} +return unmatched;};return bySet?markFunction(superMatcher):superMatcher;} +compile=Sizzle.compile=function(selector,match){var i,setMatchers=[],elementMatchers=[],cached=compilerCache[selector+" "];if(!cached){if(!match){match=tokenize(selector);} +i=match.length;while(i--){cached=matcherFromTokens(match[i]);if(cached[expando]){setMatchers.push(cached);}else{elementMatchers.push(cached);}} +cached=compilerCache(selector,matcherFromGroupMatchers(elementMatchers,setMatchers));cached.selector=selector;} +return cached;};select=Sizzle.select=function(selector,context,results,seed){var i,tokens,token,type,find,compiled=typeof selector==="function"&&selector,match=!seed&&tokenize((selector=compiled.selector||selector));results=results||[];if(match.length===1){tokens=match[0]=match[0].slice(0);if(tokens.length>2&&(token=tokens[0]).type==="ID"&&context.nodeType===9&&documentIsHTML&&Expr.relative[tokens[1].type]){context=(Expr.find["ID"](token.matches[0].replace(runescape,funescape),context)||[])[0];if(!context){return results;}else if(compiled){context=context.parentNode;} +selector=selector.slice(tokens.shift().value.length);} +i=matchExpr["needsContext"].test(selector)?0:tokens.length;while(i--){token=tokens[i];if(Expr.relative[(type=token.type)]){break;} +if((find=Expr.find[type])){if((seed=find(token.matches[0].replace(runescape,funescape),rsibling.test(tokens[0].type)&&testContext(context.parentNode)||context))){tokens.splice(i,1);selector=seed.length&&toSelector(tokens);if(!selector){push.apply(results,seed);return results;} +break;}}}} +(compiled||compile(selector,match))(seed,context,!documentIsHTML,results,!context||rsibling.test(selector)&&testContext(context.parentNode)||context);return results;};support.sortStable=expando.split("").sort(sortOrder).join("")===expando;support.detectDuplicates=!!hasDuplicate;setDocument();support.sortDetached=assert(function(el){return el.compareDocumentPosition(document.createElement("fieldset"))&1;});if(!assert(function(el){el.innerHTML="";return el.firstChild.getAttribute("href")==="#";})){addHandle("type|href|height|width",function(elem,name,isXML){if(!isXML){return elem.getAttribute(name,name.toLowerCase()==="type"?1:2);}});} +if(!support.attributes||!assert(function(el){el.innerHTML="";el.firstChild.setAttribute("value","");return el.firstChild.getAttribute("value")==="";})){addHandle("value",function(elem,_name,isXML){if(!isXML&&elem.nodeName.toLowerCase()==="input"){return elem.defaultValue;}});} +if(!assert(function(el){return el.getAttribute("disabled")==null;})){addHandle(booleans,function(elem,name,isXML){var val;if(!isXML){return elem[name]===true?name.toLowerCase():(val=elem.getAttributeNode(name))&&val.specified?val.value:null;}});} +return Sizzle;})(window);jQuery.find=Sizzle;jQuery.expr=Sizzle.selectors;jQuery.expr[":"]=jQuery.expr.pseudos;jQuery.uniqueSort=jQuery.unique=Sizzle.uniqueSort;jQuery.text=Sizzle.getText;jQuery.isXMLDoc=Sizzle.isXML;jQuery.contains=Sizzle.contains;jQuery.escapeSelector=Sizzle.escape;var dir=function(elem,dir,until){var matched=[],truncate=until!==undefined;while((elem=elem[dir])&&elem.nodeType!==9){if(elem.nodeType===1){if(truncate&&jQuery(elem).is(until)){break;} +matched.push(elem);}} +return matched;};var siblings=function(n,elem){var matched=[];for(;n;n=n.nextSibling){if(n.nodeType===1&&n!==elem){matched.push(n);}} +return matched;};var rneedsContext=jQuery.expr.match.needsContext;function nodeName(elem,name){return elem.nodeName&&elem.nodeName.toLowerCase()===name.toLowerCase();};var rsingleTag=(/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i);function winnow(elements,qualifier,not){if(isFunction(qualifier)){return jQuery.grep(elements,function(elem,i){return!!qualifier.call(elem,i,elem)!==not;});} +if(qualifier.nodeType){return jQuery.grep(elements,function(elem){return(elem===qualifier)!==not;});} +if(typeof qualifier!=="string"){return jQuery.grep(elements,function(elem){return(indexOf.call(qualifier,elem)>-1)!==not;});} +return jQuery.filter(qualifier,elements,not);} +jQuery.filter=function(expr,elems,not){var elem=elems[0];if(not){expr=":not("+expr+")";} +if(elems.length===1&&elem.nodeType===1){return jQuery.find.matchesSelector(elem,expr)?[elem]:[];} +return jQuery.find.matches(expr,jQuery.grep(elems,function(elem){return elem.nodeType===1;}));};jQuery.fn.extend({find:function(selector){var i,ret,len=this.length,self=this;if(typeof selector!=="string"){return this.pushStack(jQuery(selector).filter(function(){for(i=0;i1?jQuery.uniqueSort(ret):ret;},filter:function(selector){return this.pushStack(winnow(this,selector||[],false));},not:function(selector){return this.pushStack(winnow(this,selector||[],true));},is:function(selector){return!!winnow(this,typeof selector==="string"&&rneedsContext.test(selector)?jQuery(selector):selector||[],false).length;}});var rootjQuery,rquickExpr=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,init=jQuery.fn.init=function(selector,context,root){var match,elem;if(!selector){return this;} +root=root||rootjQuery;if(typeof selector==="string"){if(selector[0]==="<"&&selector[selector.length-1]===">"&&selector.length>=3){match=[null,selector,null];}else{match=rquickExpr.exec(selector);} +if(match&&(match[1]||!context)){if(match[1]){context=context instanceof jQuery?context[0]:context;jQuery.merge(this,jQuery.parseHTML(match[1],context&&context.nodeType?context.ownerDocument||context:document,true));if(rsingleTag.test(match[1])&&jQuery.isPlainObject(context)){for(match in context){if(isFunction(this[match])){this[match](context[match]);}else{this.attr(match,context[match]);}}} +return this;}else{elem=document.getElementById(match[2]);if(elem){this[0]=elem;this.length=1;} +return this;}}else if(!context||context.jquery){return(context||root).find(selector);}else{return this.constructor(context).find(selector);}}else if(selector.nodeType){this[0]=selector;this.length=1;return this;}else if(isFunction(selector)){return root.ready!==undefined?root.ready(selector):selector(jQuery);} +return jQuery.makeArray(selector,this);};init.prototype=jQuery.fn;rootjQuery=jQuery(document);var rparentsprev=/^(?:parents|prev(?:Until|All))/,guaranteedUnique={children:true,contents:true,next:true,prev:true};jQuery.fn.extend({has:function(target){var targets=jQuery(target,this),l=targets.length;return this.filter(function(){var i=0;for(;i-1:cur.nodeType===1&&jQuery.find.matchesSelector(cur,selectors))){matched.push(cur);break;}}}} +return this.pushStack(matched.length>1?jQuery.uniqueSort(matched):matched);},index:function(elem){if(!elem){return(this[0]&&this[0].parentNode)?this.first().prevAll().length:-1;} +if(typeof elem==="string"){return indexOf.call(jQuery(elem),this[0]);} +return indexOf.call(this,elem.jquery?elem[0]:elem);},add:function(selector,context){return this.pushStack(jQuery.uniqueSort(jQuery.merge(this.get(),jQuery(selector,context))));},addBack:function(selector){return this.add(selector==null?this.prevObject:this.prevObject.filter(selector));}});function sibling(cur,dir){while((cur=cur[dir])&&cur.nodeType!==1){} +return cur;} +jQuery.each({parent:function(elem){var parent=elem.parentNode;return parent&&parent.nodeType!==11?parent:null;},parents:function(elem){return dir(elem,"parentNode");},parentsUntil:function(elem,_i,until){return dir(elem,"parentNode",until);},next:function(elem){return sibling(elem,"nextSibling");},prev:function(elem){return sibling(elem,"previousSibling");},nextAll:function(elem){return dir(elem,"nextSibling");},prevAll:function(elem){return dir(elem,"previousSibling");},nextUntil:function(elem,_i,until){return dir(elem,"nextSibling",until);},prevUntil:function(elem,_i,until){return dir(elem,"previousSibling",until);},siblings:function(elem){return siblings((elem.parentNode||{}).firstChild,elem);},children:function(elem){return siblings(elem.firstChild);},contents:function(elem){if(elem.contentDocument!=null&&getProto(elem.contentDocument)){return elem.contentDocument;} +if(nodeName(elem,"template")){elem=elem.content||elem;} +return jQuery.merge([],elem.childNodes);}},function(name,fn){jQuery.fn[name]=function(until,selector){var matched=jQuery.map(this,fn,until);if(name.slice(-5)!=="Until"){selector=until;} +if(selector&&typeof selector==="string"){matched=jQuery.filter(selector,matched);} +if(this.length>1){if(!guaranteedUnique[name]){jQuery.uniqueSort(matched);} +if(rparentsprev.test(name)){matched.reverse();}} +return this.pushStack(matched);};});var rnothtmlwhite=(/[^\x20\t\r\n\f]+/g);function createOptions(options){var object={};jQuery.each(options.match(rnothtmlwhite)||[],function(_,flag){object[flag]=true;});return object;} +jQuery.Callbacks=function(options){options=typeof options==="string"?createOptions(options):jQuery.extend({},options);var +firing,memory,fired,locked,list=[],queue=[],firingIndex=-1,fire=function(){locked=locked||options.once;fired=firing=true;for(;queue.length;firingIndex=-1){memory=queue.shift();while(++firingIndex-1){list.splice(index,1);if(index<=firingIndex){firingIndex--;}}});return this;},has:function(fn){return fn?jQuery.inArray(fn,list)>-1:list.length>0;},empty:function(){if(list){list=[];} +return this;},disable:function(){locked=queue=[];list=memory="";return this;},disabled:function(){return!list;},lock:function(){locked=queue=[];if(!memory&&!firing){list=memory="";} +return this;},locked:function(){return!!locked;},fireWith:function(context,args){if(!locked){args=args||[];args=[context,args.slice?args.slice():args];queue.push(args);if(!firing){fire();}} +return this;},fire:function(){self.fireWith(this,arguments);return this;},fired:function(){return!!fired;}};return self;};function Identity(v){return v;} +function Thrower(ex){throw ex;} +function adoptValue(value,resolve,reject,noValue){var method;try{if(value&&isFunction((method=value.promise))){method.call(value).done(resolve).fail(reject);}else if(value&&isFunction((method=value.then))){method.call(value,resolve,reject);}else{resolve.apply(undefined,[value].slice(noValue));}}catch(value){reject.apply(undefined,[value]);}} +jQuery.extend({Deferred:function(func){var tuples=[["notify","progress",jQuery.Callbacks("memory"),jQuery.Callbacks("memory"),2],["resolve","done",jQuery.Callbacks("once memory"),jQuery.Callbacks("once memory"),0,"resolved"],["reject","fail",jQuery.Callbacks("once memory"),jQuery.Callbacks("once memory"),1,"rejected"]],state="pending",promise={state:function(){return state;},always:function(){deferred.done(arguments).fail(arguments);return this;},"catch":function(fn){return promise.then(null,fn);},pipe:function(){var fns=arguments;return jQuery.Deferred(function(newDefer){jQuery.each(tuples,function(_i,tuple){var fn=isFunction(fns[tuple[4]])&&fns[tuple[4]];deferred[tuple[1]](function(){var returned=fn&&fn.apply(this,arguments);if(returned&&isFunction(returned.promise)){returned.promise().progress(newDefer.notify).done(newDefer.resolve).fail(newDefer.reject);}else{newDefer[tuple[0]+"With"](this,fn?[returned]:arguments);}});});fns=null;}).promise();},then:function(onFulfilled,onRejected,onProgress){var maxDepth=0;function resolve(depth,deferred,handler,special){return function(){var that=this,args=arguments,mightThrow=function(){var returned,then;if(depth=maxDepth){if(handler!==Thrower){that=undefined;args=[e];} +deferred.rejectWith(that,args);}}};if(depth){process();}else{if(jQuery.Deferred.getStackHook){process.stackTrace=jQuery.Deferred.getStackHook();} +window.setTimeout(process);}};} +return jQuery.Deferred(function(newDefer){tuples[0][3].add(resolve(0,newDefer,isFunction(onProgress)?onProgress:Identity,newDefer.notifyWith));tuples[1][3].add(resolve(0,newDefer,isFunction(onFulfilled)?onFulfilled:Identity));tuples[2][3].add(resolve(0,newDefer,isFunction(onRejected)?onRejected:Thrower));}).promise();},promise:function(obj){return obj!=null?jQuery.extend(obj,promise):promise;}},deferred={};jQuery.each(tuples,function(i,tuple){var list=tuple[2],stateString=tuple[5];promise[tuple[1]]=list.add;if(stateString){list.add(function(){state=stateString;},tuples[3-i][2].disable,tuples[3-i][3].disable,tuples[0][2].lock,tuples[0][3].lock);} +list.add(tuple[3].fire);deferred[tuple[0]]=function(){deferred[tuple[0]+"With"](this===deferred?undefined:this,arguments);return this;};deferred[tuple[0]+"With"]=list.fireWith;});promise.promise(deferred);if(func){func.call(deferred,deferred);} +return deferred;},when:function(singleValue){var +remaining=arguments.length,i=remaining,resolveContexts=Array(i),resolveValues=slice.call(arguments),master=jQuery.Deferred(),updateFunc=function(i){return function(value){resolveContexts[i]=this;resolveValues[i]=arguments.length>1?slice.call(arguments):value;if(!(--remaining)){master.resolveWith(resolveContexts,resolveValues);}};};if(remaining<=1){adoptValue(singleValue,master.done(updateFunc(i)).resolve,master.reject,!remaining);if(master.state()==="pending"||isFunction(resolveValues[i]&&resolveValues[i].then)){return master.then();}} +while(i--){adoptValue(resolveValues[i],updateFunc(i),master.reject);} +return master.promise();}});var rerrorNames=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;jQuery.Deferred.exceptionHook=function(error,stack){if(window.console&&window.console.warn&&error&&rerrorNames.test(error.name)){window.console.warn("jQuery.Deferred exception: "+error.message,error.stack,stack);}};jQuery.readyException=function(error){window.setTimeout(function(){throw error;});};var readyList=jQuery.Deferred();jQuery.fn.ready=function(fn){readyList.then(fn).catch(function(error){jQuery.readyException(error);});return this;};jQuery.extend({isReady:false,readyWait:1,ready:function(wait){if(wait===true?--jQuery.readyWait:jQuery.isReady){return;} +jQuery.isReady=true;if(wait!==true&&--jQuery.readyWait>0){return;} +readyList.resolveWith(document,[jQuery]);}});jQuery.ready.then=readyList.then;function completed(){document.removeEventListener("DOMContentLoaded",completed);window.removeEventListener("load",completed);jQuery.ready();} +if(document.readyState==="complete"||(document.readyState!=="loading"&&!document.documentElement.doScroll)){window.setTimeout(jQuery.ready);}else{document.addEventListener("DOMContentLoaded",completed);window.addEventListener("load",completed);} +var access=function(elems,fn,key,value,chainable,emptyGet,raw){var i=0,len=elems.length,bulk=key==null;if(toType(key)==="object"){chainable=true;for(i in key){access(elems,fn,i,key[i],true,emptyGet,raw);}}else if(value!==undefined){chainable=true;if(!isFunction(value)){raw=true;} +if(bulk){if(raw){fn.call(elems,value);fn=null;}else{bulk=fn;fn=function(elem,_key,value){return bulk.call(jQuery(elem),value);};}} +if(fn){for(;i1,null,true);},removeData:function(key){return this.each(function(){dataUser.remove(this,key);});}});jQuery.extend({queue:function(elem,type,data){var queue;if(elem){type=(type||"fx")+"queue";queue=dataPriv.get(elem,type);if(data){if(!queue||Array.isArray(data)){queue=dataPriv.access(elem,type,jQuery.makeArray(data));}else{queue.push(data);}} +return queue||[];}},dequeue:function(elem,type){type=type||"fx";var queue=jQuery.queue(elem,type),startLength=queue.length,fn=queue.shift(),hooks=jQuery._queueHooks(elem,type),next=function(){jQuery.dequeue(elem,type);};if(fn==="inprogress"){fn=queue.shift();startLength--;} +if(fn){if(type==="fx"){queue.unshift("inprogress");} +delete hooks.stop;fn.call(elem,next,hooks);} +if(!startLength&&hooks){hooks.empty.fire();}},_queueHooks:function(elem,type){var key=type+"queueHooks";return dataPriv.get(elem,key)||dataPriv.access(elem,key,{empty:jQuery.Callbacks("once memory").add(function(){dataPriv.remove(elem,[type+"queue",key]);})});}});jQuery.fn.extend({queue:function(type,data){var setter=2;if(typeof type!=="string"){data=type;type="fx";setter--;} +if(arguments.length\x20\t\r\n\f]*)/i);var rscriptType=(/^$|^module$|\/(?:java|ecma)script/i);(function(){var fragment=document.createDocumentFragment(),div=fragment.appendChild(document.createElement("div")),input=document.createElement("input");input.setAttribute("type","radio");input.setAttribute("checked","checked");input.setAttribute("name","t");div.appendChild(input);support.checkClone=div.cloneNode(true).cloneNode(true).lastChild.checked;div.innerHTML="";support.noCloneChecked=!!div.cloneNode(true).lastChild.defaultValue;div.innerHTML="";support.option=!!div.lastChild;})();var wrapMap={thead:[1,"","
    "],col:[2,"","
    "],tr:[2,"","
    "],td:[3,"","
    "],_default:[0,"",""]};wrapMap.tbody=wrapMap.tfoot=wrapMap.colgroup=wrapMap.caption=wrapMap.thead;wrapMap.th=wrapMap.td;if(!support.option){wrapMap.optgroup=wrapMap.option=[1,""];} +function getAll(context,tag){var ret;if(typeof context.getElementsByTagName!=="undefined"){ret=context.getElementsByTagName(tag||"*");}else if(typeof context.querySelectorAll!=="undefined"){ret=context.querySelectorAll(tag||"*");}else{ret=[];} +if(tag===undefined||tag&&nodeName(context,tag)){return jQuery.merge([context],ret);} +return ret;} +function setGlobalEval(elems,refElements){var i=0,l=elems.length;for(;i-1){if(ignored){ignored.push(elem);} +continue;} +attached=isAttached(elem);tmp=getAll(fragment.appendChild(elem),"script");if(attached){setGlobalEval(tmp);} +if(scripts){j=0;while((elem=tmp[j++])){if(rscriptType.test(elem.type||"")){scripts.push(elem);}}}} +return fragment;} +var +rkeyEvent=/^key/,rmouseEvent=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,rtypenamespace=/^([^.]*)(?:\.(.+)|)/;function returnTrue(){return true;} +function returnFalse(){return false;} +function expectSync(elem,type){return(elem===safeActiveElement())===(type==="focus");} +function safeActiveElement(){try{return document.activeElement;}catch(err){}} +function on(elem,types,selector,data,fn,one){var origFn,type;if(typeof types==="object"){if(typeof selector!=="string"){data=data||selector;selector=undefined;} +for(type in types){on(elem,type,selector,data,types[type],one);} +return elem;} +if(data==null&&fn==null){fn=selector;data=selector=undefined;}else if(fn==null){if(typeof selector==="string"){fn=data;data=undefined;}else{fn=data;data=selector;selector=undefined;}} +if(fn===false){fn=returnFalse;}else if(!fn){return elem;} +if(one===1){origFn=fn;fn=function(event){jQuery().off(event);return origFn.apply(this,arguments);};fn.guid=origFn.guid||(origFn.guid=jQuery.guid++);} +return elem.each(function(){jQuery.event.add(this,types,fn,data,selector);});} +jQuery.event={global:{},add:function(elem,types,handler,data,selector){var handleObjIn,eventHandle,tmp,events,t,handleObj,special,handlers,type,namespaces,origType,elemData=dataPriv.get(elem);if(!acceptData(elem)){return;} +if(handler.handler){handleObjIn=handler;handler=handleObjIn.handler;selector=handleObjIn.selector;} +if(selector){jQuery.find.matchesSelector(documentElement,selector);} +if(!handler.guid){handler.guid=jQuery.guid++;} +if(!(events=elemData.events)){events=elemData.events=Object.create(null);} +if(!(eventHandle=elemData.handle)){eventHandle=elemData.handle=function(e){return typeof jQuery!=="undefined"&&jQuery.event.triggered!==e.type?jQuery.event.dispatch.apply(elem,arguments):undefined;};} +types=(types||"").match(rnothtmlwhite)||[""];t=types.length;while(t--){tmp=rtypenamespace.exec(types[t])||[];type=origType=tmp[1];namespaces=(tmp[2]||"").split(".").sort();if(!type){continue;} +special=jQuery.event.special[type]||{};type=(selector?special.delegateType:special.bindType)||type;special=jQuery.event.special[type]||{};handleObj=jQuery.extend({type:type,origType:origType,data:data,handler:handler,guid:handler.guid,selector:selector,needsContext:selector&&jQuery.expr.match.needsContext.test(selector),namespace:namespaces.join(".")},handleObjIn);if(!(handlers=events[type])){handlers=events[type]=[];handlers.delegateCount=0;if(!special.setup||special.setup.call(elem,data,namespaces,eventHandle)===false){if(elem.addEventListener){elem.addEventListener(type,eventHandle);}}} +if(special.add){special.add.call(elem,handleObj);if(!handleObj.handler.guid){handleObj.handler.guid=handler.guid;}} +if(selector){handlers.splice(handlers.delegateCount++,0,handleObj);}else{handlers.push(handleObj);} +jQuery.event.global[type]=true;}},remove:function(elem,types,handler,selector,mappedTypes){var j,origCount,tmp,events,t,handleObj,special,handlers,type,namespaces,origType,elemData=dataPriv.hasData(elem)&&dataPriv.get(elem);if(!elemData||!(events=elemData.events)){return;} +types=(types||"").match(rnothtmlwhite)||[""];t=types.length;while(t--){tmp=rtypenamespace.exec(types[t])||[];type=origType=tmp[1];namespaces=(tmp[2]||"").split(".").sort();if(!type){for(type in events){jQuery.event.remove(elem,type+types[t],handler,selector,true);} +continue;} +special=jQuery.event.special[type]||{};type=(selector?special.delegateType:special.bindType)||type;handlers=events[type]||[];tmp=tmp[2]&&new RegExp("(^|\\.)"+namespaces.join("\\.(?:.*\\.|)")+"(\\.|$)");origCount=j=handlers.length;while(j--){handleObj=handlers[j];if((mappedTypes||origType===handleObj.origType)&&(!handler||handler.guid===handleObj.guid)&&(!tmp||tmp.test(handleObj.namespace))&&(!selector||selector===handleObj.selector||selector==="**"&&handleObj.selector)){handlers.splice(j,1);if(handleObj.selector){handlers.delegateCount--;} +if(special.remove){special.remove.call(elem,handleObj);}}} +if(origCount&&!handlers.length){if(!special.teardown||special.teardown.call(elem,namespaces,elemData.handle)===false){jQuery.removeEvent(elem,type,elemData.handle);} +delete events[type];}} +if(jQuery.isEmptyObject(events)){dataPriv.remove(elem,"handle events");}},dispatch:function(nativeEvent){var i,j,ret,matched,handleObj,handlerQueue,args=new Array(arguments.length),event=jQuery.event.fix(nativeEvent),handlers=(dataPriv.get(this,"events")||Object.create(null))[event.type]||[],special=jQuery.event.special[event.type]||{};args[0]=event;for(i=1;i=1)){for(;cur!==this;cur=cur.parentNode||this){if(cur.nodeType===1&&!(event.type==="click"&&cur.disabled===true)){matchedHandlers=[];matchedSelectors={};for(i=0;i-1:jQuery.find(sel,this,null,[cur]).length;} +if(matchedSelectors[sel]){matchedHandlers.push(handleObj);}} +if(matchedHandlers.length){handlerQueue.push({elem:cur,handlers:matchedHandlers});}}}} +cur=this;if(delegateCount\s*$/g;function manipulationTarget(elem,content){if(nodeName(elem,"table")&&nodeName(content.nodeType!==11?content:content.firstChild,"tr")){return jQuery(elem).children("tbody")[0]||elem;} +return elem;} +function disableScript(elem){elem.type=(elem.getAttribute("type")!==null)+"/"+elem.type;return elem;} +function restoreScript(elem){if((elem.type||"").slice(0,5)==="true/"){elem.type=elem.type.slice(5);}else{elem.removeAttribute("type");} +return elem;} +function cloneCopyEvent(src,dest){var i,l,type,pdataOld,udataOld,udataCur,events;if(dest.nodeType!==1){return;} +if(dataPriv.hasData(src)){pdataOld=dataPriv.get(src);events=pdataOld.events;if(events){dataPriv.remove(dest,"handle events");for(type in events){for(i=0,l=events[type].length;i1&&typeof value==="string"&&!support.checkClone&&rchecked.test(value))){return collection.each(function(index){var self=collection.eq(index);if(valueIsFunction){args[0]=value.call(this,index,self.html());} +domManip(self,args,callback,ignored);});} +if(l){fragment=buildFragment(args,collection[0].ownerDocument,false,collection,ignored);first=fragment.firstChild;if(fragment.childNodes.length===1){fragment=first;} +if(first||ignored){scripts=jQuery.map(getAll(fragment,"script"),disableScript);hasScripts=scripts.length;for(;i0){setGlobalEval(destElements,!inPage&&getAll(elem,"script"));} +return clone;},cleanData:function(elems){var data,elem,type,special=jQuery.event.special,i=0;for(;(elem=elems[i])!==undefined;i++){if(acceptData(elem)){if((data=elem[dataPriv.expando])){if(data.events){for(type in data.events){if(special[type]){jQuery.event.remove(elem,type);}else{jQuery.removeEvent(elem,type,data.handle);}}} +elem[dataPriv.expando]=undefined;} +if(elem[dataUser.expando]){elem[dataUser.expando]=undefined;}}}}});jQuery.fn.extend({detach:function(selector){return remove(this,selector,true);},remove:function(selector){return remove(this,selector);},text:function(value){return access(this,function(value){return value===undefined?jQuery.text(this):this.empty().each(function(){if(this.nodeType===1||this.nodeType===11||this.nodeType===9){this.textContent=value;}});},null,value,arguments.length);},append:function(){return domManip(this,arguments,function(elem){if(this.nodeType===1||this.nodeType===11||this.nodeType===9){var target=manipulationTarget(this,elem);target.appendChild(elem);}});},prepend:function(){return domManip(this,arguments,function(elem){if(this.nodeType===1||this.nodeType===11||this.nodeType===9){var target=manipulationTarget(this,elem);target.insertBefore(elem,target.firstChild);}});},before:function(){return domManip(this,arguments,function(elem){if(this.parentNode){this.parentNode.insertBefore(elem,this);}});},after:function(){return domManip(this,arguments,function(elem){if(this.parentNode){this.parentNode.insertBefore(elem,this.nextSibling);}});},empty:function(){var elem,i=0;for(;(elem=this[i])!=null;i++){if(elem.nodeType===1){jQuery.cleanData(getAll(elem,false));elem.textContent="";}} +return this;},clone:function(dataAndEvents,deepDataAndEvents){dataAndEvents=dataAndEvents==null?false:dataAndEvents;deepDataAndEvents=deepDataAndEvents==null?dataAndEvents:deepDataAndEvents;return this.map(function(){return jQuery.clone(this,dataAndEvents,deepDataAndEvents);});},html:function(value){return access(this,function(value){var elem=this[0]||{},i=0,l=this.length;if(value===undefined&&elem.nodeType===1){return elem.innerHTML;} +if(typeof value==="string"&&!rnoInnerhtml.test(value)&&!wrapMap[(rtagName.exec(value)||["",""])[1].toLowerCase()]){value=jQuery.htmlPrefilter(value);try{for(;i3;documentElement.removeChild(table);} +return reliableTrDimensionsVal;}});})();function curCSS(elem,name,computed){var width,minWidth,maxWidth,ret,style=elem.style;computed=computed||getStyles(elem);if(computed){ret=computed.getPropertyValue(name)||computed[name];if(ret===""&&!isAttached(elem)){ret=jQuery.style(elem,name);} +if(!support.pixelBoxStyles()&&rnumnonpx.test(ret)&&rboxStyle.test(name)){width=style.width;minWidth=style.minWidth;maxWidth=style.maxWidth;style.minWidth=style.maxWidth=style.width=ret;ret=computed.width;style.width=width;style.minWidth=minWidth;style.maxWidth=maxWidth;}} +return ret!==undefined?ret+"":ret;} +function addGetHookIf(conditionFn,hookFn){return{get:function(){if(conditionFn()){delete this.get;return;} +return(this.get=hookFn).apply(this,arguments);}};} +var cssPrefixes=["Webkit","Moz","ms"],emptyStyle=document.createElement("div").style,vendorProps={};function vendorPropName(name){var capName=name[0].toUpperCase()+name.slice(1),i=cssPrefixes.length;while(i--){name=cssPrefixes[i]+capName;if(name in emptyStyle){return name;}}} +function finalPropName(name){var final=jQuery.cssProps[name]||vendorProps[name];if(final){return final;} +if(name in emptyStyle){return name;} +return vendorProps[name]=vendorPropName(name)||name;} +var +rdisplayswap=/^(none|table(?!-c[ea]).+)/,rcustomProp=/^--/,cssShow={position:"absolute",visibility:"hidden",display:"block"},cssNormalTransform={letterSpacing:"0",fontWeight:"400"};function setPositiveNumber(_elem,value,subtract){var matches=rcssNum.exec(value);return matches?Math.max(0,matches[2]-(subtract||0))+(matches[3]||"px"):value;} +function boxModelAdjustment(elem,dimension,box,isBorderBox,styles,computedVal){var i=dimension==="width"?1:0,extra=0,delta=0;if(box===(isBorderBox?"border":"content")){return 0;} +for(;i<4;i+=2){if(box==="margin"){delta+=jQuery.css(elem,box+cssExpand[i],true,styles);} +if(!isBorderBox){delta+=jQuery.css(elem,"padding"+cssExpand[i],true,styles);if(box!=="padding"){delta+=jQuery.css(elem,"border"+cssExpand[i]+"Width",true,styles);}else{extra+=jQuery.css(elem,"border"+cssExpand[i]+"Width",true,styles);}}else{if(box==="content"){delta-=jQuery.css(elem,"padding"+cssExpand[i],true,styles);} +if(box!=="margin"){delta-=jQuery.css(elem,"border"+cssExpand[i]+"Width",true,styles);}}} +if(!isBorderBox&&computedVal>=0){delta+=Math.max(0,Math.ceil(elem["offset"+dimension[0].toUpperCase()+dimension.slice(1)]- +computedVal- +delta- +extra- +0.5))||0;} +return delta;} +function getWidthOrHeight(elem,dimension,extra){var styles=getStyles(elem),boxSizingNeeded=!support.boxSizingReliable()||extra,isBorderBox=boxSizingNeeded&&jQuery.css(elem,"boxSizing",false,styles)==="border-box",valueIsBorderBox=isBorderBox,val=curCSS(elem,dimension,styles),offsetProp="offset"+dimension[0].toUpperCase()+dimension.slice(1);if(rnumnonpx.test(val)){if(!extra){return val;} +val="auto";} +if((!support.boxSizingReliable()&&isBorderBox||!support.reliableTrDimensions()&&nodeName(elem,"tr")||val==="auto"||!parseFloat(val)&&jQuery.css(elem,"display",false,styles)==="inline")&&elem.getClientRects().length){isBorderBox=jQuery.css(elem,"boxSizing",false,styles)==="border-box";valueIsBorderBox=offsetProp in elem;if(valueIsBorderBox){val=elem[offsetProp];}} +val=parseFloat(val)||0;return(val+ +boxModelAdjustment(elem,dimension,extra||(isBorderBox?"border":"content"),valueIsBorderBox,styles,val))+"px";} +jQuery.extend({cssHooks:{opacity:{get:function(elem,computed){if(computed){var ret=curCSS(elem,"opacity");return ret===""?"1":ret;}}}},cssNumber:{"animationIterationCount":true,"columnCount":true,"fillOpacity":true,"flexGrow":true,"flexShrink":true,"fontWeight":true,"gridArea":true,"gridColumn":true,"gridColumnEnd":true,"gridColumnStart":true,"gridRow":true,"gridRowEnd":true,"gridRowStart":true,"lineHeight":true,"opacity":true,"order":true,"orphans":true,"widows":true,"zIndex":true,"zoom":true},cssProps:{},style:function(elem,name,value,extra){if(!elem||elem.nodeType===3||elem.nodeType===8||!elem.style){return;} +var ret,type,hooks,origName=camelCase(name),isCustomProp=rcustomProp.test(name),style=elem.style;if(!isCustomProp){name=finalPropName(origName);} +hooks=jQuery.cssHooks[name]||jQuery.cssHooks[origName];if(value!==undefined){type=typeof value;if(type==="string"&&(ret=rcssNum.exec(value))&&ret[1]){value=adjustCSS(elem,name,ret);type="number";} +if(value==null||value!==value){return;} +if(type==="number"&&!isCustomProp){value+=ret&&ret[3]||(jQuery.cssNumber[origName]?"":"px");} +if(!support.clearCloneStyle&&value===""&&name.indexOf("background")===0){style[name]="inherit";} +if(!hooks||!("set"in hooks)||(value=hooks.set(elem,value,extra))!==undefined){if(isCustomProp){style.setProperty(name,value);}else{style[name]=value;}}}else{if(hooks&&"get"in hooks&&(ret=hooks.get(elem,false,extra))!==undefined){return ret;} +return style[name];}},css:function(elem,name,extra,styles){var val,num,hooks,origName=camelCase(name),isCustomProp=rcustomProp.test(name);if(!isCustomProp){name=finalPropName(origName);} +hooks=jQuery.cssHooks[name]||jQuery.cssHooks[origName];if(hooks&&"get"in hooks){val=hooks.get(elem,true,extra);} +if(val===undefined){val=curCSS(elem,name,styles);} +if(val==="normal"&&name in cssNormalTransform){val=cssNormalTransform[name];} +if(extra===""||extra){num=parseFloat(val);return extra===true||isFinite(num)?num||0:val;} +return val;}});jQuery.each(["height","width"],function(_i,dimension){jQuery.cssHooks[dimension]={get:function(elem,computed,extra){if(computed){return rdisplayswap.test(jQuery.css(elem,"display"))&&(!elem.getClientRects().length||!elem.getBoundingClientRect().width)?swap(elem,cssShow,function(){return getWidthOrHeight(elem,dimension,extra);}):getWidthOrHeight(elem,dimension,extra);}},set:function(elem,value,extra){var matches,styles=getStyles(elem),scrollboxSizeBuggy=!support.scrollboxSize()&&styles.position==="absolute",boxSizingNeeded=scrollboxSizeBuggy||extra,isBorderBox=boxSizingNeeded&&jQuery.css(elem,"boxSizing",false,styles)==="border-box",subtract=extra?boxModelAdjustment(elem,dimension,extra,isBorderBox,styles):0;if(isBorderBox&&scrollboxSizeBuggy){subtract-=Math.ceil(elem["offset"+dimension[0].toUpperCase()+dimension.slice(1)]- +parseFloat(styles[dimension])- +boxModelAdjustment(elem,dimension,"border",false,styles)- +0.5);} +if(subtract&&(matches=rcssNum.exec(value))&&(matches[3]||"px")!=="px"){elem.style[dimension]=value;value=jQuery.css(elem,dimension);} +return setPositiveNumber(elem,value,subtract);}};});jQuery.cssHooks.marginLeft=addGetHookIf(support.reliableMarginLeft,function(elem,computed){if(computed){return(parseFloat(curCSS(elem,"marginLeft"))||elem.getBoundingClientRect().left- +swap(elem,{marginLeft:0},function(){return elem.getBoundingClientRect().left;}))+"px";}});jQuery.each({margin:"",padding:"",border:"Width"},function(prefix,suffix){jQuery.cssHooks[prefix+suffix]={expand:function(value){var i=0,expanded={},parts=typeof value==="string"?value.split(" "):[value];for(;i<4;i++){expanded[prefix+cssExpand[i]+suffix]=parts[i]||parts[i-2]||parts[0];} +return expanded;}};if(prefix!=="margin"){jQuery.cssHooks[prefix+suffix].set=setPositiveNumber;}});jQuery.fn.extend({css:function(name,value){return access(this,function(elem,name,value){var styles,len,map={},i=0;if(Array.isArray(name)){styles=getStyles(elem);len=name.length;for(;i1);}});function Tween(elem,options,prop,end,easing){return new Tween.prototype.init(elem,options,prop,end,easing);} +jQuery.Tween=Tween;Tween.prototype={constructor:Tween,init:function(elem,options,prop,end,easing,unit){this.elem=elem;this.prop=prop;this.easing=easing||jQuery.easing._default;this.options=options;this.start=this.now=this.cur();this.end=end;this.unit=unit||(jQuery.cssNumber[prop]?"":"px");},cur:function(){var hooks=Tween.propHooks[this.prop];return hooks&&hooks.get?hooks.get(this):Tween.propHooks._default.get(this);},run:function(percent){var eased,hooks=Tween.propHooks[this.prop];if(this.options.duration){this.pos=eased=jQuery.easing[this.easing](percent,this.options.duration*percent,0,1,this.options.duration);}else{this.pos=eased=percent;} +this.now=(this.end-this.start)*eased+this.start;if(this.options.step){this.options.step.call(this.elem,this.now,this);} +if(hooks&&hooks.set){hooks.set(this);}else{Tween.propHooks._default.set(this);} +return this;}};Tween.prototype.init.prototype=Tween.prototype;Tween.propHooks={_default:{get:function(tween){var result;if(tween.elem.nodeType!==1||tween.elem[tween.prop]!=null&&tween.elem.style[tween.prop]==null){return tween.elem[tween.prop];} +result=jQuery.css(tween.elem,tween.prop,"");return!result||result==="auto"?0:result;},set:function(tween){if(jQuery.fx.step[tween.prop]){jQuery.fx.step[tween.prop](tween);}else if(tween.elem.nodeType===1&&(jQuery.cssHooks[tween.prop]||tween.elem.style[finalPropName(tween.prop)]!=null)){jQuery.style(tween.elem,tween.prop,tween.now+tween.unit);}else{tween.elem[tween.prop]=tween.now;}}}};Tween.propHooks.scrollTop=Tween.propHooks.scrollLeft={set:function(tween){if(tween.elem.nodeType&&tween.elem.parentNode){tween.elem[tween.prop]=tween.now;}}};jQuery.easing={linear:function(p){return p;},swing:function(p){return 0.5-Math.cos(p*Math.PI)/2;},_default:"swing"};jQuery.fx=Tween.prototype.init;jQuery.fx.step={};var +fxNow,inProgress,rfxtypes=/^(?:toggle|show|hide)$/,rrun=/queueHooks$/;function schedule(){if(inProgress){if(document.hidden===false&&window.requestAnimationFrame){window.requestAnimationFrame(schedule);}else{window.setTimeout(schedule,jQuery.fx.interval);} +jQuery.fx.tick();}} +function createFxNow(){window.setTimeout(function(){fxNow=undefined;});return(fxNow=Date.now());} +function genFx(type,includeWidth){var which,i=0,attrs={height:type};includeWidth=includeWidth?1:0;for(;i<4;i+=2-includeWidth){which=cssExpand[i];attrs["margin"+which]=attrs["padding"+which]=type;} +if(includeWidth){attrs.opacity=attrs.width=type;} +return attrs;} +function createTween(value,prop,animation){var tween,collection=(Animation.tweeners[prop]||[]).concat(Animation.tweeners["*"]),index=0,length=collection.length;for(;index1);},removeAttr:function(name){return this.each(function(){jQuery.removeAttr(this,name);});}});jQuery.extend({attr:function(elem,name,value){var ret,hooks,nType=elem.nodeType;if(nType===3||nType===8||nType===2){return;} +if(typeof elem.getAttribute==="undefined"){return jQuery.prop(elem,name,value);} +if(nType!==1||!jQuery.isXMLDoc(elem)){hooks=jQuery.attrHooks[name.toLowerCase()]||(jQuery.expr.match.bool.test(name)?boolHook:undefined);} +if(value!==undefined){if(value===null){jQuery.removeAttr(elem,name);return;} +if(hooks&&"set"in hooks&&(ret=hooks.set(elem,value,name))!==undefined){return ret;} +elem.setAttribute(name,value+"");return value;} +if(hooks&&"get"in hooks&&(ret=hooks.get(elem,name))!==null){return ret;} +ret=jQuery.find.attr(elem,name);return ret==null?undefined:ret;},attrHooks:{type:{set:function(elem,value){if(!support.radioValue&&value==="radio"&&nodeName(elem,"input")){var val=elem.value;elem.setAttribute("type",value);if(val){elem.value=val;} +return value;}}}},removeAttr:function(elem,value){var name,i=0,attrNames=value&&value.match(rnothtmlwhite);if(attrNames&&elem.nodeType===1){while((name=attrNames[i++])){elem.removeAttribute(name);}}}});boolHook={set:function(elem,value,name){if(value===false){jQuery.removeAttr(elem,name);}else{elem.setAttribute(name,name);} +return name;}};jQuery.each(jQuery.expr.match.bool.source.match(/\w+/g),function(_i,name){var getter=attrHandle[name]||jQuery.find.attr;attrHandle[name]=function(elem,name,isXML){var ret,handle,lowercaseName=name.toLowerCase();if(!isXML){handle=attrHandle[lowercaseName];attrHandle[lowercaseName]=ret;ret=getter(elem,name,isXML)!=null?lowercaseName:null;attrHandle[lowercaseName]=handle;} +return ret;};});var rfocusable=/^(?:input|select|textarea|button)$/i,rclickable=/^(?:a|area)$/i;jQuery.fn.extend({prop:function(name,value){return access(this,jQuery.prop,name,value,arguments.length>1);},removeProp:function(name){return this.each(function(){delete this[jQuery.propFix[name]||name];});}});jQuery.extend({prop:function(elem,name,value){var ret,hooks,nType=elem.nodeType;if(nType===3||nType===8||nType===2){return;} +if(nType!==1||!jQuery.isXMLDoc(elem)){name=jQuery.propFix[name]||name;hooks=jQuery.propHooks[name];} +if(value!==undefined){if(hooks&&"set"in hooks&&(ret=hooks.set(elem,value,name))!==undefined){return ret;} +return(elem[name]=value);} +if(hooks&&"get"in hooks&&(ret=hooks.get(elem,name))!==null){return ret;} +return elem[name];},propHooks:{tabIndex:{get:function(elem){var tabindex=jQuery.find.attr(elem,"tabindex");if(tabindex){return parseInt(tabindex,10);} +if(rfocusable.test(elem.nodeName)||rclickable.test(elem.nodeName)&&elem.href){return 0;} +return-1;}}},propFix:{"for":"htmlFor","class":"className"}});if(!support.optSelected){jQuery.propHooks.selected={get:function(elem){var parent=elem.parentNode;if(parent&&parent.parentNode){parent.parentNode.selectedIndex;} +return null;},set:function(elem){var parent=elem.parentNode;if(parent){parent.selectedIndex;if(parent.parentNode){parent.parentNode.selectedIndex;}}}};} +jQuery.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){jQuery.propFix[this.toLowerCase()]=this;});function stripAndCollapse(value){var tokens=value.match(rnothtmlwhite)||[];return tokens.join(" ");} +function getClass(elem){return elem.getAttribute&&elem.getAttribute("class")||"";} +function classesToArray(value){if(Array.isArray(value)){return value;} +if(typeof value==="string"){return value.match(rnothtmlwhite)||[];} +return[];} +jQuery.fn.extend({addClass:function(value){var classes,elem,cur,curValue,clazz,j,finalValue,i=0;if(isFunction(value)){return this.each(function(j){jQuery(this).addClass(value.call(this,j,getClass(this)));});} +classes=classesToArray(value);if(classes.length){while((elem=this[i++])){curValue=getClass(elem);cur=elem.nodeType===1&&(" "+stripAndCollapse(curValue)+" ");if(cur){j=0;while((clazz=classes[j++])){if(cur.indexOf(" "+clazz+" ")<0){cur+=clazz+" ";}} +finalValue=stripAndCollapse(cur);if(curValue!==finalValue){elem.setAttribute("class",finalValue);}}}} +return this;},removeClass:function(value){var classes,elem,cur,curValue,clazz,j,finalValue,i=0;if(isFunction(value)){return this.each(function(j){jQuery(this).removeClass(value.call(this,j,getClass(this)));});} +if(!arguments.length){return this.attr("class","");} +classes=classesToArray(value);if(classes.length){while((elem=this[i++])){curValue=getClass(elem);cur=elem.nodeType===1&&(" "+stripAndCollapse(curValue)+" ");if(cur){j=0;while((clazz=classes[j++])){while(cur.indexOf(" "+clazz+" ")>-1){cur=cur.replace(" "+clazz+" "," ");}} +finalValue=stripAndCollapse(cur);if(curValue!==finalValue){elem.setAttribute("class",finalValue);}}}} +return this;},toggleClass:function(value,stateVal){var type=typeof value,isValidValue=type==="string"||Array.isArray(value);if(typeof stateVal==="boolean"&&isValidValue){return stateVal?this.addClass(value):this.removeClass(value);} +if(isFunction(value)){return this.each(function(i){jQuery(this).toggleClass(value.call(this,i,getClass(this),stateVal),stateVal);});} +return this.each(function(){var className,i,self,classNames;if(isValidValue){i=0;self=jQuery(this);classNames=classesToArray(value);while((className=classNames[i++])){if(self.hasClass(className)){self.removeClass(className);}else{self.addClass(className);}}}else if(value===undefined||type==="boolean"){className=getClass(this);if(className){dataPriv.set(this,"__className__",className);} +if(this.setAttribute){this.setAttribute("class",className||value===false?"":dataPriv.get(this,"__className__")||"");}}});},hasClass:function(selector){var className,elem,i=0;className=" "+selector+" ";while((elem=this[i++])){if(elem.nodeType===1&&(" "+stripAndCollapse(getClass(elem))+" ").indexOf(className)>-1){return true;}} +return false;}});var rreturn=/\r/g;jQuery.fn.extend({val:function(value){var hooks,ret,valueIsFunction,elem=this[0];if(!arguments.length){if(elem){hooks=jQuery.valHooks[elem.type]||jQuery.valHooks[elem.nodeName.toLowerCase()];if(hooks&&"get"in hooks&&(ret=hooks.get(elem,"value"))!==undefined){return ret;} +ret=elem.value;if(typeof ret==="string"){return ret.replace(rreturn,"");} +return ret==null?"":ret;} +return;} +valueIsFunction=isFunction(value);return this.each(function(i){var val;if(this.nodeType!==1){return;} +if(valueIsFunction){val=value.call(this,i,jQuery(this).val());}else{val=value;} +if(val==null){val="";}else if(typeof val==="number"){val+="";}else if(Array.isArray(val)){val=jQuery.map(val,function(value){return value==null?"":value+"";});} +hooks=jQuery.valHooks[this.type]||jQuery.valHooks[this.nodeName.toLowerCase()];if(!hooks||!("set"in hooks)||hooks.set(this,val,"value")===undefined){this.value=val;}});}});jQuery.extend({valHooks:{option:{get:function(elem){var val=jQuery.find.attr(elem,"value");return val!=null?val:stripAndCollapse(jQuery.text(elem));}},select:{get:function(elem){var value,option,i,options=elem.options,index=elem.selectedIndex,one=elem.type==="select-one",values=one?null:[],max=one?index+1:options.length;if(index<0){i=max;}else{i=one?index:0;} +for(;i-1){optionSet=true;}} +if(!optionSet){elem.selectedIndex=-1;} +return values;}}}});jQuery.each(["radio","checkbox"],function(){jQuery.valHooks[this]={set:function(elem,value){if(Array.isArray(value)){return(elem.checked=jQuery.inArray(jQuery(elem).val(),value)>-1);}}};if(!support.checkOn){jQuery.valHooks[this].get=function(elem){return elem.getAttribute("value")===null?"on":elem.value;};}});support.focusin="onfocusin"in window;var rfocusMorph=/^(?:focusinfocus|focusoutblur)$/,stopPropagationCallback=function(e){e.stopPropagation();};jQuery.extend(jQuery.event,{trigger:function(event,data,elem,onlyHandlers){var i,cur,tmp,bubbleType,ontype,handle,special,lastElement,eventPath=[elem||document],type=hasOwn.call(event,"type")?event.type:event,namespaces=hasOwn.call(event,"namespace")?event.namespace.split("."):[];cur=lastElement=tmp=elem=elem||document;if(elem.nodeType===3||elem.nodeType===8){return;} +if(rfocusMorph.test(type+jQuery.event.triggered)){return;} +if(type.indexOf(".")>-1){namespaces=type.split(".");type=namespaces.shift();namespaces.sort();} +ontype=type.indexOf(":")<0&&"on"+type;event=event[jQuery.expando]?event:new jQuery.Event(type,typeof event==="object"&&event);event.isTrigger=onlyHandlers?2:3;event.namespace=namespaces.join(".");event.rnamespace=event.namespace?new RegExp("(^|\\.)"+namespaces.join("\\.(?:.*\\.|)")+"(\\.|$)"):null;event.result=undefined;if(!event.target){event.target=elem;} +data=data==null?[event]:jQuery.makeArray(data,[event]);special=jQuery.event.special[type]||{};if(!onlyHandlers&&special.trigger&&special.trigger.apply(elem,data)===false){return;} +if(!onlyHandlers&&!special.noBubble&&!isWindow(elem)){bubbleType=special.delegateType||type;if(!rfocusMorph.test(bubbleType+type)){cur=cur.parentNode;} +for(;cur;cur=cur.parentNode){eventPath.push(cur);tmp=cur;} +if(tmp===(elem.ownerDocument||document)){eventPath.push(tmp.defaultView||tmp.parentWindow||window);}} +i=0;while((cur=eventPath[i++])&&!event.isPropagationStopped()){lastElement=cur;event.type=i>1?bubbleType:special.bindType||type;handle=(dataPriv.get(cur,"events")||Object.create(null))[event.type]&&dataPriv.get(cur,"handle");if(handle){handle.apply(cur,data);} +handle=ontype&&cur[ontype];if(handle&&handle.apply&&acceptData(cur)){event.result=handle.apply(cur,data);if(event.result===false){event.preventDefault();}}} +event.type=type;if(!onlyHandlers&&!event.isDefaultPrevented()){if((!special._default||special._default.apply(eventPath.pop(),data)===false)&&acceptData(elem)){if(ontype&&isFunction(elem[type])&&!isWindow(elem)){tmp=elem[ontype];if(tmp){elem[ontype]=null;} +jQuery.event.triggered=type;if(event.isPropagationStopped()){lastElement.addEventListener(type,stopPropagationCallback);} +elem[type]();if(event.isPropagationStopped()){lastElement.removeEventListener(type,stopPropagationCallback);} +jQuery.event.triggered=undefined;if(tmp){elem[ontype]=tmp;}}}} +return event.result;},simulate:function(type,elem,event){var e=jQuery.extend(new jQuery.Event(),event,{type:type,isSimulated:true});jQuery.event.trigger(e,null,elem);}});jQuery.fn.extend({trigger:function(type,data){return this.each(function(){jQuery.event.trigger(type,data,this);});},triggerHandler:function(type,data){var elem=this[0];if(elem){return jQuery.event.trigger(type,data,elem,true);}}});if(!support.focusin){jQuery.each({focus:"focusin",blur:"focusout"},function(orig,fix){var handler=function(event){jQuery.event.simulate(fix,event.target,jQuery.event.fix(event));};jQuery.event.special[fix]={setup:function(){var doc=this.ownerDocument||this.document||this,attaches=dataPriv.access(doc,fix);if(!attaches){doc.addEventListener(orig,handler,true);} +dataPriv.access(doc,fix,(attaches||0)+1);},teardown:function(){var doc=this.ownerDocument||this.document||this,attaches=dataPriv.access(doc,fix)-1;if(!attaches){doc.removeEventListener(orig,handler,true);dataPriv.remove(doc,fix);}else{dataPriv.access(doc,fix,attaches);}}};});} +var location=window.location;var nonce={guid:Date.now()};var rquery=(/\?/);jQuery.parseXML=function(data){var xml;if(!data||typeof data!=="string"){return null;} +try{xml=(new window.DOMParser()).parseFromString(data,"text/xml");}catch(e){xml=undefined;} +if(!xml||xml.getElementsByTagName("parsererror").length){jQuery.error("Invalid XML: "+data);} +return xml;};var +rbracket=/\[\]$/,rCRLF=/\r?\n/g,rsubmitterTypes=/^(?:submit|button|image|reset|file)$/i,rsubmittable=/^(?:input|select|textarea|keygen)/i;function buildParams(prefix,obj,traditional,add){var name;if(Array.isArray(obj)){jQuery.each(obj,function(i,v){if(traditional||rbracket.test(prefix)){add(prefix,v);}else{buildParams(prefix+"["+(typeof v==="object"&&v!=null?i:"")+"]",v,traditional,add);}});}else if(!traditional&&toType(obj)==="object"){for(name in obj){buildParams(prefix+"["+name+"]",obj[name],traditional,add);}}else{add(prefix,obj);}} +jQuery.param=function(a,traditional){var prefix,s=[],add=function(key,valueOrFunction){var value=isFunction(valueOrFunction)?valueOrFunction():valueOrFunction;s[s.length]=encodeURIComponent(key)+"="+ +encodeURIComponent(value==null?"":value);};if(a==null){return "";} +if(Array.isArray(a)||(a.jquery&&!jQuery.isPlainObject(a))){jQuery.each(a,function(){add(this.name,this.value);});}else{for(prefix in a){buildParams(prefix,a[prefix],traditional,add);}} +return s.join("&");};jQuery.fn.extend({serialize:function(){return jQuery.param(this.serializeArray());},serializeArray:function(){return this.map(function(){var elements=jQuery.prop(this,"elements");return elements?jQuery.makeArray(elements):this;}).filter(function(){var type=this.type;return this.name&&!jQuery(this).is(":disabled")&&rsubmittable.test(this.nodeName)&&!rsubmitterTypes.test(type)&&(this.checked||!rcheckableType.test(type));}).map(function(_i,elem){var val=jQuery(this).val();if(val==null){return null;} +if(Array.isArray(val)){return jQuery.map(val,function(val){return{name:elem.name,value:val.replace(rCRLF,"\r\n")};});} +return{name:elem.name,value:val.replace(rCRLF,"\r\n")};}).get();}});var +r20=/%20/g,rhash=/#.*$/,rantiCache=/([?&])_=[^&]*/,rheaders=/^(.*?):[ \t]*([^\r\n]*)$/mg,rlocalProtocol=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,rnoContent=/^(?:GET|HEAD)$/,rprotocol=/^\/\//,prefilters={},transports={},allTypes="*/".concat("*"),originAnchor=document.createElement("a");originAnchor.href=location.href;function addToPrefiltersOrTransports(structure){return function(dataTypeExpression,func){if(typeof dataTypeExpression!=="string"){func=dataTypeExpression;dataTypeExpression="*";} +var dataType,i=0,dataTypes=dataTypeExpression.toLowerCase().match(rnothtmlwhite)||[];if(isFunction(func)){while((dataType=dataTypes[i++])){if(dataType[0]==="+"){dataType=dataType.slice(1)||"*";(structure[dataType]=structure[dataType]||[]).unshift(func);}else{(structure[dataType]=structure[dataType]||[]).push(func);}}}};} +function inspectPrefiltersOrTransports(structure,options,originalOptions,jqXHR){var inspected={},seekingTransport=(structure===transports);function inspect(dataType){var selected;inspected[dataType]=true;jQuery.each(structure[dataType]||[],function(_,prefilterOrFactory){var dataTypeOrTransport=prefilterOrFactory(options,originalOptions,jqXHR);if(typeof dataTypeOrTransport==="string"&&!seekingTransport&&!inspected[dataTypeOrTransport]){options.dataTypes.unshift(dataTypeOrTransport);inspect(dataTypeOrTransport);return false;}else if(seekingTransport){return!(selected=dataTypeOrTransport);}});return selected;} +return inspect(options.dataTypes[0])||!inspected["*"]&&inspect("*");} +function ajaxExtend(target,src){var key,deep,flatOptions=jQuery.ajaxSettings.flatOptions||{};for(key in src){if(src[key]!==undefined){(flatOptions[key]?target:(deep||(deep={})))[key]=src[key];}} +if(deep){jQuery.extend(true,target,deep);} +return target;} +function ajaxHandleResponses(s,jqXHR,responses){var ct,type,finalDataType,firstDataType,contents=s.contents,dataTypes=s.dataTypes;while(dataTypes[0]==="*"){dataTypes.shift();if(ct===undefined){ct=s.mimeType||jqXHR.getResponseHeader("Content-Type");}} +if(ct){for(type in contents){if(contents[type]&&contents[type].test(ct)){dataTypes.unshift(type);break;}}} +if(dataTypes[0]in responses){finalDataType=dataTypes[0];}else{for(type in responses){if(!dataTypes[0]||s.converters[type+" "+dataTypes[0]]){finalDataType=type;break;} +if(!firstDataType){firstDataType=type;}} +finalDataType=finalDataType||firstDataType;} +if(finalDataType){if(finalDataType!==dataTypes[0]){dataTypes.unshift(finalDataType);} +return responses[finalDataType];}} +function ajaxConvert(s,response,jqXHR,isSuccess){var conv2,current,conv,tmp,prev,converters={},dataTypes=s.dataTypes.slice();if(dataTypes[1]){for(conv in s.converters){converters[conv.toLowerCase()]=s.converters[conv];}} +current=dataTypes.shift();while(current){if(s.responseFields[current]){jqXHR[s.responseFields[current]]=response;} +if(!prev&&isSuccess&&s.dataFilter){response=s.dataFilter(response,s.dataType);} +prev=current;current=dataTypes.shift();if(current){if(current==="*"){current=prev;}else if(prev!=="*"&&prev!==current){conv=converters[prev+" "+current]||converters["* "+current];if(!conv){for(conv2 in converters){tmp=conv2.split(" ");if(tmp[1]===current){conv=converters[prev+" "+tmp[0]]||converters["* "+tmp[0]];if(conv){if(conv===true){conv=converters[conv2];}else if(converters[conv2]!==true){current=tmp[0];dataTypes.unshift(tmp[1]);} +break;}}}} +if(conv!==true){if(conv&&s.throws){response=conv(response);}else{try{response=conv(response);}catch(e){return{state:"parsererror",error:conv?e:"No conversion from "+prev+" to "+current};}}}}}} +return{state:"success",data:response};} +jQuery.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:location.href,type:"GET",isLocal:rlocalProtocol.test(location.protocol),global:true,processData:true,async:true,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":allTypes,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":true,"text json":JSON.parse,"text xml":jQuery.parseXML},flatOptions:{url:true,context:true}},ajaxSetup:function(target,settings){return settings?ajaxExtend(ajaxExtend(target,jQuery.ajaxSettings),settings):ajaxExtend(jQuery.ajaxSettings,target);},ajaxPrefilter:addToPrefiltersOrTransports(prefilters),ajaxTransport:addToPrefiltersOrTransports(transports),ajax:function(url,options){if(typeof url==="object"){options=url;url=undefined;} +options=options||{};var transport,cacheURL,responseHeadersString,responseHeaders,timeoutTimer,urlAnchor,completed,fireGlobals,i,uncached,s=jQuery.ajaxSetup({},options),callbackContext=s.context||s,globalEventContext=s.context&&(callbackContext.nodeType||callbackContext.jquery)?jQuery(callbackContext):jQuery.event,deferred=jQuery.Deferred(),completeDeferred=jQuery.Callbacks("once memory"),statusCode=s.statusCode||{},requestHeaders={},requestHeadersNames={},strAbort="canceled",jqXHR={readyState:0,getResponseHeader:function(key){var match;if(completed){if(!responseHeaders){responseHeaders={};while((match=rheaders.exec(responseHeadersString))){responseHeaders[match[1].toLowerCase()+" "]=(responseHeaders[match[1].toLowerCase()+" "]||[]).concat(match[2]);}} +match=responseHeaders[key.toLowerCase()+" "];} +return match==null?null:match.join(", ");},getAllResponseHeaders:function(){return completed?responseHeadersString:null;},setRequestHeader:function(name,value){if(completed==null){name=requestHeadersNames[name.toLowerCase()]=requestHeadersNames[name.toLowerCase()]||name;requestHeaders[name]=value;} +return this;},overrideMimeType:function(type){if(completed==null){s.mimeType=type;} +return this;},statusCode:function(map){var code;if(map){if(completed){jqXHR.always(map[jqXHR.status]);}else{for(code in map){statusCode[code]=[statusCode[code],map[code]];}}} +return this;},abort:function(statusText){var finalText=statusText||strAbort;if(transport){transport.abort(finalText);} +done(0,finalText);return this;}};deferred.promise(jqXHR);s.url=((url||s.url||location.href)+"").replace(rprotocol,location.protocol+"//");s.type=options.method||options.type||s.method||s.type;s.dataTypes=(s.dataType||"*").toLowerCase().match(rnothtmlwhite)||[""];if(s.crossDomain==null){urlAnchor=document.createElement("a");try{urlAnchor.href=s.url;urlAnchor.href=urlAnchor.href;s.crossDomain=originAnchor.protocol+"//"+originAnchor.host!==urlAnchor.protocol+"//"+urlAnchor.host;}catch(e){s.crossDomain=true;}} +if(s.data&&s.processData&&typeof s.data!=="string"){s.data=jQuery.param(s.data,s.traditional);} +inspectPrefiltersOrTransports(prefilters,s,options,jqXHR);if(completed){return jqXHR;} +fireGlobals=jQuery.event&&s.global;if(fireGlobals&&jQuery.active++===0){jQuery.event.trigger("ajaxStart");} +s.type=s.type.toUpperCase();s.hasContent=!rnoContent.test(s.type);cacheURL=s.url.replace(rhash,"");if(!s.hasContent){uncached=s.url.slice(cacheURL.length);if(s.data&&(s.processData||typeof s.data==="string")){cacheURL+=(rquery.test(cacheURL)?"&":"?")+s.data;delete s.data;} +if(s.cache===false){cacheURL=cacheURL.replace(rantiCache,"$1");uncached=(rquery.test(cacheURL)?"&":"?")+"_="+(nonce.guid++)+ +uncached;} +s.url=cacheURL+uncached;}else if(s.data&&s.processData&&(s.contentType||"").indexOf("application/x-www-form-urlencoded")===0){s.data=s.data.replace(r20,"+");} +if(s.ifModified){if(jQuery.lastModified[cacheURL]){jqXHR.setRequestHeader("If-Modified-Since",jQuery.lastModified[cacheURL]);} +if(jQuery.etag[cacheURL]){jqXHR.setRequestHeader("If-None-Match",jQuery.etag[cacheURL]);}} +if(s.data&&s.hasContent&&s.contentType!==false||options.contentType){jqXHR.setRequestHeader("Content-Type",s.contentType);} +jqXHR.setRequestHeader("Accept",s.dataTypes[0]&&s.accepts[s.dataTypes[0]]?s.accepts[s.dataTypes[0]]+ +(s.dataTypes[0]!=="*"?", "+allTypes+"; q=0.01":""):s.accepts["*"]);for(i in s.headers){jqXHR.setRequestHeader(i,s.headers[i]);} +if(s.beforeSend&&(s.beforeSend.call(callbackContext,jqXHR,s)===false||completed)){return jqXHR.abort();} +strAbort="abort";completeDeferred.add(s.complete);jqXHR.done(s.success);jqXHR.fail(s.error);transport=inspectPrefiltersOrTransports(transports,s,options,jqXHR);if(!transport){done(-1,"No Transport");}else{jqXHR.readyState=1;if(fireGlobals){globalEventContext.trigger("ajaxSend",[jqXHR,s]);} +if(completed){return jqXHR;} +if(s.async&&s.timeout>0){timeoutTimer=window.setTimeout(function(){jqXHR.abort("timeout");},s.timeout);} +try{completed=false;transport.send(requestHeaders,done);}catch(e){if(completed){throw e;} +done(-1,e);}} +function done(status,nativeStatusText,responses,headers){var isSuccess,success,error,response,modified,statusText=nativeStatusText;if(completed){return;} +completed=true;if(timeoutTimer){window.clearTimeout(timeoutTimer);} +transport=undefined;responseHeadersString=headers||"";jqXHR.readyState=status>0?4:0;isSuccess=status>=200&&status<300||status===304;if(responses){response=ajaxHandleResponses(s,jqXHR,responses);} +if(!isSuccess&&jQuery.inArray("script",s.dataTypes)>-1){s.converters["text script"]=function(){};} +response=ajaxConvert(s,response,jqXHR,isSuccess);if(isSuccess){if(s.ifModified){modified=jqXHR.getResponseHeader("Last-Modified");if(modified){jQuery.lastModified[cacheURL]=modified;} +modified=jqXHR.getResponseHeader("etag");if(modified){jQuery.etag[cacheURL]=modified;}} +if(status===204||s.type==="HEAD"){statusText="nocontent";}else if(status===304){statusText="notmodified";}else{statusText=response.state;success=response.data;error=response.error;isSuccess=!error;}}else{error=statusText;if(status||!statusText){statusText="error";if(status<0){status=0;}}} +jqXHR.status=status;jqXHR.statusText=(nativeStatusText||statusText)+"";if(isSuccess){deferred.resolveWith(callbackContext,[success,statusText,jqXHR]);}else{deferred.rejectWith(callbackContext,[jqXHR,statusText,error]);} +jqXHR.statusCode(statusCode);statusCode=undefined;if(fireGlobals){globalEventContext.trigger(isSuccess?"ajaxSuccess":"ajaxError",[jqXHR,s,isSuccess?success:error]);} +completeDeferred.fireWith(callbackContext,[jqXHR,statusText]);if(fireGlobals){globalEventContext.trigger("ajaxComplete",[jqXHR,s]);if(!(--jQuery.active)){jQuery.event.trigger("ajaxStop");}}} +return jqXHR;},getJSON:function(url,data,callback){return jQuery.get(url,data,callback,"json");},getScript:function(url,callback){return jQuery.get(url,undefined,callback,"script");}});jQuery.each(["get","post"],function(_i,method){jQuery[method]=function(url,data,callback,type){if(isFunction(data)){type=type||callback;callback=data;data=undefined;} +return jQuery.ajax(jQuery.extend({url:url,type:method,dataType:type,data:data,success:callback},jQuery.isPlainObject(url)&&url));};});jQuery.ajaxPrefilter(function(s){var i;for(i in s.headers){if(i.toLowerCase()==="content-type"){s.contentType=s.headers[i]||"";}}});jQuery._evalUrl=function(url,options,doc){return jQuery.ajax({url:url,type:"GET",dataType:"script",cache:true,async:false,global:false,converters:{"text script":function(){}},dataFilter:function(response){jQuery.globalEval(response,options,doc);}});};jQuery.fn.extend({wrapAll:function(html){var wrap;if(this[0]){if(isFunction(html)){html=html.call(this[0]);} +wrap=jQuery(html,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){wrap.insertBefore(this[0]);} +wrap.map(function(){var elem=this;while(elem.firstElementChild){elem=elem.firstElementChild;} +return elem;}).append(this);} +return this;},wrapInner:function(html){if(isFunction(html)){return this.each(function(i){jQuery(this).wrapInner(html.call(this,i));});} +return this.each(function(){var self=jQuery(this),contents=self.contents();if(contents.length){contents.wrapAll(html);}else{self.append(html);}});},wrap:function(html){var htmlIsFunction=isFunction(html);return this.each(function(i){jQuery(this).wrapAll(htmlIsFunction?html.call(this,i):html);});},unwrap:function(selector){this.parent(selector).not("body").each(function(){jQuery(this).replaceWith(this.childNodes);});return this;}});jQuery.expr.pseudos.hidden=function(elem){return!jQuery.expr.pseudos.visible(elem);};jQuery.expr.pseudos.visible=function(elem){return!!(elem.offsetWidth||elem.offsetHeight||elem.getClientRects().length);};jQuery.ajaxSettings.xhr=function(){try{return new window.XMLHttpRequest();}catch(e){}};var xhrSuccessStatus={0:200,1223:204},xhrSupported=jQuery.ajaxSettings.xhr();support.cors=!!xhrSupported&&("withCredentials"in xhrSupported);support.ajax=xhrSupported=!!xhrSupported;jQuery.ajaxTransport(function(options){var callback,errorCallback;if(support.cors||xhrSupported&&!options.crossDomain){return{send:function(headers,complete){var i,xhr=options.xhr();xhr.open(options.type,options.url,options.async,options.username,options.password);if(options.xhrFields){for(i in options.xhrFields){xhr[i]=options.xhrFields[i];}} +if(options.mimeType&&xhr.overrideMimeType){xhr.overrideMimeType(options.mimeType);} +if(!options.crossDomain&&!headers["X-Requested-With"]){headers["X-Requested-With"]="XMLHttpRequest";} +for(i in headers){xhr.setRequestHeader(i,headers[i]);} +callback=function(type){return function(){if(callback){callback=errorCallback=xhr.onload=xhr.onerror=xhr.onabort=xhr.ontimeout=xhr.onreadystatechange=null;if(type==="abort"){xhr.abort();}else if(type==="error"){if(typeof xhr.status!=="number"){complete(0,"error");}else{complete(xhr.status,xhr.statusText);}}else{complete(xhrSuccessStatus[xhr.status]||xhr.status,xhr.statusText,(xhr.responseType||"text")!=="text"||typeof xhr.responseText!=="string"?{binary:xhr.response}:{text:xhr.responseText},xhr.getAllResponseHeaders());}}};};xhr.onload=callback();errorCallback=xhr.onerror=xhr.ontimeout=callback("error");if(xhr.onabort!==undefined){xhr.onabort=errorCallback;}else{xhr.onreadystatechange=function(){if(xhr.readyState===4){window.setTimeout(function(){if(callback){errorCallback();}});}};} +callback=callback("abort");try{xhr.send(options.hasContent&&options.data||null);}catch(e){if(callback){throw e;}}},abort:function(){if(callback){callback();}}};}});jQuery.ajaxPrefilter(function(s){if(s.crossDomain){s.contents.script=false;}});jQuery.ajaxSetup({accepts:{script:"text/javascript, application/javascript, "+ +"application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(text){jQuery.globalEval(text);return text;}}});jQuery.ajaxPrefilter("script",function(s){if(s.cache===undefined){s.cache=false;} +if(s.crossDomain){s.type="GET";}});jQuery.ajaxTransport("script",function(s){if(s.crossDomain||s.scriptAttrs){var script,callback;return{send:function(_,complete){script=jQuery(" + + - - + + + - + + + + + + - - - -
    - + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + +
    +

    Back on the Fediverse

    + +
    + + Sun, Feb 14, 2021 + + + One-minute read +
    + +
    +

    A recent post from Alan Pope, Mastodon Instances, Everywhere, reminded me that I also used to run a Mastodon instance back when it was all still new and shiny.

    My instance ran for awhile and had a few users and I actually enjoyed being on the network. It was much more civil and discussions seemed friendlier than Twitter. Eventually, I shut my instance down as it took more and more sysadmin time, was quite resource hungry and their updates did not always go smoothly.

    Recently, I decided to jump back into the Fediverse and see how many people I could follow there instead of on Twitter. Not surprisingly, most of those in the Linux community are the easiest to find Mastodon accounts for.

    To get on the Fediverse, I chose to spin up an instance of Pleroma and so far I’m liking this. It uses a lot less resources than Mastodon itself, seems easier to keep up-to-date and even has a clone of the Mastodon interface (see MastoFE).

    How long will I run it this time? Who knows, but I am enjoying it again and without the stress of running a “real” Mastodon instance.

    +
    +
    +
    + + +
    +
    - - - + +
    + + +
    +
    - - - - + + + + + + - + diff --git a/public/post/2021/02/online-with-hugo/index.html b/public/post/2021/02/online-with-hugo/index.html index 6ac1d51..3b1a280 100644 --- a/public/post/2021/02/online-with-hugo/index.html +++ b/public/post/2021/02/online-with-hugo/index.html @@ -1,151 +1,205 @@ - - - + + Glenn | Online With Hugo + - Online With Hugo | Caffeinated Blog - - + + - - - - - - - + + + + + + + + + + + + + + - - - + + + - - + + + - + + + + + + - - - -
    - + +
    +
    © Glenn 2021
    +
    + +
    +
    + +
    - - - - -
    -
    -
    -

    Online With Hugo

    -

    Posted on - by -

    +
  • Home
    • + +
  • Posts
    • + -
    -
    -

    As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. I have just spun up a new web host with Apache and Git to automatically pull site changes from the repo and publish them. It’s all working beautifully so far.

    - -
    - -
    +
  • Contact
    • + + + +
  • + + + +
    • + +
    - - - -

    - Copyright © 2021, Glenn Rice -

    - - - - + + + + + + - + diff --git a/public/post/author-bios/index.html b/public/post/author-bios/index.html deleted file mode 100644 index f16a1a8..0000000 --- a/public/post/author-bios/index.html +++ /dev/null @@ -1,225 +0,0 @@ - - - - - - Author Bios | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
    - - -
    - - - - -
    -
    -
    -

    Author Bios

    - -

    Posted on - by -

    - - -

    Category: - - meta - -

    -
    - -
    -
    -

    The bottom of every page in the theme can optionally show a short biography of the site author, including a profile picture, email link, and location.

    -

    Setting up the author bio

    -

    A set of configuration options are used for displaying the biography.

    -
    [params]
-  Author = "Author Name"
-  Avatar = "images/site-logo.svg"
-  Biography = "A short description, a few sentences describing the author. Set
-               the 'ShowBio' parameter to false to hide this."
-  ShowBio = true        
-
-[params.indieWeb]  
-    EmailAddress = "email.address@example.com"
-    Country = "CountryName"
-    City = "CityName"
-

    Specifics on each setting item are as follows:

    -
      -
    • Author: Your name; this is the site author name.
      • -
    • Avatar: The path to your profile picture. By default, it will show the theme’s logo (/static/images/site-logo.svg).
      • -
    • Biography: Hopefully the placeholder text here is self-explanatory; add a couple of short sentences about yourself here.
      • -
    • ShowBio: If you prefer not to show the author bio, set this to false. By default, it’s set to true.
      • -
    • EmailAddress: The email address at which you can be contacted.
      • -
    • Country: The name of the country in which you live.
      • -
    • City: The name of the city in which you live.
      • -
    -

    IndieWeb features

    -

    The following classes are used to mark up the author bio for IndieWeb parsing:

    - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
    ElementClass
    The author cardh-card
    Profile pictureu-photo
    Author URL*p-name, u-url, rel=me
    Cityp-locality
    Countryp-country-name
    Email addressu-email
    Biographyp-note
    -

    *Author URL is set to the site’s base URL.

    -
    - -
    -
    - - - - - - - diff --git a/public/post/emoji-support/index.html b/public/post/emoji-support/index.html new file mode 100644 index 0000000..5e2e207 --- /dev/null +++ b/public/post/emoji-support/index.html @@ -0,0 +1,208 @@ + + + Glenn | Emoji Support + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + +
    +

    Emoji Support

    + +
    + + Tue, Mar 5, 2019 + + + One-minute read +
    + +
    + +

    Emoji can be enabled in a Hugo project in a number of ways.

    +

    The emojify function can be called directly in templates or Inline Shortcodes.

    +

    To enable emoji globally, set enableEmoji to true in your site’s configuration and then you can type emoji shorthand codes directly in content files; e.g.

    + +

    The Emoji cheat sheet is a useful reference for emoji shorthand codes.

    +
    +

    N.B. The above steps enable Unicode Standard emoji characters and sequences in Hugo, however the rendering of these glyphs depends on the browser and the platform. To style the emoji you can either use a third party emoji font or a font stack; e.g.

    +
    .emoji {
+  font-family: Apple Color Emoji, Segoe UI Emoji, NotoColorEmoji, Segoe UI Symbol, Android Emoji, EmojiSymbols;
+}
    +
    +
    + + emoji + +
    +
    + + +
    + + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/post/featured-typefaces/index.html b/public/post/featured-typefaces/index.html deleted file mode 100644 index d7aa63b..0000000 --- a/public/post/featured-typefaces/index.html +++ /dev/null @@ -1,192 +0,0 @@ - - - - - - Featured Typefaces | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
    - - -
    - - - - -
    -
    -
    -

    Featured Typefaces

    - -

    Posted on - by -

    - - -

    Category: - - meta - -

    -
    - -
    -
    -

    Indigo uses a combination of three beautiful typefaces to render your words.

    - -

    Licenses are included in the theme’s static/fonts folder.

    -

    Have a look at a couple of paragraphs of placeholder text using the wonderfully readable Charter:

    -
    -

    Lorem ipsum dolor sit amet, consectetur adipiscing elit. Integer eleifend nulla ac elit venenatis posuere. Sed id aliquam arcu, et malesuada lectus. Donec et dignissim massa. Pellentesque in laoreet nibh. Pellentesque sagittis, libero quis vestibulum aliquam, ante risus imperdiet magna, at ornare dolor libero quis nunc. Donec quis tempus purus. Cras ornare magna ac facilisis tristique. Nulla aliquet purus quis massa rutrum interdum ac at magna. Cras fermentum magna id orci viverra facilisis. Ut vitae lobortis nisl.

    -

    Sed interdum tincidunt venenatis. Sed hendrerit dictum nisi, at dignissim orci consectetur quis. Aenean sed nisl et nisl placerat euismod. Proin hendrerit nulla at rhoncus molestie. Cras eu gravida erat, vestibulum ornare diam. Praesent nunc arcu, ultrices et risus sed, dictum mattis dui. Maecenas vitae nisl at massa porta pellentesque. Donec eget urna eget nisl imperdiet scelerisque eget a mauris. Nam fringilla sem id vehicula rhoncus. Curabitur tincidunt massa mauris, facilisis placerat odio eleifend sit amet. Etiam nec vehicula sapien, at dignissim risus. Sed elit erat, lacinia eu vulputate at, semper eu nulla. Quisque a urna sed nulla viverra egestas nec quis nunc. Curabitur iaculis elit in orci sollicitudin suscipit.

    -
    -

    And code snippets look great with Fira Code:

    -
    <article>
-    <header>
-    {{ if .Title }}
-    <h2 class="list-title"><a href="{{ .Permalink }}">{{ .Title }}</a></h2>
-    {{ end }}
-    <p class="list-post-date">
-        <time datetime="{{ .Date.Format "2006-01-02T15:04:05Z07:00" | safeHTML }}">
-        {{ .PublishDate.Format "2 January, 2006 at 15:04 MST" }}
-        </time>
-    </p>
-    </header>
-    <div>
-    {{ .Summary | plainify | safeHTML }}
-    </div>
-    {{ if .Truncated }}
-    <p><a class="read-more" href="{{ .Permalink }}">Read more &rarr;</a></p>
-    {{ end }}
-</article>
-
    -
    - -
    -
    - - - - - - - diff --git a/public/post/image-test/index.html b/public/post/image-test/index.html new file mode 100644 index 0000000..ec86624 --- /dev/null +++ b/public/post/image-test/index.html @@ -0,0 +1,214 @@ + + + Glenn | Guide to Thumbnails in Hugo + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + + Thumbnail image + +
    +

    Guide to Thumbnails in Hugo

    + +
    + + Mon, Mar 4, 2019 + + + One-minute read +
    + +
    + +

    Thumbnails can be enabled easily by setting the thumbnail parameter in the frontmatter to an image such as "images/landscape.jpg".

    +

    Make sure to copy the image the static/images/ directory.

    +

    If put together, it will look like this (that’s in fact this post’s frontmatter):

    +
    +++
+author = "Hugo Authors"
+title = "Guide to Thumbnails in Hugo"
+date = "2019-03-04"
+description = "Guide to Thumbnails in Hugo"
+tags = [
+    "thumbnail",
+]
+thumbnail= "images/landscape.jpg"
++++
+
    +
    +
    + + thumbnail + +
    +
    + + +
    + + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/post/index.html b/public/post/index.html index f33a579..e869ef0 100644 --- a/public/post/index.html +++ b/public/post/index.html @@ -1,162 +1,198 @@ - - - + + Glenn | Posts + - Posts | Caffeinated Blog - - + + - - - - - - - + + + + + + + + + + + + + + + + - - + + + - + + + - - - - + + + + + + - - - -
    - - - + +
    - -

    Posts

    -
    - - -
    -
    +
  • + + + +
    • -

    Back on the Fediverse

    +
  • + + + +
    • -

    - -

    -
    -
    - A recent post from Alan Pope, Mastodon Instances, Everywhere, reminded me that I also used to run a Mastodon instance back when it was all still new and shiny. -My instance ran for awhile and had a few users and I actually enjoyed being on the network. It was much more civil and discussions seemed friendlier than Twitter. Eventually, I shut my instance down as it took more and more sysadmin time, was quite resource hungry and their updates did not always go smoothly. -
    - -

    Read more →

    - -
    - - - -
    -
    +
  • + + + +
    • -

    Online With Hugo

    +
  • + + + +
    • -

    - -

    -
    -
    - As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. I have just spun up a new web host with Apache and Git to automatically pull site changes from the repo and publish them. It’s all working beautifully so far. -
    - -
    - + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + +
    - - + + + + + + + - + diff --git a/public/post/index.xml b/public/post/index.xml index 6e8146d..bc64d35 100644 --- a/public/post/index.xml +++ b/public/post/index.xml @@ -1,34 +1,32 @@ - Posts on Caffeinated Blog - https://caffeinated.blog/post/ - Recent content in Posts on Caffeinated Blog + Posts on Website of Jane Doe + https://example.com/post/ + Recent content in Posts on Website of Jane Doe Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice + en Sun, 14 Feb 2021 20:47:38 +1000 - + Back on the Fediverse - https://caffeinated.blog/post/2021/02/back-on-the-fediverse/ + https://example.com/post/2021/02/back-on-the-fediverse/ Sun, 14 Feb 2021 20:47:38 +1000 - https://caffeinated.blog/post/2021/02/back-on-the-fediverse/ - A recent post from Alan Pope, Mastodon Instances, Everywhere, reminded me that I also used to run a Mastodon instance back when it was all still new and shiny. -My instance ran for awhile and had a few users and I actually enjoyed being on the network. It was much more civil and discussions seemed friendlier than Twitter. Eventually, I shut my instance down as it took more and more sysadmin time, was quite resource hungry and their updates did not always go smoothly. + https://example.com/post/2021/02/back-on-the-fediverse/ + A recent post from Alan Pope, Mastodon Instances, Everywhere, reminded me that I also used to run a Mastodon instance back when it was all still new and shiny. Online With Hugo - https://caffeinated.blog/post/2021/02/online-with-hugo/ + https://example.com/post/2021/02/online-with-hugo/ Tue, 02 Feb 2021 22:53:29 +1000 - https://caffeinated.blog/post/2021/02/online-with-hugo/ - As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. I have just spun up a new web host with Apache and Git to automatically pull site changes from the repo and publish them. It&rsquo;s all working beautifully so far. + https://example.com/post/2021/02/online-with-hugo/ + As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. diff --git a/public/post/introducing-indigo/index.html b/public/post/introducing-indigo/index.html deleted file mode 100644 index 09f081c..0000000 --- a/public/post/introducing-indigo/index.html +++ /dev/null @@ -1,207 +0,0 @@ - - - - - - Introducing Indigo | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
    - - -
    - - - - -
    -
    -
    -

    Introducing Indigo

    - -

    Posted on - by -

    - - -

    Category: - - meta - -

    -
    - -
    -
    -

    Indigo is a lightweight theme for Hugo with IndieWeb features baked in. It’s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces.

    -

    IndieWeb features

    -

    A key feature of this theme is its support for IndieWeb features, including microformats and web sign-in.

    -

    Web sign-in

    -

    Indigo handles web sign-in by setting the authorization_endpoint to IndieAuth.com:

    -
    -

    IndieAuth.com is part of the IndieWeb movement to take back control of your online identity. Instead of logging in to websites as “you on Twitter” or “you on Facebook”, you should be able to log in as just “you”.

    -
    -

    This allows you to sign in to certain services simply by providing your site’s domain name.

    -

    microformats

    -

    Indigo marks up content with appropriate microformats, which provides semantic definitions of your content to other software. Posts are marked up with h-entry classes, like p-name, p-author, and e-content, while the author bio is marked up with h-card classes, including u-photo, u-url, p-locality/p-country-name, and p-note.

    -

    Open typefaces

    -

    Indigo uses a combination of three beautiful typefaces to render your words.

    - -

    Licenses are included in the theme’s static/fonts folder.

    -

    Have a look at a couple of paragraphs of placeholder text using the wonderfully readable Charter:

    -
    -

    Lorem ipsum dolor sit amet, consectetur adipiscing elit. Integer eleifend nulla ac elit venenatis posuere. Sed id aliquam arcu, et malesuada lectus. Donec et dignissim massa. Pellentesque in laoreet nibh. Pellentesque sagittis, libero quis vestibulum aliquam, ante risus imperdiet magna, at ornare dolor libero quis nunc. Donec quis tempus purus. Cras ornare magna ac facilisis tristique. Nulla aliquet purus quis massa rutrum interdum ac at magna. Cras fermentum magna id orci viverra facilisis. Ut vitae lobortis nisl.

    -

    Sed interdum tincidunt venenatis. Sed hendrerit dictum nisi, at dignissim orci consectetur quis. Aenean sed nisl et nisl placerat euismod. Proin hendrerit nulla at rhoncus molestie. Cras eu gravida erat, vestibulum ornare diam. Praesent nunc arcu, ultrices et risus sed, dictum mattis dui. Maecenas vitae nisl at massa porta pellentesque. Donec eget urna eget nisl imperdiet scelerisque eget a mauris. Nam fringilla sem id vehicula rhoncus. Curabitur tincidunt massa mauris, facilisis placerat odio eleifend sit amet. Etiam nec vehicula sapien, at dignissim risus. Sed elit erat, lacinia eu vulputate at, semper eu nulla. Quisque a urna sed nulla viverra egestas nec quis nunc. Curabitur iaculis elit in orci sollicitudin suscipit.

    -
    -

    And code snippets look great with Fira Code:

    -
    <article>
-    <header>
-    {{ if .Title }}
-    <h2 class="list-title"><a href="{{ .Permalink }}">{{ .Title }}</a></h2>
-    {{ end }}
-    <p class="list-post-date">
-        <time datetime="{{ .Date.Format "2006-01-02T15:04:05Z07:00" | safeHTML }}">
-        {{ .PublishDate.Format "2 January, 2006 at 15:04 MST" }}
-        </time>
-    </p>
-    </header>
-    <div>
-    {{ .Summary | plainify | safeHTML }}
-    </div>
-    {{ if .Truncated }}
-    <p><a class="read-more" href="{{ .Permalink }}">Read more &rarr;</a></p>
-    {{ end }}
-</article>
-

    Contributions welcome

    -

    Indigo is distributed under the MIT license, so feel free to fork the repository and make it your own! If you’ve got ideas on how to improve the theme, let me know by opening an issue in GitHub — but please be sure to review the documentation on contributing.

    -
    - -
    -
    - - - - - - - diff --git a/public/post/markdown-syntax/index.html b/public/post/markdown-syntax/index.html new file mode 100644 index 0000000..96a19ae --- /dev/null +++ b/public/post/markdown-syntax/index.html @@ -0,0 +1,338 @@ + + + Glenn | Markdown Syntax Guide + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + +
    +

    Markdown Syntax Guide

    + +
    + + Mon, Mar 11, 2019 + + + 3-minute read +
    + +
    + +

    This article offers a sample of basic Markdown syntax that can be used in Hugo content files, also it shows whether basic HTML elements are decorated with CSS in a Hugo theme.

    +

    Headings

    +

    The following HTML <h1>—<h6> elements represent six levels of section headings. <h1> is the highest section level while <h6> is the lowest.

    +

    H1

    +

    H2

    +

    H3

    +

    H4

    +
    H5
    +
    H6
    +

    Paragraph

    +

    Xerum, quo qui aut unt expliquam qui dolut labo. Aque venitatiusda cum, voluptionse latur sitiae dolessi aut parist aut dollo enim qui voluptate ma dolestendit peritin re plis aut quas inctum laceat est volestemque commosa as cus endigna tectur, offic to cor sequas etum rerum idem sintibus eiur? Quianimin porecus evelectur, cum que nis nust voloribus ratem aut omnimi, sitatur? Quiatem. Nam, omnis sum am facea corem alique molestrunt et eos evelece arcillit ut aut eos eos nus, sin conecerem erum fuga. Ri oditatquam, ad quibus unda veliamenimin cusam et facea ipsamus es exerum sitate dolores editium rerore eost, temped molorro ratiae volorro te reribus dolorer sperchicium faceata tiustia prat.

    +

    Itatur? Quiatae cullecum rem ent aut odis in re eossequodi nonsequ idebis ne sapicia is sinveli squiatum, core et que aut hariosam ex eat.

    +

    Blockquotes

    +

    The blockquote element represents content that is quoted from another source, optionally with a citation which must be within a footer or cite element, and optionally with in-line changes such as annotations and abbreviations.

    +

    Blockquote without attribution

    +
    +

    Tiam, ad mint andaepu dandae nostion secatur sequo quae. +Note that you can use Markdown syntax within a blockquote.

    +
    +

    Blockquote with attribution

    +
    +

    Don’t communicate by sharing memory, share memory by communicating. +— Rob Pike1

    +
    +

    Tables

    +

    Tables aren’t part of the core Markdown spec, but Hugo supports supports them out-of-the-box.

    + + + + + + + + + + + + + + + + + +
    NameAge
    Bob27
    Alice23
    +

    Inline Markdown within tables

    + + + + + + + + + + + + + + + +
    ItalicsBoldCode
    italicsboldcode
    +

    Code Blocks

    +

    Code block with backticks

    +
    <!doctype html>
+<html lang="en">
+<head>
+  <meta charset="utf-8">
+  <title>Example HTML5 Document</title>
+</head>
+<body>
+  <p>Test</p>
+</body>
+</html>
+

    Code block indented with four spaces

    +
    <!doctype html>
+<html lang="en">
+<head>
+  <meta charset="utf-8">
+  <title>Example HTML5 Document</title>
+</head>
+<body>
+  <p>Test</p>
+</body>
+</html>
+
    +

    Code block with Hugo’s internal highlight shortcode

    +
    <!doctype html>
+<html lang="en">
+<head>
+  <meta charset="utf-8">
+  <title>Example HTML5 Document</title>
+</head>
+<body>
+  <p>Test</p>
+</body>
+</html>
    +

    List Types

    +

    Ordered List

    +
      +
    1. First item
      2. +
    2. Second item
      3. +
    3. Third item
      4. +
    +

    Unordered List

    +
      +
    • List item
      • +
    • Another item
      • +
    • And another item
      • +
    +

    Nested list

    +
      +
    • Fruit +
        +
      • Apple
        • +
      • Orange
        • +
      • Banana
        • +
      +
      • +
    • Dairy +
        +
      • Milk
        • +
      • Cheese
        • +
      +
      • +
    +

    Other Elements — abbr, sub, sup, kbd, mark

    +

    GIF is a bitmap image format.

    +

    H2O

    +

    Xn + Yn = Zn

    +

    Press CTRL+ALT+Delete to end the session.

    +

    Most salamanders are nocturnal, and hunt for insects, worms, and other small creatures.

    +
    +
    +
      +
    1. +

      The above quote is excerpted from Rob Pike’s talk during Gopherfest, November 18, 2015. ↩︎

      +
      2. +
    +
    +
    +
    + themessyntax + + markdowncsshtml + +
    +
    + + +
    + + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/post/math-typesetting/index.html b/public/post/math-typesetting/index.html new file mode 100644 index 0000000..c84077f --- /dev/null +++ b/public/post/math-typesetting/index.html @@ -0,0 +1,229 @@ + + + Glenn | Math Typesetting + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + +
    +

    Math Typesetting

    + +
    + + Fri, Mar 8, 2019 + + + One-minute read +
    + +
    + +

    Mathematical notation in a Hugo project can be enabled by using third party JavaScript libraries.

    +

    In this example we will be using KaTeX

    +
      +
    • Create a partial under /layouts/partials/math.html
      • +
    • Within this partial reference the Auto-render Extension or host these scripts locally.
      • +
    • Include the partial in your templates like so:
      • +
    +
    {{ if or .Params.math .Site.Params.math }}
+{{ partial "math.html" . }}
+{{ end }}
+
      +
    • To enable KaTex globally set the parameter math to true in a project’s configuration
      • +
    • To enable KaTex on a per page basis include the parameter math: true in content files
      • +
    +

    Note: Use the online reference of Supported TeX Functions

    + +

    Examples

    +

    Inline math: \(\varphi = \dfrac{1+\sqrt5}{2}= 1.6180339887…\)

    +

    Block math: +$$ +\varphi = 1+\frac{1} {1+\frac{1} {1+\frac{1} {1+\cdots} } } +$$

    +
    +
    + + +
    +
    + + +
    + + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/post/migrate-from-jekyl/index.html b/public/post/migrate-from-jekyl/index.html new file mode 100644 index 0000000..c6b6179 --- /dev/null +++ b/public/post/migrate-from-jekyl/index.html @@ -0,0 +1 @@ +https://example.com/post/markdown-syntax/ \ No newline at end of file diff --git a/public/post/page/1/index.html b/public/post/page/1/index.html deleted file mode 100644 index 8e6323c..0000000 --- a/public/post/page/1/index.html +++ /dev/null @@ -1 +0,0 @@ -https://caffeinated.blog/post/ \ No newline at end of file diff --git a/public/post/placeholder-text/index.html b/public/post/placeholder-text/index.html new file mode 100644 index 0000000..2c17497 --- /dev/null +++ b/public/post/placeholder-text/index.html @@ -0,0 +1,221 @@ + + + Glenn | Placeholder Text + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + +
    +

    Placeholder Text

    + +
    + + Sat, Mar 9, 2019 + + + 2-minute read +
    + +
    + +

    Lorem est tota propiore conpellat pectoribus de pectora summo.

    +

    Redit teque digerit hominumque toris verebor lumina non cervice subde tollit usus habet Arctonque, furores quas nec ferunt. Quoque montibus nunc caluere tempus inhospita parcite confusaque translucet patri vestro qui optatis lumine cognoscere flos nubis! Fronde ipsamque patulos Dryopen deorum.

    +
      +
    1. Exierant elisi ambit vivere dedere
      2. +
    2. Duce pollice
      3. +
    3. Eris modo
      4. +
    4. Spargitque ferrea quos palude
      5. +
    +

    Rursus nulli murmur; hastile inridet ut ab gravi sententia! Nomine potitus silentia flumen, sustinet placuit petis in dilapsa erat sunt. Atria tractus malis.

    +
      +
    1. Comas hunc haec pietate fetum procerum dixit
      2. +
    2. Post torum vates letum Tiresia
      3. +
    3. Flumen querellas
      4. +
    4. Arcanaque montibus omnes
      5. +
    5. Quidem et
      6. +
    +

    Vagus elidunt

    +

    +

    The Van de Graaf Canon

    +

    Mane refeci capiebant unda mulcebat

    +

    Victa caducifer, malo vulnere contra dicere aurato, ludit regale, voca! Retorsit colit est profanae esse virescere furit nec; iaculi matertera et visa est, viribus. Divesque creatis, tecta novat collumque vulnus est, parvas. Faces illo pepulere tempus adest. Tendit flamma, ab opes virum sustinet, sidus sequendo urbis.

    +

    Iubar proles corpore raptos vero auctor imperium; sed et huic: manus caeli Lelegas tu lux. Verbis obstitit intus oblectamina fixis linguisque ausus sperare Echionides cornuaque tenent clausit possit. Omnia putatur. Praeteritae refert ausus; ferebant e primus lora nutat, vici quae mea ipse. Et iter nil spectatae vulnus haerentia iuste et exercebat, sui et.

    +

    Eurytus Hector, materna ipsumque ut Politen, nec, nate, ignari, vernum cohaesit sequitur. Vel mitis temploque vocatus, inque alis, oculos nomen non silvis corpore coniunx ne displicet illa. Crescunt non unus, vidit visa quantum inmiti flumina mortis facto sic: undique a alios vincula sunt iactata abdita! Suspenderat ego fuit tendit: luna, ante urbem Propoetides parte.

    +
    +
    + + markdowntext + +
    +
    + + +
    + + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/post/rich-content/index.html b/public/post/rich-content/index.html new file mode 100644 index 0000000..f900627 --- /dev/null +++ b/public/post/rich-content/index.html @@ -0,0 +1,273 @@ + + + Glenn | Rich Content + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
    + +
    +

    Rich Content

    + +
    + + Sun, Mar 10, 2019 + + + One-minute read +
    + +
    + +

    Hugo ships with several Built-in Shortcodes for rich content, along with a Privacy Config and a set of Simple Shortcodes that enable static and no-JS versions of various social media embeds.

    +
    +

    YouTube Privacy Enhanced Shortcode

    + +
    + +
    + + +
    +

    Twitter Simple Shortcode

    + + + + + + + + + +
    +

    Vimeo Simple Shortcode

    + + + + + + + + +
    + + + +Sing Jan Swing - Kinetic Type +
    +
    +
    + + shortcodesprivacy + +
    +
    + + +
    + + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/posts/index.html b/public/posts/index.html new file mode 100644 index 0000000..e111f0a --- /dev/null +++ b/public/posts/index.html @@ -0,0 +1 @@ +https://example.com/post/ \ No newline at end of file diff --git a/public/robots.txt b/public/robots.txt new file mode 100644 index 0000000..4f9540b --- /dev/null +++ b/public/robots.txt @@ -0,0 +1 @@ +User-agent: * \ No newline at end of file diff --git a/public/safari-pinned-tab.svg b/public/safari-pinned-tab.svg deleted file mode 100644 index f979035..0000000 --- a/public/safari-pinned-tab.svg +++ /dev/null @@ -1,47 +0,0 @@ - - - - -Created by potrace 1.11, written by Peter Selinger 2001-2013 - - - - - diff --git a/public/showcase/index.html b/public/showcase/index.html new file mode 100644 index 0000000..e111f0a --- /dev/null +++ b/public/showcase/index.html @@ -0,0 +1 @@ +https://example.com/post/ \ No newline at end of file diff --git a/public/site.webmanifest b/public/site.webmanifest deleted file mode 100644 index b20abb7..0000000 --- a/public/site.webmanifest +++ /dev/null @@ -1,19 +0,0 @@ -{ - "name": "", - "short_name": "", - "icons": [ - { - "src": "/android-chrome-192x192.png", - "sizes": "192x192", - "type": "image/png" - }, - { - "src": "/android-chrome-512x512.png", - "sizes": "512x512", - "type": "image/png" - } - ], - "theme_color": "#ffffff", - "background_color": "#ffffff", - "display": "standalone" -} diff --git a/public/sitemap.xml b/public/sitemap.xml index c52cb6a..6fde02a 100644 --- a/public/sitemap.xml +++ b/public/sitemap.xml @@ -3,39 +3,62 @@ xmlns:xhtml="http://www.w3.org/1999/xhtml"> - https://caffeinated.blog/post/2021/02/back-on-the-fediverse/ + https://example.com/ 2021-02-14T20:47:38+10:00 - https://caffeinated.blog/ + https://example.com/post/2021/02/back-on-the-fediverse/ 2021-02-14T20:47:38+10:00 - https://caffeinated.blog/post/ + https://example.com/post/ 2021-02-14T20:47:38+10:00 - https://caffeinated.blog/post/2021/02/online-with-hugo/ + https://example.com/categories/blogging/ 2021-02-02T22:53:29+10:00 - https://caffeinated.blog/about/ + https://example.com/categories/ + 2021-02-02T22:53:29+10:00 - https://caffeinated.blog/adding-menu-items/ + https://example.com/tags/newbeginnings/ + 2021-02-02T22:53:29+10:00 - https://caffeinated.blog/categories/ + https://example.com/post/2021/02/online-with-hugo/ + 2021-02-02T22:53:29+10:00 - https://caffeinated.blog/tags/ + https://example.com/tags/ + 2021-02-02T22:53:29+10:00 + + + + https://example.com/archives/ + 2019-05-28T00:00:00+00:00 + + + + https://example.com/contact/ + 2019-03-08T00:00:00+00:00 + + + + https://example.com/about/ + 2019-02-28T00:00:00+00:00 + + + + https://example.com/tags/index/ \ No newline at end of file diff --git a/public/tags/css/index.html b/public/tags/css/index.html new file mode 100644 index 0000000..700220b --- /dev/null +++ b/public/tags/css/index.html @@ -0,0 +1,189 @@ + + + Glenn | css + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/css/index.xml b/public/tags/css/index.xml new file mode 100644 index 0000000..a4519cf --- /dev/null +++ b/public/tags/css/index.xml @@ -0,0 +1,24 @@ + + + + css on Website of Jane Doe + https://example.com/tags/css/ + Recent content in css on Website of Jane Doe + Hugo -- gohugo.io + en + Mon, 11 Mar 2019 00:00:00 +0000 + + + + + + Markdown Syntax Guide + https://example.com/post/markdown-syntax/ + Mon, 11 Mar 2019 00:00:00 +0000 + + https://example.com/post/markdown-syntax/ + <p>This article offers a sample of basic Markdown syntax that can be used in Hugo content files, also it shows whether basic HTML elements are decorated with CSS in a Hugo theme.</p> + + + + \ No newline at end of file diff --git a/public/tags/emoji/index.html b/public/tags/emoji/index.html new file mode 100644 index 0000000..fd1b61c --- /dev/null +++ b/public/tags/emoji/index.html @@ -0,0 +1,189 @@ + + + Glenn | emoji + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/emoji/index.xml b/public/tags/emoji/index.xml new file mode 100644 index 0000000..87aeabb --- /dev/null +++ b/public/tags/emoji/index.xml @@ -0,0 +1,24 @@ + + + + emoji on Website of Jane Doe + https://example.com/tags/emoji/ + Recent content in emoji on Website of Jane Doe + Hugo -- gohugo.io + en + Tue, 05 Mar 2019 00:00:00 +0000 + + + + + + Emoji Support + https://example.com/post/emoji-support/ + Tue, 05 Mar 2019 00:00:00 +0000 + + https://example.com/post/emoji-support/ + <p>Emoji can be enabled in a Hugo project in a number of ways.</p> + + + + \ No newline at end of file diff --git a/public/tags/html/index.html b/public/tags/html/index.html new file mode 100644 index 0000000..e24ce0b --- /dev/null +++ b/public/tags/html/index.html @@ -0,0 +1,189 @@ + + + Glenn | html + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/html/index.xml b/public/tags/html/index.xml new file mode 100644 index 0000000..420579e --- /dev/null +++ b/public/tags/html/index.xml @@ -0,0 +1,24 @@ + + + + html on Website of Jane Doe + https://example.com/tags/html/ + Recent content in html on Website of Jane Doe + Hugo -- gohugo.io + en + Mon, 11 Mar 2019 00:00:00 +0000 + + + + + + Markdown Syntax Guide + https://example.com/post/markdown-syntax/ + Mon, 11 Mar 2019 00:00:00 +0000 + + https://example.com/post/markdown-syntax/ + <p>This article offers a sample of basic Markdown syntax that can be used in Hugo content files, also it shows whether basic HTML elements are decorated with CSS in a Hugo theme.</p> + + + + \ No newline at end of file diff --git a/public/tags/index.html b/public/tags/index.html index 7ff9d70..a26c591 100644 --- a/public/tags/index.html +++ b/public/tags/index.html @@ -1,126 +1,201 @@ - - - + + Glenn | Tags + - Tags | Caffeinated Blog - - + + - - - - - - - + + + + + + + + + + + + + + + + - - + + + - + + + - - - - + + + + + + - - - -
    - - - +
    + +
    +
    © Glenn 2021
    +
    + +
    +
    + +
    - - + + + + + + + - + diff --git a/public/tags/index.xml b/public/tags/index.xml index f302743..2c61a66 100644 --- a/public/tags/index.xml +++ b/public/tags/index.xml @@ -1,15 +1,33 @@ - Tags on Caffeinated Blog - https://caffeinated.blog/tags/ - Recent content in Tags on Caffeinated Blog + Tags on Website of Jane Doe + https://example.com/tags/ + Recent content in Tags on Website of Jane Doe Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice + en + Tue, 02 Feb 2021 22:53:29 +1000 - + + + newbeginnings + https://example.com/tags/newbeginnings/ + Tue, 02 Feb 2021 22:53:29 +1000 + + https://example.com/tags/newbeginnings/ + + + + + index + https://example.com/tags/index/ + Mon, 01 Jan 0001 00:00:00 +0000 + + https://example.com/tags/index/ + + + \ No newline at end of file diff --git a/public/tags/index/index.html b/public/tags/index/index.html new file mode 100644 index 0000000..4cb8fda --- /dev/null +++ b/public/tags/index/index.html @@ -0,0 +1,189 @@ + + + Glenn | index + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    +
      + +
      2021
      + +
        +
        +
        Posts +
        Feb 14 +
        +
        +
        +
      + + +
    +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/index/index.xml b/public/tags/index/index.xml new file mode 100644 index 0000000..9375f7f --- /dev/null +++ b/public/tags/index/index.xml @@ -0,0 +1,23 @@ + + + + index on Website of Jane Doe + https://example.com/tags/index/ + Recent content in index on Website of Jane Doe + Hugo -- gohugo.io + en + + + + + + Posts + https://example.com/post/ + Sun, 14 Feb 2021 20:47:38 +1000 + + https://example.com/post/ + + + + + \ No newline at end of file diff --git a/public/tags/indieweb/index.html b/public/tags/indieweb/index.html deleted file mode 100644 index bae8978..0000000 --- a/public/tags/indieweb/index.html +++ /dev/null @@ -1,143 +0,0 @@ - - - - - - indieweb | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
    - - - - -
    - -

    - tags: - indieweb -

    - -
    - -
    -
    - -

    Introducing Indigo

    - -

    - -

    -
    -
    - Indigo is a lightweight theme for Hugo with IndieWeb features baked in. It’s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces. - -
    - -

    Read more →

    - -
    - -
    - - - - - - - diff --git a/public/tags/indieweb/index.xml b/public/tags/indieweb/index.xml deleted file mode 100644 index a2a4537..0000000 --- a/public/tags/indieweb/index.xml +++ /dev/null @@ -1,25 +0,0 @@ - - - - indieweb on Caffeinated Blog - https://caffeinated.blog/tags/indieweb/ - Recent content in indieweb on Caffeinated Blog - Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice - Mon, 01 Oct 2018 09:00:00 -0400 - - - - - - Introducing Indigo - https://caffeinated.blog/post/introducing-indigo/ - Mon, 01 Oct 2018 09:00:00 -0400 - - https://caffeinated.blog/post/introducing-indigo/ - <p>Indigo is a lightweight theme for <a href="https://gohugo.io">Hugo</a> with <a href="https://indieweb.org">IndieWeb</a> features baked in. It&rsquo;s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces.</p> - - - - \ No newline at end of file diff --git a/public/tags/markdown/index.html b/public/tags/markdown/index.html new file mode 100644 index 0000000..2c6a4c9 --- /dev/null +++ b/public/tags/markdown/index.html @@ -0,0 +1,198 @@ + + + Glenn | markdown + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/markdown/index.xml b/public/tags/markdown/index.xml new file mode 100644 index 0000000..6fc8ddd --- /dev/null +++ b/public/tags/markdown/index.xml @@ -0,0 +1,33 @@ + + + + markdown on Website of Jane Doe + https://example.com/tags/markdown/ + Recent content in markdown on Website of Jane Doe + Hugo -- gohugo.io + en + Mon, 11 Mar 2019 00:00:00 +0000 + + + + + + Markdown Syntax Guide + https://example.com/post/markdown-syntax/ + Mon, 11 Mar 2019 00:00:00 +0000 + + https://example.com/post/markdown-syntax/ + <p>This article offers a sample of basic Markdown syntax that can be used in Hugo content files, also it shows whether basic HTML elements are decorated with CSS in a Hugo theme.</p> + + + + Placeholder Text + https://example.com/post/placeholder-text/ + Sat, 09 Mar 2019 00:00:00 +0000 + + https://example.com/post/placeholder-text/ + <p>Lorem est tota propiore conpellat pectoribus de pectora summo.</p> + + + + \ No newline at end of file diff --git a/public/tags/newbeginnings/index.html b/public/tags/newbeginnings/index.html new file mode 100644 index 0000000..7d66b1e --- /dev/null +++ b/public/tags/newbeginnings/index.html @@ -0,0 +1,189 @@ + + + Glenn | newbeginnings + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/newbeginnings/index.xml b/public/tags/newbeginnings/index.xml new file mode 100644 index 0000000..cb02286 --- /dev/null +++ b/public/tags/newbeginnings/index.xml @@ -0,0 +1,24 @@ + + + + newbeginnings on Website of Jane Doe + https://example.com/tags/newbeginnings/ + Recent content in newbeginnings on Website of Jane Doe + Hugo -- gohugo.io + en + Tue, 02 Feb 2021 22:53:29 +1000 + + + + + + Online With Hugo + https://example.com/post/2021/02/online-with-hugo/ + Tue, 02 Feb 2021 22:53:29 +1000 + + https://example.com/post/2021/02/online-with-hugo/ + As part of wanting to go through and reorganise my various sites and blogs, so I (once again) have a place to write again, I have switched over to Hugo as my content system. + + + + \ No newline at end of file diff --git a/public/tags/options/index.html b/public/tags/options/index.html deleted file mode 100644 index 18f8cfa..0000000 --- a/public/tags/options/index.html +++ /dev/null @@ -1,143 +0,0 @@ - - - - - - options | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
    - - - - -
    - -

    - tags: - options -

    - -
    - -
    -
    - -

    Author Bios

    - -

    - -

    -
    -
    - The bottom of every page in the theme can optionally show a short biography of the site author, including a profile picture, email link, and location. - -
    - -

    Read more →

    - -
    - -
    - - - - - - - diff --git a/public/tags/options/index.xml b/public/tags/options/index.xml deleted file mode 100644 index 4bf56f8..0000000 --- a/public/tags/options/index.xml +++ /dev/null @@ -1,25 +0,0 @@ - - - - options on Caffeinated Blog - https://caffeinated.blog/tags/options/ - Recent content in options on Caffeinated Blog - Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice - Mon, 01 Oct 2018 08:00:00 -0400 - - - - - - Author Bios - https://caffeinated.blog/post/author-bios/ - Mon, 01 Oct 2018 08:00:00 -0400 - - https://caffeinated.blog/post/author-bios/ - <p>The bottom of every page in the theme can optionally show a short biography of the site author, including a profile picture, email link, and location.</p> - - - - \ No newline at end of file diff --git a/public/tags/page/1/index.html b/public/tags/page/1/index.html deleted file mode 100644 index 0d0a164..0000000 --- a/public/tags/page/1/index.html +++ /dev/null @@ -1 +0,0 @@ -https://example.com/tags/ \ No newline at end of file diff --git a/public/tags/privacy/index.html b/public/tags/privacy/index.html new file mode 100644 index 0000000..48588a5 --- /dev/null +++ b/public/tags/privacy/index.html @@ -0,0 +1,189 @@ + + + Glenn | privacy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/privacy/index.xml b/public/tags/privacy/index.xml new file mode 100644 index 0000000..27c8abb --- /dev/null +++ b/public/tags/privacy/index.xml @@ -0,0 +1,24 @@ + + + + privacy on Website of Jane Doe + https://example.com/tags/privacy/ + Recent content in privacy on Website of Jane Doe + Hugo -- gohugo.io + en + Sun, 10 Mar 2019 00:00:00 +0000 + + + + + + Rich Content + https://example.com/post/rich-content/ + Sun, 10 Mar 2019 00:00:00 +0000 + + https://example.com/post/rich-content/ + <p>Hugo ships with several <a href="https://gohugo.io/content-management/shortcodes/#use-hugos-built-in-shortcodes">Built-in Shortcodes</a> for rich content, along with a <a href="https://gohugo.io/about/hugo-and-gdpr/">Privacy Config</a> and a set of Simple Shortcodes that enable static and no-JS versions of various social media embeds.</p> + + + + \ No newline at end of file diff --git a/public/tags/shortcodes/index.html b/public/tags/shortcodes/index.html new file mode 100644 index 0000000..7db26c5 --- /dev/null +++ b/public/tags/shortcodes/index.html @@ -0,0 +1,189 @@ + + + Glenn | shortcodes + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/shortcodes/index.xml b/public/tags/shortcodes/index.xml new file mode 100644 index 0000000..0952638 --- /dev/null +++ b/public/tags/shortcodes/index.xml @@ -0,0 +1,24 @@ + + + + shortcodes on Website of Jane Doe + https://example.com/tags/shortcodes/ + Recent content in shortcodes on Website of Jane Doe + Hugo -- gohugo.io + en + Sun, 10 Mar 2019 00:00:00 +0000 + + + + + + Rich Content + https://example.com/post/rich-content/ + Sun, 10 Mar 2019 00:00:00 +0000 + + https://example.com/post/rich-content/ + <p>Hugo ships with several <a href="https://gohugo.io/content-management/shortcodes/#use-hugos-built-in-shortcodes">Built-in Shortcodes</a> for rich content, along with a <a href="https://gohugo.io/about/hugo-and-gdpr/">Privacy Config</a> and a set of Simple Shortcodes that enable static and no-JS versions of various social media embeds.</p> + + + + \ No newline at end of file diff --git a/public/tags/text/index.html b/public/tags/text/index.html new file mode 100644 index 0000000..b1f6266 --- /dev/null +++ b/public/tags/text/index.html @@ -0,0 +1,189 @@ + + + Glenn | text + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/text/index.xml b/public/tags/text/index.xml new file mode 100644 index 0000000..44c16ab --- /dev/null +++ b/public/tags/text/index.xml @@ -0,0 +1,24 @@ + + + + text on Website of Jane Doe + https://example.com/tags/text/ + Recent content in text on Website of Jane Doe + Hugo -- gohugo.io + en + Sat, 09 Mar 2019 00:00:00 +0000 + + + + + + Placeholder Text + https://example.com/post/placeholder-text/ + Sat, 09 Mar 2019 00:00:00 +0000 + + https://example.com/post/placeholder-text/ + <p>Lorem est tota propiore conpellat pectoribus de pectora summo.</p> + + + + \ No newline at end of file diff --git a/public/tags/thumbnail/index.html b/public/tags/thumbnail/index.html new file mode 100644 index 0000000..0921e85 --- /dev/null +++ b/public/tags/thumbnail/index.html @@ -0,0 +1,189 @@ + + + Glenn | thumbnail + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    +
    +
    + profile picture +

    Caffeinated

    +
    +

    A bit of personal space for writing

    +
    +
    +
    + +
    +
    © Glenn 2021
    +
    +
    +
    +
    + + +
    + +
    +
    +
    + +
    + +
    +
    +
    + + + + + + + + + + + + diff --git a/public/tags/thumbnail/index.xml b/public/tags/thumbnail/index.xml new file mode 100644 index 0000000..7fe0669 --- /dev/null +++ b/public/tags/thumbnail/index.xml @@ -0,0 +1,24 @@ + + + + thumbnail on Website of Jane Doe + https://example.com/tags/thumbnail/ + Recent content in thumbnail on Website of Jane Doe + Hugo -- gohugo.io + en + Mon, 04 Mar 2019 00:00:00 +0000 + + + + + + Guide to Thumbnails in Hugo + https://example.com/post/image-test/ + Mon, 04 Mar 2019 00:00:00 +0000 + + https://example.com/post/image-test/ + Thumbnails can be enabled easily by setting the thumbnail parameter in the frontmatter to an image such as &quot;images/landscape. + + + + \ No newline at end of file diff --git a/public/tags/typography/index.html b/public/tags/typography/index.html deleted file mode 100644 index ef9cf49..0000000 --- a/public/tags/typography/index.html +++ /dev/null @@ -1,163 +0,0 @@ - - - - - - typography | Caffeinated Blog - - - - - - - - - - - - - - - - - - - - - - - - - - -
    - - - - -
    - -

    - tags: - typography -

    - -
    - -
    -
    - -

    Introducing Indigo

    - -

    - -

    -
    -
    - Indigo is a lightweight theme for Hugo with IndieWeb features baked in. It’s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces. - -
    - -

    Read more →

    - -
    - -
    -
    - -

    Featured Typefaces

    - -

    - -

    -
    -
    - Indigo uses a combination of three beautiful typefaces to render your words. - -
    - -

    Read more →

    - -
    - -
    - - - - - - - diff --git a/public/tags/typography/index.xml b/public/tags/typography/index.xml deleted file mode 100644 index 3930aed..0000000 --- a/public/tags/typography/index.xml +++ /dev/null @@ -1,34 +0,0 @@ - - - - typography on Caffeinated Blog - https://caffeinated.blog/tags/typography/ - Recent content in typography on Caffeinated Blog - Hugo -- gohugo.io - en-US - Copyright © 2021, Glenn Rice - Mon, 01 Oct 2018 09:00:00 -0400 - - - - - - Introducing Indigo - https://caffeinated.blog/post/introducing-indigo/ - Mon, 01 Oct 2018 09:00:00 -0400 - - https://caffeinated.blog/post/introducing-indigo/ - <p>Indigo is a lightweight theme for <a href="https://gohugo.io">Hugo</a> with <a href="https://indieweb.org">IndieWeb</a> features baked in. It&rsquo;s great for longer-form blogging, placing its focus on distraction-free reading and beautiful typefaces.</p> - - - - Featured Typefaces - https://caffeinated.blog/post/featured-typefaces/ - Mon, 01 Oct 2018 08:30:00 -0400 - - https://caffeinated.blog/post/featured-typefaces/ - <p>Indigo uses a combination of three beautiful typefaces to render your words.</p> - - - - \ No newline at end of file diff --git a/static/favicon-16x16.png b/static/favicon-16x16.png deleted file mode 100644 index 5357f74..0000000 Binary files a/static/favicon-16x16.png and /dev/null differ diff --git a/static/favicon-32x32.png b/static/favicons/favicon.png similarity index 100% rename from static/favicon-32x32.png rename to static/favicons/favicon.png diff --git a/static/images/2021/danielle-macinnes-coffee-begin-unsplash.jpg b/static/images/2021/danielle-macinnes-coffee-begin-unsplash.jpg new file mode 100644 index 0000000..efb3064 Binary files /dev/null and b/static/images/2021/danielle-macinnes-coffee-begin-unsplash.jpg differ diff --git a/static/images/2021/danielle-macinnes-coffee-unsplash.jpg b/static/images/2021/danielle-macinnes-coffee-unsplash.jpg new file mode 100644 index 0000000..76e80bf Binary files /dev/null and b/static/images/2021/danielle-macinnes-coffee-unsplash.jpg differ diff --git a/static/images/landscape.jpg b/static/images/landscape.jpg new file mode 100644 index 0000000..7a39dfe Binary files /dev/null and b/static/images/landscape.jpg differ diff --git a/static/images/profile.jpg b/static/images/profile.jpg new file mode 100644 index 0000000..500b36f Binary files /dev/null and b/static/images/profile.jpg differ diff --git a/static/images/site-feature-image.png b/static/images/site-feature-image.png new file mode 100644 index 0000000..450269e Binary files /dev/null and b/static/images/site-feature-image.png differ diff --git a/themes/anatole/.gitattributes b/themes/anatole/.gitattributes new file mode 100644 index 0000000..dfe0770 --- /dev/null +++ b/themes/anatole/.gitattributes @@ -0,0 +1,2 @@ +# Auto detect text files and perform LF normalization +* text=auto diff --git a/themes/anatole/.github/FUNDING.yml b/themes/anatole/.github/FUNDING.yml new file mode 100644 index 0000000..7ac054a --- /dev/null +++ b/themes/anatole/.github/FUNDING.yml @@ -0,0 +1,2 @@ +--- +ko_fi: lxndrblz diff --git a/themes/anatole/.github/ISSUE_TEMPLATE/bug_report.md b/themes/anatole/.github/ISSUE_TEMPLATE/bug_report.md new file mode 100644 index 0000000..3d2b3ea --- /dev/null +++ b/themes/anatole/.github/ISSUE_TEMPLATE/bug_report.md @@ -0,0 +1,40 @@ +--- +name: Bug report +about: Create a report to help us improve +title: '' +labels: bug +assignees: lxndrblz + +--- + +**Describe the bug** +A clear and concise description of what the bug is. + +**To Reproduce** +Steps to reproduce the behavior: +1. Go to '...' +2. Click on '....' +3. Scroll down to '....' +4. See error + +**Expected behavior** +A clear and concise description of what you expected to happen. + +**Screenshots** +If applicable, add screenshots to help explain your problem. + +**Desktop (please complete the following information):** + - OS: [e.g. iOS] + - Browser [e.g. chrome, safari] + - Version of the Theme + - Version of Hugo (run a `hugo version` if unsure) + +**Smartphone (please complete the following information):** + - Device: [e.g. iPhone6] + - OS: [e.g. iOS8.1] + - Browser [e.g. stock browser, safari] + - Version of the Theme + - Version of Hugo (run a `hugo version` if unsure) + +**Additional context** +Add any other context about the problem here. diff --git a/themes/anatole/.github/ISSUE_TEMPLATE/feature_request.md b/themes/anatole/.github/ISSUE_TEMPLATE/feature_request.md new file mode 100644 index 0000000..d8ae0cc --- /dev/null +++ b/themes/anatole/.github/ISSUE_TEMPLATE/feature_request.md @@ -0,0 +1,20 @@ +--- +name: Feature request +about: Suggest an idea for this project +title: '' +labels: enhancement +assignees: lxndrblz + +--- + +**Is your feature request related to a problem? Please describe.** +A clear and concise description of what the problem is. Ex. I'm always frustrated when [...] + +**Describe the solution you'd like** +A clear and concise description of what you want to happen. + +**Describe alternatives you've considered** +A clear and concise description of any alternative solutions or features you've considered. + +**Additional context** +Add any other context or screenshots about the feature request here. diff --git a/themes/anatole/.github/stale.yml b/themes/anatole/.github/stale.yml new file mode 100644 index 0000000..82c0d00 --- /dev/null +++ b/themes/anatole/.github/stale.yml @@ -0,0 +1,18 @@ +--- +# Number of days of inactivity before an issue becomes stale +daysUntilStale: 60 +# Number of days of inactivity before a stale issue is closed +daysUntilClose: 7 +# Issues with these labels will never be considered stale +exemptLabels: + - pinned + - security +# Label to use when marking an issue as stale +staleLabel: wontfix +# Comment to post when marking an issue as stale. Set to `false` to disable +markComment: > + This issue has been automatically marked as stale because it has not had + recent activity. It will be closed if no further activity occurs. Thank you + for your contributions. +# Comment to post when closing a stale issue. Set to `false` to disable +closeComment: false diff --git a/themes/anatole/.gitignore b/themes/anatole/.gitignore new file mode 100644 index 0000000..ee4d895 --- /dev/null +++ b/themes/anatole/.gitignore @@ -0,0 +1,4 @@ +**/themes/ +demo/ +.hugo/* +!.hugo/version \ No newline at end of file diff --git a/themes/anatole/LICENSE b/themes/anatole/LICENSE new file mode 100644 index 0000000..635021b --- /dev/null +++ b/themes/anatole/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2020 lxndrblz + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/themes/anatole/README.md b/themes/anatole/README.md new file mode 100644 index 0000000..c3155e2 --- /dev/null +++ b/themes/anatole/README.md @@ -0,0 +1,450 @@ +# Anatole ![LICENSE](https://img.shields.io/badge/license-MIT-blue.svg) [![Netlify Status](https://api.netlify.com/api/v1/badges/ee7a5df4-b944-4e03-853d-39219c96d484/deploy-status)](https://alexbilz.com/) + +Anatole is a beautiful minimalist two-column [hugo](https://gohugo.io/) theme based on farbox-theme-Anatole. + +![Screenshot Anatole Theme](https://raw.githubusercontent.com/lxndrblz/anatole/master/images/screenshot.png) +![Screenshot Anatole Theme (dark)](https://raw.githubusercontent.com/lxndrblz/anatole/master/images/screenshot_dark.png) + +## Features + +Anatole's aims to be minimalistic and sleek, but still brings some great functionality. + +### Features include + +- Profile picture and slogan +- Dark mode +- Navigation items +- Pagination +- Multilingual +- Post Thumbnails (optional) +- 100⁄100 Google Lighthouse score +- Google Analytics (optional) +- Comments powered by Disqus or Utteranc.es (optional) +- SimpleAnalytics (optional) +- Katex support (optional) +- Formspree Contact Form (optional) +- Twitter Cards support +- MIT License +- Fontawesome 5.15.1 icons +- Custom CSS (optional) +- Custom JavaScript (optional) +- Medium like zoom for images +- Compliant to strict CSP +- Syntax highlighting +- Uses Hugo pipes to process assets + +## Preview the exampleSite + +```shell +git clone https://github.com/lxndrblz/anatole.git anatole +cd anatole/exampleSite +hugo server --themesDir ../.. +``` + +## Quick Start + +1. Add the repository into your Hugo Project repository as a submodule: `git submodule add https://github.com/lxndrblz/anatole.git themes/anatole`. +2. Configure your `config.toml`. Feel free to copy the demo `config.toml` and some content from the exampleSite. +3. Build your site with `hugo serve` and admire the result at `http://localhost:1313/`. + +## Update your installation + +If you want to get the latest update of the `Anatole` theme please execute this command: + +```shell +git submodule update --remote --merge +``` + +## Modifying the config.toml + +Ìn this section I'll discuss the custom parameters available within the `config.toml`. The complete [sample](https://github.com/lxndrblz/anatole/blob/master/exampleSite/config.toml) can be found in the exampleSite folder. + +### Profile picture and slogan + +```toml +[params] +title = "I'm Jane Doe" +author = "Jane Doe" +description = "Call me Jane" +profilePicture = "images/profile.jpg" +``` + +### Favicon + +Add you own favicon in `static/favicons/favicon.ico`. + +### Copyright +By default the copyright, will show the current year, but you can change this by configuring the `copyright` parameter. +```toml +copyright = "2020-2021" +``` + +### Navigation items + +Non-content entries can be added right from the `config.toml` file. + +```toml +[menu] + + [[menu.main]] + name = "Home" + identifier = "home" + weight = 100 + url = "/" + + [[menu.main]] + name = "Posts" + weight = 200 + identifier = "posts" + url = "/post/" + + [[menu.main]] + name = "About" + weight = 300 + identifier = "about" + url = "/about/" +``` + +### Prefer dark theme + +You can easily enable the dark mode from the `config.toml` all you have to do is to set the parameter `displayMode` to `dark`. If you don't specify any displayMode, then the light version will be loaded. + +Please also note that returning visitors will see the theme that was last displayed to them on your site. If your user has his system configured to dark mode, then this will also take precedence over the `displayMode` set in the `config.toml`. + +```toml +[params] +displayMode = "dark" +``` + +### Disable Theme Switcher +You can easily disable the theme switcher from the `config.toml`. All you have to do is to set the parameter `disableThemeSwitcher` to `true`. +```toml +[params] +disableThemeSwitcher = true # Theme switcher is enabled by default +``` + +### Disable Animations +You can easily disable the animations from the `config.toml`. All you have to do is to set the parameter `doNotLoadAnimations` to `true`. +```toml +[params] +doNotLoadAnimations = true # Animations are loaded by default +``` + +### Control the date Format +You can change the default date formating for the `list.html`, the `single.html` and the `index.html`. Simply configure the matching parameters. +```toml +[params] +singleDateFormat = "Mon, Jan 2, 2006" +indexDateFormat = "Mon, Jan 2, 2006" +listDateFormat = "Jan 2" +``` + +### Have a static page as a home page +If you prefer having a static page as your home page rather than a listing of the latest posts, then make sure you leave the `mainSections` parameter blank: +```toml +[params] + mainSections = [] +``` +Put any content into the `_index.md` file located in the content directory. If you want, you can also have some static text and the posts below. In such case, simply keep the `mainSections = ["post"]` and put any static content in the `_index.md`. + +### Multilingual support + +Anatole supports multilingual page setups. All you need to do is to add the languages to your 'config.toml'. For each Language you can set the custom options like title or description. It's important to include a `LanguageName`, as it will be displayed in the main menu. + +```toml +[Languages] + [Languages.en] + title = "My blog" + weight = 1 + LanguageName = "EN" + + [Languages.de] + title = "Mein blog" + description = "Ich bin Jane" + weight = 2 + LanguageName = "DE" +``` + +There are two ways of translating your content either by adding a suffix in the filename eg. `mypost.de.md` or by setting a contentDir (a certain directory) for each language. [Link to the Hugo documentation](https://gohugo.io/content-management/multilingual/). If you want to use the option with the `contentDir`, you will have to add the `contentDir` parameter for each language: + +```toml +[languages] + [languages.en] + contentDir = "content/english" + languageName = "EN" + weight = 1 +``` + +To make sure your menu is linking to the correct localized content, make sure that you customize the menu items to include the language prefix. Your menu might look like the following: + +```toml +[[Languages.de.menu.main]] +url = "/de/" +identifier = "home" +name = "Startseite" +weight = 100 + +[[Languages.de.menu.main]] +name = "Beiträge" +weight = 200 +identifier = "posts" +url = "/de/post/" + +[[Languages.de.menu.main]] +name = "Über" +weight = 300 +identifier = "about" +url = "/de/about/" +``` + +Anatole currently ships with support for some basic languages. Contributions for other language translations are welcome. + +### :100: Google Lighthouse score + +The theme is optimized to adhere to the requirements checked for in the Lighthouse Audit. On my [personal site](https://www.alexbilz.com) I was able to reach a perfect 100⁄100 score. +![Google Lighthouse Score](https://raw.githubusercontent.com/lxndrblz/anatole/master/images/lighthouse.png) + +### Comments powered by Disqus + +No comment section is shown on the `single.html`, unless a Disqus code is specified in the `config.toml` file. + +```toml +disqusShortname = "XXX" +``` + +### Comments powered by Utteranc.es + +No comment section is shown on the `single.html` unless a `repo` is specified in the `config.toml` file. If uncertain how parameter to configure, check out the official [documentation}(https://utteranc.es/). + +```toml +[params.utterances] +repo = "githubuser/reponame" +issueTerm = "pathname" +theme= "preferred-color-scheme" +# label = +``` +Two notes on the security of Utteranc.es +- If you are using a strict CSP, you'll have to add the domain to it. +- The script currently has no built-in integrity check, due to limitations of [Utterances](https://github.com/utterance/utterances/issues/40). +### Google Analytics + +To use Google Analytics, a valid tracking code has to be added. If you don't want to load the code, then commend out the parameter. + +```toml +googleAnalytics = "UA-123-45" +``` + +### Simple Analytics + +To use Simple Analytics, it has to be enabled by setting the parameter to true. If you are using a custom subdomain to evade Adblockers, then specify the URL without a trailing slash. + +```toml +[params.simpleAnalytics] +enable = true +# customurl = "https://analytics.example.com" +``` + +### Google Site Verification + +To use Google Site Verification, add the following line to the `[params]`: + +```toml +[params] +googleSiteVerify = "ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789" +``` + +Replace the hash with the one Google provided you. + +### Beautiful math functions + +```toml +## Math settings +[params.math] +enable = false # options: true, false. Enable math support globally, default: false. You can always enable math on per page. +use = "katex" # options: "katex", "mathjax". default is "katex". +``` +### Formspree Contact Form on the Contact page +Step 1: Configure the `contactFormAction` in the `config.toml` +```toml +[params] +#contactFormAction = "https://formspree.io/f/your-form-hash-here" +``` +Step 2: Activate the `contact: true` or `contact=true` in the frontmatter of a page. See `exampleSite/content/contact.html` as an example. +### Twitter Cards support + +In order to use the full functionality of Twitter cards, you will have to define a couple of settings in the `config.toml` and the frontmatter of a page. + +In the `config.toml` you can configure a site feature image. This image will be displayed, if no image is defined in the frontmatter of a page. + +```toml +[params] + images = ["images/site-feature-image.png"] +``` + +To define a custom image of a page, you might want to add the following to the frontmatter of a post. + +```toml +images = ["post-cover.png"] +``` + +### Post Thumbnails +Thumbnails can be enabled easily by setting the `thumbnail` parameter in the frontmatter of a post to an image such as `"images/landscape.jpg"`. +```md ++++ +... +tags = [ + "thumbnail", +] +thumbnail= "images/landscape.jpg" ++++ +``` +Make sure to put the image in the `static/images/` directory. + +### Custom CSS + +You can add your custom CSS files with the `customCss` parameter of the configuration file. Put your files into the `assets/css` directory. + +```toml +customCss = ["css/custom.css", "css/styles.css"] +``` + +On the user-side it will look like this: + +```text +. +└── assets + └── css + ├── custom.css + └── styles.css +``` + +### Custom JavaScript + +You can add your custom JS files with the `customJs` parameter of the configuration file. Put your files into the `assets/js` directory. + +```toml +[params] +customJs = ["js/hello.js", "js/world.js"] +``` + +On the user-side it will look like this: + +```text +. +└── assets + └── js + ├── hello.js + └── world.js +``` + +`hello.js` and `world.js` will be bundled into a `custom.min.js`. + +You can also include links to remote javascript files (hosted on CDNs for example). But be aware, that integrity settings and minification won't be applied. Further make sure to adjust your CSP. You can load a remote script like this: + +```toml +[params] +customJs = ["http://cdn.exmple.org/fancyscript.js"] +``` + +Both approaches can even be mixed: + +```toml +[params] +customJs = ["https://cdn.exmple.org/fancyscript.js", "js/world.js"] +``` + +### Content Security Policy + +The theme is compliant with most strict CSP policies out of the box. A sample CSP for an Anatole-based site would look something like this: + +```text +Content-Security-Policy " + base-uri 'self'; + connect-src 'self'; + default-src 'self'; + frame-ancestors 'none'; + font-src 'self' cdnjs.cloudflare.com; + img-src 'self'; + object-src 'none'; + script-src 'self'; + style-src 'self' cdnjs.cloudflare.com; +" +``` + +If you want to configure the security headers for a site running on Netlify, you want to make sure you create a special `_headers` file in your sites static folder. The content might look like the following: + +```text +/* + X-Frame-Options: DENY + X-Clacks-Overhead: "GNU Terry Pratchett" + X-XSS-Protection: 1; mode=block + X-Content-Type-Options: nosniff + Referrer-Policy: same-origin + Content-Security-Policy: base-uri 'self'; connect-src 'self'; default-src 'self'; frame-ancestors 'none'; font-src 'self' cdnjs.cloudflare.com; img-src 'self'; object-src 'none'; script-src 'self'; style-src 'self' cdnjs.cloudflare.com; + Strict-Transport-Security: max-age=63072000; includeSubDomains; preload +``` + +### Configurable pagination section + +You can configure the pages shown on the front page by altering the `mainSections` parameter: + +```toml +[params] + mainSections = ["post", "docs"] +``` + +### Robots.txt + +If you want Hugo to generate a robots.txt, you will have to set the `enableRobotsTXT` in the `config.toml` to `true`. By default a robots.txt, which allows search engine crawlers to access to any page, will be generated. It will look like this: + +```text +User-agent: * +``` + +If certain sites should be excluded from being accessed, you might want to setup a custom robots.txt file within your `static` folder of your site. + +### Syntax highlighting + +This theme has support for either Hugo's lightning-fast Chroma code highlighting. See the [Hugo docs](https://gohugo.io/content-management/syntax-highlighting/) for more information. + +To enable Chroma, add the following to your site parameters: + +```toml +pygmentsCodeFences = true +pygmentsUseClasses = true +``` + +Then, you can generate a different style by running: + +```shell +hugo gen chromastyles --style=monokailight > assets/css/syntax.css +``` + +If you get any errors, make sure the `assets/css/` directory exists within your sites root folder. +Include the newly generated `syntax.css` like a standard custom CSS script: + +```toml +[params] +customCss = ["css/syntax.css"] +``` + +## License + +Anatole is licensed under the [MIT license](https://github.com/lxndrblz/anatole/blob/master/LICENSE). + +## Maintenance + +This theme is maintained by its author [Alexander Bilz](https://github.com/lxndrblz) and with the help from these awesome [contributors](https://github.com/lxndrblz/anatole/graphs/contributors). Please open an issue/pull request if you want to contribute to making this theme better and more feature-complete. For PRs please make sure that they align with theme's goals: minimalism, speed and elegance. + +## Sponsoring + +If you like this theme, give it a star on GitHub, and consider supporting its development: + +[![ko-fi](https://www.ko-fi.com/img/githubbutton_sm.svg)](https://ko-fi.com/lxndrblz/) + + +## Special Thanks 🎁 + +- Go to [Cai Cai](https://github.com/hi-caicai), for the great Anatole Farbox theme that formed the foundation for this theme. +- Go to [Kareya Saleh](https://unsplash.com/photos/tLKOj6cNwe0) for providing the profile picture in the exampleSite. +- Go to [Ales Krivec](https://unsplash.com/photos/4miBe6zg5r0) for providing the thumbnail picture in the exampleSite post. \ No newline at end of file diff --git a/themes/anatole/archetypes/post.md b/themes/anatole/archetypes/post.md new file mode 100644 index 0000000..607aa3f --- /dev/null +++ b/themes/anatole/archetypes/post.md @@ -0,0 +1,8 @@ +--- +title: "{{ replace .Name "-" " " | title }}" +date: {{ .Date }} +Description: "" +Tags: [] +Categories: [] +DisableComments: false +--- diff --git a/themes/anatole/assets/css/markupHighlight.css b/themes/anatole/assets/css/markupHighlight.css new file mode 100644 index 0000000..29ad3d6 --- /dev/null +++ b/themes/anatole/assets/css/markupHighlight.css @@ -0,0 +1,216 @@ +:root { + /* Light -> monokailight */ + --chr-def-color: #272822; + --chr-def-bg-color: #fafafa; + --chr-err-color: #960050; + --chr-err-bg-color: #960050; + --chr-hl-bg-color: #ffffcc; + --chr-lnt-color: #7f7f7f; + --chr-ln-color: #7f7f7f; + --chr-k-color: #00a8c8; + --chr-kc-color: #00a8c8; + --chr-kd-color: #00a8c8; + --chr-kn-color: #f92672; + --chr-kp-color: #00a8c8; + --chr-kr-color: #00a8c8; + --chr-kt-color: #00a8c8; + --chr-n-color: #111111; + --chr-na-color: #75af00; + --chr-nb-color: #111111; + --chr-bp-color: #111111; + --chr-nc-color: #75af00; + --chr-no-color: #00a8c8; + --chr-nd-color: #75af00; + --chr-ni-color: #111111; + --chr-ne-color: #75af00; + --chr-nf-color: #75af00; + --chr-fm-color: #111111; + --chr-nl-color: #111111; + --chr-nn-color: #111111; + --chr-nx-color: #75af00; + --chr-py-color: #111111; + --chr-nt-color: #f92672; + --chr-nv-color: #111111; + --chr-vc-color: #111111; + --chr-vg-color: #111111; + --chr-vi-color: #111111; + --chr-vm-color: #111111; + --chr-l-color: #ae81ff; + --chr-ld-color: #d88200; + --chr-s-color: #d88200; + --chr-sa-color: #d88200; + --chr-sb-color: #d88200; + --chr-sc-color: #d88200; + --chr-dl-color: #d88200; + --chr-sd-color: #d88200; + --chr-s2-color: #d88200; + --chr-se-color: #8045ff; + --chr-sh-color: #d88200; + --chr-si-color: #d88200; + --chr-sx-color: #d88200; + --chr-sr-color: #d88200; + --chr-s1-color: #d88200; + --chr-ss-color: #d88200; + --chr-m-color: #ae81ff; + --chr-mb-color: #ae81ff; + --chr-mf-color: #ae81ff; + --chr-mh-color: #ae81ff; + --chr-mi-color: #ae81ff; + --chr-il-color: #ae81ff; + --chr-mo-color: #ae81ff; + --chr-o-color: #f92672; + --chr-ow-color: #f92672; + --chr-p-color: #111111; + --chr-c-color: #75715e; + --chr-ch-color: #75715e; + --chr-cm-color: #75715e; + --chr-c1-color: #75715e; + --chr-cs-color: #75715e; + --chr-cp-color: #75715e; + --chr-cpf-color: #75715e; +} + +html[data-theme='dark'] { + /* Dark -> monokai */ + --chr-def-color: #f8f8f2; + --chr-def-bg-color: #272822; + --chr-err-color: #960050; + --chr-err-bg-color: #1e0010; + --chr-hl-bg-color: #ffffcc; + --chr-lnt-color: #7f7f7f; + --chr-ln-color: #7f7f7f; + --chr-k-color: #66d9ef; + --chr-kc-color: #66d9ef; + --chr-kd-color: #66d9ef; + --chr-kn-color: #f92672; + --chr-kp-color: #66d9ef; + --chr-kr-color: #66d9ef; + --chr-kt-color: #66d9ef; + --chr-na-color: #a6e22e; + --chr-nc-color: #a6e22e; + --chr-no-color: #66d9ef; + --chr-nd-color: #a6e22e; + --chr-ne-color: #a6e22e; + --chr-nf-color: #a6e22e; + --chr-nx-color: #a6e22e; + --chr-nt-color: #f92672; + --chr-l-color: #ae81ff; + --chr-ld-color: #e6db74; + --chr-s-color: #e6db74; + --chr-sa-color: #e6db74; + --chr-sb-color: #e6db74; + --chr-sc-color: #e6db74; + --chr-dl-color: #e6db74; + --chr-sd-color: #e6db74; + --chr-s2-color: #e6db74; + --chr-se-color: #ae81ff; + --chr-sh-color: #e6db74; + --chr-si-color: #e6db74; + --chr-sx-color: #e6db74; + --chr-sr-color: #e6db74; + --chr-s1-color: #e6db74; + --chr-ss-color: #e6db74; + --chr-m-color: #ae81ff; + --chr-mb-color: #ae81ff; + --chr-mf-color: #ae81ff; + --chr-mh-color: #ae81ff; + --chr-mi-color: #ae81ff; + --chr-il-color: #ae81ff; + --chr-mo-color: #ae81ff; + --chr-o-color: #f92672; + --chr-ow-color: #f92672; + --chr-p-color: #f8f8f2; + --chr-c-color: #75715e; + --chr-ch-color: #75715e; + --chr-cm-color: #75715e; + --chr-c1-color: #75715e; + --chr-cs-color: #75715e; + --chr-cp-color: #75715e; + --chr-cpf-color: #75715e; + --chr-gd-color: #f92672; + --chr-gi-color: #a6e22e; + --chr-gu-color: #75715e; +} + +/* Background */ .chroma { color: var(--chr-def-color); background-color: var(--chr-def-bg-color) } +/* Other */ .chroma .x { } +/* Error */ .chroma .err { color: var(--chr-err-color); background-color: var(--chr-err-bg-color) } +/* LineTableTD */ .chroma .lntd { vertical-align: top; padding: 0; margin: 0; border: 0; } +/* LineTable */ .chroma .lntable { border-spacing: 0; padding: 0; margin: 0; border: 0; width: auto; overflow: auto; display: block; } +/* LineHighlight */ .chroma .hl { display: block; width: 100%;background-color: var(--chr-hl-bg-color) } +/* LineNumbersTable */ .chroma .lnt { margin-right: 0.4em; padding: 0 0.4em 0 0.4em;color: var(--chr-lnt-color) } +/* LineNumbers */ .chroma .ln { margin-right: 0.4em; padding: 0 0.4em 0 0.4em;color: var(--chr-ln-color) } +/* Keyword */ .chroma .k { color: var(--chr-k-color) } +/* KeywordConstant */ .chroma .kc { color: var(--chr-kc-color) } +/* KeywordDeclaration */ .chroma .kd { color: var(--chr-kd-color) } +/* KeywordNamespace */ .chroma .kn { color: var(--chr-kn-color) } +/* KeywordPseudo */ .chroma .kp { color: var(--chr-kp-color) } +/* KeywordReserved */ .chroma .kr { color: var(--chr-kr-color) } +/* KeywordType */ .chroma .kt { color: var(--chr-kt-color) } +/* Name */ .chroma .n { color: var(--chr-n-color) } +/* NameAttribute */ .chroma .na { color: var(--chr-na-color) } +/* NameBuiltin */ .chroma .nb { color: var(--chr-nb-color) } +/* NameBuiltinPseudo */ .chroma .bp { color: var(--chr-bp-color) } +/* NameClass */ .chroma .nc { color: var(--chr-nc-color) } +/* NameConstant */ .chroma .no { color: var(--chr-no-color) } +/* NameDecorator */ .chroma .nd { color: var(--chr-nd-color) } +/* NameEntity */ .chroma .ni { color: var(--chr-ni-color) } +/* NameException */ .chroma .ne { color: var(--chr-ne-color) } +/* NameFunction */ .chroma .nf { color: var(--chr-nf-color) } +/* NameFunctionMagic */ .chroma .fm { color: var(--chr-fm-color) } +/* NameLabel */ .chroma .nl { color: var(--chr-nl-color) } +/* NameNamespace */ .chroma .nn { color: var(--chr-nn-color) } +/* NameOther */ .chroma .nx { color: var(--chr-nx-color) } +/* NameProperty */ .chroma .py { color: var(--chr-py-color) } +/* NameTag */ .chroma .nt { color: var(--chr-nt-color) } +/* NameVariable */ .chroma .nv { color: var(--chr-nv-color) } +/* NameVariableClass */ .chroma .vc { color: var(--chr-vc-color) } +/* NameVariableGlobal */ .chroma .vg { color: var(--chr-vg-color) } +/* NameVariableInstance */ .chroma .vi { color: var(--chr-vi-color) } +/* NameVariableMagic */ .chroma .vm { color: var(--chr-vm-color) } +/* Literal */ .chroma .l { color: var(--chr-l-color) } +/* LiteralDate */ .chroma .ld { color: var(--chr-ld-color) } +/* LiteralString */ .chroma .s { color: var(--chr-s-color) } +/* LiteralStringAffix */ .chroma .sa { color: var(--chr-sa-color) } +/* LiteralStringBacktick */ .chroma .sb { color: var(--chr-sb-color) } +/* LiteralStringChar */ .chroma .sc { color: var(--chr-sc-color) } +/* LiteralStringDelimiter */ .chroma .dl { color: var(--chr-dl-color) } +/* LiteralStringDoc */ .chroma .sd { color: var(--chr-sd-color) } +/* LiteralStringDouble */ .chroma .s2 { color: var(--chr-s2-color) } +/* LiteralStringEscape */ .chroma .se { color: var(--chr-se-color) } +/* LiteralStringHeredoc */ .chroma .sh { color: var(--chr-sh-color) } +/* LiteralStringInterpol */ .chroma .si { color: var(--chr-si-color) } +/* LiteralStringOther */ .chroma .sx { color: var(--chr-sx-color) } +/* LiteralStringRegex */ .chroma .sr { color: var(--chr-sr-color) } +/* LiteralStringSingle */ .chroma .s1 { color: var(--chr-s1-color) } +/* LiteralStringSymbol */ .chroma .ss { color: var(--chr-ss-color) } +/* LiteralNumber */ .chroma .m { color: var(--chr-m-color) } +/* LiteralNumberBin */ .chroma .mb { color: var(--chr-mb-color) } +/* LiteralNumberFloat */ .chroma .mf { color: var(--chr-mf-color) } +/* LiteralNumberHex */ .chroma .mh { color: var(--chr-mh-color) } +/* LiteralNumberInteger */ .chroma .mi { color: var(--chr-mi-color) } +/* LiteralNumberIntegerLong */ .chroma .il { color: var(--chr-il-color) } +/* LiteralNumberOct */ .chroma .mo { color: var(--chr-mo-color) } +/* Operator */ .chroma .o { color: var(--chr-o-color) } +/* OperatorWord */ .chroma .ow { color: var(--chr-ow-color) } +/* Punctuation */ .chroma .p { color: var(--chr-p-color) } +/* Comment */ .chroma .c { color: var(--chr-c-color) } +/* CommentHashbang */ .chroma .ch { color: var(--chr-ch-color) } +/* CommentMultiline */ .chroma .cm { color: var(--chr-cm-color) } +/* CommentSingle */ .chroma .c1 { color: var(--chr-c1-color) } +/* CommentSpecial */ .chroma .cs { color: var(--chr-cs-color) } +/* CommentPreproc */ .chroma .cp { color: var(--chr-cp-color) } +/* CommentPreprocFile */ .chroma .cpf { color: var(--chr-cpf-color) } +/* Generic */ .chroma .g { } +/* GenericDeleted */ .chroma .gd { } +/* GenericEmph */ .chroma .ge { font-style: italic } +/* GenericError */ .chroma .gr { } +/* GenericHeading */ .chroma .gh { } +/* GenericInserted */ .chroma .gi { } +/* GenericOutput */ .chroma .go { } +/* GenericPrompt */ .chroma .gp { } +/* GenericStrong */ .chroma .gs { font-weight: bold } +/* GenericSubheading */ .chroma .gu { } +/* GenericTraceback */ .chroma .gt { } +/* GenericUnderline */ .chroma .gl { } +/* TextWhitespace */ .chroma .w { } diff --git a/themes/anatole/assets/css/style.css b/themes/anatole/assets/css/style.css new file mode 100644 index 0000000..b4b2085 --- /dev/null +++ b/themes/anatole/assets/css/style.css @@ -0,0 +1,1110 @@ +@charset "UTF-8"; + +:root { + --bg-color: #fff; + --secondary-bg-color: #eeeeee; + --heading-color: #5f5f5f; + --body-color: rgba(0, 0, 0, 0.7); + --post-color: rgba(0, 0, 0, 0.44); + --border-color: rgba(0, 0, 0, 0.15); + --form-border-color: #9f9f9f; + --form-button-hover-border-color: #000; + --pre-bg-color: #f9f9fd; + --nav-text-color: #5a5a5a; + --tag-color: #424242; + --blockquote-text-color: #858585; + --blockquote-border-color: #dfe2e5; + --thumbnail-height: 15em; + scroll-padding-top: 100px; +} + +html[data-theme='dark'] { + --bg-color: #292a2d; + --secondary-bg-color: #2c2d32; + --heading-color: rgb(169, 169, 179); + --body-color: rgb(169, 169, 179); + --post-color: rgba(0, 0, 0, 0.44); + --border-color: rgb(38, 38, 38); + --form-border-color: rgb(169, 169, 179); + --form-button-hover-border-color: #fff; + --pre-bg-color: rgb(33, 33, 45); + --nav-text-color: rgb(191, 191, 191); + --tag-color: rgb(191, 191, 191); + --blockquote-text-color: #808080; + --blockquote-border-color: #424242; +} + +html { + background-color: var(--bg-color); + -webkit-font-smoothing: antialiased; +} + +body { + color: var(--body-color); + font-family: 'Verdana', sans-serif; + font-size: 15px; + width: 100%; + margin: 0 auto 30px auto; + background-color: var(--bg-color); +} + +p { + line-height: 1.9em; + font-weight: 400; + font-size: 14px; +} + +a { + text-decoration: none; +} + +blockquote { + padding: 0 1em; + border-left: .25em solid var(--blockquote-border-color); + color: var(--blockquote-text-color); +} + +.category { + padding: 4px 6px; + border-radius: 3px; + color: var(--tag-color) !important; + background-color: var(--secondary-bg-color); + border: 1px solid var(--border-color); +} + +.tag::before { + content: "#"; + opacity: .5; +} + +.tag, +.category { + display: inline-block; + font-size: 15px; + line-height: 1; + margin: 5px 8px 5px 0; +} + +pre { + background-color: var(--pre-bg-color); + padding: 5px; + display: block; + overflow-x: auto; +} + +.info i { + opacity: 0.5; + margin-right: 5px; +} + +a:link, +a:visited { + opacity: 1; + color: var(--tag-color); +} + +a:hover, +a:active { + color: #2660ab; +} + +/*basic styles ends*/ +/*animation starts*/ + +.animated { + transition: top .8s linear; + -webkit-animation-duration: 1s; + -moz-animation-duration: 1s; + -ms-animation-duration: 1s; + -o-animation-duration: 1s; + animation-duration: 1s; +} + +.animated.hinge { + -webkit-animation-duration: 1s; + -moz-animation-duration: 1s; + -ms-animation-duration: 1s; + -o-animation-duration: 1s; + animation-duration: 1s; +} + +@-webkit-keyframes fadeInDown { + 0% { + -webkit-transform: translateY(-20px); + } + + 100% { + -webkit-transform: translateY(0); + } +} + +@-moz-keyframes fadeInDown { + 0% { + -moz-transform: translateY(-20px); + } + + 100% { + -moz-transform: translateY(0); + } +} + +@-o-keyframes fadeInDown { + 0% { + -o-transform: translateY(-20px); + } + + 100% { + -o-transform: translateY(0); + } +} + +@keyframes fadeInDown { + 0% { + transform: translateY(-20px); + } + + 100% { + transform: translateY(0); + } +} + +.fadeInDown { + -webkit-animation-name: fadeInDown; + -moz-animation-name: fadeInDown; + -o-animation-name: fadeInDown; + animation-name: fadeInDown; +} + +/*animation ends*/ +.content { + height: auto; + float: right; + width: 60%; + margin-top: 60px; +} + +.page-top { + width: 60%; + position: fixed; + right: 0; + z-index: 3; + background-color: var(--bg-color); + height: 60px; + border-bottom: 1px solid var(--border-color); +} + +.page-top .nav { + list-style: none; + padding: 11px 30px; + float: left; + font-size: 12px; + display: block; + width: calc(100% - 30px); +} + +.page-top .nav li { + position: relative; + display: initial; + padding-right: 20px; +} + +.page-top .nav a { + color: var(--nav-text-color); +} + +.page-top .nav a:hover { + color: #2660ab; +} + +.page-top .nav a.current { + color: var(--nav-text-color); + padding-bottom: 22px; + border-bottom: 1px solid var(--nav-text-color); +} + +.theme-switch-item { + float: right; + font-size: 2em; + margin-top: -5px; +} + +.page-top .information { + float: right; + padding-top: 12px; + padding-right: 20px; +} + +.page-top .information .avatar { + float: right; +} + +.page-top .information .avatar img { + width: 32px; + height: 32px; + border-radius: 300px; +} + +.page-top .information .back_btn { + float: left; + padding-top: 5px; + margin-right: -10px; +} + +.page-top .information .back_btn li { + display: initial; + padding-right: 40px; +} + +.sidebar { + width: 40%; + -webkit-background-size: cover; + background-size: cover; + background-color: var(--bg-color); + height: 100%; + top: 0; + left: 0; + position: fixed; + z-index: 4; + border-right: 1px solid var(--border-color); + display: flex; + flex-direction: column; + min-height: 100%; +} + +.sidebar .logo-title { + text-align: center; + padding-top: 240px; + flex: 1; +} + +.sidebar .logo-title .description { + font-size: 14px; +} + +.sidebar .logo-title .logo { + margin: 0 auto; +} + +.sidebar .logo-title .title img { + width: 127px; + border-radius: 50%; +} + +.sidebar .logo-title .title h3 { + text-transform: uppercase; + font-size: 2rem; + font-weight: bold; + letter-spacing: 2px; + line-height: 1; + margin: 1em; +} + +.sidebar .logo-title .title a { + text-decoration: none; + color: var(--heading-color); + font-size: 2rem; + font-weight: bold; +} + +.sidebar .social-links { + list-style: none; + padding: 0; + font-size: 14px; + text-align: center; + flex: 7; +} + +.sidebar .social-links i { + margin-right: 3px; +} + +.sidebar .social-links li { + display: inline; + padding: 0 4px; + line-height: 0; +} + +.sidebar .social-links a { + color: var(--heading-color); +} + +.sidebar .social-links a:hover { + color: #2660ab; +} + +.post { + background-color: var(--bg-color); + margin: 30px; +} + +.post .post-title h1 { + text-transform: uppercase; + font-size: 30px; + letter-spacing: 5px; + line-height: 1; +} + +.post .post-title h2 { + text-transform: uppercase; + letter-spacing: 1px; + font-size: 28px; + line-height: 1; + font-weight: 600; + color: var(--heading-color); +} + +.post .post-title h3 { + text-transform: uppercase; + letter-spacing: 1px; + line-height: 1; + font-weight: 600; + /* color: #464646; */ + color: var(--heading-color); + font-size: 22px; + margin: 0; +} + +.post .post-title a { + text-decoration: none; + letter-spacing: 1px; + color: var(--heading-color); +} + +.post .post-title a:hover { + text-decoration: underline; +} + +.post .post-content a { + text-decoration: none; + letter-spacing: 1px; + color: #2660ab; +} + +.post .post-content a:hover { + color: #2F69B3; +} + +.post .post-content h3 { + font-size: 22px; + font-weight: 600; +} + +.post .post-content h4 { + /* color: var(--heading-color); */ + font-size: 16px; +} + +.post .post-content img { + max-width: 100%; +} + +.post .post-footer { + padding: 0 0 10px 0; + border-bottom: 1px solid var(--border-color); +} + +.post .post-footer .meta { + max-width: 100%; + display: flex; + color: #bbbbbb; +} + +.post .post-footer .meta .info { + float: left; + font-size: 12px; + margin-bottom: 1em; + color: var(--body-color); +} + +.post .post-footer .info .separator a { + margin-right: 0.2em; +} + +.post .post-footer .meta .info .date { + margin-right: 10px; + margin-left: 5px +} + +.info { + margin: 1em; +} + +.info span { + margin-right: 0.5em; +} + +.post .post-footer .meta a { + text-decoration: none; + color: var(--body-color); +} + +.post .post-footer .meta a:hover { + color: #2660ab; +} + +.post .post-footer .meta i { + margin-right: 6px; +} + +.post .post-footer .tags { + padding-bottom: 15px; + font-size: 13px; +} + +.post .post-footer .tags ul { + list-style-type: none; + display: inline; + margin: 0; + padding: 0; +} + +.post .post-footer .tags ul li { + list-style-type: none; + margin: 0; + padding-right: 5px; + display: inline; +} + +.post .post-footer .tags a { + text-decoration: none; + color: var(--post-color); + font-weight: 400; +} + +.post .post-footer .tags a:hover { + text-decoration: none; +} + +.post .post-thumbnail { + width: 100%; + padding-bottom: 1em; + box-shadow: black; + border-radius: 0.5em; + overflow: hidden; + transition: box-shadow .3s ease; + +} + +.post .post-thumbnail img { + width: 100%; + height: var(--thumbnail-height); + object-fit: cover; + border: 1px solid var(--border-color); + border-bottom: 0px; +} + +.pagination { + margin: 30px; + padding: 0px 0 56px 0; + text-align: center; +} + +.pagination ul { + list-style: none; + margin: 0; + padding: 0; + height: 13px; +} + +.pagination ul li { + margin: 0 2px 0 2px; + display: inline; + line-height: 1; +} + +.pagination ul li a { + text-decoration: none; + color: var(--body-color); +} + +.pagination .pre { + float: left; +} + +.pagination .next { + float: right; +} + +.like-reblog-buttons { + float: right; +} + +.like-button { + float: right; + padding: 0 0 0 10px; +} + +.reblog-button { + float: right; + padding: 0; +} + +#install-btn { + position: fixed; + bottom: 0px; + right: 6px; +} + +#disqus_thread { + margin: 30px; + border-bottom: 1px solid var(--border-color); +} + +.footer { + clear: both; + text-align: center; + font-size: 10px; + margin: 0 auto; + bottom: 0; + width: 100%; + padding-bottom: 20px; + flex: 0; + position: relative; +} + +.footer a { + color: #A6A6A6; +} + +.footer a:hover { + color: #2660ab; +} + +/*for archive*/ +.archive { + width: 100%; +} + +.list-with-title { + font-size: 14px; + margin: 30px; + padding: 0; +} + +.list-with-title li { + list-style-type: none; + padding: 0; +} + +.list-with-title .listing-title { + font-size: 24px; + color: #666666; + font-weight: 600; + line-height: 2.2em; +} + +.list-with-title .listing { + padding: 0; +} + +.list-with-title .listing .listing-post { + padding-bottom: 5px; +} + +.list-with-title .listing .listing-post .post-time { + float: right; + display: inline-block; + max-width: 10%; + text-align: right; + color: #C5C5C5; +} + +.list-with-title .listing .listing-post a { + color: #8F8F8F; + width: 90%; + display: inline-block; +} + +.list-with-title .listing .listing-post a:hover { + color: #2660ab; +} + +/* share */ +.share { + margin: 0px 30px; + display: inline-flex; +} + +.evernote { + width: 32px; + height: 32px; + border-radius: 300px; + background-color: #3E3E3E; + margin-right: 5px; +} + +.evernote a { + color: #fff; + padding: 11px; + font-size: 12px; +} + +.evernote a:hover { + color: #ED6243; + padding: 11px; +} + +.weibo { + width: 32px; + height: 32px; + border-radius: 300px; + background-color: #ED6243; + margin-right: 5px; +} + +.weibo a { + color: #fff; + padding: 9px; +} + +.weibo a:hover { + color: #BD4226; +} + +.twitter { + width: 32px; + height: 32px; + border-radius: 300px; + background-color: #59C0FD; + margin-right: 5px; +} + +.twitter a { + color: #fff; + padding: 9px; +} + +.twitter a:hover { + color: #4B9ECE; +} + +/* about */ +.about { + margin: 30px; +} + +.about h3 { + font-size: 22px; +} + +/* links*/ +.links { + margin: 30px; +} + +.links h3 { + font-size: 22px; +} + +.links a { + cursor: pointer; +} + +/* Comments */ +.comment-count { + color: #666; +} + +.tab-community { + color: #666; +} + +.read_more { + font-size: 14px; +} + +.back-button { + padding-top: 30px; + max-width: 100px; + padding-left: 40px; + float: left; +} + +/* Facebook Comments */ +#fb_comments_container { + margin: 30px; +} + +.utterances { + max-width: unset; +} + +/* Buttons */ +a.btn { + color: #868686; + font-weight: 400; +} + +.btn { + display: inline-block; + position: relative; + outline: 0; + color: var(--post-color); + background: transparent; + font-size: 14px; + text-align: center; + text-decoration: none; + cursor: pointer; + border: 1px solid var(--border-color); + white-space: nowrap; + font-weight: 400; + font-style: normal; + border-radius: 999em; +} + +.btn:hover { + display: inline-block; + position: relative; + outline: 0px; + color: #464545; + background: transparent; + font-size: 14px; + text-align: center; + text-decoration: none; + cursor: pointer; + border: 1px solid #464545; + white-space: nowrap; + font-weight: 400; + font-style: normal; + border-radius: 999em; +} + +[role="back"] { + padding: 0.5em 1.25em; + line-height: 1.666em; +} + +[role="home"] { + padding: 0.5em 1.25em; + line-height: 1.666em; +} + +[role="navigation"] { + padding: 0.5em 1.25em; + line-height: 1.666em; +} + +[role="tags"] { + padding: 6px 12px; +} + +/* Menu */ +.menu { + float: right; + padding-top: 30px; +} + +.menu .btn-down { + margin: 0px; +} + +.menu .btn-down li { + list-style: none; + width: 100px; +} + +.menu .btn-down li a { + display: inline-block; + position: relative; + padding: 0.5em 1.25em; + outline: 0; + color: var(--post-color); + background: transparent; + font-size: 14px; + text-align: center; + text-decoration: none; + cursor: pointer; + border: 1px solid var(--border-color); + white-space: nowrap; + font-weight: 400; + font-style: normal; + border-radius: 999em; + margin-top: 5px; +} + +.menu .btn-down li a:hover { + position: relative; + padding: 0.5em 1.25em; + outline: 0; + color: #fff; + background: #3CBD10; + font-size: 14px; + text-align: center; + text-decoration: none; + cursor: pointer; + border: 1px solid rgba(0, 0, 0, 0.15); + white-space: nowrap; + font-weight: 400; + font-style: normal; + border-radius: 999em; + margin-top: 5px; +} + +.menu .btn-down div { + position: absolute; + visibility: hidden; + width: 100px; + float: right; +} + +.page_404 { + text-align: center; + padding-top: 50px; +} + +.navbar-burger { + display: none; +} + +@media screen and (max-width: 960px), +print { + .sidebar { + width: 100%; + position: absolute; + border-right: none; + z-index: 1; + } + + .sidebar .logo-title { + padding-top: 120px; + } + + .sidebar .logo-title .title img { + width: 100px; + } + + .sidebar .logo-title .title h3 { + font-size: 20px; + } + + .page-top { + width: 100%; + } + + .post-title h3 { + line-height: 1.6; + } + + .content { + margin-top: 420px; + width: 100%; + z-index: 2; + position: absolute; + } + + .footer { + display: none; + } + + .share { + display: grid; + } + + .page-top .nav { + background-color: var(--secondary-bg-color); + box-shadow: 0 8px 16px rgba(10, 10, 10, .1); + padding: .5rem 0; + width: 100%; + display: none; + margin-top: 0px; + } + + .page-top .nav.is-active { + /* display: block; */ + display: block; + } + + .page-top .nav li { + display: block; + flex-grow: 0; + flex-shrink: 0; + line-height: 2.5; + padding: .5rem .75rem; + position: relative; + text-transform: uppercase; + text-align: center; + font-size: 1.3em; + } + + .page-top .nav a.current { + border-bottom: none; + } + + .navbar-burger { + cursor: pointer; + display: block; + height: 3.25rem; + position: relative; + width: 3.25rem; + margin-left: auto; + } + + .navbar-burger span { + background-color: var(--heading-color); + display: block; + height: 1px; + left: calc(50% - 8px); + position: absolute; + transform-origin: center; + transition-duration: 86ms; + transition-property: background-color, opacity, transform; + transition-timing-function: ease-out; + width: 16px; + } + + .navbar-burger span:nth-child(1) { + top: calc(50% - 6px); + } + + .navbar-burger span:nth-child(2) { + top: calc(50% - 1px); + } + + .navbar-burger span:nth-child(3) { + top: calc(50% + 4px); + } + + .theme-switch-item { + float: none; + } + + .list-with-title .listing .listing-post .post-time { + max-width: 20%; + } + + .list-with-title .listing .listing-post a { + width: 80%; + } +} + +/* Medium zoom */ +.medium-zoom-overlay { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + opacity: 0; + transition: opacity 300ms; + will-change: opacity; + background: var(--bg-color); +} + +.medium-zoom--opened .medium-zoom-overlay { + cursor: pointer; + cursor: zoom-out; + opacity: 1; +} + +.medium-zoom-image { + cursor: pointer; + cursor: zoom-in; + /* + The `transition` is marked as "!important" for the animation to happen + even though it's overriden by another inline `transition` style attribute. + This is problematic with frameworks that generate inline styles on their + images (e.g. Gatsby). + See https://github.com/francoischalifour/medium-zoom/issues/110 + */ + transition: transform 300ms cubic-bezier(0.2, 0, 0.2, 1) !important; + z-index: 100; +} + +.medium-zoom-image--hidden { + visibility: hidden; +} + +.medium-zoom-image--opened { + position: relative; + cursor: pointer; + cursor: zoom-out; + will-change: transform; +} + +@media print { + .page-top { + display: none; + } +} + +@media (min-width: 1921px){ + .content { + padding-right: 25%; + width: 35%; + } + .sidebar { + padding-left: 15%; + width: 25%; + } +} + + +/* (CONTACT) FORM */ + +.contact-form { + margin-top: 30px; +} +.form-style{ + width: 100%; +} +.form-style ul { + padding: 0; + margin: 0; + list-style: none; +} +.form-style ul li { + display: block; + margin-bottom: 10px; + min-height: 35px; +} +.form-style ul li .field-style { + box-sizing: border-box; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + font-size: 14px; + padding: 8px; + outline: none; + background-color: var(--bg-color); + border: 1px solid var(--form-border-color); + color: var(--body-color); +} +.form-style ul li .field-style:focus { + box-shadow: 0 0 5px; + border:1px solid; +} +.form-style ul li .field-split { + width: 49%; +} +.form-style ul li .field-full { + width: 100%; +} +.form-style ul li input.align-left { + float:left; +} +.form-style ul li input.align-right { + float:right; +} +.form-style ul li textarea { + background-color: var(--bg-color); + border: 1px solid var(--form-border-color); + color: var(--body-color); + width: 100%; + height: auto; +} +.form-style ul li input[type="button"], +.form-style ul li input[type="submit"] { + background-color: var(--bg-color); + border: 1px solid var(--form-border-color); + display: inline-block; + cursor: pointer; + color: var(--body-color); + text-decoration: none; + width: 100%; +} +.form-style ul li input[type="button"]:hover, +.form-style ul li input[type="submit"]:hover { + background-color: var(--bg-color); + border: 1px solid var(--form-button-hover-border-color); +} + +/* (CONTACT) FORM END */ \ No newline at end of file diff --git a/themes/anatole/assets/js/anatole-header.js b/themes/anatole/assets/js/anatole-header.js new file mode 100644 index 0000000..0bae781 --- /dev/null +++ b/themes/anatole/assets/js/anatole-header.js @@ -0,0 +1,16 @@ +document.addEventListener("DOMContentLoaded", function () { +// Get all "navbar-burger" elements + var $navbarBurgers = Array.prototype.slice.call(document.querySelectorAll(".navbar-burger"), 0); +// Check if there are any navbar burgers + if ($navbarBurgers.length > 0) { + // Add a click event on each of them + $navbarBurgers.forEach(function ($el) { + $el.addEventListener("click", function () { + var target = $el.dataset.target; + var $target = document.getElementById(target); + $el.classList.toggle("is-active"); + $target.classList.toggle("is-active"); + }); + }); + } +}); \ No newline at end of file diff --git a/themes/anatole/assets/js/anatole-theme-switcher.js b/themes/anatole/assets/js/anatole-theme-switcher.js new file mode 100644 index 0000000..ac82793 --- /dev/null +++ b/themes/anatole/assets/js/anatole-theme-switcher.js @@ -0,0 +1,51 @@ +// initialize default value +function getTheme() { + return localStorage.getItem('theme') ? localStorage.getItem('theme') : null; +} + +function setTheme(style) { + document.documentElement.setAttribute('data-theme', style); + localStorage.setItem('theme', style); +} + +function init() { + // initialize default value + const theme = getTheme(); + + // check if a preferred color theme is set for users that have never been to our site + const userPrefersDark = window.matchMedia && window.matchMedia('(prefers-color-scheme: dark)').matches; + if (theme === null) { + if (userPrefersDark) { + setTheme('dark'); + } else if (!document.documentElement.getAttribute('data-theme')) { + setTheme('light'); + } else { + setTheme(document.documentElement.getAttribute('data-theme')); + } + } else { + // load a stored theme + if (theme === 'light') { + document.documentElement.setAttribute('data-theme', 'light'); + } else { + document.documentElement.setAttribute('data-theme', 'dark'); + } + } +} + + +// switch themes +function switchTheme() { + const theme = getTheme(); + if (theme === 'light') { + setTheme('dark'); + } else { + setTheme('light'); + } +} + +document.addEventListener('DOMContentLoaded', function () { + const themeSwitcher = document.querySelector('.theme-switch'); + themeSwitcher.addEventListener('click', switchTheme, false); +}, false); + +init(); diff --git a/themes/anatole/assets/js/jquery-appear.js b/themes/anatole/assets/js/jquery-appear.js new file mode 100644 index 0000000..3b84698 --- /dev/null +++ b/themes/anatole/assets/js/jquery-appear.js @@ -0,0 +1,124 @@ +/* + * jQuery appear plugin + * + * Copyright (c) 2012 Andrey Sidorov + * licensed under MIT license. + * + * https://github.com/morr/jquery.appear/ + * + * Version: 0.4 + */ +(function ($) { + var selectors = []; + + var check_binded = false; + var check_lock = false; + var defaults = { + interval: 250, + force_process: false + }; + var $window = $(window); + + var $prior_appeared = []; + + function appeared(selector) { + return $(selector).filter(function () { + return $(this).is(':appeared'); + }); + } + + function process() { + check_lock = false; + for (var index = 0, selectorsLength = selectors.length; index < selectorsLength; index++) { + var $appeared = appeared(selectors[index]); + + $appeared.trigger('appear', [$appeared]); + + if ($prior_appeared[index]) { + var $disappeared = $prior_appeared[index].not($appeared); + $disappeared.trigger('disappear', [$disappeared]); + } + $prior_appeared[index] = $appeared; + } + } + + function add_selector(selector) { + selectors.push(selector); + $prior_appeared.push(); + } + + // ":appeared" custom filter + $.expr.pseudos.appeared = $.expr.createPseudo(function (arg) { + return function (element) { + var $element = $(element); + if (!$element.is(':visible')) { + return false; + } + + var window_left = $window.scrollLeft(); + var window_top = $window.scrollTop(); + var offset = $element.offset(); + var left = offset.left; + var top = offset.top; + + if (top + $element.height() >= window_top && + top - ($element.data('appear-top-offset') || 0) <= window_top + $window.height() && + left + $element.width() >= window_left && + left - ($element.data('appear-left-offset') || 0) <= window_left + $window.width()) { + return true; + } else { + return false; + } + }; + }); + + $.fn.extend({ + // watching for element's appearance in browser viewport + appear: function (selector, options) { + $.appear(this, options); + return this; + } + }); + + $.extend({ + appear: function (selector, options) { + var opts = $.extend({}, defaults, options || {}); + + if (!check_binded) { + var on_check = function () { + if (check_lock) { + return; + } + check_lock = true; + + setTimeout(process, opts.interval); + }; + + $(window).scroll(on_check).resize(on_check); + check_binded = true; + } + + if (opts.force_process) { + setTimeout(process, opts.interval); + } + + add_selector(selector); + }, + // force elements's appearance check + force_appear: function () { + if (check_binded) { + process(); + return true; + } + return false; + } + }); +})(function () { + if (typeof module !== 'undefined') { + // Node + return require('jquery'); + } else { + return jQuery; + } +}()); + \ No newline at end of file diff --git a/themes/anatole/assets/js/jquery-migrate.js b/themes/anatole/assets/js/jquery-migrate.js new file mode 100644 index 0000000..d759cce --- /dev/null +++ b/themes/anatole/assets/js/jquery-migrate.js @@ -0,0 +1,837 @@ +/*! + * jQuery Migrate - v3.3.0 - 2020-05-05T01:57Z + * Copyright OpenJS Foundation and other contributors + */ +(function (factory) { + "use strict"; + + if (typeof define === "function" && define.amd) { + + // AMD. Register as an anonymous module. + define(["jquery"], function (jQuery) { + return factory(jQuery, window); + }); + } else if (typeof module === "object" && module.exports) { + + // Node/CommonJS + // eslint-disable-next-line no-undef + module.exports = factory(require("jquery"), window); + } else { + + // Browser globals + factory(jQuery, window); + } +})(function (jQuery, window) { + "use strict"; + + jQuery.migrateVersion = "3.3.0"; + +// Returns 0 if v1 == v2, -1 if v1 < v2, 1 if v1 > v2 + function compareVersions(v1, v2) { + var i, + rVersionParts = /^(\d+)\.(\d+)\.(\d+)/, + v1p = rVersionParts.exec(v1) || [], + v2p = rVersionParts.exec(v2) || []; + + for (i = 1; i <= 3; i++) { + if (+v1p[i] > +v2p[i]) { + return 1; + } + if (+v1p[i] < +v2p[i]) { + return -1; + } + } + return 0; + } + + function jQueryVersionSince(version) { + return compareVersions(jQuery.fn.jquery, version) >= 0; + } + + (function () { + + // Support: IE9 only + // IE9 only creates console object when dev tools are first opened + // IE9 console is a host object, callable but doesn't have .apply() + if (!window.console || !window.console.log) { + return; + } + + // Need jQuery 3.0.0+ and no older Migrate loaded + if (!jQuery || !jQueryVersionSince("3.0.0")) { + window.console.log("JQMIGRATE: jQuery 3.0.0+ REQUIRED"); + } + if (jQuery.migrateWarnings) { + window.console.log("JQMIGRATE: Migrate plugin loaded multiple times"); + } + + // Show a message on the console so devs know we're active + window.console.log("JQMIGRATE: Migrate is installed" + + (jQuery.migrateMute ? "" : " with logging active") + + ", version " + jQuery.migrateVersion); + + })(); + + var warnedAbout = {}; + +// By default each warning is only reported once. + jQuery.migrateDeduplicateWarnings = true; + +// List of warnings already given; public read only + jQuery.migrateWarnings = []; + +// Set to false to disable traces that appear with warnings + if (jQuery.migrateTrace === undefined) { + jQuery.migrateTrace = true; + } + +// Forget any warnings we've already given; public + jQuery.migrateReset = function () { + warnedAbout = {}; + jQuery.migrateWarnings.length = 0; + }; + + function migrateWarn(msg) { + var console = window.console; + if (!jQuery.migrateDeduplicateWarnings || !warnedAbout[msg]) { + warnedAbout[msg] = true; + jQuery.migrateWarnings.push(msg); + if (console && console.warn && !jQuery.migrateMute) { + console.warn("JQMIGRATE: " + msg); + if (jQuery.migrateTrace && console.trace) { + console.trace(); + } + } + } + } + + function migrateWarnProp(obj, prop, value, msg) { + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + get: function () { + migrateWarn(msg); + return value; + }, + set: function (newValue) { + migrateWarn(msg); + value = newValue; + } + }); + } + + function migrateWarnFunc(obj, prop, newFunc, msg) { + obj[prop] = function () { + migrateWarn(msg); + return newFunc.apply(this, arguments); + }; + } + + if (window.document.compatMode === "BackCompat") { + + // JQuery has never supported or tested Quirks Mode + migrateWarn("jQuery is not compatible with Quirks Mode"); + } + + var findProp, + class2type = {}, + oldInit = jQuery.fn.init, + oldFind = jQuery.find, + + rattrHashTest = /\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/, + rattrHashGlob = /\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/g, + + // Support: Android <=4.0 only + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g; + + jQuery.fn.init = function (arg1) { + var args = Array.prototype.slice.call(arguments); + + if (typeof arg1 === "string" && arg1 === "#") { + + // JQuery( "#" ) is a bogus ID selector, but it returned an empty set before jQuery 3.0 + migrateWarn("jQuery( '#' ) is not a valid selector"); + args[0] = []; + } + + return oldInit.apply(this, args); + }; + jQuery.fn.init.prototype = jQuery.fn; + + jQuery.find = function (selector) { + var args = Array.prototype.slice.call(arguments); + + // Support: PhantomJS 1.x + // String#match fails to match when used with a //g RegExp, only on some strings + if (typeof selector === "string" && rattrHashTest.test(selector)) { + + // The nonstandard and undocumented unquoted-hash was removed in jQuery 1.12.0 + // First see if qS thinks it's a valid selector, if so avoid a false positive + try { + window.document.querySelector(selector); + } catch (err1) { + + // Didn't *look* valid to qSA, warn and try quoting what we think is the value + selector = selector.replace(rattrHashGlob, function (_, attr, op, value) { + return "[" + attr + op + "\"" + value + "\"]"; + }); + + // If the regexp *may* have created an invalid selector, don't update it + // Note that there may be false alarms if selector uses jQuery extensions + try { + window.document.querySelector(selector); + migrateWarn("Attribute selector with '#' must be quoted: " + args[0]); + args[0] = selector; + } catch (err2) { + migrateWarn("Attribute selector with '#' was not fixed: " + args[0]); + } + } + } + + return oldFind.apply(this, args); + }; + +// Copy properties attached to original jQuery.find method (e.g. .attr, .isXML) + for (findProp in oldFind) { + if (Object.prototype.hasOwnProperty.call(oldFind, findProp)) { + jQuery.find[findProp] = oldFind[findProp]; + } + } + +// The number of elements contained in the matched element set + migrateWarnFunc(jQuery.fn, "size", function () { + return this.length; + }, + "jQuery.fn.size() is deprecated and removed; use the .length property"); + + migrateWarnFunc(jQuery, "parseJSON", function () { + return JSON.parse.apply(null, arguments); + }, + "jQuery.parseJSON is deprecated; use JSON.parse"); + + migrateWarnFunc(jQuery, "holdReady", jQuery.holdReady, + "jQuery.holdReady is deprecated"); + + migrateWarnFunc(jQuery, "unique", jQuery.uniqueSort, + "jQuery.unique is deprecated; use jQuery.uniqueSort"); + +// Now jQuery.expr.pseudos is the standard incantation + migrateWarnProp(jQuery.expr, "filters", jQuery.expr.pseudos, + "jQuery.expr.filters is deprecated; use jQuery.expr.pseudos"); + migrateWarnProp(jQuery.expr, ":", jQuery.expr.pseudos, + "jQuery.expr[':'] is deprecated; use jQuery.expr.pseudos"); + +// Prior to jQuery 3.1.1 there were internal refs so we don't warn there + if (jQueryVersionSince("3.1.1")) { + migrateWarnFunc(jQuery, "trim", function (text) { + return text == null ? + "" : + (text + "").replace(rtrim, ""); + }, + "jQuery.trim is deprecated; use String.prototype.trim"); + } + +// Prior to jQuery 3.2 there were internal refs so we don't warn there + if (jQueryVersionSince("3.2.0")) { + migrateWarnFunc(jQuery, "nodeName", function (elem, name) { + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + }, + "jQuery.nodeName is deprecated"); + } + + if (jQueryVersionSince("3.3.0")) { + + migrateWarnFunc(jQuery, "isNumeric", function (obj) { + + // As of jQuery 3.0, isNumeric is limited to + // strings and numbers (primitives or objects) + // that can be coerced to finite numbers (gh-2662) + var type = typeof obj; + return (type === "number" || type === "string") && + + // parseFloat NaNs numeric-cast false positives ("") + // ...but misinterprets leading-number strings, e.g. hex literals ("0x...") + // subtraction forces infinities to NaN + !isNaN(obj - parseFloat(obj)); + }, + "jQuery.isNumeric() is deprecated" + ); + + // Populate the class2type map + jQuery.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "), + function (_, name) { + class2type["[object " + name + "]"] = name.toLowerCase(); + }); + + migrateWarnFunc(jQuery, "type", function (obj) { + if (obj == null) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[Object.prototype.toString.call(obj)] || "object" : + typeof obj; + }, + "jQuery.type is deprecated"); + + migrateWarnFunc(jQuery, "isFunction", + function (obj) { + return typeof obj === "function"; + }, + "jQuery.isFunction() is deprecated"); + + migrateWarnFunc(jQuery, "isWindow", + function (obj) { + return obj != null && obj === obj.window; + }, + "jQuery.isWindow() is deprecated" + ); + + migrateWarnFunc(jQuery, "isArray", Array.isArray, + "jQuery.isArray is deprecated; use Array.isArray" + ); + } + +// Support jQuery slim which excludes the ajax module + if (jQuery.ajax) { + + var oldAjax = jQuery.ajax; + + jQuery.ajax = function () { + var jQXHR = oldAjax.apply(this, arguments); + + // Be sure we got a jQXHR (e.g., not sync) + if (jQXHR.promise) { + migrateWarnFunc(jQXHR, "success", jQXHR.done, + "jQXHR.success is deprecated and removed"); + migrateWarnFunc(jQXHR, "error", jQXHR.fail, + "jQXHR.error is deprecated and removed"); + migrateWarnFunc(jQXHR, "complete", jQXHR.always, + "jQXHR.complete is deprecated and removed"); + } + + return jQXHR; + }; + + } + + var oldRemoveAttr = jQuery.fn.removeAttr, + oldToggleClass = jQuery.fn.toggleClass, + rmatchNonSpace = /\S+/g; + + jQuery.fn.removeAttr = function (name) { + var self = this; + + jQuery.each(name.match(rmatchNonSpace), function (_i, attr) { + if (jQuery.expr.match.bool.test(attr)) { + migrateWarn("jQuery.fn.removeAttr no longer sets boolean properties: " + attr); + self.prop(attr, false); + } + }); + + return oldRemoveAttr.apply(this, arguments); + }; + + jQuery.fn.toggleClass = function (state) { + + // Only deprecating no-args or single boolean arg + if (state !== undefined && typeof state !== "boolean") { + return oldToggleClass.apply(this, arguments); + } + + migrateWarn("jQuery.fn.toggleClass( boolean ) is deprecated"); + + // Toggle entire class name of each element + return this.each(function () { + var className = this.getAttribute && this.getAttribute("class") || ""; + + if (className) { + jQuery.data(this, "__className__", className); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if (this.setAttribute) { + this.setAttribute("class", + className || state === false ? + "" : + jQuery.data(this, "__className__") || "" + ); + } + }); + }; + + function camelCase(string) { + return string.replace(/-([a-z])/g, function (_, letter) { + return letter.toUpperCase(); + }); + } + + var oldFnCss, + internalSwapCall = false, + ralphaStart = /^[a-z]/, + + // The regex visualized: + // + // /----------\ + // | | /-------\ + // | / Top \ | | | + // /--- Border ---+-| Right |-+---+- Width -+---\ + // | | Bottom | | + // | \ Left / | + // | | + // | /----------\ | + // | /-------------\ | | |- END + // | | | | / Top \ | | + // | | / Margin \ | | | Right | | | + // |---------+-| |-+---+-| Bottom |-+----| + // | \ Padding / \ Left / | + // BEGIN -| | + // | /---------\ | + // | | | | + // | | / Min \ | / Width \ | + // \--------------+-| |-+---| |---/ + // \ Max / \ Height / + rautoPx = /^(?:Border(?:Top|Right|Bottom|Left)?(?:Width|)|(?:Margin|Padding)?(?:Top|Right|Bottom|Left)?|(?:Min|Max)?(?:Width|Height))$/; + +// If this version of jQuery has .swap(), don't false-alarm on internal uses + if (jQuery.swap) { + jQuery.each(["height", "width", "reliableMarginRight"], function (_, name) { + var oldHook = jQuery.cssHooks[name] && jQuery.cssHooks[name].get; + + if (oldHook) { + jQuery.cssHooks[name].get = function () { + var ret; + + internalSwapCall = true; + ret = oldHook.apply(this, arguments); + internalSwapCall = false; + return ret; + }; + } + }); + } + + jQuery.swap = function (elem, options, callback, args) { + var ret, name, + old = {}; + + if (!internalSwapCall) { + migrateWarn("jQuery.swap() is undocumented and deprecated"); + } + + // Remember the old values, and insert the new ones + for (name in options) { + old[name] = elem.style[name]; + elem.style[name] = options[name]; + } + + ret = callback.apply(elem, args || []); + + // Revert the old values + for (name in options) { + elem.style[name] = old[name]; + } + + return ret; + }; + + if (jQueryVersionSince("3.4.0") && typeof Proxy !== "undefined") { + + jQuery.cssProps = new Proxy(jQuery.cssProps || {}, { + set: function () { + migrateWarn("JQMIGRATE: jQuery.cssProps is deprecated"); + return Reflect.set.apply(this, arguments); + } + }); + } + +// Create a dummy jQuery.cssNumber if missing. It won't be used by jQuery but +// it will prevent code adding new keys to it unconditionally from crashing. + if (!jQuery.cssNumber) { + jQuery.cssNumber = {}; + } + + function isAutoPx(prop) { + + // The first test is used to ensure that: + // 1. The prop starts with a lowercase letter (as we uppercase it for the second regex). + // 2. The prop is not empty. + return ralphaStart.test(prop) && + rautoPx.test(prop[0].toUpperCase() + prop.slice(1)); + } + + oldFnCss = jQuery.fn.css; + + jQuery.fn.css = function (name, value) { + var origThis = this; + if (typeof name !== "string") { + jQuery.each(name, function (n, v) { + jQuery.fn.css.call(origThis, n, v); + }); + } + if (typeof value === "number" && !isAutoPx(camelCase(name))) { + migrateWarn("Use of number-typed values is deprecated in jQuery.fn.css"); + } + + return oldFnCss.apply(this, arguments); + }; + + var oldData = jQuery.data; + + jQuery.data = function (elem, name, value) { + var curData, sameKeys, key; + + // Name can be an object, and each entry in the object is meant to be set as data + if (name && typeof name === "object" && arguments.length === 2) { + curData = jQuery.hasData(elem) && oldData.call(this, elem); + sameKeys = {}; + for (key in name) { + if (key !== camelCase(key)) { + migrateWarn("jQuery.data() always sets/gets camelCased names: " + key); + curData[key] = name[key]; + } else { + sameKeys[key] = name[key]; + } + } + + oldData.call(this, elem, sameKeys); + + return name; + } + + // If the name is transformed, look for the un-transformed name in the data object + if (name && typeof name === "string" && name !== camelCase(name)) { + curData = jQuery.hasData(elem) && oldData.call(this, elem); + if (curData && name in curData) { + migrateWarn("jQuery.data() always sets/gets camelCased names: " + name); + if (arguments.length > 2) { + curData[name] = value; + } + return curData[name]; + } + } + + return oldData.apply(this, arguments); + }; + +// Support jQuery slim which excludes the effects module + if (jQuery.fx) { + + var intervalValue, intervalMsg, + oldTweenRun = jQuery.Tween.prototype.run, + linearEasing = function (pct) { + return pct; + }; + + jQuery.Tween.prototype.run = function () { + if (jQuery.easing[this.easing].length > 1) { + migrateWarn( + "'jQuery.easing." + this.easing.toString() + "' should use only one argument" + ); + + jQuery.easing[this.easing] = linearEasing; + } + + oldTweenRun.apply(this, arguments); + }; + + intervalValue = jQuery.fx.interval || 13; + intervalMsg = "jQuery.fx.interval is deprecated"; + +// Support: IE9, Android <=4.4 +// Avoid false positives on browsers that lack rAF +// Don't warn if document is hidden, jQuery uses setTimeout (#292) + if (window.requestAnimationFrame) { + Object.defineProperty(jQuery.fx, "interval", { + configurable: true, + enumerable: true, + get: function () { + if (!window.document.hidden) { + migrateWarn(intervalMsg); + } + return intervalValue; + }, + set: function (newValue) { + migrateWarn(intervalMsg); + intervalValue = newValue; + } + }); + } + + } + + var oldLoad = jQuery.fn.load, + oldEventAdd = jQuery.event.add, + originalFix = jQuery.event.fix; + + jQuery.event.props = []; + jQuery.event.fixHooks = {}; + + migrateWarnProp(jQuery.event.props, "concat", jQuery.event.props.concat, + "jQuery.event.props.concat() is deprecated and removed"); + + jQuery.event.fix = function (originalEvent) { + var event, + type = originalEvent.type, + fixHook = this.fixHooks[type], + props = jQuery.event.props; + + if (props.length) { + migrateWarn("jQuery.event.props are deprecated and removed: " + props.join()); + while (props.length) { + jQuery.event.addProp(props.pop()); + } + } + + if (fixHook && !fixHook._migrated_) { + fixHook._migrated_ = true; + migrateWarn("jQuery.event.fixHooks are deprecated and removed: " + type); + if ((props = fixHook.props) && props.length) { + while (props.length) { + jQuery.event.addProp(props.pop()); + } + } + } + + event = originalFix.call(this, originalEvent); + + return fixHook && fixHook.filter ? fixHook.filter(event, originalEvent) : event; + }; + + jQuery.event.add = function (elem, types) { + + // This misses the multiple-types case but that seems awfully rare + if (elem === window && types === "load" && window.document.readyState === "complete") { + migrateWarn("jQuery(window).on('load'...) called after load event occurred"); + } + return oldEventAdd.apply(this, arguments); + }; + + jQuery.each(["load", "unload", "error"], function (_, name) { + + jQuery.fn[name] = function () { + var args = Array.prototype.slice.call(arguments, 0); + + // If this is an ajax load() the first arg should be the string URL; + // technically this could also be the "Anything" arg of the event .load() + // which just goes to show why this dumb signature has been deprecated! + // jQuery custom builds that exclude the Ajax module justifiably die here. + if (name === "load" && typeof args[0] === "string") { + return oldLoad.apply(this, args); + } + + migrateWarn("jQuery.fn." + name + "() is deprecated"); + + args.splice(0, 0, name); + if (arguments.length) { + return this.on.apply(this, args); + } + + // Use .triggerHandler here because: + // - load and unload events don't need to bubble, only applied to window or image + // - error event should not bubble to window, although it does pre-1.7 + // See http://bugs.jquery.com/ticket/11820 + this.triggerHandler.apply(this, args); + return this; + }; + + }); + + jQuery.each(("blur focus focusin focusout resize scroll click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup contextmenu").split(" "), + function (_i, name) { + + // Handle event binding + jQuery.fn[name] = function (data, fn) { + migrateWarn("jQuery.fn." + name + "() event shorthand is deprecated"); + return arguments.length > 0 ? + this.on(name, null, data, fn) : + this.trigger(name); + }; + }); + +// Trigger "ready" event only once, on document ready + jQuery(function () { + jQuery(window.document).triggerHandler("ready"); + }); + + jQuery.event.special.ready = { + setup: function () { + if (this === window.document) { + migrateWarn("'ready' event is deprecated"); + } + } + }; + + jQuery.fn.extend({ + + bind: function (types, data, fn) { + migrateWarn("jQuery.fn.bind() is deprecated"); + return this.on(types, null, data, fn); + }, + unbind: function (types, fn) { + migrateWarn("jQuery.fn.unbind() is deprecated"); + return this.off(types, null, fn); + }, + delegate: function (selector, types, data, fn) { + migrateWarn("jQuery.fn.delegate() is deprecated"); + return this.on(types, selector, data, fn); + }, + undelegate: function (selector, types, fn) { + migrateWarn("jQuery.fn.undelegate() is deprecated"); + return arguments.length === 1 ? + this.off(selector, "**") : + this.off(types, selector || "**", fn); + }, + hover: function (fnOver, fnOut) { + migrateWarn("jQuery.fn.hover() is deprecated"); + return this.on("mouseenter", fnOver).on("mouseleave", fnOut || fnOver); + } + }); + + var rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi, + origHtmlPrefilter = jQuery.htmlPrefilter, + makeMarkup = function (html) { + var doc = window.document.implementation.createHTMLDocument(""); + doc.body.innerHTML = html; + return doc.body && doc.body.innerHTML; + }, + warnIfChanged = function (html) { + var changed = html.replace(rxhtmlTag, "<$1>"); + if (changed !== html && makeMarkup(html) !== makeMarkup(changed)) { + migrateWarn("HTML tags must be properly nested and closed: " + html); + } + }; + + jQuery.UNSAFE_restoreLegacyHtmlPrefilter = function () { + jQuery.htmlPrefilter = function (html) { + warnIfChanged(html); + return html.replace(rxhtmlTag, "<$1>"); + }; + }; + + jQuery.htmlPrefilter = function (html) { + warnIfChanged(html); + return origHtmlPrefilter(html); + }; + + var oldOffset = jQuery.fn.offset; + + jQuery.fn.offset = function () { + var docElem, + elem = this[0], + bogus = {top: 0, left: 0}; + + if (!elem || !elem.nodeType) { + migrateWarn("jQuery.fn.offset() requires a valid DOM element"); + return undefined; + } + + docElem = (elem.ownerDocument || window.document).documentElement; + if (!jQuery.contains(docElem, elem)) { + migrateWarn("jQuery.fn.offset() requires an element connected to a document"); + return bogus; + } + + return oldOffset.apply(this, arguments); + }; + +// Support jQuery slim which excludes the ajax module +// The jQuery.param patch is about respecting `jQuery.ajaxSettings.traditional` +// so it doesn't make sense for the slim build. + if (jQuery.ajax) { + + var oldParam = jQuery.param; + + jQuery.param = function (data, traditional) { + var ajaxTraditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional; + + if (traditional === undefined && ajaxTraditional) { + + migrateWarn("jQuery.param() no longer uses jQuery.ajaxSettings.traditional"); + traditional = ajaxTraditional; + } + + return oldParam.call(this, data, traditional); + }; + + } + + var oldSelf = jQuery.fn.andSelf || jQuery.fn.addBack; + + jQuery.fn.andSelf = function () { + migrateWarn("jQuery.fn.andSelf() is deprecated and removed, use jQuery.fn.addBack()"); + return oldSelf.apply(this, arguments); + }; + +// Support jQuery slim which excludes the deferred module in jQuery 4.0+ + if (jQuery.Deferred) { + + var oldDeferred = jQuery.Deferred, + tuples = [ + + // Action, add listener, callbacks, .then handlers, final state + ["resolve", "done", jQuery.Callbacks("once memory"), + jQuery.Callbacks("once memory"), "resolved"], + ["reject", "fail", jQuery.Callbacks("once memory"), + jQuery.Callbacks("once memory"), "rejected"], + ["notify", "progress", jQuery.Callbacks("memory"), + jQuery.Callbacks("memory")] + ]; + + jQuery.Deferred = function (func) { + var deferred = oldDeferred(), + promise = deferred.promise(); + + deferred.pipe = promise.pipe = function ( /* fnDone, fnFail, fnProgress */) { + var fns = arguments; + + migrateWarn("deferred.pipe() is deprecated"); + + return jQuery.Deferred(function (newDefer) { + jQuery.each(tuples, function (i, tuple) { + var fn = typeof fns[i] === "function" && fns[i]; + + // Deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + deferred[tuple[1]](function () { + var returned = fn && fn.apply(this, arguments); + if (returned && typeof returned.promise === "function") { + returned.promise() + .done(newDefer.resolve) + .fail(newDefer.reject) + .progress(newDefer.notify); + } else { + newDefer[tuple[0] + "With"]( + this === promise ? newDefer.promise() : this, + fn ? [returned] : arguments + ); + } + }); + }); + fns = null; + }).promise(); + + }; + + if (func) { + func.call(deferred, deferred); + } + + return deferred; + }; + +// Preserve handler of uncaught exceptions in promise chains + jQuery.Deferred.exceptionHook = oldDeferred.exceptionHook; + + } + + return jQuery; +}); \ No newline at end of file diff --git a/themes/anatole/assets/js/jquery.js b/themes/anatole/assets/js/jquery.js new file mode 100644 index 0000000..8ab0167 --- /dev/null +++ b/themes/anatole/assets/js/jquery.js @@ -0,0 +1,10836 @@ +/*! + * jQuery JavaScript Library v3.5.1 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2020-05-04T22:49Z + */ +(function (global, factory) { + + "use strict"; + + if (typeof module === "object" && typeof module.exports === "object") { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory(global, true) : + function (w) { + if (!w.document) { + throw new Error("jQuery requires a window with a document"); + } + return factory(w); + }; + } else { + factory(global); + } + +// Pass this if window is not defined yet +})(typeof window !== "undefined" ? window : this, function (window, noGlobal) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. + "use strict"; + + var arr = []; + + var getProto = Object.getPrototypeOf; + + var slice = arr.slice; + + var flat = arr.flat ? function (array) { + return arr.flat.call(array); + } : function (array) { + return arr.concat.apply([], array); + }; + + + var push = arr.push; + + var indexOf = arr.indexOf; + + var class2type = {}; + + var toString = class2type.toString; + + var hasOwn = class2type.hasOwnProperty; + + var fnToString = hasOwn.toString; + + var ObjectFunctionString = fnToString.call(Object); + + var support = {}; + + var isFunction = function isFunction(obj) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + return typeof obj === "function" && typeof obj.nodeType !== "number"; + }; + + + var isWindow = function isWindow(obj) { + return obj != null && obj === obj.window; + }; + + + var document = window.document; + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval(code, node, doc) { + doc = doc || document; + + var i, val, + script = doc.createElement("script"); + + script.text = code; + if (node) { + for (i in preservedScriptAttributes) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[i] || node.getAttribute && node.getAttribute(i); + if (val) { + script.setAttribute(i, val); + } + } + } + doc.head.appendChild(script).parentNode.removeChild(script); + } + + + function toType(obj) { + if (obj == null) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[toString.call(obj)] || "object" : + typeof obj; + } + + /* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + var + version = "3.5.1", + + // Define a local copy of jQuery + jQuery = function (selector, context) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init(selector, context); + }; + + jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function () { + return slice.call(this); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function (num) { + + // Return all the elements in a clean array + if (num == null) { + return slice.call(this); + } + + // Return just the one element from the set + return num < 0 ? this[num + this.length] : this[num]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function (elems) { + + // Build a new jQuery matched element set + var ret = jQuery.merge(this.constructor(), elems); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function (callback) { + return jQuery.each(this, callback); + }, + + map: function (callback) { + return this.pushStack(jQuery.map(this, function (elem, i) { + return callback.call(elem, i, elem); + })); + }, + + slice: function () { + return this.pushStack(slice.apply(this, arguments)); + }, + + first: function () { + return this.eq(0); + }, + + last: function () { + return this.eq(-1); + }, + + even: function () { + return this.pushStack(jQuery.grep(this, function (_elem, i) { + return (i + 1) % 2; + })); + }, + + odd: function () { + return this.pushStack(jQuery.grep(this, function (_elem, i) { + return i % 2; + })); + }, + + eq: function (i) { + var len = this.length, + j = +i + (i < 0 ? len : 0); + return this.pushStack(j >= 0 && j < len ? [this[j]] : []); + }, + + end: function () { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice + }; + + jQuery.extend = jQuery.fn.extend = function () { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if (typeof target === "boolean") { + deep = target; + + // Skip the boolean and the target + target = arguments[i] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if (typeof target !== "object" && !isFunction(target)) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if (i === length) { + target = this; + i--; + } + + for (; i < length; i++) { + + // Only deal with non-null/undefined values + if ((options = arguments[i]) != null) { + + // Extend the base object + for (name in options) { + copy = options[name]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if (name === "__proto__" || target === copy) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if (deep && copy && (jQuery.isPlainObject(copy) || + (copyIsArray = Array.isArray(copy)))) { + src = target[name]; + + // Ensure proper type for the source value + if (copyIsArray && !Array.isArray(src)) { + clone = []; + } else if (!copyIsArray && !jQuery.isPlainObject(src)) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[name] = jQuery.extend(deep, clone, copy); + + // Don't bring in undefined values + } else if (copy !== undefined) { + target[name] = copy; + } + } + } + } + + // Return the modified object + return target; + }; + + jQuery.extend({ + + // Unique for each copy of jQuery on the page + expando: "jQuery" + (version + Math.random()).replace(/\D/g, ""), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function (msg) { + throw new Error(msg); + }, + + noop: function () { + }, + + isPlainObject: function (obj) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if (!obj || toString.call(obj) !== "[object Object]") { + return false; + } + + proto = getProto(obj); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if (!proto) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call(proto, "constructor") && proto.constructor; + return typeof Ctor === "function" && fnToString.call(Ctor) === ObjectFunctionString; + }, + + isEmptyObject: function (obj) { + var name; + + for (name in obj) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function (code, options, doc) { + DOMEval(code, {nonce: options && options.nonce}, doc); + }, + + each: function (obj, callback) { + var length, i = 0; + + if (isArrayLike(obj)) { + length = obj.length; + for (; i < length; i++) { + if (callback.call(obj[i], i, obj[i]) === false) { + break; + } + } + } else { + for (i in obj) { + if (callback.call(obj[i], i, obj[i]) === false) { + break; + } + } + } + + return obj; + }, + + // results is for internal usage only + makeArray: function (arr, results) { + var ret = results || []; + + if (arr != null) { + if (isArrayLike(Object(arr))) { + jQuery.merge(ret, + typeof arr === "string" ? + [arr] : arr + ); + } else { + push.call(ret, arr); + } + } + + return ret; + }, + + inArray: function (elem, arr, i) { + return arr == null ? -1 : indexOf.call(arr, elem, i); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function (first, second) { + var len = +second.length, + j = 0, + i = first.length; + + for (; j < len; j++) { + first[i++] = second[j]; + } + + first.length = i; + + return first; + }, + + grep: function (elems, callback, invert) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for (; i < length; i++) { + callbackInverse = !callback(elems[i], i); + if (callbackInverse !== callbackExpect) { + matches.push(elems[i]); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function (elems, callback, arg) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if (isArrayLike(elems)) { + length = elems.length; + for (; i < length; i++) { + value = callback(elems[i], i, arg); + + if (value != null) { + ret.push(value); + } + } + + // Go through every key on the object, + } else { + for (i in elems) { + value = callback(elems[i], i, arg); + + if (value != null) { + ret.push(value); + } + } + } + + // Flatten any nested arrays + return flat(ret); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support + }); + + if (typeof Symbol === "function") { + jQuery.fn[Symbol.iterator] = arr[Symbol.iterator]; + } + +// Populate the class2type map + jQuery.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "), + function (_i, name) { + class2type["[object " + name + "]"] = name.toLowerCase(); + }); + + function isArrayLike(obj) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType(obj); + + if (isFunction(obj) || isWindow(obj)) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && (length - 1) in obj; + } + + var Sizzle = + /*! + * Sizzle CSS Selector Engine v2.3.5 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2020-03-14 + */ + (function (window) { + var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function (a, b) { + if (a === b) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ({}).hasOwnProperty, + arr = [], + pop = arr.pop, + pushNative = arr.push, + push = arr.push, + slice = arr.slice, + + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function (list, elem) { + var i = 0, + len = list.length; + for (; i < len; i++) { + if (list[i] === elem) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" + + "ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] + // or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp(whitespace + "+", "g"), + rtrim = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + + whitespace + "+$", "g"), + + rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"), + rcombinators = new RegExp("^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + + "*"), + rdescend = new RegExp(whitespace + "|>"), + + rpseudo = new RegExp(pseudos), + ridentifier = new RegExp("^" + identifier + "$"), + + matchExpr = { + "ID": new RegExp("^#(" + identifier + ")"), + "CLASS": new RegExp("^\\.(" + identifier + ")"), + "TAG": new RegExp("^(" + identifier + "|[*])"), + "ATTR": new RegExp("^" + attributes), + "PSEUDO": new RegExp("^" + pseudos), + "CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i"), + "bool": new RegExp("^(?:" + booleans + ")$", "i"), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp("^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i") + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp("\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g"), + funescape = function (escape, nonHex) { + var high = "0x" + escape.slice(1) - 0x10000; + + return nonHex ? + + // Strip the backslash prefix from a non-hex escape sequence + nonHex : + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + high < 0 ? + String.fromCharCode(high + 0x10000) : + String.fromCharCode(high >> 10 | 0xD800, high & 0x3FF | 0xDC00); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function (ch, asCodePoint) { + if (asCodePoint) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if (ch === "\0") { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice(0, -1) + "\\" + + ch.charCodeAt(ch.length - 1).toString(16) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function () { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function (elem) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + {dir: "parentNode", next: "legend"} + ); + +// Optimize for push.apply( _, NodeList ) + try { + push.apply( + (arr = slice.call(preferredDoc.childNodes)), + preferredDoc.childNodes + ); + + // Support: Android<4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[preferredDoc.childNodes.length].nodeType; + } catch (e) { + push = { + apply: arr.length ? + + // Leverage slice if possible + function (target, els) { + pushNative.apply(target, slice.call(els)); + } : + + // Support: IE<9 + // Otherwise append directly + function (target, els) { + var j = target.length, + i = 0; + + // Can't trust NodeList.length + while ((target[j++] = els[i++])) { + } + target.length = j - 1; + } + }; + } + + function Sizzle(selector, context, results, seed) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if (typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if (!seed) { + setDocument(context); + context = context || document; + + if (documentIsHTML) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if (nodeType !== 11 && (match = rquickExpr.exec(selector))) { + + // ID selector + if ((m = match[1])) { + + // Document context + if (nodeType === 9) { + if ((elem = context.getElementById(m))) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if (elem.id === m) { + results.push(elem); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if (newContext && (elem = newContext.getElementById(m)) && + contains(context, elem) && + elem.id === m) { + + results.push(elem); + return results; + } + } + + // Type selector + } else if (match[2]) { + push.apply(results, context.getElementsByTagName(selector)); + return results; + + // Class selector + } else if ((m = match[3]) && support.getElementsByClassName && + context.getElementsByClassName) { + + push.apply(results, context.getElementsByClassName(m)); + return results; + } + } + + // Take advantage of querySelectorAll + if (support.qsa && + !nonnativeSelectorCache[selector + " "] && + (!rbuggyQSA || !rbuggyQSA.test(selector)) && + + // Support: IE 8 only + // Exclude object elements + (nodeType !== 1 || context.nodeName.toLowerCase() !== "object")) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if (nodeType === 1 && + (rdescend.test(selector) || rcombinators.test(selector))) { + + // Expand context for sibling selectors + newContext = rsibling.test(selector) && testContext(context.parentNode) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + if (newContext !== context || !support.scope) { + + // Capture the context ID, setting it first if necessary + if ((nid = context.getAttribute("id"))) { + nid = nid.replace(rcssescape, fcssescape); + } else { + context.setAttribute("id", (nid = expando)); + } + } + + // Prefix every selector in the list + groups = tokenize(selector); + i = groups.length; + while (i--) { + groups[i] = (nid ? "#" + nid : ":scope") + " " + + toSelector(groups[i]); + } + newSelector = groups.join(","); + } + + try { + push.apply(results, + newContext.querySelectorAll(newSelector) + ); + return results; + } catch (qsaError) { + nonnativeSelectorCache(selector, true); + } finally { + if (nid === expando) { + context.removeAttribute("id"); + } + } + } + } + } + + // All others + return select(selector.replace(rtrim, "$1"), context, results, seed); + } + + /** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ + function createCache() { + var keys = []; + + function cache(key, value) { + + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if (keys.push(key + " ") > Expr.cacheLength) { + + // Only keep the most recent entries + delete cache[keys.shift()]; + } + return (cache[key + " "] = value); + } + + return cache; + } + + /** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ + function markFunction(fn) { + fn[expando] = true; + return fn; + } + + /** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ + function assert(fn) { + var el = document.createElement("fieldset"); + + try { + return !!fn(el); + } catch (e) { + return false; + } finally { + + // Remove from its parent by default + if (el.parentNode) { + el.parentNode.removeChild(el); + } + + // release memory in IE + el = null; + } + } + + /** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ + function addHandle(attrs, handler) { + var arr = attrs.split("|"), + i = arr.length; + + while (i--) { + Expr.attrHandle[arr[i]] = handler; + } + } + + /** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ + function siblingCheck(a, b) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if (diff) { + return diff; + } + + // Check if b follows a + if (cur) { + while ((cur = cur.nextSibling)) { + if (cur === b) { + return -1; + } + } + } + + return a ? 1 : -1; + } + + /** + * Returns a function to use in pseudos for input types + * @param {String} type + */ + function createInputPseudo(type) { + return function (elem) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; + } + + /** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ + function createButtonPseudo(type) { + return function (elem) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; + } + + /** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ + function createDisabledPseudo(disabled) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function (elem) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ("form" in elem) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if (elem.parentNode && elem.disabled === false) { + + // Option elements defer to a parent optgroup if present + if ("label" in elem) { + if ("label" in elem.parentNode) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset(elem) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ("label" in elem) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; + } + + /** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ + function createPositionalPseudo(fn) { + return markFunction(function (argument) { + argument = +argument; + return markFunction(function (seed, matches) { + var j, + matchIndexes = fn([], seed.length, argument), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while (i--) { + if (seed[(j = matchIndexes[i])]) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); + } + + /** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ + function testContext(context) { + return context && typeof context.getElementsByTagName !== "undefined" && context; + } + +// Expose support vars for convenience + support = Sizzle.support = {}; + + /** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ + isXML = Sizzle.isXML = function (elem) { + var namespace = elem.namespaceURI, + docElem = (elem.ownerDocument || elem).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test(namespace || docElem && docElem.nodeName || "HTML"); + }; + + /** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ + setDocument = Sizzle.setDocument = function (node) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if (doc == document || doc.nodeType !== 9 || !doc.documentElement) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML(document); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if (preferredDoc != document && + (subWindow = document.defaultView) && subWindow.top !== subWindow) { + + // Support: IE 11, Edge + if (subWindow.addEventListener) { + subWindow.addEventListener("unload", unloadHandler, false); + + // Support: IE 9 - 10 only + } else if (subWindow.attachEvent) { + subWindow.attachEvent("onunload", unloadHandler); + } + } + + // Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only, + // Safari 4 - 5 only, Opera <=11.6 - 12.x only + // IE/Edge & older browsers don't support the :scope pseudo-class. + // Support: Safari 6.0 only + // Safari 6.0 supports :scope but it's an alias of :root there. + support.scope = assert(function (el) { + docElem.appendChild(el).appendChild(document.createElement("div")); + return typeof el.querySelectorAll !== "undefined" && + !el.querySelectorAll(":scope fieldset div").length; + }); + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert(function (el) { + el.className = "i"; + return !el.getAttribute("className"); + }); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert(function (el) { + el.appendChild(document.createComment("")); + return !el.getElementsByTagName("*").length; + }); + + // Support: IE<9 + support.getElementsByClassName = rnative.test(document.getElementsByClassName); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert(function (el) { + docElem.appendChild(el).id = expando; + return !document.getElementsByName || !document.getElementsByName(expando).length; + }); + + // ID filter and find + if (support.getById) { + Expr.filter["ID"] = function (id) { + var attrId = id.replace(runescape, funescape); + return function (elem) { + return elem.getAttribute("id") === attrId; + }; + }; + Expr.find["ID"] = function (id, context) { + if (typeof context.getElementById !== "undefined" && documentIsHTML) { + var elem = context.getElementById(id); + return elem ? [elem] : []; + } + }; + } else { + Expr.filter["ID"] = function (id) { + var attrId = id.replace(runescape, funescape); + return function (elem) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find["ID"] = function (id, context) { + if (typeof context.getElementById !== "undefined" && documentIsHTML) { + var node, i, elems, + elem = context.getElementById(id); + + if (elem) { + + // Verify the id attribute + node = elem.getAttributeNode("id"); + if (node && node.value === id) { + return [elem]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName(id); + i = 0; + while ((elem = elems[i++])) { + node = elem.getAttributeNode("id"); + if (node && node.value === id) { + return [elem]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find["TAG"] = support.getElementsByTagName ? + function (tag, context) { + if (typeof context.getElementsByTagName !== "undefined") { + return context.getElementsByTagName(tag); + + // DocumentFragment nodes don't have gEBTN + } else if (support.qsa) { + return context.querySelectorAll(tag); + } + } : + + function (tag, context) { + var elem, + tmp = [], + i = 0, + + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName(tag); + + // Filter out possible comments + if (tag === "*") { + while ((elem = results[i++])) { + if (elem.nodeType === 1) { + tmp.push(elem); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find["CLASS"] = support.getElementsByClassName && function (className, context) { + if (typeof context.getElementsByClassName !== "undefined" && documentIsHTML) { + return context.getElementsByClassName(className); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ((support.qsa = rnative.test(document.querySelectorAll))) { + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function (el) { + + var input; + + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild(el).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if (el.querySelectorAll("[msallowcapture^='']").length) { + rbuggyQSA.push("[*^$]=" + whitespace + "*(?:''|\"\")"); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if (!el.querySelectorAll("[selected]").length) { + rbuggyQSA.push("\\[" + whitespace + "*(?:value|" + booleans + ")"); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if (!el.querySelectorAll("[id~=" + expando + "-]").length) { + rbuggyQSA.push("~="); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement("input"); + input.setAttribute("name", ""); + el.appendChild(input); + if (!el.querySelectorAll("[name='']").length) { + rbuggyQSA.push("\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")"); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if (!el.querySelectorAll(":checked").length) { + rbuggyQSA.push(":checked"); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if (!el.querySelectorAll("a#" + expando + "+*").length) { + rbuggyQSA.push(".#.+[+~]"); + } + + // Support: Firefox <=3.6 - 5 only + // Old Firefox doesn't throw on a badly-escaped identifier. + el.querySelectorAll("\\\f"); + rbuggyQSA.push("[\\r\\n\\f]"); + }); + + assert(function (el) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement("input"); + input.setAttribute("type", "hidden"); + el.appendChild(input).setAttribute("name", "D"); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if (el.querySelectorAll("[name=d]").length) { + rbuggyQSA.push("name" + whitespace + "*[*^$|!~]?="); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if (el.querySelectorAll(":enabled").length !== 2) { + rbuggyQSA.push(":enabled", ":disabled"); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild(el).disabled = true; + if (el.querySelectorAll(":disabled").length !== 2) { + rbuggyQSA.push(":enabled", ":disabled"); + } + + // Support: Opera 10 - 11 only + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ((support.matchesSelector = rnative.test((matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector)))) { + + assert(function (el) { + + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call(el, "*"); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call(el, "[s!='']:x"); + rbuggyMatches.push("!=", pseudos); + }); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|")); + rbuggyMatches = rbuggyMatches.length && new RegExp(rbuggyMatches.join("|")); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test(docElem.compareDocumentPosition); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test(docElem.contains) ? + function (a, b) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!(bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains(bup) : + a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16 + )); + } : + function (a, b) { + if (b) { + while ((b = b.parentNode)) { + if (b === a) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function (a, b) { + + // Flag for duplicate removal + if (a === b) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if (compare) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = (a.ownerDocument || a) == (b.ownerDocument || b) ? + a.compareDocumentPosition(b) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if (compare & 1 || + (!support.sortDetached && b.compareDocumentPosition(a) === compare)) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if (a == document || a.ownerDocument == preferredDoc && + contains(preferredDoc, a)) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if (b == document || b.ownerDocument == preferredDoc && + contains(preferredDoc, b)) { + return 1; + } + + // Maintain original order + return sortInput ? + (indexOf(sortInput, a) - indexOf(sortInput, b)) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function (a, b) { + + // Exit early if the nodes are identical + if (a === b) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [a], + bp = [b]; + + // Parentless nodes are either documents or disconnected + if (!aup || !bup) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + return a == document ? -1 : + b == document ? 1 : + /* eslint-enable eqeqeq */ + aup ? -1 : + bup ? 1 : + sortInput ? + (indexOf(sortInput, a) - indexOf(sortInput, b)) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if (aup === bup) { + return siblingCheck(a, b); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ((cur = cur.parentNode)) { + ap.unshift(cur); + } + cur = b; + while ((cur = cur.parentNode)) { + bp.unshift(cur); + } + + // Walk down the tree looking for a discrepancy + while (ap[i] === bp[i]) { + i++; + } + + return i ? + + // Do a sibling check if the nodes have a common ancestor + siblingCheck(ap[i], bp[i]) : + + // Otherwise nodes in our document sort first + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + ap[i] == preferredDoc ? -1 : + bp[i] == preferredDoc ? 1 : + /* eslint-enable eqeqeq */ + 0; + }; + + return document; + }; + + Sizzle.matches = function (expr, elements) { + return Sizzle(expr, null, null, elements); + }; + + Sizzle.matchesSelector = function (elem, expr) { + setDocument(elem); + + if (support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[expr + " "] && + (!rbuggyMatches || !rbuggyMatches.test(expr)) && + (!rbuggyQSA || !rbuggyQSA.test(expr))) { + + try { + var ret = matches.call(elem, expr); + + // IE 9's matchesSelector returns false on disconnected nodes + if (ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11) { + return ret; + } + } catch (e) { + nonnativeSelectorCache(expr, true); + } + } + + return Sizzle(expr, document, null, [elem]).length > 0; + }; + + Sizzle.contains = function (context, elem) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ((context.ownerDocument || context) != document) { + setDocument(context); + } + return contains(context, elem); + }; + + Sizzle.attr = function (elem, name) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ((elem.ownerDocument || elem) != document) { + setDocument(elem); + } + + var fn = Expr.attrHandle[name.toLowerCase()], + + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call(Expr.attrHandle, name.toLowerCase()) ? + fn(elem, name, !documentIsHTML) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute(name) : + (val = elem.getAttributeNode(name)) && val.specified ? + val.value : + null; + }; + + Sizzle.escape = function (sel) { + return (sel + "").replace(rcssescape, fcssescape); + }; + + Sizzle.error = function (msg) { + throw new Error("Syntax error, unrecognized expression: " + msg); + }; + + /** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ + Sizzle.uniqueSort = function (results) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice(0); + results.sort(sortOrder); + + if (hasDuplicate) { + while ((elem = results[i++])) { + if (elem === results[i]) { + j = duplicates.push(i); + } + } + while (j--) { + results.splice(duplicates[j], 1); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; + }; + + /** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ + getText = Sizzle.getText = function (elem) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if (!nodeType) { + + // If no nodeType, this is expected to be an array + while ((node = elem[i++])) { + + // Do not traverse comment nodes + ret += getText(node); + } + } else if (nodeType === 1 || nodeType === 9 || nodeType === 11) { + + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if (typeof elem.textContent === "string") { + return elem.textContent; + } else { + + // Traverse its children + for (elem = elem.firstChild; elem; elem = elem.nextSibling) { + ret += getText(elem); + } + } + } else if (nodeType === 3 || nodeType === 4) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; + }; + + Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": {dir: "parentNode", first: true}, + " ": {dir: "parentNode"}, + "+": {dir: "previousSibling", first: true}, + "~": {dir: "previousSibling"} + }, + + preFilter: { + "ATTR": function (match) { + match[1] = match[1].replace(runescape, funescape); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = (match[3] || match[4] || + match[5] || "").replace(runescape, funescape); + + if (match[2] === "~=") { + match[3] = " " + match[3] + " "; + } + + return match.slice(0, 4); + }, + + "CHILD": function (match) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if (match[1].slice(0, 3) === "nth") { + + // nth-* requires argument + if (!match[3]) { + Sizzle.error(match[0]); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +(match[4] ? + match[5] + (match[6] || 1) : + 2 * (match[3] === "even" || match[3] === "odd")); + match[5] = +((match[7] + match[8]) || match[3] === "odd"); + + // other types prohibit arguments + } else if (match[3]) { + Sizzle.error(match[0]); + } + + return match; + }, + + "PSEUDO": function (match) { + var excess, + unquoted = !match[6] && match[2]; + + if (matchExpr["CHILD"].test(match[0])) { + return null; + } + + // Accept quoted arguments as-is + if (match[3]) { + match[2] = match[4] || match[5] || ""; + + // Strip excess characters from unquoted arguments + } else if (unquoted && rpseudo.test(unquoted) && + + // Get excess from tokenize (recursively) + (excess = tokenize(unquoted, true)) && + + // advance to the next closing parenthesis + (excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) { + + // excess is a negative index + match[0] = match[0].slice(0, excess); + match[2] = unquoted.slice(0, excess); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice(0, 3); + } + }, + + filter: { + + "TAG": function (nodeNameSelector) { + var nodeName = nodeNameSelector.replace(runescape, funescape).toLowerCase(); + return nodeNameSelector === "*" ? + function () { + return true; + } : + function (elem) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function (className) { + var pattern = classCache[className + " "]; + + return pattern || + (pattern = new RegExp("(^|" + whitespace + + ")" + className + "(" + whitespace + "|$)")) && classCache( + className, function (elem) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute("class") || + "" + ); + }); + }, + + "ATTR": function (name, operator, check) { + return function (elem) { + var result = Sizzle.attr(elem, name); + + if (result == null) { + return operator === "!="; + } + if (!operator) { + return true; + } + + result += ""; + + /* eslint-disable max-len */ + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf(check) === 0 : + operator === "*=" ? check && result.indexOf(check) > -1 : + operator === "$=" ? check && result.slice(-check.length) === check : + operator === "~=" ? (" " + result.replace(rwhitespace, " ") + " ").indexOf(check) > -1 : + operator === "|=" ? result === check || result.slice(0, check.length + 1) === check + "-" : + false; + /* eslint-enable max-len */ + + }; + }, + + "CHILD": function (type, what, _argument, first, last) { + var simple = type.slice(0, 3) !== "nth", + forward = type.slice(-4) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function (elem) { + return !!elem.parentNode; + } : + + function (elem, _context, xml) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if (parent) { + + // :(first|last|only)-(child|of-type) + if (simple) { + while (dir) { + node = elem; + while ((node = node[dir])) { + if (ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [forward ? parent.firstChild : parent.lastChild]; + + // non-xml :nth-child(...) stores cache data on `parent` + if (forward && useCache) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[expando] || (node[expando] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[node.uniqueID] || + (outerCache[node.uniqueID] = {}); + + cache = uniqueCache[type] || []; + nodeIndex = cache[0] === dirruns && cache[1]; + diff = nodeIndex && cache[2]; + node = nodeIndex && parent.childNodes[nodeIndex]; + + while ((node = ++nodeIndex && node && node[dir] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop())) { + + // When found, cache indexes on `parent` and break + if (node.nodeType === 1 && ++diff && node === elem) { + uniqueCache[type] = [dirruns, nodeIndex, diff]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if (useCache) { + + // ...in a gzip-friendly way + node = elem; + outerCache = node[expando] || (node[expando] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[node.uniqueID] || + (outerCache[node.uniqueID] = {}); + + cache = uniqueCache[type] || []; + nodeIndex = cache[0] === dirruns && cache[1]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if (diff === false) { + + // Use the same loop as above to seek `elem` from the start + while ((node = ++nodeIndex && node && node[dir] || + (diff = nodeIndex = 0) || start.pop())) { + + if ((ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1) && + ++diff) { + + // Cache the index of each encountered element + if (useCache) { + outerCache = node[expando] || + (node[expando] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[node.uniqueID] || + (outerCache[node.uniqueID] = {}); + + uniqueCache[type] = [dirruns, diff]; + } + + if (node === elem) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || (diff % first === 0 && diff / first >= 0); + } + }; + }, + + "PSEUDO": function (pseudo, argument) { + + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] || + Sizzle.error("unsupported pseudo: " + pseudo); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if (fn[expando]) { + return fn(argument); + } + + // But maintain support for old signatures + if (fn.length > 1) { + args = [pseudo, pseudo, "", argument]; + return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ? + markFunction(function (seed, matches) { + var idx, + matched = fn(seed, argument), + i = matched.length; + while (i--) { + idx = indexOf(seed, matched[i]); + seed[idx] = !(matches[idx] = matched[i]); + } + }) : + function (elem) { + return fn(elem, 0, args); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + "not": markFunction(function (selector) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile(selector.replace(rtrim, "$1")); + + return matcher[expando] ? + markFunction(function (seed, matches, _context, xml) { + var elem, + unmatched = matcher(seed, null, xml, []), + i = seed.length; + + // Match elements unmatched by `matcher` + while (i--) { + if ((elem = unmatched[i])) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function (elem, _context, xml) { + input[0] = elem; + matcher(input, null, xml, results); + + // Don't keep the element (issue #299) + input[0] = null; + return !results.pop(); + }; + }), + + "has": markFunction(function (selector) { + return function (elem) { + return Sizzle(selector, elem).length > 0; + }; + }), + + "contains": markFunction(function (text) { + text = text.replace(runescape, funescape); + return function (elem) { + return (elem.textContent || getText(elem)).indexOf(text) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction(function (lang) { + + // lang value must be a valid identifier + if (!ridentifier.test(lang || "")) { + Sizzle.error("unsupported lang: " + lang); + } + lang = lang.replace(runescape, funescape).toLowerCase(); + return function (elem) { + var elemLang; + do { + if ((elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute("xml:lang") || elem.getAttribute("lang"))) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf(lang + "-") === 0; + } + } while ((elem = elem.parentNode) && elem.nodeType === 1); + return false; + }; + }), + + // Miscellaneous + "target": function (elem) { + var hash = window.location && window.location.hash; + return hash && hash.slice(1) === elem.id; + }, + + "root": function (elem) { + return elem === docElem; + }, + + "focus": function (elem) { + return elem === document.activeElement && + (!document.hasFocus || document.hasFocus()) && + !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": createDisabledPseudo(false), + "disabled": createDisabledPseudo(true), + + "checked": function (elem) { + + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || + (nodeName === "option" && !!elem.selected); + }, + + "selected": function (elem) { + + // Accessing this property makes selected-by-default + // options in Safari work properly + if (elem.parentNode) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function (elem) { + + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for (elem = elem.firstChild; elem; elem = elem.nextSibling) { + if (elem.nodeType < 6) { + return false; + } + } + return true; + }, + + "parent": function (elem) { + return !Expr.pseudos["empty"](elem); + }, + + // Element/input types + "header": function (elem) { + return rheader.test(elem.nodeName); + }, + + "input": function (elem) { + return rinputs.test(elem.nodeName); + }, + + "button": function (elem) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function (elem) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ((attr = elem.getAttribute("type")) == null || + attr.toLowerCase() === "text"); + }, + + // Position-in-collection + "first": createPositionalPseudo(function () { + return [0]; + }), + + "last": createPositionalPseudo(function (_matchIndexes, length) { + return [length - 1]; + }), + + "eq": createPositionalPseudo(function (_matchIndexes, length, argument) { + return [argument < 0 ? argument + length : argument]; + }), + + "even": createPositionalPseudo(function (matchIndexes, length) { + var i = 0; + for (; i < length; i += 2) { + matchIndexes.push(i); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function (matchIndexes, length) { + var i = 1; + for (; i < length; i += 2) { + matchIndexes.push(i); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function (matchIndexes, length, argument) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for (; --i >= 0;) { + matchIndexes.push(i); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function (matchIndexes, length, argument) { + var i = argument < 0 ? argument + length : argument; + for (; ++i < length;) { + matchIndexes.push(i); + } + return matchIndexes; + }) + } + }; + + Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Add button/input type pseudos + for (i in {radio: true, checkbox: true, file: true, password: true, image: true}) { + Expr.pseudos[i] = createInputPseudo(i); + } + for (i in {submit: true, reset: true}) { + Expr.pseudos[i] = createButtonPseudo(i); + } + +// Easy API for creating new setFilters + function setFilters() { + } + + setFilters.prototype = Expr.filters = Expr.pseudos; + Expr.setFilters = new setFilters(); + + tokenize = Sizzle.tokenize = function (selector, parseOnly) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[selector + " "]; + + if (cached) { + return parseOnly ? 0 : cached.slice(0); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while (soFar) { + + // Comma and first run + if (!matched || (match = rcomma.exec(soFar))) { + if (match) { + + // Don't consume trailing commas as valid + soFar = soFar.slice(match[0].length) || soFar; + } + groups.push((tokens = [])); + } + + matched = false; + + // Combinators + if ((match = rcombinators.exec(soFar))) { + matched = match.shift(); + tokens.push({ + value: matched, + + // Cast descendant combinators to space + type: match[0].replace(rtrim, " ") + }); + soFar = soFar.slice(matched.length); + } + + // Filters + for (type in Expr.filter) { + if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] || + (match = preFilters[type](match)))) { + matched = match.shift(); + tokens.push({ + value: matched, + type: type, + matches: match + }); + soFar = soFar.slice(matched.length); + } + } + + if (!matched) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error(selector) : + + // Cache the tokens + tokenCache(selector, groups).slice(0); + }; + + function toSelector(tokens) { + var i = 0, + len = tokens.length, + selector = ""; + for (; i < len; i++) { + selector += tokens[i].value; + } + return selector; + } + + function addCombinator(matcher, combinator, base) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function (elem, context, xml) { + while ((elem = elem[dir])) { + if (elem.nodeType === 1 || checkNonElements) { + return matcher(elem, context, xml); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function (elem, context, xml) { + var oldCache, uniqueCache, outerCache, + newCache = [dirruns, doneName]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if (xml) { + while ((elem = elem[dir])) { + if (elem.nodeType === 1 || checkNonElements) { + if (matcher(elem, context, xml)) { + return true; + } + } + } + } else { + while ((elem = elem[dir])) { + if (elem.nodeType === 1 || checkNonElements) { + outerCache = elem[expando] || (elem[expando] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[elem.uniqueID] || + (outerCache[elem.uniqueID] = {}); + + if (skip && skip === elem.nodeName.toLowerCase()) { + elem = elem[dir] || elem; + } else if ((oldCache = uniqueCache[key]) && + oldCache[0] === dirruns && oldCache[1] === doneName) { + + // Assign to newCache so results back-propagate to previous elements + return (newCache[2] = oldCache[2]); + } else { + + // Reuse newcache so results back-propagate to previous elements + uniqueCache[key] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ((newCache[2] = matcher(elem, context, xml))) { + return true; + } + } + } + } + } + return false; + }; + } + + function elementMatcher(matchers) { + return matchers.length > 1 ? + function (elem, context, xml) { + var i = matchers.length; + while (i--) { + if (!matchers[i](elem, context, xml)) { + return false; + } + } + return true; + } : + matchers[0]; + } + + function multipleContexts(selector, contexts, results) { + var i = 0, + len = contexts.length; + for (; i < len; i++) { + Sizzle(selector, contexts[i], results); + } + return results; + } + + function condense(unmatched, map, filter, context, xml) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for (; i < len; i++) { + if ((elem = unmatched[i])) { + if (!filter || filter(elem, context, xml)) { + newUnmatched.push(elem); + if (mapped) { + map.push(i); + } + } + } + } + + return newUnmatched; + } + + function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) { + if (postFilter && !postFilter[expando]) { + postFilter = setMatcher(postFilter); + } + if (postFinder && !postFinder[expando]) { + postFinder = setMatcher(postFinder, postSelector); + } + return markFunction(function (seed, results, context, xml) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( + selector || "*", + context.nodeType ? [context] : context, + [] + ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && (seed || !selector) ? + condense(elems, preMap, preFilter, context, xml) : + elems, + + matcherOut = matcher ? + + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || (seed ? preFilter : preexisting || postFilter) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if (matcher) { + matcher(matcherIn, matcherOut, context, xml); + } + + // Apply postFilter + if (postFilter) { + temp = condense(matcherOut, postMap); + postFilter(temp, [], context, xml); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while (i--) { + if ((elem = temp[i])) { + matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem); + } + } + } + + if (seed) { + if (postFinder || preFilter) { + if (postFinder) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while (i--) { + if ((elem = matcherOut[i])) { + + // Restore matcherIn since elem is not yet a final match + temp.push((matcherIn[i] = elem)); + } + } + postFinder(null, (matcherOut = []), temp, xml); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while (i--) { + if ((elem = matcherOut[i]) && + (temp = postFinder ? indexOf(seed, elem) : preMap[i]) > -1) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice(preexisting, matcherOut.length) : + matcherOut + ); + if (postFinder) { + postFinder(null, results, matcherOut, xml); + } else { + push.apply(results, matcherOut); + } + } + }); + } + + function matcherFromTokens(tokens) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[tokens[0].type], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator(function (elem) { + return elem === checkContext; + }, implicitRelative, true), + matchAnyContext = addCombinator(function (elem) { + return indexOf(checkContext, elem) > -1; + }, implicitRelative, true), + matchers = [function (elem, context, xml) { + var ret = (!leadingRelative && (xml || context !== outermostContext)) || ( + (checkContext = context).nodeType ? + matchContext(elem, context, xml) : + matchAnyContext(elem, context, xml)); + + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + }]; + + for (; i < len; i++) { + if ((matcher = Expr.relative[tokens[i].type])) { + matchers = [addCombinator(elementMatcher(matchers), matcher)]; + } else { + matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches); + + // Return special upon seeing a positional matcher + if (matcher[expando]) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for (; j < len; j++) { + if (Expr.relative[tokens[j].type]) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher(matchers), + i > 1 && toSelector( + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens + .slice(0, i - 1) + .concat({value: tokens[i - 2].type === " " ? "*" : ""}) + ).replace(rtrim, "$1"), + matcher, + i < j && matcherFromTokens(tokens.slice(i, j)), + j < len && matcherFromTokens((tokens = tokens.slice(j))), + j < len && toSelector(tokens) + ); + } + matchers.push(matcher); + } + } + + return elementMatcher(matchers); + } + + function matcherFromGroupMatchers(elementMatchers, setMatchers) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function (seed, context, xml, results, outermost) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find["TAG"]("*", outermost), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), + len = elems.length; + + if (outermost) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for (; i !== len && (elem = elems[i]) != null; i++) { + if (byElement && elem) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if (!context && elem.ownerDocument != document) { + setDocument(elem); + xml = !documentIsHTML; + } + while ((matcher = elementMatchers[j++])) { + if (matcher(elem, context || document, xml)) { + results.push(elem); + break; + } + } + if (outermost) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if (bySet) { + + // They will have gone through all possible matchers + if ((elem = !matcher && elem)) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if (seed) { + unmatched.push(elem); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if (bySet && i !== matchedCount) { + j = 0; + while ((matcher = setMatchers[j++])) { + matcher(unmatched, setMatched, context, xml); + } + + if (seed) { + + // Reintegrate element matches to eliminate the need for sorting + if (matchedCount > 0) { + while (i--) { + if (!(unmatched[i] || setMatched[i])) { + setMatched[i] = pop.call(results); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense(setMatched); + } + + // Add matches to results + push.apply(results, setMatched); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if (outermost && !seed && setMatched.length > 0 && + (matchedCount + setMatchers.length) > 1) { + + Sizzle.uniqueSort(results); + } + } + + // Override manipulation of globals by nested matchers + if (outermost) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction(superMatcher) : + superMatcher; + } + + compile = Sizzle.compile = function (selector, match /* Internal Use Only */) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[selector + " "]; + + if (!cached) { + + // Generate a function of recursive functions that can be used to check each element + if (!match) { + match = tokenize(selector); + } + i = match.length; + while (i--) { + cached = matcherFromTokens(match[i]); + if (cached[expando]) { + setMatchers.push(cached); + } else { + elementMatchers.push(cached); + } + } + + // Cache the compiled function + cached = compilerCache( + selector, + matcherFromGroupMatchers(elementMatchers, setMatchers) + ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; + }; + + /** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ + select = Sizzle.select = function (selector, context, results, seed) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize((selector = compiled.selector || selector)); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if (match.length === 1) { + + // Reduce context if the leading compound selector is an ID + tokens = match[0] = match[0].slice(0); + if (tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[tokens[1].type]) { + + context = (Expr.find["ID"](token.matches[0] + .replace(runescape, funescape), context) || [])[0]; + if (!context) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if (compiled) { + context = context.parentNode; + } + + selector = selector.slice(tokens.shift().value.length); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr["needsContext"].test(selector) ? 0 : tokens.length; + while (i--) { + token = tokens[i]; + + // Abort if we hit a combinator + if (Expr.relative[(type = token.type)]) { + break; + } + if ((find = Expr.find[type])) { + + // Search, expanding context for leading sibling combinators + if ((seed = find( + token.matches[0].replace(runescape, funescape), + rsibling.test(tokens[0].type) && testContext(context.parentNode) || + context + ))) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice(i, 1); + selector = seed.length && toSelector(tokens); + if (!selector) { + push.apply(results, seed); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + (compiled || compile(selector, match))( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test(selector) && testContext(context.parentNode) || context + ); + return results; + }; + +// One-time assignments + +// Sort stability + support.sortStable = expando.split("").sort(sortOrder).join("") === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function + support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document + setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* + support.sortDetached = assert(function (el) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition(document.createElement("fieldset")) & 1; + }); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx + if (!assert(function (el) { + el.innerHTML = ""; + return el.firstChild.getAttribute("href") === "#"; + })) { + addHandle("type|href|height|width", function (elem, name, isXML) { + if (!isXML) { + return elem.getAttribute(name, name.toLowerCase() === "type" ? 1 : 2); + } + }); + } + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") + if (!support.attributes || !assert(function (el) { + el.innerHTML = ""; + el.firstChild.setAttribute("value", ""); + return el.firstChild.getAttribute("value") === ""; + })) { + addHandle("value", function (elem, _name, isXML) { + if (!isXML && elem.nodeName.toLowerCase() === "input") { + return elem.defaultValue; + } + }); + } + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies + if (!assert(function (el) { + return el.getAttribute("disabled") == null; + })) { + addHandle(booleans, function (elem, name, isXML) { + var val; + if (!isXML) { + return elem[name] === true ? name.toLowerCase() : + (val = elem.getAttributeNode(name)) && val.specified ? + val.value : + null; + } + }); + } + + return Sizzle; + + })(window); + + + jQuery.find = Sizzle; + jQuery.expr = Sizzle.selectors; + +// Deprecated + jQuery.expr[":"] = jQuery.expr.pseudos; + jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; + jQuery.text = Sizzle.getText; + jQuery.isXMLDoc = Sizzle.isXML; + jQuery.contains = Sizzle.contains; + jQuery.escapeSelector = Sizzle.escape; + + + var dir = function (elem, dir, until) { + var matched = [], + truncate = until !== undefined; + + while ((elem = elem[dir]) && elem.nodeType !== 9) { + if (elem.nodeType === 1) { + if (truncate && jQuery(elem).is(until)) { + break; + } + matched.push(elem); + } + } + return matched; + }; + + + var siblings = function (n, elem) { + var matched = []; + + for (; n; n = n.nextSibling) { + if (n.nodeType === 1 && n !== elem) { + matched.push(n); + } + } + + return matched; + }; + + + var rneedsContext = jQuery.expr.match.needsContext; + + + function nodeName(elem, name) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + + }; + var rsingleTag = (/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i); + + +// Implement the identical functionality for filter and not + function winnow(elements, qualifier, not) { + if (isFunction(qualifier)) { + return jQuery.grep(elements, function (elem, i) { + return !!qualifier.call(elem, i, elem) !== not; + }); + } + + // Single element + if (qualifier.nodeType) { + return jQuery.grep(elements, function (elem) { + return (elem === qualifier) !== not; + }); + } + + // Arraylike of elements (jQuery, arguments, Array) + if (typeof qualifier !== "string") { + return jQuery.grep(elements, function (elem) { + return (indexOf.call(qualifier, elem) > -1) !== not; + }); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter(qualifier, elements, not); + } + + jQuery.filter = function (expr, elems, not) { + var elem = elems[0]; + + if (not) { + expr = ":not(" + expr + ")"; + } + + if (elems.length === 1 && elem.nodeType === 1) { + return jQuery.find.matchesSelector(elem, expr) ? [elem] : []; + } + + return jQuery.find.matches(expr, jQuery.grep(elems, function (elem) { + return elem.nodeType === 1; + })); + }; + + jQuery.fn.extend({ + find: function (selector) { + var i, ret, + len = this.length, + self = this; + + if (typeof selector !== "string") { + return this.pushStack(jQuery(selector).filter(function () { + for (i = 0; i < len; i++) { + if (jQuery.contains(self[i], this)) { + return true; + } + } + })); + } + + ret = this.pushStack([]); + + for (i = 0; i < len; i++) { + jQuery.find(selector, self[i], ret); + } + + return len > 1 ? jQuery.uniqueSort(ret) : ret; + }, + filter: function (selector) { + return this.pushStack(winnow(this, selector || [], false)); + }, + not: function (selector) { + return this.pushStack(winnow(this, selector || [], true)); + }, + is: function (selector) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test(selector) ? + jQuery(selector) : + selector || [], + false + ).length; + } + }); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) + var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function (selector, context, root) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if (!selector) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if (typeof selector === "string") { + if (selector[0] === "<" && + selector[selector.length - 1] === ">" && + selector.length >= 3) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [null, selector, null]; + + } else { + match = rquickExpr.exec(selector); + } + + // Match html or make sure no context is specified for #id + if (match && (match[1] || !context)) { + + // HANDLE: $(html) -> $(array) + if (match[1]) { + context = context instanceof jQuery ? context[0] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge(this, jQuery.parseHTML( + match[1], + context && context.nodeType ? context.ownerDocument || context : document, + true + )); + + // HANDLE: $(html, props) + if (rsingleTag.test(match[1]) && jQuery.isPlainObject(context)) { + for (match in context) { + + // Properties of context are called as methods if possible + if (isFunction(this[match])) { + this[match](context[match]); + + // ...and otherwise set as attributes + } else { + this.attr(match, context[match]); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById(match[2]); + + if (elem) { + + // Inject the element directly into the jQuery object + this[0] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if (!context || context.jquery) { + return (context || root).find(selector); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor(context).find(selector); + } + + // HANDLE: $(DOMElement) + } else if (selector.nodeType) { + this[0] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if (isFunction(selector)) { + return root.ready !== undefined ? + root.ready(selector) : + + // Execute immediately if ready is not present + selector(jQuery); + } + + return jQuery.makeArray(selector, this); + }; + +// Give the init function the jQuery prototype for later instantiation + init.prototype = jQuery.fn; + +// Initialize central reference + rootjQuery = jQuery(document); + + + var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + + jQuery.fn.extend({ + has: function (target) { + var targets = jQuery(target, this), + l = targets.length; + + return this.filter(function () { + var i = 0; + for (; i < l; i++) { + if (jQuery.contains(this, targets[i])) { + return true; + } + } + }); + }, + + closest: function (selectors, context) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery(selectors); + + // Positional selectors never match, since there's no _selection_ context + if (!rneedsContext.test(selectors)) { + for (; i < l; i++) { + for (cur = this[i]; cur && cur !== context; cur = cur.parentNode) { + + // Always skip document fragments + if (cur.nodeType < 11 && (targets ? + targets.index(cur) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector(cur, selectors))) { + + matched.push(cur); + break; + } + } + } + } + + return this.pushStack(matched.length > 1 ? jQuery.uniqueSort(matched) : matched); + }, + + // Determine the position of an element within the set + index: function (elem) { + + // No argument, return index in parent + if (!elem) { + return (this[0] && this[0].parentNode) ? this.first().prevAll().length : -1; + } + + // Index in selector + if (typeof elem === "string") { + return indexOf.call(jQuery(elem), this[0]); + } + + // Locate the position of the desired element + return indexOf.call(this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem + ); + }, + + add: function (selector, context) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge(this.get(), jQuery(selector, context)) + ) + ); + }, + + addBack: function (selector) { + return this.add(selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } + }); + + function sibling(cur, dir) { + while ((cur = cur[dir]) && cur.nodeType !== 1) { + } + return cur; + } + + jQuery.each({ + parent: function (elem) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function (elem) { + return dir(elem, "parentNode"); + }, + parentsUntil: function (elem, _i, until) { + return dir(elem, "parentNode", until); + }, + next: function (elem) { + return sibling(elem, "nextSibling"); + }, + prev: function (elem) { + return sibling(elem, "previousSibling"); + }, + nextAll: function (elem) { + return dir(elem, "nextSibling"); + }, + prevAll: function (elem) { + return dir(elem, "previousSibling"); + }, + nextUntil: function (elem, _i, until) { + return dir(elem, "nextSibling", until); + }, + prevUntil: function (elem, _i, until) { + return dir(elem, "previousSibling", until); + }, + siblings: function (elem) { + return siblings((elem.parentNode || {}).firstChild, elem); + }, + children: function (elem) { + return siblings(elem.firstChild); + }, + contents: function (elem) { + if (elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto(elem.contentDocument)) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if (nodeName(elem, "template")) { + elem = elem.content || elem; + } + + return jQuery.merge([], elem.childNodes); + } + }, function (name, fn) { + jQuery.fn[name] = function (until, selector) { + var matched = jQuery.map(this, fn, until); + + if (name.slice(-5) !== "Until") { + selector = until; + } + + if (selector && typeof selector === "string") { + matched = jQuery.filter(selector, matched); + } + + if (this.length > 1) { + + // Remove duplicates + if (!guaranteedUnique[name]) { + jQuery.uniqueSort(matched); + } + + // Reverse order for parents* and prev-derivatives + if (rparentsprev.test(name)) { + matched.reverse(); + } + } + + return this.pushStack(matched); + }; + }); + var rnothtmlwhite = (/[^\x20\t\r\n\f]+/g); + + +// Convert String-formatted options into Object-formatted ones + function createOptions(options) { + var object = {}; + jQuery.each(options.match(rnothtmlwhite) || [], function (_, flag) { + object[flag] = true; + }); + return object; + } + + /* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ + jQuery.Callbacks = function (options) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions(options) : + jQuery.extend({}, options); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function () { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for (; queue.length; firingIndex = -1) { + memory = queue.shift(); + while (++firingIndex < list.length) { + + // Run callback and check for early termination + if (list[firingIndex].apply(memory[0], memory[1]) === false && + options.stopOnFalse) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if (!options.memory) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if (locked) { + + // Keep an empty list if we have data for future add calls + if (memory) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function () { + if (list) { + + // If we have memory from a past run, we should fire after adding + if (memory && !firing) { + firingIndex = list.length - 1; + queue.push(memory); + } + + (function add(args) { + jQuery.each(args, function (_, arg) { + if (isFunction(arg)) { + if (!options.unique || !self.has(arg)) { + list.push(arg); + } + } else if (arg && arg.length && toType(arg) !== "string") { + + // Inspect recursively + add(arg); + } + }); + })(arguments); + + if (memory && !firing) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function () { + jQuery.each(arguments, function (_, arg) { + var index; + while ((index = jQuery.inArray(arg, list, index)) > -1) { + list.splice(index, 1); + + // Handle firing indexes + if (index <= firingIndex) { + firingIndex--; + } + } + }); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function (fn) { + return fn ? + jQuery.inArray(fn, list) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function () { + if (list) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function () { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function () { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function () { + locked = queue = []; + if (!memory && !firing) { + list = memory = ""; + } + return this; + }, + locked: function () { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function (context, args) { + if (!locked) { + args = args || []; + args = [context, args.slice ? args.slice() : args]; + queue.push(args); + if (!firing) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function () { + self.fireWith(this, arguments); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function () { + return !!fired; + } + }; + + return self; + }; + + + function Identity(v) { + return v; + } + + function Thrower(ex) { + throw ex; + } + + function adoptValue(value, resolve, reject, noValue) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if (value && isFunction((method = value.promise))) { + method.call(value).done(resolve).fail(reject); + + // Other thenables + } else if (value && isFunction((method = value.then))) { + method.call(value, resolve, reject); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply(undefined, [value].slice(noValue)); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch (value) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply(undefined, [value]); + } + } + + jQuery.extend({ + + Deferred: function (func) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + ["notify", "progress", jQuery.Callbacks("memory"), + jQuery.Callbacks("memory"), 2], + ["resolve", "done", jQuery.Callbacks("once memory"), + jQuery.Callbacks("once memory"), 0, "resolved"], + ["reject", "fail", jQuery.Callbacks("once memory"), + jQuery.Callbacks("once memory"), 1, "rejected"] + ], + state = "pending", + promise = { + state: function () { + return state; + }, + always: function () { + deferred.done(arguments).fail(arguments); + return this; + }, + "catch": function (fn) { + return promise.then(null, fn); + }, + + // Keep pipe for back-compat + pipe: function ( /* fnDone, fnFail, fnProgress */) { + var fns = arguments; + + return jQuery.Deferred(function (newDefer) { + jQuery.each(tuples, function (_i, tuple) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction(fns[tuple[4]]) && fns[tuple[4]]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[tuple[1]](function () { + var returned = fn && fn.apply(this, arguments); + if (returned && isFunction(returned.promise)) { + returned.promise() + .progress(newDefer.notify) + .done(newDefer.resolve) + .fail(newDefer.reject); + } else { + newDefer[tuple[0] + "With"]( + this, + fn ? [returned] : arguments + ); + } + }); + }); + fns = null; + }).promise(); + }, + then: function (onFulfilled, onRejected, onProgress) { + var maxDepth = 0; + + function resolve(depth, deferred, handler, special) { + return function () { + var that = this, + args = arguments, + mightThrow = function () { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if (depth < maxDepth) { + return; + } + + returned = handler.apply(that, args); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if (returned === deferred.promise()) { + throw new TypeError("Thenable self-resolution"); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + (typeof returned === "object" || + typeof returned === "function") && + returned.then; + + // Handle a returned thenable + if (isFunction(then)) { + + // Special processors (notify) just wait for resolution + if (special) { + then.call( + returned, + resolve(maxDepth, deferred, Identity, special), + resolve(maxDepth, deferred, Thrower, special) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve(maxDepth, deferred, Identity, special), + resolve(maxDepth, deferred, Thrower, special), + resolve(maxDepth, deferred, Identity, + deferred.notifyWith) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if (handler !== Identity) { + that = undefined; + args = [returned]; + } + + // Process the value(s) + // Default process is resolve + (special || deferred.resolveWith)(that, args); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function () { + try { + mightThrow(); + } catch (e) { + + if (jQuery.Deferred.exceptionHook) { + jQuery.Deferred.exceptionHook(e, + process.stackTrace); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if (depth + 1 >= maxDepth) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if (handler !== Thrower) { + that = undefined; + args = [e]; + } + + deferred.rejectWith(that, args); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if (depth) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if (jQuery.Deferred.getStackHook) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout(process); + } + }; + } + + return jQuery.Deferred(function (newDefer) { + + // progress_handlers.add( ... ) + tuples[0][3].add( + resolve( + 0, + newDefer, + isFunction(onProgress) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[1][3].add( + resolve( + 0, + newDefer, + isFunction(onFulfilled) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[2][3].add( + resolve( + 0, + newDefer, + isFunction(onRejected) ? + onRejected : + Thrower + ) + ); + }).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function (obj) { + return obj != null ? jQuery.extend(obj, promise) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each(tuples, function (i, tuple) { + var list = tuple[2], + stateString = tuple[5]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[tuple[1]] = list.add; + + // Handle state + if (stateString) { + list.add( + function () { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[3 - i][2].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[3 - i][3].disable, + + // progress_callbacks.lock + tuples[0][2].lock, + + // progress_handlers.lock + tuples[0][3].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add(tuple[3].fire); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[tuple[0]] = function () { + deferred[tuple[0] + "With"](this === deferred ? undefined : this, arguments); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[tuple[0] + "With"] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise(deferred); + + // Call given func if any + if (func) { + func.call(deferred, deferred); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function (singleValue) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array(i), + resolveValues = slice.call(arguments), + + // the master Deferred + master = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function (i) { + return function (value) { + resolveContexts[i] = this; + resolveValues[i] = arguments.length > 1 ? slice.call(arguments) : value; + if (!(--remaining)) { + master.resolveWith(resolveContexts, resolveValues); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if (remaining <= 1) { + adoptValue(singleValue, master.done(updateFunc(i)).resolve, master.reject, + !remaining); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if (master.state() === "pending" || + isFunction(resolveValues[i] && resolveValues[i].then)) { + + return master.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while (i--) { + adoptValue(resolveValues[i], updateFunc(i), master.reject); + } + + return master.promise(); + } + }); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. + var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + + jQuery.Deferred.exceptionHook = function (error, stack) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if (window.console && window.console.warn && error && rerrorNames.test(error.name)) { + window.console.warn("jQuery.Deferred exception: " + error.message, error.stack, stack); + } + }; + + + jQuery.readyException = function (error) { + window.setTimeout(function () { + throw error; + }); + }; + + +// The deferred used on DOM ready + var readyList = jQuery.Deferred(); + + jQuery.fn.ready = function (fn) { + + readyList + .then(fn) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch(function (error) { + jQuery.readyException(error); + }); + + return this; + }; + + jQuery.extend({ + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function (wait) { + + // Abort if there are pending holds or we're already ready + if (wait === true ? --jQuery.readyWait : jQuery.isReady) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if (wait !== true && --jQuery.readyWait > 0) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith(document, [jQuery]); + } + }); + + jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method + function completed() { + document.removeEventListener("DOMContentLoaded", completed); + window.removeEventListener("load", completed); + jQuery.ready(); + } + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon + if (document.readyState === "complete" || + (document.readyState !== "loading" && !document.documentElement.doScroll)) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout(jQuery.ready); + + } else { + + // Use the handy event callback + document.addEventListener("DOMContentLoaded", completed); + + // A fallback to window.onload, that will always work + window.addEventListener("load", completed); + } + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function + var access = function (elems, fn, key, value, chainable, emptyGet, raw) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if (toType(key) === "object") { + chainable = true; + for (i in key) { + access(elems, fn, i, key[i], true, emptyGet, raw); + } + + // Sets one value + } else if (value !== undefined) { + chainable = true; + + if (!isFunction(value)) { + raw = true; + } + + if (bulk) { + + // Bulk operations run against the entire set + if (raw) { + fn.call(elems, value); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function (elem, _key, value) { + return bulk.call(jQuery(elem), value); + }; + } + } + + if (fn) { + for (; i < len; i++) { + fn( + elems[i], key, raw ? + value : + value.call(elems[i], i, fn(elems[i], key)) + ); + } + } + } + + if (chainable) { + return elems; + } + + // Gets + if (bulk) { + return fn.call(elems); + } + + return len ? fn(elems[0], key) : emptyGet; + }; + + +// Matches dashed string for camelizing + var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() + function fcamelCase(_all, letter) { + return letter.toUpperCase(); + } + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) + function camelCase(string) { + return string.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase); + } + + var acceptData = function (owner) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !(+owner.nodeType); + }; + + + function Data() { + this.expando = jQuery.expando + Data.uid++; + } + + Data.uid = 1; + + Data.prototype = { + + cache: function (owner) { + + // Check if the owner object already has a cache + var value = owner[this.expando]; + + // If not, create one + if (!value) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if (acceptData(owner)) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if (owner.nodeType) { + owner[this.expando] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty(owner, this.expando, { + value: value, + configurable: true + }); + } + } + } + + return value; + }, + set: function (owner, data, value) { + var prop, + cache = this.cache(owner); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if (typeof data === "string") { + cache[camelCase(data)] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for (prop in data) { + cache[camelCase(prop)] = data[prop]; + } + } + return cache; + }, + get: function (owner, key) { + return key === undefined ? + this.cache(owner) : + + // Always use camelCase key (gh-2257) + owner[this.expando] && owner[this.expando][camelCase(key)]; + }, + access: function (owner, key, value) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if (key === undefined || + ((key && typeof key === "string") && value === undefined)) { + + return this.get(owner, key); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set(owner, key, value); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function (owner, key) { + var i, + cache = owner[this.expando]; + + if (cache === undefined) { + return; + } + + if (key !== undefined) { + + // Support array or space separated string of keys + if (Array.isArray(key)) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map(camelCase); + } else { + key = camelCase(key); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [key] : + (key.match(rnothtmlwhite) || []); + } + + i = key.length; + + while (i--) { + delete cache[key[i]]; + } + } + + // Remove the expando if there's no more data + if (key === undefined || jQuery.isEmptyObject(cache)) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if (owner.nodeType) { + owner[this.expando] = undefined; + } else { + delete owner[this.expando]; + } + } + }, + hasData: function (owner) { + var cache = owner[this.expando]; + return cache !== undefined && !jQuery.isEmptyObject(cache); + } + }; + var dataPriv = new Data(); + + var dataUser = new Data(); + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + + var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + + function getData(data) { + if (data === "true") { + return true; + } + + if (data === "false") { + return false; + } + + if (data === "null") { + return null; + } + + // Only convert to a number if it doesn't change the string + if (data === +data + "") { + return +data; + } + + if (rbrace.test(data)) { + return JSON.parse(data); + } + + return data; + } + + function dataAttr(elem, key, data) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if (data === undefined && elem.nodeType === 1) { + name = "data-" + key.replace(rmultiDash, "-$&").toLowerCase(); + data = elem.getAttribute(name); + + if (typeof data === "string") { + try { + data = getData(data); + } catch (e) { + } + + // Make sure we set the data so it isn't changed later + dataUser.set(elem, key, data); + } else { + data = undefined; + } + } + return data; + } + + jQuery.extend({ + hasData: function (elem) { + return dataUser.hasData(elem) || dataPriv.hasData(elem); + }, + + data: function (elem, name, data) { + return dataUser.access(elem, name, data); + }, + + removeData: function (elem, name) { + dataUser.remove(elem, name); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function (elem, name, data) { + return dataPriv.access(elem, name, data); + }, + + _removeData: function (elem, name) { + dataPriv.remove(elem, name); + } + }); + + jQuery.fn.extend({ + data: function (key, value) { + var i, name, data, + elem = this[0], + attrs = elem && elem.attributes; + + // Gets all values + if (key === undefined) { + if (this.length) { + data = dataUser.get(elem); + + if (elem.nodeType === 1 && !dataPriv.get(elem, "hasDataAttrs")) { + i = attrs.length; + while (i--) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if (attrs[i]) { + name = attrs[i].name; + if (name.indexOf("data-") === 0) { + name = camelCase(name.slice(5)); + dataAttr(elem, name, data[name]); + } + } + } + dataPriv.set(elem, "hasDataAttrs", true); + } + } + + return data; + } + + // Sets multiple values + if (typeof key === "object") { + return this.each(function () { + dataUser.set(this, key); + }); + } + + return access(this, function (value) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if (elem && value === undefined) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get(elem, key); + if (data !== undefined) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr(elem, key); + if (data !== undefined) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each(function () { + + // We always store the camelCased key + dataUser.set(this, key, value); + }); + }, null, value, arguments.length > 1, null, true); + }, + + removeData: function (key) { + return this.each(function () { + dataUser.remove(this, key); + }); + } + }); + + + jQuery.extend({ + queue: function (elem, type, data) { + var queue; + + if (elem) { + type = (type || "fx") + "queue"; + queue = dataPriv.get(elem, type); + + // Speed up dequeue by getting out quickly if this is just a lookup + if (data) { + if (!queue || Array.isArray(data)) { + queue = dataPriv.access(elem, type, jQuery.makeArray(data)); + } else { + queue.push(data); + } + } + return queue || []; + } + }, + + dequeue: function (elem, type) { + type = type || "fx"; + + var queue = jQuery.queue(elem, type), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks(elem, type), + next = function () { + jQuery.dequeue(elem, type); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if (fn === "inprogress") { + fn = queue.shift(); + startLength--; + } + + if (fn) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if (type === "fx") { + queue.unshift("inprogress"); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call(elem, next, hooks); + } + + if (!startLength && hooks) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function (elem, type) { + var key = type + "queueHooks"; + return dataPriv.get(elem, key) || dataPriv.access(elem, key, { + empty: jQuery.Callbacks("once memory").add(function () { + dataPriv.remove(elem, [type + "queue", key]); + }) + }); + } + }); + + jQuery.fn.extend({ + queue: function (type, data) { + var setter = 2; + + if (typeof type !== "string") { + data = type; + type = "fx"; + setter--; + } + + if (arguments.length < setter) { + return jQuery.queue(this[0], type); + } + + return data === undefined ? + this : + this.each(function () { + var queue = jQuery.queue(this, type, data); + + // Ensure a hooks for this queue + jQuery._queueHooks(this, type); + + if (type === "fx" && queue[0] !== "inprogress") { + jQuery.dequeue(this, type); + } + }); + }, + dequeue: function (type) { + return this.each(function () { + jQuery.dequeue(this, type); + }); + }, + clearQueue: function (type) { + return this.queue(type || "fx", []); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function (type, obj) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function () { + if (!(--count)) { + defer.resolveWith(elements, [elements]); + } + }; + + if (typeof type !== "string") { + obj = type; + type = undefined; + } + type = type || "fx"; + + while (i--) { + tmp = dataPriv.get(elements[i], type + "queueHooks"); + if (tmp && tmp.empty) { + count++; + tmp.empty.add(resolve); + } + } + resolve(); + return defer.promise(obj); + } + }); + var pnum = (/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/).source; + + var rcssNum = new RegExp("^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i"); + + + var cssExpand = ["Top", "Right", "Bottom", "Left"]; + + var documentElement = document.documentElement; + + + var isAttached = function (elem) { + return jQuery.contains(elem.ownerDocument, elem); + }, + composed = {composed: true}; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if (documentElement.getRootNode) { + isAttached = function (elem) { + return jQuery.contains(elem.ownerDocument, elem) || + elem.getRootNode(composed) === elem.ownerDocument; + }; + } + var isHiddenWithinTree = function (elem, el) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached(elem) && + + jQuery.css(elem, "display") === "none"; + }; + + + function adjustCSS(elem, prop, valueParts, tween) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function () { + return tween.cur(); + } : + function () { + return jQuery.css(elem, prop, ""); + }, + initial = currentValue(), + unit = valueParts && valueParts[3] || (jQuery.cssNumber[prop] ? "" : "px"), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + (jQuery.cssNumber[prop] || unit !== "px" && +initial) && + rcssNum.exec(jQuery.css(elem, prop)); + + if (initialInUnit && initialInUnit[3] !== unit) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[3]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while (maxIterations--) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style(elem, prop, initialInUnit + unit); + if ((1 - scale) * (1 - (scale = currentValue() / initial || 0.5)) <= 0) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style(elem, prop, initialInUnit + unit); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if (valueParts) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[1] ? + initialInUnit + (valueParts[1] + 1) * valueParts[2] : + +valueParts[2]; + if (tween) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; + } + + + var defaultDisplayMap = {}; + + function getDefaultDisplay(elem) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[nodeName]; + + if (display) { + return display; + } + + temp = doc.body.appendChild(doc.createElement(nodeName)); + display = jQuery.css(temp, "display"); + + temp.parentNode.removeChild(temp); + + if (display === "none") { + display = "block"; + } + defaultDisplayMap[nodeName] = display; + + return display; + } + + function showHide(elements, show) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for (; index < length; index++) { + elem = elements[index]; + if (!elem.style) { + continue; + } + + display = elem.style.display; + if (show) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if (display === "none") { + values[index] = dataPriv.get(elem, "display") || null; + if (!values[index]) { + elem.style.display = ""; + } + } + if (elem.style.display === "" && isHiddenWithinTree(elem)) { + values[index] = getDefaultDisplay(elem); + } + } else { + if (display !== "none") { + values[index] = "none"; + + // Remember what we're overwriting + dataPriv.set(elem, "display", display); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for (index = 0; index < length; index++) { + if (values[index] != null) { + elements[index].style.display = values[index]; + } + } + + return elements; + } + + jQuery.fn.extend({ + show: function () { + return showHide(this, true); + }, + hide: function () { + return showHide(this); + }, + toggle: function (state) { + if (typeof state === "boolean") { + return state ? this.show() : this.hide(); + } + + return this.each(function () { + if (isHiddenWithinTree(this)) { + jQuery(this).show(); + } else { + jQuery(this).hide(); + } + }); + } + }); + var rcheckableType = (/^(?:checkbox|radio)$/i); + + var rtagName = (/<([a-z][^\/\0>\x20\t\r\n\f]*)/i); + + var rscriptType = (/^$|^module$|\/(?:java|ecma)script/i); + + + (function () { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild(document.createElement("div")), + input = document.createElement("input"); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute("type", "radio"); + input.setAttribute("checked", "checked"); + input.setAttribute("name", "t"); + + div.appendChild(input); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode(true).cloneNode(true).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode(true).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; + })(); + + +// We have to close these tags to support XHTML (#13200) + var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [1, "", "
    "], + col: [2, "", "
    "], + tr: [2, "", "
    "], + td: [3, "", "
    "], + + _default: [0, "", ""] + }; + + wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; + wrapMap.th = wrapMap.td; + +// Support: IE <=9 only + if (!support.option) { + wrapMap.optgroup = wrapMap.option = [1, ""]; + } + + + function getAll(context, tag) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if (typeof context.getElementsByTagName !== "undefined") { + ret = context.getElementsByTagName(tag || "*"); + + } else if (typeof context.querySelectorAll !== "undefined") { + ret = context.querySelectorAll(tag || "*"); + + } else { + ret = []; + } + + if (tag === undefined || tag && nodeName(context, tag)) { + return jQuery.merge([context], ret); + } + + return ret; + } + + +// Mark scripts as having already been evaluated + function setGlobalEval(elems, refElements) { + var i = 0, + l = elems.length; + + for (; i < l; i++) { + dataPriv.set( + elems[i], + "globalEval", + !refElements || dataPriv.get(refElements[i], "globalEval") + ); + } + } + + + var rhtml = /<|&#?\w+;/; + + function buildFragment(elems, context, scripts, selection, ignored) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for (; i < l; i++) { + elem = elems[i]; + + if (elem || elem === 0) { + + // Add nodes directly + if (toType(elem) === "object") { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge(nodes, elem.nodeType ? [elem] : elem); + + // Convert non-html into a text node + } else if (!rhtml.test(elem)) { + nodes.push(context.createTextNode(elem)); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild(context.createElement("div")); + + // Deserialize a standard representation + tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase(); + wrap = wrapMap[tag] || wrapMap._default; + tmp.innerHTML = wrap[1] + jQuery.htmlPrefilter(elem) + wrap[2]; + + // Descend through wrappers to the right content + j = wrap[0]; + while (j--) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge(nodes, tmp.childNodes); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ((elem = nodes[i++])) { + + // Skip elements already in the context collection (trac-4087) + if (selection && jQuery.inArray(elem, selection) > -1) { + if (ignored) { + ignored.push(elem); + } + continue; + } + + attached = isAttached(elem); + + // Append to fragment + tmp = getAll(fragment.appendChild(elem), "script"); + + // Preserve script evaluation history + if (attached) { + setGlobalEval(tmp); + } + + // Capture executables + if (scripts) { + j = 0; + while ((elem = tmp[j++])) { + if (rscriptType.test(elem.type || "")) { + scripts.push(elem); + } + } + } + } + + return fragment; + } + + + var + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + + function returnTrue() { + return true; + } + + function returnFalse() { + return false; + } + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). + function expectSync(elem, type) { + return (elem === safeActiveElement()) === (type === "focus"); + } + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 + function safeActiveElement() { + try { + return document.activeElement; + } catch (err) { + } + } + + function on(elem, types, selector, data, fn, one) { + var origFn, type; + + // Types can be a map of types/handlers + if (typeof types === "object") { + + // ( types-Object, selector, data ) + if (typeof selector !== "string") { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for (type in types) { + on(elem, type, selector, data, types[type], one); + } + return elem; + } + + if (data == null && fn == null) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if (fn == null) { + if (typeof selector === "string") { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if (fn === false) { + fn = returnFalse; + } else if (!fn) { + return elem; + } + + if (one === 1) { + origFn = fn; + fn = function (event) { + + // Can use an empty set, since event contains the info + jQuery().off(event); + return origFn.apply(this, arguments); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || (origFn.guid = jQuery.guid++); + } + return elem.each(function () { + jQuery.event.add(this, types, fn, data, selector); + }); + } + + /* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ + jQuery.event = { + + global: {}, + + add: function (elem, types, handler, data, selector) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get(elem); + + // Only attach events to objects that accept data + if (!acceptData(elem)) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if (handler.handler) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if (selector) { + jQuery.find.matchesSelector(documentElement, selector); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if (!handler.guid) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if (!(events = elemData.events)) { + events = elemData.events = Object.create(null); + } + if (!(eventHandle = elemData.handle)) { + eventHandle = elemData.handle = function (e) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply(elem, arguments) : undefined; + }; + } + + // Handle multiple events separated by a space + types = (types || "").match(rnothtmlwhite) || [""]; + t = types.length; + while (t--) { + tmp = rtypenamespace.exec(types[t]) || []; + type = origType = tmp[1]; + namespaces = (tmp[2] || "").split(".").sort(); + + // There *must* be a type, no attaching namespace-only handlers + if (!type) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[type] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = (selector ? special.delegateType : special.bindType) || type; + + // Update special based on newly reset type + special = jQuery.event.special[type] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test(selector), + namespace: namespaces.join(".") + }, handleObjIn); + + // Init the event handler queue if we're the first + if (!(handlers = events[type])) { + handlers = events[type] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if (!special.setup || + special.setup.call(elem, data, namespaces, eventHandle) === false) { + + if (elem.addEventListener) { + elem.addEventListener(type, eventHandle); + } + } + } + + if (special.add) { + special.add.call(elem, handleObj); + + if (!handleObj.handler.guid) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if (selector) { + handlers.splice(handlers.delegateCount++, 0, handleObj); + } else { + handlers.push(handleObj); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[type] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function (elem, types, handler, selector, mappedTypes) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData(elem) && dataPriv.get(elem); + + if (!elemData || !(events = elemData.events)) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = (types || "").match(rnothtmlwhite) || [""]; + t = types.length; + while (t--) { + tmp = rtypenamespace.exec(types[t]) || []; + type = origType = tmp[1]; + namespaces = (tmp[2] || "").split(".").sort(); + + // Unbind all events (on this namespace, if provided) for the element + if (!type) { + for (type in events) { + jQuery.event.remove(elem, type + types[t], handler, selector, true); + } + continue; + } + + special = jQuery.event.special[type] || {}; + type = (selector ? special.delegateType : special.bindType) || type; + handlers = events[type] || []; + tmp = tmp[2] && + new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)"); + + // Remove matching events + origCount = j = handlers.length; + while (j--) { + handleObj = handlers[j]; + + if ((mappedTypes || origType === handleObj.origType) && + (!handler || handler.guid === handleObj.guid) && + (!tmp || tmp.test(handleObj.namespace)) && + (!selector || selector === handleObj.selector || + selector === "**" && handleObj.selector)) { + handlers.splice(j, 1); + + if (handleObj.selector) { + handlers.delegateCount--; + } + if (special.remove) { + special.remove.call(elem, handleObj); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if (origCount && !handlers.length) { + if (!special.teardown || + special.teardown.call(elem, namespaces, elemData.handle) === false) { + + jQuery.removeEvent(elem, type, elemData.handle); + } + + delete events[type]; + } + } + + // Remove data and the expando if it's no longer used + if (jQuery.isEmptyObject(events)) { + dataPriv.remove(elem, "handle events"); + } + }, + + dispatch: function (nativeEvent) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array(arguments.length), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix(nativeEvent), + + handlers = ( + dataPriv.get(this, "events") || Object.create(null) + )[event.type] || [], + special = jQuery.event.special[event.type] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + + for (i = 1; i < arguments.length; i++) { + args[i] = arguments[i]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if (special.preDispatch && special.preDispatch.call(this, event) === false) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call(this, event, handlers); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) { + event.currentTarget = matched.elem; + + j = 0; + while ((handleObj = matched.handlers[j++]) && + !event.isImmediatePropagationStopped()) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if (!event.rnamespace || handleObj.namespace === false || + event.rnamespace.test(handleObj.namespace)) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ((jQuery.event.special[handleObj.origType] || {}).handle || + handleObj.handler).apply(matched.elem, args); + + if (ret !== undefined) { + if ((event.result = ret) === false) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if (special.postDispatch) { + special.postDispatch.call(this, event); + } + + return event.result; + }, + + handlers: function (event, handlers) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if (delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !(event.type === "click" && event.button >= 1)) { + + for (; cur !== this; cur = cur.parentNode || this) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if (cur.nodeType === 1 && !(event.type === "click" && cur.disabled === true)) { + matchedHandlers = []; + matchedSelectors = {}; + for (i = 0; i < delegateCount; i++) { + handleObj = handlers[i]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if (matchedSelectors[sel] === undefined) { + matchedSelectors[sel] = handleObj.needsContext ? + jQuery(sel, this).index(cur) > -1 : + jQuery.find(sel, this, null, [cur]).length; + } + if (matchedSelectors[sel]) { + matchedHandlers.push(handleObj); + } + } + if (matchedHandlers.length) { + handlerQueue.push({elem: cur, handlers: matchedHandlers}); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if (delegateCount < handlers.length) { + handlerQueue.push({elem: cur, handlers: handlers.slice(delegateCount)}); + } + + return handlerQueue; + }, + + addProp: function (name, hook) { + Object.defineProperty(jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction(hook) ? + function () { + if (this.originalEvent) { + return hook(this.originalEvent); + } + } : + function () { + if (this.originalEvent) { + return this.originalEvent[name]; + } + }, + + set: function (value) { + Object.defineProperty(this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + }); + } + }); + }, + + fix: function (originalEvent) { + return originalEvent[jQuery.expando] ? + originalEvent : + new jQuery.Event(originalEvent); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function (data) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if (rcheckableType.test(el.type) && + el.click && nodeName(el, "input")) { + + // dataPriv.set( el, "click", ... ) + leverageNative(el, "click", returnTrue); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function (data) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if (rcheckableType.test(el.type) && + el.click && nodeName(el, "input")) { + + leverageNative(el, "click"); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function (event) { + var target = event.target; + return rcheckableType.test(target.type) && + target.click && nodeName(target, "input") && + dataPriv.get(target, "click") || + nodeName(target, "a"); + } + }, + + beforeunload: { + postDispatch: function (event) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if (event.result !== undefined && event.originalEvent) { + event.originalEvent.returnValue = event.result; + } + } + } + } + }; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. + function leverageNative(el, type, expectSync) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if (!expectSync) { + if (dataPriv.get(el, type) === undefined) { + jQuery.event.add(el, type, returnTrue); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set(el, type, false); + jQuery.event.add(el, type, { + namespace: false, + handler: function (event) { + var notAsync, result, + saved = dataPriv.get(this, type); + + if ((event.isTrigger & 1) && this[type]) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if (!saved.length) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call(arguments); + dataPriv.set(this, type, saved); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync(this, type); + this[type](); + result = dataPriv.get(this, type); + if (saved !== result || notAsync) { + dataPriv.set(this, type, false); + } else { + result = {}; + } + if (saved !== result) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + return result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ((jQuery.event.special[type] || {}).delegateType) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if (saved.length) { + + // ...and capture the result + dataPriv.set(this, type, { + value: jQuery.event.trigger( + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend(saved[0], jQuery.Event.prototype), + saved.slice(1), + this + ) + }); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + }); + } + + jQuery.removeEvent = function (elem, type, handle) { + + // This "if" is needed for plain objects + if (elem.removeEventListener) { + elem.removeEventListener(type, handle); + } + }; + + jQuery.Event = function (src, props) { + + // Allow instantiation without the 'new' keyword + if (!(this instanceof jQuery.Event)) { + return new jQuery.Event(src, props); + } + + // Event object + if (src && src.type) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = (src.target && src.target.nodeType === 3) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if (props) { + jQuery.extend(this, props); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[jQuery.expando] = true; + }; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html + jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function () { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if (e && !this.isSimulated) { + e.preventDefault(); + } + }, + stopPropagation: function () { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if (e && !this.isSimulated) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function () { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if (e && !this.isSimulated) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } + }; + +// Includes all common event props including KeyEvent and MouseEvent specific props + jQuery.each({ + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + + which: function (event) { + var button = event.button; + + // Add which for key events + if (event.which == null && rkeyEvent.test(event.type)) { + return event.charCode != null ? event.charCode : event.keyCode; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + if (!event.which && button !== undefined && rmouseEvent.test(event.type)) { + if (button & 1) { + return 1; + } + + if (button & 2) { + return 3; + } + + if (button & 4) { + return 2; + } + + return 0; + } + + return event.which; + } + }, jQuery.event.addProp); + + jQuery.each({focus: "focusin", blur: "focusout"}, function (type, delegateType) { + jQuery.event.special[type] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function () { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative(this, type, expectSync); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function () { + + // Force setup before trigger + leverageNative(this, type); + + // Return non-false to allow normal event-path propagation + return true; + }, + + delegateType: delegateType + }; + }); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). + jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" + }, function (orig, fix) { + jQuery.event.special[orig] = { + delegateType: fix, + bindType: fix, + + handle: function (event) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if (!related || (related !== target && !jQuery.contains(target, related))) { + event.type = handleObj.origType; + ret = handleObj.handler.apply(this, arguments); + event.type = fix; + } + return ret; + } + }; + }); + + jQuery.fn.extend({ + + on: function (types, selector, data, fn) { + return on(this, types, selector, data, fn); + }, + one: function (types, selector, data, fn) { + return on(this, types, selector, data, fn, 1); + }, + off: function (types, selector, fn) { + var handleObj, type; + if (types && types.preventDefault && types.handleObj) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery(types.delegateTarget).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if (typeof types === "object") { + + // ( types-object [, selector] ) + for (type in types) { + this.off(type, selector, types[type]); + } + return this; + } + if (selector === false || typeof selector === "function") { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if (fn === false) { + fn = returnFalse; + } + return this.each(function () { + jQuery.event.remove(this, types, fn, selector); + }); + } + }); + + + var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows + function manipulationTarget(elem, content) { + if (nodeName(elem, "table") && + nodeName(content.nodeType !== 11 ? content : content.firstChild, "tr")) { + + return jQuery(elem).children("tbody")[0] || elem; + } + + return elem; + } + +// Replace/restore the type attribute of script elements for safe DOM manipulation + function disableScript(elem) { + elem.type = (elem.getAttribute("type") !== null) + "/" + elem.type; + return elem; + } + + function restoreScript(elem) { + if ((elem.type || "").slice(0, 5) === "true/") { + elem.type = elem.type.slice(5); + } else { + elem.removeAttribute("type"); + } + + return elem; + } + + function cloneCopyEvent(src, dest) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if (dest.nodeType !== 1) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if (dataPriv.hasData(src)) { + pdataOld = dataPriv.get(src); + events = pdataOld.events; + + if (events) { + dataPriv.remove(dest, "handle events"); + + for (type in events) { + for (i = 0, l = events[type].length; i < l; i++) { + jQuery.event.add(dest, type, events[type][i]); + } + } + } + } + + // 2. Copy user data + if (dataUser.hasData(src)) { + udataOld = dataUser.access(src); + udataCur = jQuery.extend({}, udataOld); + + dataUser.set(dest, udataCur); + } + } + +// Fix IE bugs, see support tests + function fixInput(src, dest) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if (nodeName === "input" && rcheckableType.test(src.type)) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if (nodeName === "input" || nodeName === "textarea") { + dest.defaultValue = src.defaultValue; + } + } + + function domManip(collection, args, callback, ignored) { + + // Flatten any nested arrays + args = flat(args); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[0], + valueIsFunction = isFunction(value); + + // We can't cloneNode fragments that contain checked, in WebKit + if (valueIsFunction || + (l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test(value))) { + return collection.each(function (index) { + var self = collection.eq(index); + if (valueIsFunction) { + args[0] = value.call(this, index, self.html()); + } + domManip(self, args, callback, ignored); + }); + } + + if (l) { + fragment = buildFragment(args, collection[0].ownerDocument, false, collection, ignored); + first = fragment.firstChild; + + if (fragment.childNodes.length === 1) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if (first || ignored) { + scripts = jQuery.map(getAll(fragment, "script"), disableScript); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for (; i < l; i++) { + node = fragment; + + if (i !== iNoClone) { + node = jQuery.clone(node, true, true); + + // Keep references to cloned scripts for later restoration + if (hasScripts) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge(scripts, getAll(node, "script")); + } + } + + callback.call(collection[i], node, i); + } + + if (hasScripts) { + doc = scripts[scripts.length - 1].ownerDocument; + + // Reenable scripts + jQuery.map(scripts, restoreScript); + + // Evaluate executable scripts on first document insertion + for (i = 0; i < hasScripts; i++) { + node = scripts[i]; + if (rscriptType.test(node.type || "") && + !dataPriv.access(node, "globalEval") && + jQuery.contains(doc, node)) { + + if (node.src && (node.type || "").toLowerCase() !== "module") { + + // Optional AJAX dependency, but won't run scripts if not present + if (jQuery._evalUrl && !node.noModule) { + jQuery._evalUrl(node.src, { + nonce: node.nonce || node.getAttribute("nonce") + }, doc); + } + } else { + DOMEval(node.textContent.replace(rcleanScript, ""), node, doc); + } + } + } + } + } + } + + return collection; + } + + function remove(elem, selector, keepData) { + var node, + nodes = selector ? jQuery.filter(selector, elem) : elem, + i = 0; + + for (; (node = nodes[i]) != null; i++) { + if (!keepData && node.nodeType === 1) { + jQuery.cleanData(getAll(node)); + } + + if (node.parentNode) { + if (keepData && isAttached(node)) { + setGlobalEval(getAll(node, "script")); + } + node.parentNode.removeChild(node); + } + } + + return elem; + } + + jQuery.extend({ + htmlPrefilter: function (html) { + return html; + }, + + clone: function (elem, dataAndEvents, deepDataAndEvents) { + var i, l, srcElements, destElements, + clone = elem.cloneNode(true), + inPage = isAttached(elem); + + // Fix IE cloning issues + if (!support.noCloneChecked && (elem.nodeType === 1 || elem.nodeType === 11) && + !jQuery.isXMLDoc(elem)) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll(clone); + srcElements = getAll(elem); + + for (i = 0, l = srcElements.length; i < l; i++) { + fixInput(srcElements[i], destElements[i]); + } + } + + // Copy the events from the original to the clone + if (dataAndEvents) { + if (deepDataAndEvents) { + srcElements = srcElements || getAll(elem); + destElements = destElements || getAll(clone); + + for (i = 0, l = srcElements.length; i < l; i++) { + cloneCopyEvent(srcElements[i], destElements[i]); + } + } else { + cloneCopyEvent(elem, clone); + } + } + + // Preserve script evaluation history + destElements = getAll(clone, "script"); + if (destElements.length > 0) { + setGlobalEval(destElements, !inPage && getAll(elem, "script")); + } + + // Return the cloned set + return clone; + }, + + cleanData: function (elems) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for (; (elem = elems[i]) !== undefined; i++) { + if (acceptData(elem)) { + if ((data = elem[dataPriv.expando])) { + if (data.events) { + for (type in data.events) { + if (special[type]) { + jQuery.event.remove(elem, type); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent(elem, type, data.handle); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[dataPriv.expando] = undefined; + } + if (elem[dataUser.expando]) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[dataUser.expando] = undefined; + } + } + } + } + }); + + jQuery.fn.extend({ + detach: function (selector) { + return remove(this, selector, true); + }, + + remove: function (selector) { + return remove(this, selector); + }, + + text: function (value) { + return access(this, function (value) { + return value === undefined ? + jQuery.text(this) : + this.empty().each(function () { + if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) { + this.textContent = value; + } + }); + }, null, value, arguments.length); + }, + + append: function () { + return domManip(this, arguments, function (elem) { + if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) { + var target = manipulationTarget(this, elem); + target.appendChild(elem); + } + }); + }, + + prepend: function () { + return domManip(this, arguments, function (elem) { + if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) { + var target = manipulationTarget(this, elem); + target.insertBefore(elem, target.firstChild); + } + }); + }, + + before: function () { + return domManip(this, arguments, function (elem) { + if (this.parentNode) { + this.parentNode.insertBefore(elem, this); + } + }); + }, + + after: function () { + return domManip(this, arguments, function (elem) { + if (this.parentNode) { + this.parentNode.insertBefore(elem, this.nextSibling); + } + }); + }, + + empty: function () { + var elem, + i = 0; + + for (; (elem = this[i]) != null; i++) { + if (elem.nodeType === 1) { + + // Prevent memory leaks + jQuery.cleanData(getAll(elem, false)); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function (dataAndEvents, deepDataAndEvents) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map(function () { + return jQuery.clone(this, dataAndEvents, deepDataAndEvents); + }); + }, + + html: function (value) { + return access(this, function (value) { + var elem = this[0] || {}, + i = 0, + l = this.length; + + if (value === undefined && elem.nodeType === 1) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if (typeof value === "string" && !rnoInnerhtml.test(value) && + !wrapMap[(rtagName.exec(value) || ["", ""])[1].toLowerCase()]) { + + value = jQuery.htmlPrefilter(value); + + try { + for (; i < l; i++) { + elem = this[i] || {}; + + // Remove element nodes and prevent memory leaks + if (elem.nodeType === 1) { + jQuery.cleanData(getAll(elem, false)); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch (e) { + } + } + + if (elem) { + this.empty().append(value); + } + }, null, value, arguments.length); + }, + + replaceWith: function () { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip(this, arguments, function (elem) { + var parent = this.parentNode; + + if (jQuery.inArray(this, ignored) < 0) { + jQuery.cleanData(getAll(this)); + if (parent) { + parent.replaceChild(elem, this); + } + } + + // Force callback invocation + }, ignored); + } + }); + + jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" + }, function (name, original) { + jQuery.fn[name] = function (selector) { + var elems, + ret = [], + insert = jQuery(selector), + last = insert.length - 1, + i = 0; + + for (; i <= last; i++) { + elems = i === last ? this : this.clone(true); + jQuery(insert[i])[original](elems); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply(ret, elems.get()); + } + + return this.pushStack(ret); + }; + }); + var rnumnonpx = new RegExp("^(" + pnum + ")(?!px)[a-z%]+$", "i"); + + var getStyles = function (elem) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if (!view || !view.opener) { + view = window; + } + + return view.getComputedStyle(elem); + }; + + var swap = function (elem, options, callback) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for (name in options) { + old[name] = elem.style[name]; + elem.style[name] = options[name]; + } + + ret = callback.call(elem); + + // Revert the old values + for (name in options) { + elem.style[name] = old[name]; + } + + return ret; + }; + + + var rboxStyle = new RegExp(cssExpand.join("|"), "i"); + + + (function () { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if (!div) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild(container).appendChild(div); + + var divStyle = window.getComputedStyle(div); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures(divStyle.marginLeft) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures(divStyle.right) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures(divStyle.width) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures(div.offsetWidth / 3) === 12; + + documentElement.removeChild(container); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures(measure) { + return Math.round(parseFloat(measure)); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement("div"), + div = document.createElement("div"); + + // Finish early in limited (non-browser) environments + if (!div.style) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode(true).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend(support, { + boxSizingReliable: function () { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function () { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function () { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function () { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function () { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + reliableTrDimensions: function () { + var table, tr, trChild, trStyle; + if (reliableTrDimensionsVal == null) { + table = document.createElement("table"); + tr = document.createElement("tr"); + trChild = document.createElement("div"); + + table.style.cssText = "position:absolute;left:-11111px"; + tr.style.height = "1px"; + trChild.style.height = "9px"; + + documentElement + .appendChild(table) + .appendChild(tr) + .appendChild(trChild); + + trStyle = window.getComputedStyle(tr); + reliableTrDimensionsVal = parseInt(trStyle.height) > 3; + + documentElement.removeChild(table); + } + return reliableTrDimensionsVal; + } + }); + })(); + + + function curCSS(elem, name, computed) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles(elem); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if (computed) { + ret = computed.getPropertyValue(name) || computed[name]; + + if (ret === "" && !isAttached(elem)) { + ret = jQuery.style(elem, name); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if (!support.pixelBoxStyles() && rnumnonpx.test(ret) && rboxStyle.test(name)) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; + } + + + function addGetHookIf(conditionFn, hookFn) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function () { + if (conditionFn()) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return (this.get = hookFn).apply(this, arguments); + } + }; + } + + + var cssPrefixes = ["Webkit", "Moz", "ms"], + emptyStyle = document.createElement("div").style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined + function vendorPropName(name) { + + // Check for vendor prefixed names + var capName = name[0].toUpperCase() + name.slice(1), + i = cssPrefixes.length; + + while (i--) { + name = cssPrefixes[i] + capName; + if (name in emptyStyle) { + return name; + } + } + } + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property + function finalPropName(name) { + var final = jQuery.cssProps[name] || vendorProps[name]; + + if (final) { + return final; + } + if (name in emptyStyle) { + return name; + } + return vendorProps[name] = vendorPropName(name) || name; + } + + + var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = {position: "absolute", visibility: "hidden", display: "block"}, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + + function setPositiveNumber(_elem, value, subtract) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec(value); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max(0, matches[2] - (subtract || 0)) + (matches[3] || "px") : + value; + } + + function boxModelAdjustment(elem, dimension, box, isBorderBox, styles, computedVal) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if (box === (isBorderBox ? "border" : "content")) { + return 0; + } + + for (; i < 4; i += 2) { + + // Both box models exclude margin + if (box === "margin") { + delta += jQuery.css(elem, box + cssExpand[i], true, styles); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if (!isBorderBox) { + + // Add padding + delta += jQuery.css(elem, "padding" + cssExpand[i], true, styles); + + // For "border" or "margin", add border + if (box !== "padding") { + delta += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles); + + // But still keep track of it otherwise + } else { + extra += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if (box === "content") { + delta -= jQuery.css(elem, "padding" + cssExpand[i], true, styles); + } + + // For "content" or "padding", subtract border + if (box !== "margin") { + delta -= jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if (!isBorderBox && computedVal >= 0) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max(0, Math.ceil( + elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + )) || 0; + } + + return delta; + } + + function getWidthOrHeight(elem, dimension, extra) { + + // Start with computed style + var styles = getStyles(elem), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css(elem, "boxSizing", false, styles) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS(elem, dimension, styles), + offsetProp = "offset" + dimension[0].toUpperCase() + dimension.slice(1); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if (rnumnonpx.test(val)) { + if (!extra) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ((!support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName(elem, "tr") || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat(val) && jQuery.css(elem, "display", false, styles) === "inline") && + + // Make sure the element is visible & connected + elem.getClientRects().length) { + + isBorderBox = jQuery.css(elem, "boxSizing", false, styles) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if (valueIsBorderBox) { + val = elem[offsetProp]; + } + } + + // Normalize "" and auto + val = parseFloat(val) || 0; + + // Adjust for the element's box model + return (val + + boxModelAdjustment( + elem, + dimension, + extra || (isBorderBox ? "border" : "content"), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; + } + + jQuery.extend({ + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function (elem, computed) { + if (computed) { + + // We should always get a number back from opacity + var ret = curCSS(elem, "opacity"); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function (elem, name, value, extra) { + + // Don't set styles on text and comment nodes + if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase(name), + isCustomProp = rcustomProp.test(name), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if (!isCustomProp) { + name = finalPropName(origName); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName]; + + // Check if we're setting a value + if (value !== undefined) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if (type === "string" && (ret = rcssNum.exec(value)) && ret[1]) { + value = adjustCSS(elem, name, ret); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if (value == null || value !== value) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if (type === "number" && !isCustomProp) { + value += ret && ret[3] || (jQuery.cssNumber[origName] ? "" : "px"); + } + + // background-* props affect original clone's values + if (!support.clearCloneStyle && value === "" && name.indexOf("background") === 0) { + style[name] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if (!hooks || !("set" in hooks) || + (value = hooks.set(elem, value, extra)) !== undefined) { + + if (isCustomProp) { + style.setProperty(name, value); + } else { + style[name] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if (hooks && "get" in hooks && + (ret = hooks.get(elem, false, extra)) !== undefined) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[name]; + } + }, + + css: function (elem, name, extra, styles) { + var val, num, hooks, + origName = camelCase(name), + isCustomProp = rcustomProp.test(name); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if (!isCustomProp) { + name = finalPropName(origName); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName]; + + // If a hook was provided get the computed value from there + if (hooks && "get" in hooks) { + val = hooks.get(elem, true, extra); + } + + // Otherwise, if a way to get the computed value exists, use that + if (val === undefined) { + val = curCSS(elem, name, styles); + } + + // Convert "normal" to computed value + if (val === "normal" && name in cssNormalTransform) { + val = cssNormalTransform[name]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if (extra === "" || extra) { + num = parseFloat(val); + return extra === true || isFinite(num) ? num || 0 : val; + } + + return val; + } + }); + + jQuery.each(["height", "width"], function (_i, dimension) { + jQuery.cssHooks[dimension] = { + get: function (elem, computed, extra) { + if (computed) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test(jQuery.css(elem, "display")) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + (!elem.getClientRects().length || !elem.getBoundingClientRect().width) ? + swap(elem, cssShow, function () { + return getWidthOrHeight(elem, dimension, extra); + }) : + getWidthOrHeight(elem, dimension, extra); + } + }, + + set: function (elem, value, extra) { + var matches, + styles = getStyles(elem), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css(elem, "boxSizing", false, styles) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if (isBorderBox && scrollboxSizeBuggy) { + subtract -= Math.ceil( + elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] - + parseFloat(styles[dimension]) - + boxModelAdjustment(elem, dimension, "border", false, styles) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if (subtract && (matches = rcssNum.exec(value)) && + (matches[3] || "px") !== "px") { + + elem.style[dimension] = value; + value = jQuery.css(elem, dimension); + } + + return setPositiveNumber(elem, value, subtract); + } + }; + }); + + jQuery.cssHooks.marginLeft = addGetHookIf(support.reliableMarginLeft, + function (elem, computed) { + if (computed) { + return (parseFloat(curCSS(elem, "marginLeft")) || + elem.getBoundingClientRect().left - + swap(elem, {marginLeft: 0}, function () { + return elem.getBoundingClientRect().left; + }) + ) + "px"; + } + } + ); + +// These hooks are used by animate to expand properties + jQuery.each({ + margin: "", + padding: "", + border: "Width" + }, function (prefix, suffix) { + jQuery.cssHooks[prefix + suffix] = { + expand: function (value) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split(" ") : [value]; + + for (; i < 4; i++) { + expanded[prefix + cssExpand[i] + suffix] = + parts[i] || parts[i - 2] || parts[0]; + } + + return expanded; + } + }; + + if (prefix !== "margin") { + jQuery.cssHooks[prefix + suffix].set = setPositiveNumber; + } + }); + + jQuery.fn.extend({ + css: function (name, value) { + return access(this, function (elem, name, value) { + var styles, len, + map = {}, + i = 0; + + if (Array.isArray(name)) { + styles = getStyles(elem); + len = name.length; + + for (; i < len; i++) { + map[name[i]] = jQuery.css(elem, name[i], false, styles); + } + + return map; + } + + return value !== undefined ? + jQuery.style(elem, name, value) : + jQuery.css(elem, name); + }, name, value, arguments.length > 1); + } + }); + + + function Tween(elem, options, prop, end, easing) { + return new Tween.prototype.init(elem, options, prop, end, easing); + } + + jQuery.Tween = Tween; + + Tween.prototype = { + constructor: Tween, + init: function (elem, options, prop, end, easing, unit) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || (jQuery.cssNumber[prop] ? "" : "px"); + }, + cur: function () { + var hooks = Tween.propHooks[this.prop]; + + return hooks && hooks.get ? + hooks.get(this) : + Tween.propHooks._default.get(this); + }, + run: function (percent) { + var eased, + hooks = Tween.propHooks[this.prop]; + + if (this.options.duration) { + this.pos = eased = jQuery.easing[this.easing]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = (this.end - this.start) * eased + this.start; + + if (this.options.step) { + this.options.step.call(this.elem, this.now, this); + } + + if (hooks && hooks.set) { + hooks.set(this); + } else { + Tween.propHooks._default.set(this); + } + return this; + } + }; + + Tween.prototype.init.prototype = Tween.prototype; + + Tween.propHooks = { + _default: { + get: function (tween) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if (tween.elem.nodeType !== 1 || + tween.elem[tween.prop] != null && tween.elem.style[tween.prop] == null) { + return tween.elem[tween.prop]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css(tween.elem, tween.prop, ""); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function (tween) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if (jQuery.fx.step[tween.prop]) { + jQuery.fx.step[tween.prop](tween); + } else if (tween.elem.nodeType === 1 && ( + jQuery.cssHooks[tween.prop] || + tween.elem.style[finalPropName(tween.prop)] != null)) { + jQuery.style(tween.elem, tween.prop, tween.now + tween.unit); + } else { + tween.elem[tween.prop] = tween.now; + } + } + } + }; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes + Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function (tween) { + if (tween.elem.nodeType && tween.elem.parentNode) { + tween.elem[tween.prop] = tween.now; + } + } + }; + + jQuery.easing = { + linear: function (p) { + return p; + }, + swing: function (p) { + return 0.5 - Math.cos(p * Math.PI) / 2; + }, + _default: "swing" + }; + + jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point + jQuery.fx.step = {}; + + + var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + + function schedule() { + if (inProgress) { + if (document.hidden === false && window.requestAnimationFrame) { + window.requestAnimationFrame(schedule); + } else { + window.setTimeout(schedule, jQuery.fx.interval); + } + + jQuery.fx.tick(); + } + } + +// Animations created synchronously will run synchronously + function createFxNow() { + window.setTimeout(function () { + fxNow = undefined; + }); + return (fxNow = Date.now()); + } + +// Generate parameters to create a standard animation + function genFx(type, includeWidth) { + var which, + i = 0, + attrs = {height: type}; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for (; i < 4; i += 2 - includeWidth) { + which = cssExpand[i]; + attrs["margin" + which] = attrs["padding" + which] = type; + } + + if (includeWidth) { + attrs.opacity = attrs.width = type; + } + + return attrs; + } + + function createTween(value, prop, animation) { + var tween, + collection = (Animation.tweeners[prop] || []).concat(Animation.tweeners["*"]), + index = 0, + length = collection.length; + for (; index < length; index++) { + if ((tween = collection[index].call(animation, prop, value))) { + + // We're done with this property + return tween; + } + } + } + + function defaultPrefilter(elem, props, opts) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree(elem), + dataShow = dataPriv.get(elem, "fxshow"); + + // Queue-skipping animations hijack the fx hooks + if (!opts.queue) { + hooks = jQuery._queueHooks(elem, "fx"); + if (hooks.unqueued == null) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function () { + if (!hooks.unqueued) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always(function () { + + // Ensure the complete handler is called before this completes + anim.always(function () { + hooks.unqueued--; + if (!jQuery.queue(elem, "fx").length) { + hooks.empty.fire(); + } + }); + }); + } + + // Detect show/hide animations + for (prop in props) { + value = props[prop]; + if (rfxtypes.test(value)) { + delete props[prop]; + toggle = toggle || value === "toggle"; + if (value === (hidden ? "hide" : "show")) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if (value === "show" && dataShow && dataShow[prop] !== undefined) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[prop] = dataShow && dataShow[prop] || jQuery.style(elem, prop); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject(props); + if (!propTween && jQuery.isEmptyObject(orig)) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if (isBox && elem.nodeType === 1) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [style.overflow, style.overflowX, style.overflowY]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if (restoreDisplay == null) { + restoreDisplay = dataPriv.get(elem, "display"); + } + display = jQuery.css(elem, "display"); + if (display === "none") { + if (restoreDisplay) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide([elem], true); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css(elem, "display"); + showHide([elem]); + } + } + + // Animate inline elements as inline-block + if (display === "inline" || display === "inline-block" && restoreDisplay != null) { + if (jQuery.css(elem, "float") === "none") { + + // Restore the original display value at the end of pure show/hide animations + if (!propTween) { + anim.done(function () { + style.display = restoreDisplay; + }); + if (restoreDisplay == null) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if (opts.overflow) { + style.overflow = "hidden"; + anim.always(function () { + style.overflow = opts.overflow[0]; + style.overflowX = opts.overflow[1]; + style.overflowY = opts.overflow[2]; + }); + } + + // Implement show/hide animations + propTween = false; + for (prop in orig) { + + // General show/hide setup for this element animation + if (!propTween) { + if (dataShow) { + if ("hidden" in dataShow) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access(elem, "fxshow", {display: restoreDisplay}); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if (toggle) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if (hidden) { + showHide([elem], true); + } + + /* eslint-disable no-loop-func */ + + anim.done(function () { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if (!hidden) { + showHide([elem]); + } + dataPriv.remove(elem, "fxshow"); + for (prop in orig) { + jQuery.style(elem, prop, orig[prop]); + } + }); + } + + // Per-property setup + propTween = createTween(hidden ? dataShow[prop] : 0, prop, anim); + if (!(prop in dataShow)) { + dataShow[prop] = propTween.start; + if (hidden) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } + } + + function propFilter(props, specialEasing) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for (index in props) { + name = camelCase(index); + easing = specialEasing[name]; + value = props[index]; + if (Array.isArray(value)) { + easing = value[1]; + value = props[index] = value[0]; + } + + if (index !== name) { + props[name] = value; + delete props[index]; + } + + hooks = jQuery.cssHooks[name]; + if (hooks && "expand" in hooks) { + value = hooks.expand(value); + delete props[name]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for (index in value) { + if (!(index in props)) { + props[index] = value[index]; + specialEasing[index] = easing; + } + } + } else { + specialEasing[name] = easing; + } + } + } + + function Animation(elem, properties, options) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always(function () { + + // Don't match elem in the :animated selector + delete tick.elem; + }), + tick = function () { + if (stopped) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max(0, animation.startTime + animation.duration - currentTime), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for (; index < length; index++) { + animation.tweens[index].run(percent); + } + + deferred.notifyWith(elem, [animation, percent, remaining]); + + // If there's more to do, yield + if (percent < 1 && length) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if (!length) { + deferred.notifyWith(elem, [animation, 1, 0]); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith(elem, [animation]); + return false; + }, + animation = deferred.promise({ + elem: elem, + props: jQuery.extend({}, properties), + opts: jQuery.extend(true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function (prop, end) { + var tween = jQuery.Tween(elem, animation.opts, prop, end, + animation.opts.specialEasing[prop] || animation.opts.easing); + animation.tweens.push(tween); + return tween; + }, + stop: function (gotoEnd) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if (stopped) { + return this; + } + stopped = true; + for (; index < length; index++) { + animation.tweens[index].run(1); + } + + // Resolve when we played the last frame; otherwise, reject + if (gotoEnd) { + deferred.notifyWith(elem, [animation, 1, 0]); + deferred.resolveWith(elem, [animation, gotoEnd]); + } else { + deferred.rejectWith(elem, [animation, gotoEnd]); + } + return this; + } + }), + props = animation.props; + + propFilter(props, animation.opts.specialEasing); + + for (; index < length; index++) { + result = Animation.prefilters[index].call(animation, elem, props, animation.opts); + if (result) { + if (isFunction(result.stop)) { + jQuery._queueHooks(animation.elem, animation.opts.queue).stop = + result.stop.bind(result); + } + return result; + } + } + + jQuery.map(props, createTween, animation); + + if (isFunction(animation.opts.start)) { + animation.opts.start.call(elem, animation); + } + + // Attach callbacks from options + animation + .progress(animation.opts.progress) + .done(animation.opts.done, animation.opts.complete) + .fail(animation.opts.fail) + .always(animation.opts.always); + + jQuery.fx.timer( + jQuery.extend(tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + }) + ); + + return animation; + } + + jQuery.Animation = jQuery.extend(Animation, { + + tweeners: { + "*": [function (prop, value) { + var tween = this.createTween(prop, value); + adjustCSS(tween.elem, prop, rcssNum.exec(value), tween); + return tween; + }] + }, + + tweener: function (props, callback) { + if (isFunction(props)) { + callback = props; + props = ["*"]; + } else { + props = props.match(rnothtmlwhite); + } + + var prop, + index = 0, + length = props.length; + + for (; index < length; index++) { + prop = props[index]; + Animation.tweeners[prop] = Animation.tweeners[prop] || []; + Animation.tweeners[prop].unshift(callback); + } + }, + + prefilters: [defaultPrefilter], + + prefilter: function (callback, prepend) { + if (prepend) { + Animation.prefilters.unshift(callback); + } else { + Animation.prefilters.push(callback); + } + } + }); + + jQuery.speed = function (speed, easing, fn) { + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + isFunction(speed) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction(easing) && easing + }; + + // Go to the end state if fx are off + if (jQuery.fx.off) { + opt.duration = 0; + + } else { + if (typeof opt.duration !== "number") { + if (opt.duration in jQuery.fx.speeds) { + opt.duration = jQuery.fx.speeds[opt.duration]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if (opt.queue == null || opt.queue === true) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function () { + if (isFunction(opt.old)) { + opt.old.call(this); + } + + if (opt.queue) { + jQuery.dequeue(this, opt.queue); + } + }; + + return opt; + }; + + jQuery.fn.extend({ + fadeTo: function (speed, to, easing, callback) { + + // Show any hidden elements after setting opacity to 0 + return this.filter(isHiddenWithinTree).css("opacity", 0).show() + + // Animate to the value specified + .end().animate({opacity: to}, speed, easing, callback); + }, + animate: function (prop, speed, easing, callback) { + var empty = jQuery.isEmptyObject(prop), + optall = jQuery.speed(speed, easing, callback), + doAnimation = function () { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation(this, jQuery.extend({}, prop), optall); + + // Empty animations, or finishing resolves immediately + if (empty || dataPriv.get(this, "finish")) { + anim.stop(true); + } + }; + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each(doAnimation) : + this.queue(optall.queue, doAnimation); + }, + stop: function (type, clearQueue, gotoEnd) { + var stopQueue = function (hooks) { + var stop = hooks.stop; + delete hooks.stop; + stop(gotoEnd); + }; + + if (typeof type !== "string") { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if (clearQueue) { + this.queue(type || "fx", []); + } + + return this.each(function () { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get(this); + + if (index) { + if (data[index] && data[index].stop) { + stopQueue(data[index]); + } + } else { + for (index in data) { + if (data[index] && data[index].stop && rrun.test(index)) { + stopQueue(data[index]); + } + } + } + + for (index = timers.length; index--;) { + if (timers[index].elem === this && + (type == null || timers[index].queue === type)) { + + timers[index].anim.stop(gotoEnd); + dequeue = false; + timers.splice(index, 1); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if (dequeue || !gotoEnd) { + jQuery.dequeue(this, type); + } + }); + }, + finish: function (type) { + if (type !== false) { + type = type || "fx"; + } + return this.each(function () { + var index, + data = dataPriv.get(this), + queue = data[type + "queue"], + hooks = data[type + "queueHooks"], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue(this, type, []); + + if (hooks && hooks.stop) { + hooks.stop.call(this, true); + } + + // Look for any active animations, and finish them + for (index = timers.length; index--;) { + if (timers[index].elem === this && timers[index].queue === type) { + timers[index].anim.stop(true); + timers.splice(index, 1); + } + } + + // Look for any animations in the old queue and finish them + for (index = 0; index < length; index++) { + if (queue[index] && queue[index].finish) { + queue[index].finish.call(this); + } + } + + // Turn off finishing flag + delete data.finish; + }); + } + }); + + jQuery.each(["toggle", "show", "hide"], function (_i, name) { + var cssFn = jQuery.fn[name]; + jQuery.fn[name] = function (speed, easing, callback) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply(this, arguments) : + this.animate(genFx(name, true), speed, easing, callback); + }; + }); + +// Generate shortcuts for custom animations + jQuery.each({ + slideDown: genFx("show"), + slideUp: genFx("hide"), + slideToggle: genFx("toggle"), + fadeIn: {opacity: "show"}, + fadeOut: {opacity: "hide"}, + fadeToggle: {opacity: "toggle"} + }, function (name, props) { + jQuery.fn[name] = function (speed, easing, callback) { + return this.animate(props, speed, easing, callback); + }; + }); + + jQuery.timers = []; + jQuery.fx.tick = function () { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for (; i < timers.length; i++) { + timer = timers[i]; + + // Run the timer and safely remove it when done (allowing for external removal) + if (!timer() && timers[i] === timer) { + timers.splice(i--, 1); + } + } + + if (!timers.length) { + jQuery.fx.stop(); + } + fxNow = undefined; + }; + + jQuery.fx.timer = function (timer) { + jQuery.timers.push(timer); + jQuery.fx.start(); + }; + + jQuery.fx.interval = 13; + jQuery.fx.start = function () { + if (inProgress) { + return; + } + + inProgress = true; + schedule(); + }; + + jQuery.fx.stop = function () { + inProgress = null; + }; + + jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 + }; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ + jQuery.fn.delay = function (time, type) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue(type, function (next, hooks) { + var timeout = window.setTimeout(next, time); + hooks.stop = function () { + window.clearTimeout(timeout); + }; + }); + }; + + + (function () { + var input = document.createElement("input"), + select = document.createElement("select"), + opt = select.appendChild(document.createElement("option")); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement("input"); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; + })(); + + + var boolHook, + attrHandle = jQuery.expr.attrHandle; + + jQuery.fn.extend({ + attr: function (name, value) { + return access(this, jQuery.attr, name, value, arguments.length > 1); + }, + + removeAttr: function (name) { + return this.each(function () { + jQuery.removeAttr(this, name); + }); + } + }); + + jQuery.extend({ + attr: function (elem, name, value) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if (nType === 3 || nType === 8 || nType === 2) { + return; + } + + // Fallback to prop when attributes are not supported + if (typeof elem.getAttribute === "undefined") { + return jQuery.prop(elem, name, value); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if (nType !== 1 || !jQuery.isXMLDoc(elem)) { + hooks = jQuery.attrHooks[name.toLowerCase()] || + (jQuery.expr.match.bool.test(name) ? boolHook : undefined); + } + + if (value !== undefined) { + if (value === null) { + jQuery.removeAttr(elem, name); + return; + } + + if (hooks && "set" in hooks && + (ret = hooks.set(elem, value, name)) !== undefined) { + return ret; + } + + elem.setAttribute(name, value + ""); + return value; + } + + if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) { + return ret; + } + + ret = jQuery.find.attr(elem, name); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function (elem, value) { + if (!support.radioValue && value === "radio" && + nodeName(elem, "input")) { + var val = elem.value; + elem.setAttribute("type", value); + if (val) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function (elem, value) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match(rnothtmlwhite); + + if (attrNames && elem.nodeType === 1) { + while ((name = attrNames[i++])) { + elem.removeAttribute(name); + } + } + } + }); + +// Hooks for boolean attributes + boolHook = { + set: function (elem, value, name) { + if (value === false) { + + // Remove boolean attributes when set to false + jQuery.removeAttr(elem, name); + } else { + elem.setAttribute(name, name); + } + return name; + } + }; + + jQuery.each(jQuery.expr.match.bool.source.match(/\w+/g), function (_i, name) { + var getter = attrHandle[name] || jQuery.find.attr; + + attrHandle[name] = function (elem, name, isXML) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if (!isXML) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[lowercaseName]; + attrHandle[lowercaseName] = ret; + ret = getter(elem, name, isXML) != null ? + lowercaseName : + null; + attrHandle[lowercaseName] = handle; + } + return ret; + }; + }); + + + var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + + jQuery.fn.extend({ + prop: function (name, value) { + return access(this, jQuery.prop, name, value, arguments.length > 1); + }, + + removeProp: function (name) { + return this.each(function () { + delete this[jQuery.propFix[name] || name]; + }); + } + }); + + jQuery.extend({ + prop: function (elem, name, value) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if (nType === 3 || nType === 8 || nType === 2) { + return; + } + + if (nType !== 1 || !jQuery.isXMLDoc(elem)) { + + // Fix name and attach hooks + name = jQuery.propFix[name] || name; + hooks = jQuery.propHooks[name]; + } + + if (value !== undefined) { + if (hooks && "set" in hooks && + (ret = hooks.set(elem, value, name)) !== undefined) { + return ret; + } + + return (elem[name] = value); + } + + if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) { + return ret; + } + + return elem[name]; + }, + + propHooks: { + tabIndex: { + get: function (elem) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr(elem, "tabindex"); + + if (tabindex) { + return parseInt(tabindex, 10); + } + + if ( + rfocusable.test(elem.nodeName) || + rclickable.test(elem.nodeName) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } + }); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop + if (!support.optSelected) { + jQuery.propHooks.selected = { + get: function (elem) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if (parent && parent.parentNode) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function (elem) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if (parent) { + parent.selectedIndex; + + if (parent.parentNode) { + parent.parentNode.selectedIndex; + } + } + } + }; + } + + jQuery.each([ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" + ], function () { + jQuery.propFix[this.toLowerCase()] = this; + }); + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse(value) { + var tokens = value.match(rnothtmlwhite) || []; + return tokens.join(" "); + } + + + function getClass(elem) { + return elem.getAttribute && elem.getAttribute("class") || ""; + } + + function classesToArray(value) { + if (Array.isArray(value)) { + return value; + } + if (typeof value === "string") { + return value.match(rnothtmlwhite) || []; + } + return []; + } + + jQuery.fn.extend({ + addClass: function (value) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if (isFunction(value)) { + return this.each(function (j) { + jQuery(this).addClass(value.call(this, j, getClass(this))); + }); + } + + classes = classesToArray(value); + + if (classes.length) { + while ((elem = this[i++])) { + curValue = getClass(elem); + cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " "); + + if (cur) { + j = 0; + while ((clazz = classes[j++])) { + if (cur.indexOf(" " + clazz + " ") < 0) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse(cur); + if (curValue !== finalValue) { + elem.setAttribute("class", finalValue); + } + } + } + } + + return this; + }, + + removeClass: function (value) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if (isFunction(value)) { + return this.each(function (j) { + jQuery(this).removeClass(value.call(this, j, getClass(this))); + }); + } + + if (!arguments.length) { + return this.attr("class", ""); + } + + classes = classesToArray(value); + + if (classes.length) { + while ((elem = this[i++])) { + curValue = getClass(elem); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " "); + + if (cur) { + j = 0; + while ((clazz = classes[j++])) { + + // Remove *all* instances + while (cur.indexOf(" " + clazz + " ") > -1) { + cur = cur.replace(" " + clazz + " ", " "); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse(cur); + if (curValue !== finalValue) { + elem.setAttribute("class", finalValue); + } + } + } + } + + return this; + }, + + toggleClass: function (value, stateVal) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray(value); + + if (typeof stateVal === "boolean" && isValidValue) { + return stateVal ? this.addClass(value) : this.removeClass(value); + } + + if (isFunction(value)) { + return this.each(function (i) { + jQuery(this).toggleClass( + value.call(this, i, getClass(this), stateVal), + stateVal + ); + }); + } + + return this.each(function () { + var className, i, self, classNames; + + if (isValidValue) { + + // Toggle individual class names + i = 0; + self = jQuery(this); + classNames = classesToArray(value); + + while ((className = classNames[i++])) { + + // Check each className given, space separated list + if (self.hasClass(className)) { + self.removeClass(className); + } else { + self.addClass(className); + } + } + + // Toggle whole class name + } else if (value === undefined || type === "boolean") { + className = getClass(this); + if (className) { + + // Store className if set + dataPriv.set(this, "__className__", className); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if (this.setAttribute) { + this.setAttribute("class", + className || value === false ? + "" : + dataPriv.get(this, "__className__") || "" + ); + } + } + }); + }, + + hasClass: function (selector) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ((elem = this[i++])) { + if (elem.nodeType === 1 && + (" " + stripAndCollapse(getClass(elem)) + " ").indexOf(className) > -1) { + return true; + } + } + + return false; + } + }); + + + var rreturn = /\r/g; + + jQuery.fn.extend({ + val: function (value) { + var hooks, ret, valueIsFunction, + elem = this[0]; + + if (!arguments.length) { + if (elem) { + hooks = jQuery.valHooks[elem.type] || + jQuery.valHooks[elem.nodeName.toLowerCase()]; + + if (hooks && + "get" in hooks && + (ret = hooks.get(elem, "value")) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if (typeof ret === "string") { + return ret.replace(rreturn, ""); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction(value); + + return this.each(function (i) { + var val; + + if (this.nodeType !== 1) { + return; + } + + if (valueIsFunction) { + val = value.call(this, i, jQuery(this).val()); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if (val == null) { + val = ""; + + } else if (typeof val === "number") { + val += ""; + + } else if (Array.isArray(val)) { + val = jQuery.map(val, function (value) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[this.type] || jQuery.valHooks[this.nodeName.toLowerCase()]; + + // If set returns undefined, fall back to normal setting + if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === undefined) { + this.value = val; + } + }); + } + }); + + jQuery.extend({ + valHooks: { + option: { + get: function (elem) { + + var val = jQuery.find.attr(elem, "value"); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse(jQuery.text(elem)); + } + }, + select: { + get: function (elem) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if (index < 0) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for (; i < max; i++) { + option = options[i]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ((option.selected || i === index) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + (!option.parentNode.disabled || + !nodeName(option.parentNode, "optgroup"))) { + + // Get the specific value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if (one) { + return value; + } + + // Multi-Selects return an array + values.push(value); + } + } + + return values; + }, + + set: function (elem, value) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray(value), + i = options.length; + + while (i--) { + option = options[i]; + + /* eslint-disable no-cond-assign */ + + if (option.selected = + jQuery.inArray(jQuery.valHooks.option.get(option), values) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if (!optionSet) { + elem.selectedIndex = -1; + } + return values; + } + } + } + }); + +// Radios and checkboxes getter/setter + jQuery.each(["radio", "checkbox"], function () { + jQuery.valHooks[this] = { + set: function (elem, value) { + if (Array.isArray(value)) { + return (elem.checked = jQuery.inArray(jQuery(elem).val(), value) > -1); + } + } + }; + if (!support.checkOn) { + jQuery.valHooks[this].get = function (elem) { + return elem.getAttribute("value") === null ? "on" : elem.value; + }; + } + }); + + +// Return jQuery for attributes-only inclusion + + + support.focusin = "onfocusin" in window; + + + var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function (e) { + e.stopPropagation(); + }; + + jQuery.extend(jQuery.event, { + + trigger: function (event, data, elem, onlyHandlers) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [elem || document], + type = hasOwn.call(event, "type") ? event.type : event, + namespaces = hasOwn.call(event, "namespace") ? event.namespace.split(".") : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if (elem.nodeType === 3 || elem.nodeType === 8) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if (rfocusMorph.test(type + jQuery.event.triggered)) { + return; + } + + if (type.indexOf(".") > -1) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf(":") < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[jQuery.expando] ? + event : + new jQuery.Event(type, typeof event === "object" && event); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join("."); + event.rnamespace = event.namespace ? + new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if (!event.target) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [event] : + jQuery.makeArray(data, [event]); + + // Allow special events to draw outside the lines + special = jQuery.event.special[type] || {}; + if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if (!onlyHandlers && !special.noBubble && !isWindow(elem)) { + + bubbleType = special.delegateType || type; + if (!rfocusMorph.test(bubbleType + type)) { + cur = cur.parentNode; + } + for (; cur; cur = cur.parentNode) { + eventPath.push(cur); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if (tmp === (elem.ownerDocument || document)) { + eventPath.push(tmp.defaultView || tmp.parentWindow || window); + } + } + + // Fire handlers on the event path + i = 0; + while ((cur = eventPath[i++]) && !event.isPropagationStopped()) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( + dataPriv.get(cur, "events") || Object.create(null) + )[event.type] && + dataPriv.get(cur, "handle"); + if (handle) { + handle.apply(cur, data); + } + + // Native handler + handle = ontype && cur[ontype]; + if (handle && handle.apply && acceptData(cur)) { + event.result = handle.apply(cur, data); + if (event.result === false) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if (!onlyHandlers && !event.isDefaultPrevented()) { + + if ((!special._default || + special._default.apply(eventPath.pop(), data) === false) && + acceptData(elem)) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if (ontype && isFunction(elem[type]) && !isWindow(elem)) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ontype]; + + if (tmp) { + elem[ontype] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if (event.isPropagationStopped()) { + lastElement.addEventListener(type, stopPropagationCallback); + } + + elem[type](); + + if (event.isPropagationStopped()) { + lastElement.removeEventListener(type, stopPropagationCallback); + } + + jQuery.event.triggered = undefined; + + if (tmp) { + elem[ontype] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function (type, elem, event) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger(e, null, elem); + } + + }); + + jQuery.fn.extend({ + + trigger: function (type, data) { + return this.each(function () { + jQuery.event.trigger(type, data, this); + }); + }, + triggerHandler: function (type, data) { + var elem = this[0]; + if (elem) { + return jQuery.event.trigger(type, data, elem, true); + } + } + }); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 + if (!support.focusin) { + jQuery.each({focus: "focusin", blur: "focusout"}, function (orig, fix) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function (event) { + jQuery.event.simulate(fix, event.target, jQuery.event.fix(event)); + }; + + jQuery.event.special[fix] = { + setup: function () { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access(doc, fix); + + if (!attaches) { + doc.addEventListener(orig, handler, true); + } + dataPriv.access(doc, fix, (attaches || 0) + 1); + }, + teardown: function () { + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access(doc, fix) - 1; + + if (!attaches) { + doc.removeEventListener(orig, handler, true); + dataPriv.remove(doc, fix); + + } else { + dataPriv.access(doc, fix, attaches); + } + } + }; + }); + } + var location = window.location; + + var nonce = {guid: Date.now()}; + + var rquery = (/\?/); + + +// Cross-browser xml parsing + jQuery.parseXML = function (data) { + var xml; + if (!data || typeof data !== "string") { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = (new window.DOMParser()).parseFromString(data, "text/xml"); + } catch (e) { + xml = undefined; + } + + if (!xml || xml.getElementsByTagName("parsererror").length) { + jQuery.error("Invalid XML: " + data); + } + return xml; + }; + + + var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + + function buildParams(prefix, obj, traditional, add) { + var name; + + if (Array.isArray(obj)) { + + // Serialize array item. + jQuery.each(obj, function (i, v) { + if (traditional || rbracket.test(prefix)) { + + // Treat each array item as a scalar. + add(prefix, v); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + (typeof v === "object" && v != null ? i : "") + "]", + v, + traditional, + add + ); + } + }); + + } else if (!traditional && toType(obj) === "object") { + + // Serialize object item. + for (name in obj) { + buildParams(prefix + "[" + name + "]", obj[name], traditional, add); + } + + } else { + + // Serialize scalar item. + add(prefix, obj); + } + } + +// Serialize an array of form elements or a set of +// key/values into a query string + jQuery.param = function (a, traditional) { + var prefix, + s = [], + add = function (key, valueOrFunction) { + + // If value is a function, invoke it and use its return value + var value = isFunction(valueOrFunction) ? + valueOrFunction() : + valueOrFunction; + + s[s.length] = encodeURIComponent(key) + "=" + + encodeURIComponent(value == null ? "" : value); + }; + + if (a == null) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if (Array.isArray(a) || (a.jquery && !jQuery.isPlainObject(a))) { + + // Serialize the form elements + jQuery.each(a, function () { + add(this.name, this.value); + }); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for (prefix in a) { + buildParams(prefix, a[prefix], traditional, add); + } + } + + // Return the resulting serialization + return s.join("&"); + }; + + jQuery.fn.extend({ + serialize: function () { + return jQuery.param(this.serializeArray()); + }, + serializeArray: function () { + return this.map(function () { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop(this, "elements"); + return elements ? jQuery.makeArray(elements) : this; + }) + .filter(function () { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery(this).is(":disabled") && + rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) && + (this.checked || !rcheckableType.test(type)); + }) + .map(function (_i, elem) { + var val = jQuery(this).val(); + + if (val == null) { + return null; + } + + if (Array.isArray(val)) { + return jQuery.map(val, function (val) { + return {name: elem.name, value: val.replace(rCRLF, "\r\n")}; + }); + } + + return {name: elem.name, value: val.replace(rCRLF, "\r\n")}; + }).get(); + } + }); + + + var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat("*"), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement("a"); + originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport + function addToPrefiltersOrTransports(structure) { + + // dataTypeExpression is optional and defaults to "*" + return function (dataTypeExpression, func) { + + if (typeof dataTypeExpression !== "string") { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match(rnothtmlwhite) || []; + + if (isFunction(func)) { + + // For each dataType in the dataTypeExpression + while ((dataType = dataTypes[i++])) { + + // Prepend if requested + if (dataType[0] === "+") { + dataType = dataType.slice(1) || "*"; + (structure[dataType] = structure[dataType] || []).unshift(func); + + // Otherwise append + } else { + (structure[dataType] = structure[dataType] || []).push(func); + } + } + } + }; + } + +// Base inspection function for prefilters and transports + function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) { + + var inspected = {}, + seekingTransport = (structure === transports); + + function inspect(dataType) { + var selected; + inspected[dataType] = true; + jQuery.each(structure[dataType] || [], function (_, prefilterOrFactory) { + var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR); + if (typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[dataTypeOrTransport]) { + + options.dataTypes.unshift(dataTypeOrTransport); + inspect(dataTypeOrTransport); + return false; + } else if (seekingTransport) { + return !(selected = dataTypeOrTransport); + } + }); + return selected; + } + + return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*"); + } + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 + function ajaxExtend(target, src) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for (key in src) { + if (src[key] !== undefined) { + (flatOptions[key] ? target : (deep || (deep = {})))[key] = src[key]; + } + } + if (deep) { + jQuery.extend(true, target, deep); + } + + return target; + } + + /* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ + function ajaxHandleResponses(s, jqXHR, responses) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while (dataTypes[0] === "*") { + dataTypes.shift(); + if (ct === undefined) { + ct = s.mimeType || jqXHR.getResponseHeader("Content-Type"); + } + } + + // Check if we're dealing with a known content-type + if (ct) { + for (type in contents) { + if (contents[type] && contents[type].test(ct)) { + dataTypes.unshift(type); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if (dataTypes[0] in responses) { + finalDataType = dataTypes[0]; + } else { + + // Try convertible dataTypes + for (type in responses) { + if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) { + finalDataType = type; + break; + } + if (!firstDataType) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if (finalDataType) { + if (finalDataType !== dataTypes[0]) { + dataTypes.unshift(finalDataType); + } + return responses[finalDataType]; + } + } + + /* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ + function ajaxConvert(s, response, jqXHR, isSuccess) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if (dataTypes[1]) { + for (conv in s.converters) { + converters[conv.toLowerCase()] = s.converters[conv]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while (current) { + + if (s.responseFields[current]) { + jqXHR[s.responseFields[current]] = response; + } + + // Apply the dataFilter if provided + if (!prev && isSuccess && s.dataFilter) { + response = s.dataFilter(response, s.dataType); + } + + prev = current; + current = dataTypes.shift(); + + if (current) { + + // There's only work to do if current dataType is non-auto + if (current === "*") { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if (prev !== "*" && prev !== current) { + + // Seek a direct converter + conv = converters[prev + " " + current] || converters["* " + current]; + + // If none found, seek a pair + if (!conv) { + for (conv2 in converters) { + + // If conv2 outputs current + tmp = conv2.split(" "); + if (tmp[1] === current) { + + // If prev can be converted to accepted input + conv = converters[prev + " " + tmp[0]] || + converters["* " + tmp[0]]; + if (conv) { + + // Condense equivalence converters + if (conv === true) { + conv = converters[conv2]; + + // Otherwise, insert the intermediate dataType + } else if (converters[conv2] !== true) { + current = tmp[0]; + dataTypes.unshift(tmp[1]); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if (conv !== true) { + + // Unless errors are allowed to bubble, catch and return them + if (conv && s.throws) { + response = conv(response); + } else { + try { + response = conv(response); + } catch (e) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return {state: "success", data: response}; + } + + jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test(location.protocol), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function (target, settings) { + return settings ? + + // Building a settings object + ajaxExtend(ajaxExtend(target, jQuery.ajaxSettings), settings) : + + // Extending ajaxSettings + ajaxExtend(jQuery.ajaxSettings, target); + }, + + ajaxPrefilter: addToPrefiltersOrTransports(prefilters), + ajaxTransport: addToPrefiltersOrTransports(transports), + + // Main method + ajax: function (url, options) { + + // If url is an object, simulate pre-1.5 signature + if (typeof url === "object") { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup({}, options), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + (callbackContext.nodeType || callbackContext.jquery) ? + jQuery(callbackContext) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks("once memory"), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function (key) { + var match; + if (completed) { + if (!responseHeaders) { + responseHeaders = {}; + while ((match = rheaders.exec(responseHeadersString))) { + responseHeaders[match[1].toLowerCase() + " "] = + (responseHeaders[match[1].toLowerCase() + " "] || []) + .concat(match[2]); + } + } + match = responseHeaders[key.toLowerCase() + " "]; + } + return match == null ? null : match.join(", "); + }, + + // Raw string + getAllResponseHeaders: function () { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function (name, value) { + if (completed == null) { + name = requestHeadersNames[name.toLowerCase()] = + requestHeadersNames[name.toLowerCase()] || name; + requestHeaders[name] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function (type) { + if (completed == null) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function (map) { + var code; + if (map) { + if (completed) { + + // Execute the appropriate callbacks + jqXHR.always(map[jqXHR.status]); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for (code in map) { + statusCode[code] = [statusCode[code], map[code]]; + } + } + } + return this; + }, + + // Cancel the request + abort: function (statusText) { + var finalText = statusText || strAbort; + if (transport) { + transport.abort(finalText); + } + done(0, finalText); + return this; + } + }; + + // Attach deferreds + deferred.promise(jqXHR); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ((url || s.url || location.href) + "") + .replace(rprotocol, location.protocol + "//"); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = (s.dataType || "*").toLowerCase().match(rnothtmlwhite) || [""]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if (s.crossDomain == null) { + urlAnchor = document.createElement("a"); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch (e) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if (s.data && s.processData && typeof s.data !== "string") { + s.data = jQuery.param(s.data, s.traditional); + } + + // Apply prefilters + inspectPrefiltersOrTransports(prefilters, s, options, jqXHR); + + // If request was aborted inside a prefilter, stop there + if (completed) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if (fireGlobals && jQuery.active++ === 0) { + jQuery.event.trigger("ajaxStart"); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test(s.type); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace(rhash, ""); + + // More options handling for requests with no content + if (!s.hasContent) { + + // Remember the hash so we can put it back + uncached = s.url.slice(cacheURL.length); + + // If data is available and should be processed, append data to url + if (s.data && (s.processData || typeof s.data === "string")) { + cacheURL += (rquery.test(cacheURL) ? "&" : "?") + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if (s.cache === false) { + cacheURL = cacheURL.replace(rantiCache, "$1"); + uncached = (rquery.test(cacheURL) ? "&" : "?") + "_=" + (nonce.guid++) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if (s.data && s.processData && + (s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0) { + s.data = s.data.replace(r20, "+"); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if (s.ifModified) { + if (jQuery.lastModified[cacheURL]) { + jqXHR.setRequestHeader("If-Modified-Since", jQuery.lastModified[cacheURL]); + } + if (jQuery.etag[cacheURL]) { + jqXHR.setRequestHeader("If-None-Match", jQuery.etag[cacheURL]); + } + } + + // Set the correct header, if data is being sent + if (s.data && s.hasContent && s.contentType !== false || options.contentType) { + jqXHR.setRequestHeader("Content-Type", s.contentType); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[0] && s.accepts[s.dataTypes[0]] ? + s.accepts[s.dataTypes[0]] + + (s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") : + s.accepts["*"] + ); + + // Check for headers option + for (i in s.headers) { + jqXHR.setRequestHeader(i, s.headers[i]); + } + + // Allow custom headers/mimetypes and early abort + if (s.beforeSend && + (s.beforeSend.call(callbackContext, jqXHR, s) === false || completed)) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add(s.complete); + jqXHR.done(s.success); + jqXHR.fail(s.error); + + // Get transport + transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR); + + // If no transport, we auto-abort + if (!transport) { + done(-1, "No Transport"); + } else { + jqXHR.readyState = 1; + + // Send global event + if (fireGlobals) { + globalEventContext.trigger("ajaxSend", [jqXHR, s]); + } + + // If request was aborted inside ajaxSend, stop there + if (completed) { + return jqXHR; + } + + // Timeout + if (s.async && s.timeout > 0) { + timeoutTimer = window.setTimeout(function () { + jqXHR.abort("timeout"); + }, s.timeout); + } + + try { + completed = false; + transport.send(requestHeaders, done); + } catch (e) { + + // Rethrow post-completion exceptions + if (completed) { + throw e; + } + + // Propagate others as results + done(-1, e); + } + } + + // Callback for when everything is done + function done(status, nativeStatusText, responses, headers) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if (completed) { + return; + } + + completed = true; + + // Clear timeout if it exists + if (timeoutTimer) { + window.clearTimeout(timeoutTimer); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if (responses) { + response = ajaxHandleResponses(s, jqXHR, responses); + } + + // Use a noop converter for missing script + if (!isSuccess && jQuery.inArray("script", s.dataTypes) > -1) { + s.converters["text script"] = function () { + }; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert(s, response, jqXHR, isSuccess); + + // If successful, handle type chaining + if (isSuccess) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if (s.ifModified) { + modified = jqXHR.getResponseHeader("Last-Modified"); + if (modified) { + jQuery.lastModified[cacheURL] = modified; + } + modified = jqXHR.getResponseHeader("etag"); + if (modified) { + jQuery.etag[cacheURL] = modified; + } + } + + // if no content + if (status === 204 || s.type === "HEAD") { + statusText = "nocontent"; + + // if not modified + } else if (status === 304) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if (status || !statusText) { + statusText = "error"; + if (status < 0) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = (nativeStatusText || statusText) + ""; + + // Success/Error + if (isSuccess) { + deferred.resolveWith(callbackContext, [success, statusText, jqXHR]); + } else { + deferred.rejectWith(callbackContext, [jqXHR, statusText, error]); + } + + // Status-dependent callbacks + jqXHR.statusCode(statusCode); + statusCode = undefined; + + if (fireGlobals) { + globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError", + [jqXHR, s, isSuccess ? success : error]); + } + + // Complete + completeDeferred.fireWith(callbackContext, [jqXHR, statusText]); + + if (fireGlobals) { + globalEventContext.trigger("ajaxComplete", [jqXHR, s]); + + // Handle the global AJAX counter + if (!(--jQuery.active)) { + jQuery.event.trigger("ajaxStop"); + } + } + } + + return jqXHR; + }, + + getJSON: function (url, data, callback) { + return jQuery.get(url, data, callback, "json"); + }, + + getScript: function (url, callback) { + return jQuery.get(url, undefined, callback, "script"); + } + }); + + jQuery.each(["get", "post"], function (_i, method) { + jQuery[method] = function (url, data, callback, type) { + + // Shift arguments if data argument was omitted + if (isFunction(data)) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax(jQuery.extend({ + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject(url) && url)); + }; + }); + + jQuery.ajaxPrefilter(function (s) { + var i; + for (i in s.headers) { + if (i.toLowerCase() === "content-type") { + s.contentType = s.headers[i] || ""; + } + } + }); + + + jQuery._evalUrl = function (url, options, doc) { + return jQuery.ajax({ + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function () { + } + }, + dataFilter: function (response) { + jQuery.globalEval(response, options, doc); + } + }); + }; + + + jQuery.fn.extend({ + wrapAll: function (html) { + var wrap; + + if (this[0]) { + if (isFunction(html)) { + html = html.call(this[0]); + } + + // The elements to wrap the target around + wrap = jQuery(html, this[0].ownerDocument).eq(0).clone(true); + + if (this[0].parentNode) { + wrap.insertBefore(this[0]); + } + + wrap.map(function () { + var elem = this; + + while (elem.firstElementChild) { + elem = elem.firstElementChild; + } + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function (html) { + if (isFunction(html)) { + return this.each(function (i) { + jQuery(this).wrapInner(html.call(this, i)); + }); + } + + return this.each(function () { + var self = jQuery(this), + contents = self.contents(); + + if (contents.length) { + contents.wrapAll(html); + + } else { + self.append(html); + } + }); + }, + + wrap: function (html) { + var htmlIsFunction = isFunction(html); + + return this.each(function (i) { + jQuery(this).wrapAll(htmlIsFunction ? html.call(this, i) : html); + }); + }, + + unwrap: function (selector) { + this.parent(selector).not("body").each(function () { + jQuery(this).replaceWith(this.childNodes); + }); + return this; + } + }); + + + jQuery.expr.pseudos.hidden = function (elem) { + return !jQuery.expr.pseudos.visible(elem); + }; + jQuery.expr.pseudos.visible = function (elem) { + return !!(elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length); + }; + + + jQuery.ajaxSettings.xhr = function () { + try { + return new window.XMLHttpRequest(); + } catch (e) { + } + }; + + var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + + support.cors = !!xhrSupported && ("withCredentials" in xhrSupported); + support.ajax = xhrSupported = !!xhrSupported; + + jQuery.ajaxTransport(function (options) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if (support.cors || xhrSupported && !options.crossDomain) { + return { + send: function (headers, complete) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if (options.xhrFields) { + for (i in options.xhrFields) { + xhr[i] = options.xhrFields[i]; + } + } + + // Override mime type if needed + if (options.mimeType && xhr.overrideMimeType) { + xhr.overrideMimeType(options.mimeType); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if (!options.crossDomain && !headers["X-Requested-With"]) { + headers["X-Requested-With"] = "XMLHttpRequest"; + } + + // Set headers + for (i in headers) { + xhr.setRequestHeader(i, headers[i]); + } + + // Callback + callback = function (type) { + return function () { + if (callback) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if (type === "abort") { + xhr.abort(); + } else if (type === "error") { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if (typeof xhr.status !== "number") { + complete(0, "error"); + } else { + complete( + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[xhr.status] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + (xhr.responseType || "text") !== "text" || + typeof xhr.responseText !== "string" ? + {binary: xhr.response} : + {text: xhr.responseText}, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback("error"); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if (xhr.onabort !== undefined) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function () { + + // Check readyState before timeout as it changes + if (xhr.readyState === 4) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout(function () { + if (callback) { + errorCallback(); + } + }); + } + }; + } + + // Create the abort callback + callback = callback("abort"); + + try { + + // Do send the request (this may raise an exception) + xhr.send(options.hasContent && options.data || null); + } catch (e) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if (callback) { + throw e; + } + } + }, + + abort: function () { + if (callback) { + callback(); + } + } + }; + } + }); + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) + jQuery.ajaxPrefilter(function (s) { + if (s.crossDomain) { + s.contents.script = false; + } + }); + +// Install script dataType + jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function (text) { + jQuery.globalEval(text); + return text; + } + } + }); + +// Handle cache's special case and crossDomain + jQuery.ajaxPrefilter("script", function (s) { + if (s.cache === undefined) { + s.cache = false; + } + if (s.crossDomain) { + s.type = "GET"; + } + }); + +// Bind script tag hack transport + jQuery.ajaxTransport("script", function (s) { + + // This transport only deals with cross domain or forced-by-attrs requests + if (s.crossDomain || s.scriptAttrs) { + var script, callback; + return { + send: function (_, complete) { + script = jQuery(" + +{{ end }} +{{}} + +### Examples + + +Inline math: \\(\varphi = \dfrac{1+\sqrt5}{2}= 1.6180339887…\\) + +Block math: +$$ + \varphi = 1+\frac{1} {1+\frac{1} {1+\frac{1} {1+\cdots} } } +$$ \ No newline at end of file diff --git a/themes/anatole/exampleSite/content/post/placeholder-text.md b/themes/anatole/exampleSite/content/post/placeholder-text.md new file mode 100644 index 0000000..9ed5f69 --- /dev/null +++ b/themes/anatole/exampleSite/content/post/placeholder-text.md @@ -0,0 +1,45 @@ ++++ +author = "Hugo Authors" +title = "Placeholder Text" +date = "2019-03-09" +description = "Lorem Ipsum Dolor Si Amet" +tags = [ + "markdown", + "text", +] ++++ + +Lorem est tota propiore conpellat pectoribus de pectora summo. Redit teque digerit hominumque toris verebor lumina non cervice subde tollit usus habet Arctonque, furores quas nec ferunt. Quoque montibus nunc caluere tempus inhospita parcite confusaque translucet patri vestro qui optatis lumine cognoscere flos nubis! Fronde ipsamque patulos Dryopen deorum. + +1. Exierant elisi ambit vivere dedere +2. Duce pollice +3. Eris modo +4. Spargitque ferrea quos palude + +Rursus nulli murmur; hastile inridet ut ab gravi sententia! Nomine potitus silentia flumen, sustinet placuit petis in dilapsa erat sunt. Atria tractus malis. + +1. Comas hunc haec pietate fetum procerum dixit +2. Post torum vates letum Tiresia +3. Flumen querellas +4. Arcanaque montibus omnes +5. Quidem et + +# Vagus elidunt + + + +[The Van de Graaf Canon](https://en.wikipedia.org/wiki/Canons_of_page_construction#Van_de_Graaf_canon) + +## Mane refeci capiebant unda mulcebat + +Victa caducifer, malo vulnere contra dicere aurato, ludit regale, voca! Retorsit colit est profanae esse virescere furit nec; iaculi matertera et visa est, viribus. Divesque creatis, tecta novat collumque vulnus est, parvas. **Faces illo pepulere** tempus adest. Tendit flamma, ab opes virum sustinet, sidus sequendo urbis. + +Iubar proles corpore raptos vero auctor imperium; sed et huic: manus caeli Lelegas tu lux. Verbis obstitit intus oblectamina fixis linguisque ausus sperare Echionides cornuaque tenent clausit possit. Omnia putatur. Praeteritae refert ausus; ferebant e primus lora nutat, vici quae mea ipse. Et iter nil spectatae vulnus haerentia iuste et exercebat, sui et. + +Eurytus Hector, materna ipsumque ut Politen, nec, nate, ignari, vernum cohaesit sequitur. Vel **mitis temploque** vocatus, inque alis, *oculos nomen* non silvis corpore coniunx ne displicet illa. Crescunt non unus, vidit visa quantum inmiti flumina mortis facto sic: undique a alios vincula sunt iactata abdita! Suspenderat ego fuit tendit: luna, ante urbem Propoetides **parte**. + +{{< css.inline >}} + +{{< /css.inline >}} diff --git a/themes/anatole/exampleSite/content/post/rich-content.md b/themes/anatole/exampleSite/content/post/rich-content.md new file mode 100644 index 0000000..92b4b03 --- /dev/null +++ b/themes/anatole/exampleSite/content/post/rich-content.md @@ -0,0 +1,34 @@ ++++ +author = "Hugo Authors" +title = "Rich Content" +date = "2019-03-10" +description = "A brief description of Hugo Shortcodes" +tags = [ + "shortcodes", + "privacy", +] ++++ + +Hugo ships with several [Built-in Shortcodes](https://gohugo.io/content-management/shortcodes/#use-hugos-built-in-shortcodes) for rich content, along with a [Privacy Config](https://gohugo.io/about/hugo-and-gdpr/) and a set of Simple Shortcodes that enable static and no-JS versions of various social media embeds. + +--- + +## YouTube Privacy Enhanced Shortcode + +{{< youtube ZJthWmvUzzc >}} + +
    + +--- + +## Twitter Simple Shortcode + +{{< twitter_simple 1085870671291310081 >}} + +
    + +--- + +## Vimeo Simple Shortcode + +{{< vimeo_simple 48912912 >}} diff --git a/themes/anatole/exampleSite/static/favicons/favicon.ico b/themes/anatole/exampleSite/static/favicons/favicon.ico new file mode 100644 index 0000000..e94ec59 Binary files /dev/null and b/themes/anatole/exampleSite/static/favicons/favicon.ico differ diff --git a/themes/anatole/exampleSite/static/images/landscape.jpg b/themes/anatole/exampleSite/static/images/landscape.jpg new file mode 100644 index 0000000..7a39dfe Binary files /dev/null and b/themes/anatole/exampleSite/static/images/landscape.jpg differ diff --git a/themes/anatole/exampleSite/static/images/profile.jpg b/themes/anatole/exampleSite/static/images/profile.jpg new file mode 100644 index 0000000..500b36f Binary files /dev/null and b/themes/anatole/exampleSite/static/images/profile.jpg differ diff --git a/themes/anatole/exampleSite/static/images/site-feature-image.png b/themes/anatole/exampleSite/static/images/site-feature-image.png new file mode 100644 index 0000000..450269e Binary files /dev/null and b/themes/anatole/exampleSite/static/images/site-feature-image.png differ diff --git a/themes/anatole/i18n/de.toml b/themes/anatole/i18n/de.toml new file mode 100644 index 0000000..0ed8625 --- /dev/null +++ b/themes/anatole/i18n/de.toml @@ -0,0 +1,24 @@ +[category] +other = "Kategorie" + +[tag] +other = "Tag" + +[reading_time] +one = "{{ .Count }} Minute zum Lesen" +other = "{{ .Count }} Minuten zum Lesen" + +[page_not_found] +other = "Seite nicht gefunden" + +[page_does_not_exist] +other = "Tut mir Leid, diese Seite existiert leider nicht." + +[head_back] +other = "Du kannst hier zurück zur Startseite." + +[comments] +other = "Kommentare" + +[send] +other = "Senden" \ No newline at end of file diff --git a/themes/anatole/i18n/dk.toml b/themes/anatole/i18n/dk.toml new file mode 100644 index 0000000..1ed7e77 --- /dev/null +++ b/themes/anatole/i18n/dk.toml @@ -0,0 +1,24 @@ +[category] +other = "Kategori" + +[tag] +other = "mærkat" + +[reading_time] +one = "et minuts læsetid" +other = "{{ .Count }}-minutters læsetid" + +[page_not_found] +other = "Side ikke fundet" + +[page_does_not_exist] +other = "Beklager, denne side eksisterer ikke" + +[head_back] +other = "Returner til homepage." + +[comments] +other = "kommentar" + +[send] +other = "Sende" \ No newline at end of file diff --git a/themes/anatole/i18n/en.toml b/themes/anatole/i18n/en.toml new file mode 100644 index 0000000..db43452 --- /dev/null +++ b/themes/anatole/i18n/en.toml @@ -0,0 +1,24 @@ +[category] +other = "category" + +[tag] +other = "tag" + +[reading_time] +one = "One-minute read" +other = "{{ .Count }}-minute read" + +[page_not_found] +other = "Page Not Found" + +[page_does_not_exist] +other = "Sorry, this page does not exist." + +[head_back] +other = "You can head back to homepage." + +[comments] +other = "comments" + +[send] +other = "Send" \ No newline at end of file diff --git a/themes/anatole/i18n/es.toml b/themes/anatole/i18n/es.toml new file mode 100644 index 0000000..a95542a --- /dev/null +++ b/themes/anatole/i18n/es.toml @@ -0,0 +1,24 @@ +[category] +other = "categoría" + +[tag] +other = "etiqueta" + +[reading_time] +one = "1 minuto de lectura" +other = "{{ .Count }} minutos de lectura" + +[page_not_found] +other = "Página no encontrada" + +[page_does_not_exist] +other = "Disculpa, la página no existe." + +[head_back] +other = "Puedes regresar a la página inicial." + +[comments] +other = "comentarios" + +[send] +other = "Enviar" \ No newline at end of file diff --git a/themes/anatole/i18n/fa.toml b/themes/anatole/i18n/fa.toml new file mode 100644 index 0000000..2911b2c --- /dev/null +++ b/themes/anatole/i18n/fa.toml @@ -0,0 +1,24 @@ +[category] +other = "دسته‌بندی" + +[tag] +other = "برچسب" + +[reading_time] +one = "یک دقیقه زبان برای مطالعه" +other = "{{ .Count }}-دقیقه زمان باقی مانده است" + +[page_not_found] +other = "صفحه پیدا نشد" + +[page_does_not_exist] +other = "با عرض معذرت، این صفحه موجود نمی‌باشد." + +[head_back] +other = "شما می‌توانید برگردید به صفحه اصلی." + +[comments] +other = "نظرات" + +[send] +other = "ارسال" \ No newline at end of file diff --git a/themes/anatole/i18n/fi.toml b/themes/anatole/i18n/fi.toml new file mode 100644 index 0000000..622de2c --- /dev/null +++ b/themes/anatole/i18n/fi.toml @@ -0,0 +1,24 @@ +[category] +other = "kategoria" + +[tag] +other = "merkki" + +[reading_time] +one = "Yksi lukuminuutti" +other = "{{ .Count }} lukuminuuttia" + +[page_not_found] +other = "Sivua ei löydetty" + +[page_does_not_exist] +other = "Valitettavasti tätä sivua ei ole olemassa." + +[head_back] +other = "Voit palata takaisin kotisivulle." + +[comments] +other = "kommentit" + +[send] +other = "Lähetä" \ No newline at end of file diff --git a/themes/anatole/i18n/fr.toml b/themes/anatole/i18n/fr.toml new file mode 100644 index 0000000..b97fd5a --- /dev/null +++ b/themes/anatole/i18n/fr.toml @@ -0,0 +1,24 @@ +[category] +other = "catégorie" + +[tag] +other = "tag" + +[reading_time] +one = "Une minute de lecture" +other = "{{ .Count }} minutes de lecture" + +[page_not_found] +other = "Page Non Trouvée" + +[page_does_not_exist] +other = "Désolé, cette page n'existe pas." + +[head_back] +other = "Vous pouvez revenir à l'accueil." + +[comments] +other = "commentaire" + +[send] +other = "Envoyer" \ No newline at end of file diff --git a/themes/anatole/i18n/it.toml b/themes/anatole/i18n/it.toml new file mode 100644 index 0000000..9f6020c --- /dev/null +++ b/themes/anatole/i18n/it.toml @@ -0,0 +1,24 @@ +[category] +other = "categoria" + +[tag] +other = "tag" + +[reading_time] +one = "Tempo di lettura: Un minuto" +other = "Tempo di lettura: {{ .Count }} Minuti" + +[page_not_found] +other = "Pagina non trovata" + +[page_does_not_exist] +other = "Spiacente, questa pagina non esiste." + +[head_back] +other = "Puoi tornare alla homepage." + +[comments] +other = "commenti" + +[send] +other = "Spedire" \ No newline at end of file diff --git a/themes/anatole/i18n/pt-br.toml b/themes/anatole/i18n/pt-br.toml new file mode 100644 index 0000000..2456fa9 --- /dev/null +++ b/themes/anatole/i18n/pt-br.toml @@ -0,0 +1,24 @@ +[category] +other = "categoria" + +[tag] +other = "etiqueta" + +[reading_time] +one = "Tempo de leitura: 1 minuto" +other = "Tempo de leitura: {{ .Count }} minutos" + +[page_not_found] +other = "Página não encontrada" + +[page_does_not_exist] +other = "Desculpa, esta página não existe." + +[head_back] +other = "Retornar à página inicial." + +[comments] +other = "comentários" + +[send] +other = "Enviar" diff --git a/themes/anatole/i18n/zh-cn.toml b/themes/anatole/i18n/zh-cn.toml new file mode 100755 index 0000000..62c1293 --- /dev/null +++ b/themes/anatole/i18n/zh-cn.toml @@ -0,0 +1,24 @@ +[category] +other = "分类" + +[tag] +other = "标签" + +[reading_time] +one = "阅读时间 1 分钟" +other = "阅读时间 {{ .Count }} 分钟" + +[page_not_found] +other = "页面未找到" + +[page_does_not_exist] +other = "抱歉，此页面不存在" + +[head_back] +other = "返回首页." + +[comments] +other = "评论" + +[send] +other = "发送" diff --git a/themes/anatole/i18n/zh-tw.toml b/themes/anatole/i18n/zh-tw.toml new file mode 100644 index 0000000..87e7e69 --- /dev/null +++ b/themes/anatole/i18n/zh-tw.toml @@ -0,0 +1,24 @@ +[category] +other = "分類" + +[tag] +other = "標籤" + +[reading_time] +one = "閱讀時間 1 分鐘" +other = "閱讀時間 {{ .Count }} 分鐘" + +[page_not_found] +other = "找不到頁面" + +[page_does_not_exist] +other = "此頁面不存在" + +[head_back] +other = "返回 首頁." + +[comments] +other = "註解" + +[send] +other = "發送" \ No newline at end of file diff --git a/themes/anatole/images/lighthouse.png b/themes/anatole/images/lighthouse.png new file mode 100644 index 0000000..064354d Binary files /dev/null and b/themes/anatole/images/lighthouse.png differ diff --git a/themes/anatole/images/screenshot.png b/themes/anatole/images/screenshot.png new file mode 100644 index 0000000..feb5286 Binary files /dev/null and b/themes/anatole/images/screenshot.png differ diff --git a/themes/anatole/images/screenshot_dark.png b/themes/anatole/images/screenshot_dark.png new file mode 100644 index 0000000..939a6cd Binary files /dev/null and b/themes/anatole/images/screenshot_dark.png differ diff --git a/themes/anatole/images/tn.png b/themes/anatole/images/tn.png new file mode 100644 index 0000000..5761d32 Binary files /dev/null and b/themes/anatole/images/tn.png differ diff --git a/themes/anatole/layouts/404.html b/themes/anatole/layouts/404.html new file mode 100644 index 0000000..1d22600 --- /dev/null +++ b/themes/anatole/layouts/404.html @@ -0,0 +1,8 @@ +{{ define "main" }} +
    +

    404

    +

    {{ i18n "page_not_found" }}

    +

    {{ i18n "page_does_not_exist" }}

    +

    {{ i18n "head_back" .Site.BaseURL | safeHTML }}

    +
    +{{ end }} diff --git a/themes/anatole/layouts/_default/baseof.html b/themes/anatole/layouts/_default/baseof.html new file mode 100644 index 0000000..dc92dba --- /dev/null +++ b/themes/anatole/layouts/_default/baseof.html @@ -0,0 +1,22 @@ + + +{{- partial "head.html" . -}} + + +{{- partial "sidebar.html" . -}} +
    + {{ partial "navbar.html" . }} +
    +
    + {{- block "main" . }}{{- end }} +
    +
    +
    + +{{- partial "footer.html" . -}} +{{- if (eq .Site.Params.simpleAnalytics.enable true) -}} + {{- partial "analytics/simpleanalytics.html" . -}} +{{- end -}} + + + diff --git a/themes/anatole/layouts/_default/list.html b/themes/anatole/layouts/_default/list.html new file mode 100644 index 0000000..cad95c8 --- /dev/null +++ b/themes/anatole/layouts/_default/list.html @@ -0,0 +1,21 @@ +{{ define "main" }} +
    +
      + {{ range .Data.Pages.GroupByDate "2006" }} +
      {{ .Key }}
      + {{ range .Pages }} +
        +
        +
        {{ .Title }} +
        {{ if isset .Site.Params "listdateformat" }} + {{ .Date.Format .Site.Params.listDateFormat }} + {{ else }} {{.Date.Format "Jan 2"}} + {{ end }}
        +
        +
        +
      + {{ end }} + {{ end }} +
    +
    +{{ end }} diff --git a/themes/anatole/layouts/_default/single.html b/themes/anatole/layouts/_default/single.html new file mode 100644 index 0000000..b4ff807 --- /dev/null +++ b/themes/anatole/layouts/_default/single.html @@ -0,0 +1,52 @@ +{{ define "main" }} +
    +
    + {{ if .Params.thumbnail }} + Thumbnail image + {{ end }} +
    +

    {{ .Title }}

    + {{ if eq .Type "post"}} +
    + + {{ if isset .Site.Params "singledateformat" }} + {{ .Date.Format .Site.Params.singleDateFormat }} + {{ else }} {{.Date.Format "Mon, Jan 2, 2006"}} + {{ end }} + + {{ i18n "reading_time" .ReadingTime }} +
    + {{ end }} +
    + + {{ .Content }} + + {{- if (eq .Params.contact true) -}} + {{- partial "contact.html" . -}} + {{- end -}} + +
    +
    +
    + {{ with .Page.Params.Categories }}{{ partial "taxonomy/categories.html" . }}{{ end }} + {{ with .Page.Params.Tags }}{{ partial "taxonomy/tags.html" . }}{{ end }} +
    +
    + + {{ if eq .Type "post"}} + {{- if .Site.DisqusShortname -}} +
    +

    {{ i18n "comments" }}

    + {{ template "_internal/disqus.html" . }} +
    + {{- end -}} + {{- if .Site.Params.utterances.repo -}} +
    +

    {{ i18n "comments" }}

    + {{ partial "comments/utterances.html" . }} +
    + {{- end -}} + {{ end }} +
    + +{{ end }} diff --git a/themes/anatole/layouts/index.html b/themes/anatole/layouts/index.html new file mode 100644 index 0000000..36b5ed5 --- /dev/null +++ b/themes/anatole/layouts/index.html @@ -0,0 +1,54 @@ +{{ define "main" }} + +
    + + {{ .Content }} +
    + + {{ $paginator := .Paginate (where .Site.RegularPages "Type" "in" .Site.Params.mainSections) }} + {{ range $paginator.Pages }} + +
    + {{ if .Params.thumbnail }} +
    + + Thumbnail image + +
    + {{ end }} +
    +

    {{ .Title }} +

    +
    +
    +

    {{ .Summary }}

    +
    +
    +
    +
    + + {{ if isset .Site.Params "indexdateformat" }} + {{ .Date.Format .Site.Params.indexDateFormat }} + {{ else }} {{.Date.Format "Mon, Jan 2, 2006"}} + {{ end }} + {{ with .Page.Params.Categories }}{{ partial "taxonomy/categories.html" . }}{{ end }} + {{ with .Params.tags }} + {{- range $index, $el := . -}} + {{ . }} + {{- end -}} + {{ end }} +
    +
    +
    +
    + {{ end }} + +{{ end }} diff --git a/themes/anatole/layouts/partials/analytics/simpleanalytics.html b/themes/anatole/layouts/partials/analytics/simpleanalytics.html new file mode 100644 index 0000000..1d6c745 --- /dev/null +++ b/themes/anatole/layouts/partials/analytics/simpleanalytics.html @@ -0,0 +1,7 @@ +{{ with .Site.Params.simpleAnalytics.customUrl }} + + +{{ else }} + + +{{ end }} diff --git a/themes/anatole/layouts/partials/comments/utterances.html b/themes/anatole/layouts/partials/comments/utterances.html new file mode 100644 index 0000000..f17a592 --- /dev/null +++ b/themes/anatole/layouts/partials/comments/utterances.html @@ -0,0 +1,10 @@ + \ No newline at end of file diff --git a/themes/anatole/layouts/partials/contact.html b/themes/anatole/layouts/partials/contact.html new file mode 100644 index 0000000..e598114 --- /dev/null +++ b/themes/anatole/layouts/partials/contact.html @@ -0,0 +1,19 @@ + +
    +
    +
      +
    • + +
      • +
    • + +
      • +
    • + +
      • +
    • + +
      • +
    +
    +
    diff --git a/themes/anatole/layouts/partials/footer.html b/themes/anatole/layouts/partials/footer.html new file mode 100644 index 0000000..6e668c8 --- /dev/null +++ b/themes/anatole/layouts/partials/footer.html @@ -0,0 +1,18 @@ +{{ $js := resources.Get "js/jquery.js" }} +{{ $secureJS := $js | resources.Minify | resources.Fingerprint }} + +{{ $migrate := resources.Get "js/jquery-migrate.js" }} +{{ $appear := resources.Get "js/jquery-appear.js" }} +{{ $js := slice $migrate $appear | resources.Concat "js/bundle.js" }} +{{ $secureJS := $js | resources.Minify | resources.Fingerprint }} + + +{{- partial "medium-zoom.html" . -}} +{{- partial "math.html" . -}} +{{- template "_internal/google_analytics_async.html" . -}} diff --git a/themes/anatole/layouts/partials/head.html b/themes/anatole/layouts/partials/head.html new file mode 100644 index 0000000..62bc8e7 --- /dev/null +++ b/themes/anatole/layouts/partials/head.html @@ -0,0 +1,97 @@ + + {{.Site.Params.author}}{{ with .Title }} | {{ . }}{{ end }} + + + + {{- hugo.Generator -}} + + + {{- if .Site.Params.googleSiteVerify }} + + {{- end -}} + + + {{ $style := resources.Get "css/style.css" | resources.Minify | resources.Fingerprint }} + + {{ $markupHighlightStyle := resources.Get "css/markupHighlight.css" | resources.Minify | resources.Fingerprint }} + + {{ range .Site.Params.customCss }} + {{ $minstyles := resources.Get . }} + {{ $styles := $minstyles | resources.Minify | resources.Fingerprint }} + + {{ end }} + + + + + + + + + + + + {{ with .OutputFormats.Get "rss" -}} + {{ printf `` .Rel .MediaType.Type .Permalink $.Site.Title | safeHTML }} + {{ end -}} + + + {{ $anatoleHeader := resources.Get "js/anatole-header.js" }} + {{ $secureHeaderJS := $anatoleHeader | resources.Minify | resources.Fingerprint }} + + + + {{ if not .Site.Params.disableThemeSwitcher }} + {{ $anatoleThemeSwitcher := resources.Get "js/anatole-theme-switcher.js" }} + {{ $secureThemeSwitcherJS := $anatoleThemeSwitcher | resources.Minify | resources.Fingerprint }} + + {{ end }} + + {{- $js := "" -}} + {{- range .Site.Params.customJs -}} + {{- if or (in . "http://") (in . "https://") -}} + + {{- else -}} + {{- $customJS := resources.Get . -}} + {{- if $customJS -}} + {{- if eq $js "" -}} + {{- $js = $customJS -}} + {{- else -}} + {{- $js = slice $js $customJS | resources.Concat "js/custom.js" -}} + {{- end -}} + {{- end -}} + {{- end -}} + {{- end -}} + + {{- if ne $js "" -}} + {{- $secureJS := $js | resources.Minify | resources.Fingerprint -}} + + {{- end -}} + + + {{ template "_internal/twitter_cards.html" . }} + diff --git a/themes/anatole/layouts/partials/math.html b/themes/anatole/layouts/partials/math.html new file mode 100644 index 0000000..2af0f93 --- /dev/null +++ b/themes/anatole/layouts/partials/math.html @@ -0,0 +1,44 @@ +{{- if or (eq site.Params.math true) (eq .Params.math true) -}} + {{- $use := "katex" -}} + + {{- with site.Params.math -}} + {{- if and (isset . "use") (eq (.use | lower) "mathjax") -}} + {{- $use = "mathjax" -}} + {{- end -}} + {{- end -}} + + {{- if eq $use "mathjax" -}} + {{- $url := "https://cdnjs.cloudflare.com/ajax/libs/mathjax/2.7.7/MathJax.js?config=TeX-AMS-MML_HTMLorMML" -}} + {{- $hash := "sha384-e/4/LvThKH1gwzXhdbY2AsjR3rm7LHWyhIG5C0jiRfn8AN2eTN5ILeztWw0H9jmN" -}} + + + {{- else -}} + {{- $url := "https://cdn.jsdelivr.net/npm/katex@0.11.1/dist/katex.min.css" -}} + {{- $hash := "sha384-zB1R0rpPzHqg7Kpt0Aljp8JPLqbXI3bhnPWROx27a9N0Ll6ZP/+DiW/UqRcLbRjq" -}} + + + {{- $url := "https://cdn.jsdelivr.net/npm/katex@0.11.1/dist/katex.min.js" -}} + {{- $hash := "sha384-y23I5Q6l+B6vatafAwxRu/0oK/79VlbSz7Q9aiSZUvyWYIYsd+qj+o24G5ZU2zJz" -}} + + + {{- $url := "https://cdn.jsdelivr.net/npm/katex@0.11.1/dist/contrib/auto-render.min.js" -}} + {{- $hash := "sha384-kWPLUVMOks5AQFrykwIup5lo0m3iMkkHrD0uJ4H5cjeGihAutqP0yW0J6dpFiVkI" -}} + + {{- end -}} +{{- end -}} diff --git a/themes/anatole/layouts/partials/medium-zoom.html b/themes/anatole/layouts/partials/medium-zoom.html new file mode 100644 index 0000000..1e1b1ff --- /dev/null +++ b/themes/anatole/layouts/partials/medium-zoom.html @@ -0,0 +1,6 @@ +{{ $js := resources.Get "js/medium-zoom.js" }} +{{ $secureJS := $js | resources.Minify | resources.Fingerprint }} + diff --git a/themes/anatole/layouts/partials/navbar.html b/themes/anatole/layouts/partials/navbar.html new file mode 100644 index 0000000..9c4c28e --- /dev/null +++ b/themes/anatole/layouts/partials/navbar.html @@ -0,0 +1,34 @@ +
    + + +
    diff --git a/themes/anatole/layouts/partials/sidebar.html b/themes/anatole/layouts/partials/sidebar.html new file mode 100644 index 0000000..22afa5d --- /dev/null +++ b/themes/anatole/layouts/partials/sidebar.html @@ -0,0 +1,23 @@ +
    +
    +
    + profile picture +

    {{ .Site.Params.Title }}

    +
    +

    {{ .Site.Params.description }}

    +
    +
    +
    + +
    +
    © {{ .Site.Params.author }} {{ if isset .Site.Params "copyright" }} {{ .Site.Params.copyright }} {{ else }} {{ now.Format "2006"}} {{end}}
    +
    +
    diff --git a/themes/anatole/layouts/partials/taxonomy/categories.html b/themes/anatole/layouts/partials/taxonomy/categories.html new file mode 100644 index 0000000..fd4988d --- /dev/null +++ b/themes/anatole/layouts/partials/taxonomy/categories.html @@ -0,0 +1,5 @@ + +{{- range $index, $el := . -}} + {{ . }} +{{- end -}} + diff --git a/themes/anatole/layouts/partials/taxonomy/tags.html b/themes/anatole/layouts/partials/taxonomy/tags.html new file mode 100644 index 0000000..86c0673 --- /dev/null +++ b/themes/anatole/layouts/partials/taxonomy/tags.html @@ -0,0 +1,5 @@ + +{{- range $index, $el := . -}} + {{ . }} +{{- end -}} + diff --git a/themes/anatole/theme.toml b/themes/anatole/theme.toml new file mode 100644 index 0000000..0a2d205 --- /dev/null +++ b/themes/anatole/theme.toml @@ -0,0 +1,21 @@ +# theme.toml template for a Hugo theme +# See https://github.com/gohugoio/hugoThemes#themetoml for an example + +name = "Anatole" +license = "MIT" +licenselink = "https://github.com/lxndrblz/anatole/blob/master/LICENSE" +description = "Anatole is a beautiful minimalist two-column hugo theme based on farbox-theme-Anatole." +homepage = "https://github.com/lxndrblz/anatole/" +tags = ["blog", "responsive", "clean", "minimalist", "minimal", "personal", "dark"] +features = ["blog", "seo", "responsive", "mobile", "disqus", "fontawesome", "analytics", "math"] +min_version = "0.53.0" + +[author] + name = "Alexander Bilz" + homepage = "https://alexbilz.com" + +# If porting an existing theme +[original] + author = "Cai Cai" + homepage = "https://www.caicai.me/" + repo = "https://github.com/hi-caicai/farbox-theme-Anatole" diff --git a/themes/indigo b/themes/indigo deleted file mode 160000 index ddc7002..0000000 --- a/themes/indigo +++ /dev/null @@ -1 +0,0 @@ -Subproject commit ddc70020be6a8b8e27c99fbe830bc2f6526cd201